Stop the war!
Остановите войну!
for scientists:
default search action
Search dblp for Publications
export results for "stream:streams/journals/comgeo:"
more than 1000 matches, exporting first 1000 hits only!
@article{DBLP:journals/comgeo/AgarwalKS24, author = {Pankaj K. Agarwal and Matthew J. Katz and Micha Sharir}, title = {On reverse shortest paths in geometric proximity graphs}, journal = {Comput. Geom.}, volume = {117}, pages = {102053}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102053}, doi = {10.1016/J.COMGEO.2023.102053}, timestamp = {Fri, 20 Oct 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AgarwalKS24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Brandenburg24, author = {Franz J. Brandenburg}, title = {Straight-line drawings of 1-planar graphs}, journal = {Comput. Geom.}, volume = {116}, pages = {102036}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102036}, doi = {10.1016/J.COMGEO.2023.102036}, timestamp = {Thu, 31 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CurryDGHKM24, author = {Justin Curry and Jordan DeSha and Ad{\'{e}}lie Garin and Kathryn Hess and Lida Kanari and Brendan Mallery}, title = {From trees to barcodes and back again {II:} Combinatorial and probabilistic aspects of a topological inverse problem}, journal = {Comput. Geom.}, volume = {116}, pages = {102031}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102031}, doi = {10.1016/J.COMGEO.2023.102031}, timestamp = {Mon, 04 Dec 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CurryDGHKM24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FoxHR24, author = {Emily Fox and Hongyao Huang and Benjamin Raichel}, title = {Clustering with faulty centers}, journal = {Comput. Geom.}, volume = {117}, pages = {102052}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102052}, doi = {10.1016/J.COMGEO.2023.102052}, timestamp = {Fri, 20 Oct 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FoxHR24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Glickenstein24, author = {David Glickenstein}, title = {Geometric triangulations and discrete Laplacians on manifolds: An update}, journal = {Comput. Geom.}, volume = {118}, pages = {102063}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102063}, doi = {10.1016/J.COMGEO.2023.102063}, timestamp = {Sun, 31 Dec 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Glickenstein24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeS24, author = {Meng He and Don Sheehy}, title = {Guest editorial: Special issue on the 33rd Canadian Conference on Computational Geometry {(CCCG)}}, journal = {Comput. Geom.}, volume = {116}, pages = {102035}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102035}, doi = {10.1016/J.COMGEO.2023.102035}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HeS24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MajhiVW24, author = {Sushovan Majhi and Jeffrey Vitter and Carola Wenk}, title = {Approximating Gromov-Hausdorff distance in Euclidean space}, journal = {Comput. Geom.}, volume = {116}, pages = {102034}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102034}, doi = {10.1016/J.COMGEO.2023.102034}, timestamp = {Thu, 31 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/MajhiVW24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MajhiW24, author = {Sushovan Majhi and Carola Wenk}, title = {Distance measures for geometric graphs}, journal = {Comput. Geom.}, volume = {118}, pages = {102056}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102056}, doi = {10.1016/J.COMGEO.2023.102056}, timestamp = {Sun, 31 Dec 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MajhiW24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MalicS24, author = {Goran Malic and Ileana Streinu}, title = {Enumerating combinatorial resultant trees}, journal = {Comput. Geom.}, volume = {118}, pages = {102064}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102064}, doi = {10.1016/J.COMGEO.2023.102064}, timestamp = {Fri, 08 Mar 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MalicS24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PoureidiF24, author = {Abolfazl Poureidi and Mohammad Farshi}, title = {On algorithmic complexity of imprecise spanners}, journal = {Comput. Geom.}, volume = {117}, pages = {102051}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102051}, doi = {10.1016/J.COMGEO.2023.102051}, timestamp = {Fri, 27 Oct 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/PoureidiF24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Radons24, author = {Manuel Radons}, title = {Edge-unfolding nested prismatoids}, journal = {Comput. Geom.}, volume = {116}, pages = {102033}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102033}, doi = {10.1016/J.COMGEO.2023.102033}, timestamp = {Thu, 31 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Radons24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RieckS24, author = {Christian Rieck and Christian Scheffer}, title = {The dispersive art gallery problem}, journal = {Comput. Geom.}, volume = {117}, pages = {102054}, year = {2024}, url = {https://doi.org/10.1016/j.comgeo.2023.102054}, doi = {10.1016/J.COMGEO.2023.102054}, timestamp = {Fri, 08 Mar 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RieckS24.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Abu-AffashCM23, author = {A. Karim Abu{-}Affash and Paz Carmi and Meytal Maman}, title = {Piercing pairwise intersecting geodesic disks by five points}, journal = {Comput. Geom.}, volume = {109}, pages = {101947}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101947}, doi = {10.1016/J.COMGEO.2022.101947}, timestamp = {Thu, 10 Nov 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashCM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AfshaniK23, author = {Peyman Afshani and Rasmus Killmann}, title = {Rectangle stabbing and orthogonal range reporting lower bounds in moderate dimensions}, journal = {Comput. Geom.}, volume = {111}, pages = {101959}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101959}, doi = {10.1016/J.COMGEO.2022.101959}, timestamp = {Thu, 16 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AfshaniK23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AgarwalGHT23, author = {Pankaj K. Agarwal and Tzvika Geft and Dan Halperin and Erin Taylor}, title = {Multi-robot motion planning for unit discs with revolving areas}, journal = {Comput. Geom.}, volume = {114}, pages = {102019}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102019}, doi = {10.1016/J.COMGEO.2023.102019}, timestamp = {Tue, 20 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AgarwalGHT23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerEH23, author = {Oswin Aichholzer and David Eppstein and Eva{-}Maria Hainzl}, title = {Geometric dominating sets - a minimum version of the No-Three-In-Line Problem}, journal = {Comput. Geom.}, volume = {108}, pages = {101913}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101913}, doi = {10.1016/J.COMGEO.2022.101913}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerEH23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovBCEIS23, author = {Boris Aronov and Mark de Berg and Jean Cardinal and Esther Ezra and John Iacono and Micha Sharir}, title = {Subquadratic algorithms for some 3Sum-hard geometric problems in the algebraic decision-tree model}, journal = {Comput. Geom.}, volume = {109}, pages = {101945}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101945}, doi = {10.1016/J.COMGEO.2022.101945}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AronovBCEIS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovESZ23, author = {Boris Aronov and Esther Ezra and Micha Sharir and Guy Zigdon}, title = {Time and space efficient collinearity indexing}, journal = {Comput. Geom.}, volume = {110}, pages = {101963}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101963}, doi = {10.1016/J.COMGEO.2022.101963}, timestamp = {Fri, 20 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovESZ23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AshurK23, author = {Stav Ashur and Matthew J. Katz}, title = {A 4-approximation of the 2{\(\pi\)}3-MST}, journal = {Comput. Geom.}, volume = {108}, pages = {101914}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101914}, doi = {10.1016/J.COMGEO.2022.101914}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AshurK23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BakhajianF23, author = {Ziv Bakhajian and Ohad Noy Feldheim}, title = {Drawing outerplanar graphs using thirteen edge lengths}, journal = {Comput. Geom.}, volume = {110}, pages = {101964}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101964}, doi = {10.1016/J.COMGEO.2022.101964}, timestamp = {Tue, 31 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BakhajianF23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BalkoST23, author = {Martin Balko and Adam Sheffer and Ruiwen Tang}, title = {The constant of point-line incidence constructions}, journal = {Comput. Geom.}, volume = {114}, pages = {102009}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102009}, doi = {10.1016/J.COMGEO.2023.102009}, timestamp = {Fri, 07 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BalkoST23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanikRR23, author = {Aritra Banik and Rajiv Raman and Saurabh Ray}, title = {On the geometric priority set cover problem}, journal = {Comput. Geom.}, volume = {112}, pages = {101984}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101984}, doi = {10.1016/J.COMGEO.2023.101984}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BanikRR23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarequetM23, author = {Gill Barequet and Bar Magal}, title = {Automatic generation of formulae for polyominoes with a fixed perimeter defect}, journal = {Comput. Geom.}, volume = {108}, pages = {101919}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101919}, doi = {10.1016/J.COMGEO.2022.101919}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BarequetM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaumeisterK23, author = {Markus Baumeister and Leif Kobbelt}, title = {How close is a quad mesh to a polycube?}, journal = {Comput. Geom.}, volume = {111}, pages = {101978}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101978}, doi = {10.1016/J.COMGEO.2022.101978}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaumeisterK23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergS23, author = {Sarita de Berg and Frank Staals}, title = {Dynamic data structures for \emph{k}-nearest neighbor queries}, journal = {Comput. Geom.}, volume = {111}, pages = {101976}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101976}, doi = {10.1016/J.COMGEO.2022.101976}, timestamp = {Sat, 13 May 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BergS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BertschingerRM23, author = {Daniel Bertschinger and Meghana M. Reddy and Enrico Mann}, title = {Lions and contamination: Monotone clearings}, journal = {Comput. Geom.}, volume = {110}, pages = {101961}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101961}, doi = {10.1016/J.COMGEO.2022.101961}, timestamp = {Tue, 31 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BertschingerRM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhoreLNRW23, author = {Sujoy Bhore and Guangping Li and Martin N{\"{o}}llenburg and Ignaz Rutter and Hsiang{-}Yun Wu}, title = {Untangling circular drawings: Algorithms and complexity}, journal = {Comput. Geom.}, volume = {111}, pages = {101975}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101975}, doi = {10.1016/J.COMGEO.2022.101975}, timestamp = {Sat, 13 May 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BhoreLNRW23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazBW23, author = {Ahmad Biniaz and Prosenjit Bose and Yunkai Wang}, title = {Simple linear time algorithms for piercing pairwise intersecting disks}, journal = {Comput. Geom.}, volume = {114}, pages = {102011}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102011}, doi = {10.1016/J.COMGEO.2023.102011}, timestamp = {Mon, 26 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazBW23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BinucciDM23, author = {Carla Binucci and Walter Didimo and Fabrizio Montecchiani}, title = {1-planarity testing and embedding: An experimental study}, journal = {Comput. Geom.}, volume = {108}, pages = {101900}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101900}, doi = {10.1016/J.COMGEO.2022.101900}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BinucciDM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BlasiusFKM23, author = {Thomas Bl{\"{a}}sius and Tobias Friedrich and Martin S. Krejca and Louise Molitor}, title = {The impact of geometry on monochrome regions in the flip Schelling process}, journal = {Comput. Geom.}, volume = {108}, pages = {101902}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101902}, doi = {10.1016/J.COMGEO.2022.101902}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BlasiusFKM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BonerathHMN23, author = {Annika Bonerath and Jan{-}Henrik Haunert and Joseph S. B. Mitchell and Benjamin Niedermann}, title = {Shortcut hulls: Vertex-restricted outer simplifications of polygons}, journal = {Comput. Geom.}, volume = {112}, pages = {101983}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101983}, doi = {10.1016/J.COMGEO.2023.101983}, timestamp = {Tue, 21 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BonerathHMN23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCDMMMS23, author = {Prosenjit Bose and Paz Carmi and Vida Dujmovic and Saeed Mehrabi and Fabrizio Montecchiani and Pat Morin and Lu{\'{\i}}s Fernando Schultz Xavier da Silveira}, title = {Geodesic obstacle representation of graphs}, journal = {Comput. Geom.}, volume = {109}, pages = {101946}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101946}, doi = {10.1016/J.COMGEO.2022.101946}, timestamp = {Sun, 13 Nov 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCDMMMS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Buchin23, author = {Kevin Buchin}, title = {Editorial}, journal = {Comput. Geom.}, volume = {113}, pages = {102008}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102008}, doi = {10.1016/J.COMGEO.2023.102008}, timestamp = {Wed, 17 May 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Buchin23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinLOPUV23, author = {Kevin Buchin and Maarten L{\"{o}}ffler and Tim Ophelders and Aleksandr Popov and J{\'{e}}r{\^{o}}me Urhausen and Kevin Verbeek}, title = {Computing the Fr{\'{e}}chet distance between uncertain curves in one dimension}, journal = {Comput. Geom.}, volume = {109}, pages = {101923}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101923}, doi = {10.1016/J.COMGEO.2022.101923}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinLOPUV23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CalesCEF23, author = {Ludovic Cal{\`{e}}s and Apostolos Chalkis and Ioannis Z. Emiris and Vissarion Fisikopoulos}, title = {Practical volume approximation of high-dimensional convex bodies, applied to modeling portfolio dependencies and financial crises}, journal = {Comput. Geom.}, volume = {109}, pages = {101916}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101916}, doi = {10.1016/J.COMGEO.2022.101916}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CalesCEF23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalKMPUV23, author = {Jean Cardinal and Kolja Knauer and Piotr Micek and D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and Torsten Ueckerdt and Narmada Varadarajan}, title = {Colouring bottomless rectangles and arborescences}, journal = {Comput. Geom.}, volume = {115}, pages = {102020}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102020}, doi = {10.1016/J.COMGEO.2023.102020}, timestamp = {Fri, 21 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalKMPUV23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChacholskiGJL23, author = {Wojciech Chach{\'{o}}lski and Barbara Giunti and Alvin Jin and Claudia Landi}, title = {Decomposing filtered chain complexes: Geometry behind barcoding algorithms}, journal = {Comput. Geom.}, volume = {109}, pages = {101938}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101938}, doi = {10.1016/J.COMGEO.2022.101938}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChacholskiGJL23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChoO23, author = {Kyungjin Cho and Eunjin Oh}, title = {Linear-time approximation scheme for \emph{k}-means clustering of axis-parallel affine subspaces}, journal = {Comput. Geom.}, volume = {112}, pages = {101981}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101981}, doi = {10.1016/J.COMGEO.2023.101981}, timestamp = {Thu, 16 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChoO23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChoiJA23, author = {Jongmin Choi and Dahye Jeong and Hee{-}Kap Ahn}, title = {Covering convex polygons by two congruent disks}, journal = {Comput. Geom.}, volume = {109}, pages = {101936}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101936}, doi = {10.1016/J.COMGEO.2022.101936}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChoiJA23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DamianF23, author = {Mirela Damian and Robin Y. Flatland}, title = {Unfolding 3-separated polycube graphs of arbitrary genus}, journal = {Comput. Geom.}, volume = {109}, pages = {101944}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101944}, doi = {10.1016/J.COMGEO.2022.101944}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DamianF23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DasDFGR23, author = {Arun Kumar Das and Sandip Das and Guilherme Dias da Fonseca and Yan Gerard and Bastien Rivier}, title = {Complexity results on untangling red-blue matchings}, journal = {Comput. Geom.}, volume = {111}, pages = {101974}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101974}, doi = {10.1016/J.COMGEO.2022.101974}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DasDFGR23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeL23, author = {Minati De and Abhiruk Lahiri}, title = {Geometric dominating-set and set-cover via local-search}, journal = {Comput. Geom.}, volume = {113}, pages = {102007}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102007}, doi = {10.1016/J.COMGEO.2023.102007}, timestamp = {Fri, 02 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DeL23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeVW23, author = {Anway De and Thong Vo and Matthew Wright}, title = {Value-offset bifiltrations for digital images}, journal = {Comput. Geom.}, volume = {109}, pages = {101939}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101939}, doi = {10.1016/J.COMGEO.2022.101939}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DeVW23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineDDKUZ23, author = {Erik D. Demaine and Martin L. Demaine and Yevhenii Diomidov and Tonan Kamata and Ryuhei Uehara and Hanyu Alice Zhang}, title = {Any platonic solid can transform to another by \emph{O}(1) refoldings}, journal = {Comput. Geom.}, volume = {113}, pages = {101995}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101995}, doi = {10.1016/J.COMGEO.2023.101995}, timestamp = {Wed, 17 May 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineDDKUZ23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineDU23, author = {Erik D. Demaine and Martin L. Demaine and Ryuhei Uehara}, title = {Developing a tetramonohedron with minimum cut length}, journal = {Comput. Geom.}, volume = {108}, pages = {101903}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101903}, doi = {10.1016/J.COMGEO.2022.101903}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineDU23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineLS23, author = {Erik D. Demaine and Maarten L{\"{o}}ffler and Christiane Schmidt}, title = {Rectangular Spiral Galaxies are still hard}, journal = {Comput. Geom.}, volume = {110}, pages = {101949}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101949}, doi = {10.1016/J.COMGEO.2022.101949}, timestamp = {Tue, 31 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineLS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DevadossH23, author = {Satyan L. Devadoss and Matthew S. Harvey}, title = {Unfoldings and nets of regular polytopes}, journal = {Comput. Geom.}, volume = {111}, pages = {101977}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101977}, doi = {10.1016/J.COMGEO.2022.101977}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DevadossH23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EastHP23, author = {James East and Michael Hendriksen and Laurence Park}, title = {On the enumeration of integer tetrahedra}, journal = {Comput. Geom.}, volume = {108}, pages = {101915}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101915}, doi = {10.1016/J.COMGEO.2022.101915}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EastHP23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EderHLP23, author = {G{\"{u}}nther Eder and Martin Held and Stefan de Lorenzo and Peter Palfrader}, title = {On the recognition and reconstruction of weighted Voronoi diagrams and bisector graphs}, journal = {Comput. Geom.}, volume = {109}, pages = {101935}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101935}, doi = {10.1016/J.COMGEO.2022.101935}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EderHLP23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ElkindSS23, author = {Edith Elkind and Erel Segal{-}Halevi and Warut Suksompong}, title = {Keep your distance: Land division with separation}, journal = {Comput. Geom.}, volume = {113}, pages = {102006}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102006}, doi = {10.1016/J.COMGEO.2023.102006}, timestamp = {Tue, 12 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ElkindSS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EppsteinFO23, author = {David Eppstein and Daniel Frishberg and Martha C. Osegueda}, title = {Angles of arc-polygons and Lombardi drawings of cacti}, journal = {Comput. Geom.}, volume = {112}, pages = {101982}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101982}, doi = {10.1016/J.COMGEO.2023.101982}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EppsteinFO23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvansS23, author = {William S. Evans and Lucca Morais de Arruda Siaudzionis}, title = {On path-greedy geometric spanners}, journal = {Comput. Geom.}, volume = {110}, pages = {101948}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101948}, doi = {10.1016/J.COMGEO.2022.101948}, timestamp = {Tue, 31 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EvansS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FerniqueP23, author = {Thomas Fernique and Daria Pchelina}, title = {Density of triangulated ternary disc packings}, journal = {Comput. Geom.}, volume = {115}, pages = {102032}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102032}, doi = {10.1016/J.COMGEO.2023.102032}, timestamp = {Fri, 21 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FerniqueP23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FriederichGGHS23, author = {Rachel Friederich and Anirban Ghosh and Matthew Graham and Brian Hicks and Ronald Shevchenko}, title = {Experiments with unit disk cover algorithms for covering massive pointsets}, journal = {Comput. Geom.}, volume = {109}, pages = {101925}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101925}, doi = {10.1016/J.COMGEO.2022.101925}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FriederichGGHS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Fuentes-Sepulveda23, author = {Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and Gonzalo Navarro and Diego Seco}, title = {Navigating planar topologies in near-optimal space and time}, journal = {Comput. Geom.}, volume = {109}, pages = {101922}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101922}, doi = {10.1016/J.COMGEO.2022.101922}, timestamp = {Wed, 28 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Fuentes-Sepulveda23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FugacciKR23, author = {Ulderico Fugacci and Michael Kerber and Alexander Rolle}, title = {Compression for 2-parameter persistent homology}, journal = {Comput. Geom.}, volume = {109}, pages = {101940}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101940}, doi = {10.1016/J.COMGEO.2022.101940}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FugacciKR23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiacomoM23, author = {Emilio Di Giacomo and Fabrizio Montecchiani}, title = {Editorial}, journal = {Comput. Geom.}, volume = {111}, pages = {101980}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101980}, doi = {10.1016/J.COMGEO.2022.101980}, timestamp = {Thu, 16 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiacomoM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GitikJ23, author = {Rivka Gitik and Leo Joskowicz}, title = {Half-plane point retrieval queries with independent and dependent geometric uncertainties}, journal = {Comput. Geom.}, volume = {115}, pages = {102021}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102021}, doi = {10.1016/J.COMGEO.2023.102021}, timestamp = {Fri, 21 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GitikJ23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GonzalezDiazST23, author = {Roc{\'{\i}}o Gonz{\'{a}}lez{-}D{\'{\i}}az and M. Soriano{-}Trigueros and {\'{A}}lvaro Torras{-}Casas}, title = {Partial matchings induced by morphisms between persistence modules}, journal = {Comput. Geom.}, volume = {112}, pages = {101985}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101985}, doi = {10.1016/J.COMGEO.2023.101985}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GonzalezDiazST23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonS23, author = {Joachim Gudmundsson and Yuan Sha}, title = {Augmenting graphs to minimize the radius}, journal = {Comput. Geom.}, volume = {113}, pages = {101996}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101996}, doi = {10.1016/J.COMGEO.2023.101996}, timestamp = {Fri, 02 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonS23a, author = {Joachim Gudmundsson and Yuan Sha}, title = {Algorithms for radius-optimally augmenting trees in a metric space}, journal = {Comput. Geom.}, volume = {114}, pages = {102018}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102018}, doi = {10.1016/J.COMGEO.2023.102018}, timestamp = {Fri, 07 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS23a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonSW23, author = {Joachim Gudmundsson and Yuan Sha and Sampson Wong}, title = {Approximating the packedness of polygonal curves}, journal = {Comput. Geom.}, volume = {108}, pages = {101920}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101920}, doi = {10.1016/J.COMGEO.2022.101920}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonSW23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeLS23, author = {Meng He and Anna Lubiw and Mohammad R. Salavatipour}, title = {Preface}, journal = {Comput. Geom.}, volume = {110}, pages = {101958}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101958}, doi = {10.1016/J.COMGEO.2022.101958}, timestamp = {Thu, 24 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HeLS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeldNS23, author = {Martin Held and Martin N{\"{o}}llenburg and Peter Sanders}, title = {Editorial}, journal = {Comput. Geom.}, volume = {110}, pages = {101950}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101950}, doi = {10.1016/J.COMGEO.2022.101950}, timestamp = {Fri, 20 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HeldNS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HiraniKWW23, author = {Anil N. Hirani and Kaushik Kalyanaraman and Han Wang and Seth Watts}, title = {Computing discrete harmonic differential forms in a given cohomology class using finite element exterior calculus}, journal = {Comput. Geom.}, volume = {109}, pages = {101937}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101937}, doi = {10.1016/J.COMGEO.2022.101937}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HiraniKWW23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KangCA23, author = {Byeonguk Kang and Jongmin Choi and Hee{-}Kap Ahn}, title = {Intersecting disks using two congruent disks}, journal = {Comput. Geom.}, volume = {110}, pages = {101966}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101966}, doi = {10.1016/J.COMGEO.2022.101966}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KangCA23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KarlT23, author = {J{\'{a}}nos Karl and G{\'{e}}za T{\'{o}}th}, title = {Crossing lemma for the odd-crossing number}, journal = {Comput. Geom.}, volume = {108}, pages = {101901}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101901}, doi = {10.1016/J.COMGEO.2022.101901}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KarlT23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KatzS23, author = {Matthew J. Katz and Micha Sharir}, title = {Bottleneck matching in the plane}, journal = {Comput. Geom.}, volume = {112}, pages = {101986}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.101986}, doi = {10.1016/J.COMGEO.2023.101986}, timestamp = {Thu, 16 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KatzS23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimLA23, author = {Hwi Kim and Jaegun Lee and Hee{-}Kap Ahn}, title = {Rectangular partitions of a rectilinear polygon}, journal = {Comput. Geom.}, volume = {110}, pages = {101965}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101965}, doi = {10.1016/J.COMGEO.2022.101965}, timestamp = {Tue, 31 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimLA23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Klost23, author = {Katharina Klost}, title = {An algorithmic framework for the single source shortest path problem with applications to disk graphs}, journal = {Comput. Geom.}, volume = {111}, pages = {101979}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101979}, doi = {10.1016/J.COMGEO.2022.101979}, timestamp = {Tue, 28 Mar 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Klost23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LavasaniP23, author = {Ali Mohammad Lavasani and Denis Pankratov}, title = {Advice complexity of online non-crossing matching}, journal = {Comput. Geom.}, volume = {110}, pages = {101943}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101943}, doi = {10.1016/J.COMGEO.2022.101943}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LavasaniP23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LuT23, author = {Shangqi Lu and Yufei Tao}, title = {Range updates and range sum queries on multidimensional points with monoid weights}, journal = {Comput. Geom.}, volume = {115}, pages = {102030}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102030}, doi = {10.1016/J.COMGEO.2023.102030}, timestamp = {Fri, 21 Jul 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LuT23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MchedlidzeA23, author = {Tamara Mchedlidze and Elena Arseneva}, title = {Editorial}, journal = {Comput. Geom.}, volume = {110}, pages = {101962}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101962}, doi = {10.1016/J.COMGEO.2022.101962}, timestamp = {Fri, 20 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MchedlidzeA23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Medina-Mardones23, author = {Anibal M. Medina{-}Mardones}, title = {New formulas for cup-\emph{i} products and fast computation of Steenrod squares}, journal = {Comput. Geom.}, volume = {109}, pages = {101921}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101921}, doi = {10.1016/J.COMGEO.2022.101921}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Medina-Mardones23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ORourkeV23, author = {Joseph O'Rourke and Costin V{\^{\i}}lcu}, title = {Cut locus realizations on convex polyhedra}, journal = {Comput. Geom.}, volume = {114}, pages = {102010}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2023.102010}, doi = {10.1016/J.COMGEO.2023.102010}, timestamp = {Mon, 26 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ORourkeV23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Raussen23, author = {Martin Raussen}, title = {Connectivity of spaces of directed paths in geometric models for concurrent computation}, journal = {Comput. Geom.}, volume = {109}, pages = {101942}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101942}, doi = {10.1016/J.COMGEO.2022.101942}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Raussen23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Scheucher23, author = {Manfred Scheucher}, title = {Many order types on integer grids of polynomial size}, journal = {Comput. Geom.}, volume = {109}, pages = {101924}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101924}, doi = {10.1016/J.COMGEO.2022.101924}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Scheucher23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SethMN23, author = {Ritesh Seth and Anil Maheshwari and Subhas C. Nandy}, title = {Acrophobic guard watchtower problem}, journal = {Comput. Geom.}, volume = {109}, pages = {101918}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101918}, doi = {10.1016/J.COMGEO.2022.101918}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SethMN23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/StehrK23, author = {Eva Stehr and Linda Kleist}, title = {Folding polyiamonds into octahedra}, journal = {Comput. Geom.}, volume = {108}, pages = {101917}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101917}, doi = {10.1016/J.COMGEO.2022.101917}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/StehrK23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/UngerKM23, author = {Florian Unger and Jonathan Krebs and Michael G. M{\"{u}}ller}, title = {Simplex closing probabilities in directed graphs}, journal = {Comput. Geom.}, volume = {109}, pages = {101941}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101941}, doi = {10.1016/J.COMGEO.2022.101941}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/UngerKM23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Vodolazskiy23, author = {Evgeniy Vodolazskiy}, title = {Discrete Fr{\'{e}}chet distance for closed curves}, journal = {Comput. Geom.}, volume = {111}, pages = {101967}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101967}, doi = {10.1016/J.COMGEO.2022.101967}, timestamp = {Sat, 13 May 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Vodolazskiy23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WangZ23, author = {Haitao Wang and Yiming Zhao}, title = {An optimal algorithm for \emph{L}\({}_{\mbox{1}}\) shortest paths in unit-disk graphs}, journal = {Comput. Geom.}, volume = {110}, pages = {101960}, year = {2023}, url = {https://doi.org/10.1016/j.comgeo.2022.101960}, doi = {10.1016/J.COMGEO.2022.101960}, timestamp = {Fri, 20 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WangZ23.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Abu-AffashBC22, author = {A. Karim Abu{-}Affash and Gali Bar{-}On and Paz Carmi}, title = {\emph{{\(\delta\)}}-Greedy \emph{t}-spanner}, journal = {Comput. Geom.}, volume = {100}, pages = {101807}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101807}, doi = {10.1016/J.COMGEO.2021.101807}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashBC22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnCCABY22, author = {Taehoon Ahn and Jongmin Choi and Chaeyoon Chung and Hee{-}Kap Ahn and Sang Won Bae and Sang Duk Yoon}, title = {Rearranging a sequence of points onto a line}, journal = {Comput. Geom.}, volume = {107}, pages = {101887}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101887}, doi = {10.1016/J.COMGEO.2022.101887}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnCCABY22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnMS22, author = {Hee{-}Kap Ahn and Tamara Mtsentlintze and J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {{CGTA} Awards}, journal = {Comput. Geom.}, volume = {107}, pages = {101896}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101896}, doi = {10.1016/J.COMGEO.2022.101896}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnMS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerKSVV22, author = {Oswin Aichholzer and Jan Kyncl and Manfred Scheucher and Birgit Vogtenhuber and Pavel Valtr}, title = {On crossing-families in planar point sets}, journal = {Comput. Geom.}, volume = {107}, pages = {101899}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101899}, doi = {10.1016/J.COMGEO.2022.101899}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerKSVV22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkitayaBB22, author = {Hugo A. Akitaya and Ahmad Biniaz and Prosenjit Bose}, title = {On the spanning and routing ratios of the directed {\(\Theta\)}\({}_{\mbox{6}}\)-graph}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101881}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101881}, doi = {10.1016/J.COMGEO.2022.101881}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AkitayaBB22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkitayaDETU22, author = {Hugo A. Akitaya and Erik D. Demaine and David Eppstein and Tomohiro Tachi and Ryuhei Uehara}, title = {Ununfoldable polyhedra with 6 vertices or 6 faces}, journal = {Comput. Geom.}, volume = {103}, pages = {101857}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101857}, doi = {10.1016/J.COMGEO.2021.101857}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AkitayaDETU22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Almendra-Hernandez22, author = {V{\'{\i}}ctor Hugo Almendra{-}Hern{\'{a}}ndez and Leonardo Mart{\'{\i}}nez{-}Sandoval}, title = {On prescribing total orders and preorders to pairwise distances of points in Euclidean space}, journal = {Comput. Geom.}, volume = {107}, pages = {101898}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101898}, doi = {10.1016/J.COMGEO.2022.101898}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Almendra-Hernandez22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlpertBBMNTY22, author = {Hannah Alpert and Russell J. Barnes and Seth Bell and Anna Mauro and Na'ama Nevo and Nataya Tucker and Hanna Yang}, title = {Routing by matching on convex pieces of grid graphs}, journal = {Comput. Geom.}, volume = {104}, pages = {101862}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101862}, doi = {10.1016/J.COMGEO.2022.101862}, timestamp = {Fri, 13 May 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AlpertBBMNTY22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AsashibaBENY22, author = {Hideto Asashiba and Micka{\"{e}}l Buchet and Emerson G. Escolar and Ken Nakashima and Michio Yoshiwaki}, title = {On interval decomposability of 2D persistence modules}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101879}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101879}, doi = {10.1016/J.COMGEO.2022.101879}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AsashibaBENY22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AshurFKS22, author = {Stav Ashur and Omrit Filtser and Matthew J. Katz and Rachel Saban}, title = {Terrain-like graphs: PTASs for guarding weakly-visible polygons and terrains}, journal = {Comput. Geom.}, volume = {101}, pages = {101832}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101832}, doi = {10.1016/J.COMGEO.2021.101832}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AshurFKS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BakhsheshF22, author = {Davood Bakhshesh and Mohammad Farshi}, title = {On the plane angle-monotone graphs}, journal = {Comput. Geom.}, volume = {100}, pages = {101818}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101818}, doi = {10.1016/J.COMGEO.2021.101818}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaloghCL22, author = {J{\'{o}}zsef Balogh and Felix Christian Clemen and Bernard Lidick{\'{y}}}, title = {Maximum number of almost similar triangles in the plane}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101880}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101880}, doi = {10.1016/J.COMGEO.2022.101880}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaloghCL22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BauernoppelMS22, author = {Frank Bauern{\"{o}}ppel and Anil Maheshwari and J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {An {\(\Omega\)}(\emph{n}\({}^{\mbox{\emph{d}}}\)) lower bound on the number of cell crossings for weighted shortest paths in \emph{d}-dimensional polyhedral structures}, journal = {Comput. Geom.}, volume = {107}, pages = {101897}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101897}, doi = {10.1016/J.COMGEO.2022.101897}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BauernoppelMS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeltramoS22, author = {Gabriele Beltramo and Primoz Skraba}, title = {Persistent homology in \emph{{\(\mathscr{l}\)}}\({}_{\mbox{{\(\infty\)}}}\) metric}, journal = {Comput. Geom.}, volume = {101}, pages = {101821}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101821}, doi = {10.1016/J.COMGEO.2021.101821}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeltramoS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCKM0MS22, author = {Prosenjit Bose and Paz Carmi and J. Mark Keil and Anil Maheshwari and Saeed Mehrabi and Debajyoti Mondal and Michiel Smid}, title = {Computing maximum independent set on outerstring graphs and their relatives}, journal = {Comput. Geom.}, volume = {103}, pages = {101852}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101852}, doi = {10.1016/J.COMGEO.2021.101852}, timestamp = {Tue, 15 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCKM0MS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BubenikE22, author = {Peter Bubenik and Alex Elchesen}, title = {Universality of persistence diagrams and the bottleneck and Wasserstein distances}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101882}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101882}, doi = {10.1016/J.COMGEO.2022.101882}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BubenikE22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinK22, author = {Maike Buchin and Bernhard Kilgus}, title = {Fr{\'{e}}chet distance between two point sets}, journal = {Comput. Geom.}, volume = {102}, pages = {101842}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101842}, doi = {10.1016/J.COMGEO.2021.101842}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinK22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CanoTUV22, author = {Javier Cano and Csaba D. T{\'{o}}th and Jorge Urrutia and Giovanni Viglietta}, title = {Edge guards for polyhedra in three-space}, journal = {Comput. Geom.}, volume = {104}, pages = {101859}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101859}, doi = {10.1016/J.COMGEO.2022.101859}, timestamp = {Fri, 01 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CanoTUV22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarufelF22, author = {Jean{-}Lou De Carufel and Zachary Friggstad}, title = {Preface}, journal = {Comput. Geom.}, volume = {101}, pages = {101776}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101776}, doi = {10.1016/J.COMGEO.2021.101776}, timestamp = {Mon, 27 Dec 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarufelF22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChakrabortyDM22, author = {Dibyayan Chakraborty and Sandip Das and Joydeep Mukherjee}, title = {On dominating set of some subclasses of string graphs}, journal = {Comput. Geom.}, volume = {107}, pages = {101884}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101884}, doi = {10.1016/J.COMGEO.2022.101884}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChakrabortyDM22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanR22, author = {Timothy M. Chan and Zahed Rahmati}, title = {Corrigendum to "Approximating the minimum closest pair distance and nearest neighbor distances of linearly moving points" [Comput. Geom. 60 {(2017)} 2-7]}, journal = {Comput. Geom.}, volume = {101}, pages = {101831}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101831}, doi = {10.1016/J.COMGEO.2021.101831}, timestamp = {Mon, 27 Dec 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanR22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DezaP22, author = {Antoine Deza and Lionel Pournin}, title = {A linear optimization oracle for zonotope computation}, journal = {Comput. Geom.}, volume = {100}, pages = {101809}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101809}, doi = {10.1016/J.COMGEO.2021.101809}, timestamp = {Mon, 27 Dec 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DezaP22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuGT22, author = {Adrian Dumitrescu and Anirban Ghosh and Csaba D. T{\'{o}}th}, title = {Sparse hop spanners for unit disk graphs}, journal = {Comput. Geom.}, volume = {100}, pages = {101808}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101808}, doi = {10.1016/J.COMGEO.2021.101808}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuGT22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvansFKSSW22, author = {William S. Evans and Krzysztof Fleszar and Philipp Kindermann and Noushin Saeedi and Chan{-}Su Shin and Alexander Wolff}, title = {Minimum rectilinear polygons for given angle sequences}, journal = {Comput. Geom.}, volume = {100}, pages = {101820}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101820}, doi = {10.1016/J.COMGEO.2021.101820}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EvansFKSSW22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Frati22, author = {Fabrizio Frati}, title = {Planar rectilinear drawings of outerplanar graphs in linear time}, journal = {Comput. Geom.}, volume = {103}, pages = {101854}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101854}, doi = {10.1016/J.COMGEO.2021.101854}, timestamp = {Tue, 01 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Frati22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Guo0P22, author = {Zhengyang Guo and Yi Li and Shaoyu Pei}, title = {Expected size of random Tukey layers and convex layers}, journal = {Comput. Geom.}, volume = {103}, pages = {101856}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101856}, doi = {10.1016/J.COMGEO.2021.101856}, timestamp = {Tue, 15 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Guo0P22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HoriyamaKKPUY22, author = {Takashi Horiyama and Fabian Klute and Matias Korman and Irene Parada and Ryuhei Uehara and Katsuhisa Yamanaka}, title = {Efficient segment folding is hard}, journal = {Comput. Geom.}, volume = {104}, pages = {101860}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101860}, doi = {10.1016/J.COMGEO.2022.101860}, timestamp = {Fri, 01 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HoriyamaKKPUY22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HuicocheaLR22, author = {Mario Huicochea and Jes{\'{u}}s Lea{\~{n}}os and Luis Manuel Rivera}, title = {A note on the minimum number of red lines needed to pierce the intersections of blue lines}, journal = {Comput. Geom.}, volume = {104}, pages = {101863}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101863}, doi = {10.1016/J.COMGEO.2022.101863}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HuicocheaLR22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JanaMR22, author = {Satyabrata Jana and Anil Maheshwari and Sasanka Roy}, title = {Linear-size planar Manhattan network for convex point sets}, journal = {Comput. Geom.}, volume = {100}, pages = {101819}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101819}, doi = {10.1016/J.COMGEO.2021.101819}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/JanaMR22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaziS22, author = {Abrar Kazi and Michiel Smid}, title = {Closest-pair queries and minimum-weight queries are equivalent for squares}, journal = {Comput. Geom.}, volume = {100}, pages = {101810}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101810}, doi = {10.1016/J.COMGEO.2021.101810}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KaziS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimA22, author = {Mincheol Kim and Hee{-}Kap Ahn}, title = {Minimum-link shortest paths for polygons amidst rectilinear obstacles}, journal = {Comput. Geom.}, volume = {103}, pages = {101858}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101858}, doi = {10.1016/J.COMGEO.2022.101858}, timestamp = {Tue, 15 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimA22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KodmonL22, author = {Csenge Lili K{\"{o}}dm{\"{o}}n and Zsolt L{\'{a}}ngi}, title = {Extremal convex polygons inscribed in a given convex polygon}, journal = {Comput. Geom.}, volume = {102}, pages = {101844}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101844}, doi = {10.1016/J.COMGEO.2021.101844}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KodmonL22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KreveldMOSV22, author = {Marc J. van Kreveld and Tillmann Miltzow and Tim Ophelders and Willem Sonke and Jordi L. Vermeulen}, title = {Between shapes, using the Hausdorff distance}, journal = {Comput. Geom.}, volume = {100}, pages = {101817}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101817}, doi = {10.1016/J.COMGEO.2021.101817}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KreveldMOSV22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KumarSS22, author = {Neeraj Kumar and Stavros Sintos and Subhash Suri}, title = {The maximum exposure problem}, journal = {Comput. Geom.}, volume = {104}, pages = {101861}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101861}, doi = {10.1016/J.COMGEO.2022.101861}, timestamp = {Fri, 01 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KumarSS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LenchnerP22, author = {Jonathan Lenchner and Eli Packer}, title = {Line segment visibility with sidedness constraints}, journal = {Comput. Geom.}, volume = {107}, pages = {101885}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101885}, doi = {10.1016/J.COMGEO.2022.101885}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LenchnerP22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Matthews22, author = {Polly Matthews Jr.}, title = {Distinct distances with \emph{{\(\mathscr{l}\)}}\({}_{\mbox{\emph{p}}}\) metrics}, journal = {Comput. Geom.}, volume = {100}, pages = {101785}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101785}, doi = {10.1016/J.COMGEO.2021.101785}, timestamp = {Mon, 27 Dec 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Matthews22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MessinaS22, author = {John A. Messina and Pablo Sober{\'{o}}n}, title = {Isometric and affine copies of a set in volumetric Helly results}, journal = {Comput. Geom.}, volume = {103}, pages = {101855}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101855}, doi = {10.1016/J.COMGEO.2021.101855}, timestamp = {Tue, 15 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MessinaS22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PedersenW22, author = {Logan Pedersen and Haitao Wang}, title = {Algorithms for the line-constrained disk coverage and related problems}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101883}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101883}, doi = {10.1016/J.COMGEO.2022.101883}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/PedersenW22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RadermacherR22, author = {Marcel Radermacher and Ignaz Rutter}, title = {Inserting an edge into a geometric embedding}, journal = {Comput. Geom.}, volume = {102}, pages = {101843}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101843}, doi = {10.1016/J.COMGEO.2021.101843}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RadermacherR22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Scheffer22, author = {Christian Scheffer}, title = {The prefix Fr{\'{e}}chet similarity}, journal = {Comput. Geom.}, volume = {103}, pages = {101853}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101853}, doi = {10.1016/J.COMGEO.2021.101853}, timestamp = {Tue, 15 Mar 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Scheffer22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WangX22, author = {Haitao Wang and Jie Xue}, title = {Improved algorithms for the bichromatic two-center problem for pairs of points}, journal = {Comput. Geom.}, volume = {100}, pages = {101806}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2021.101806}, doi = {10.1016/J.COMGEO.2021.101806}, timestamp = {Thu, 04 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/WangX22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZinkWBW22, author = {Johannes Zink and Julian Walter and Joachim Baumeister and Alexander Wolff}, title = {Layered drawing of undirected graphs with generalized port constraints}, journal = {Comput. Geom.}, volume = {105-106}, pages = {101886}, year = {2022}, url = {https://doi.org/10.1016/j.comgeo.2022.101886}, doi = {10.1016/J.COMGEO.2022.101886}, timestamp = {Wed, 14 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZinkWBW22.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbelACDDHKLRR21, author = {Zachary Abel and Hugo A. Akitaya and Man{-}Kwun Chiu and Erik D. Demaine and Martin L. Demaine and Adam Hesterberg and Matias Korman and Jayson Lynch and Andr{\'{e}} van Renssen and Marcel Roeloffzen}, title = {Snipperclips: Cutting tools into desired polygons using themselves}, journal = {Comput. Geom.}, volume = {98}, pages = {101784}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101784}, doi = {10.1016/J.COMGEO.2021.101784}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AbelACDDHKLRR21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbelDDKLIN21, author = {Zachary Abel and Erik D. Demaine and Martin L. Demaine and Jason S. Ku and Jayson Lynch and Jin{-}ichi Itoh and Chie Nara}, title = {Continuous flattening of all polyhedral manifolds using countably infinite creases}, journal = {Comput. Geom.}, volume = {98}, pages = {101773}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101773}, doi = {10.1016/J.COMGEO.2021.101773}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AbelDDKLIN21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AckermanKP21, author = {Eyal Ackerman and Bal{\'{a}}zs Keszegh and D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi}, title = {Coloring Delaunay-edges and their generalizations}, journal = {Comput. Geom.}, volume = {96}, pages = {101745}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101745}, doi = {10.1016/J.COMGEO.2021.101745}, timestamp = {Thu, 29 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AckermanKP21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerACDDF21, author = {Oswin Aichholzer and Hugo A. Akitaya and Kenneth C. Cheung and Erik D. Demaine and Martin L. Demaine and S{\'{a}}ndor P. Fekete and Linda Kleist and Irina Kostitsyna and Maarten L{\"{o}}ffler and Zuzana Mas{\'{a}}rov{\'{a}} and Klara Mundilova and Christiane Schmidt}, title = {Folding polyominoes with holes into a cube}, journal = {Comput. Geom.}, volume = {93}, pages = {101700}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101700}, doi = {10.1016/J.COMGEO.2020.101700}, timestamp = {Sat, 14 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerACDDF21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkitayaBKSW21, author = {Hugo A. Akitaya and Maike Buchin and Bernhard Kilgus and Stef Sijben and Carola Wenk}, title = {Distance measures for embedded graphs}, journal = {Comput. Geom.}, volume = {95}, pages = {101743}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101743}, doi = {10.1016/J.COMGEO.2020.101743}, timestamp = {Tue, 02 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AkitayaBKSW21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovDEP21, author = {Boris Aronov and Anirudh Donakonda and Esther Ezra and Rom Pinchasi}, title = {On pseudo-disk hypergraphs}, journal = {Comput. Geom.}, volume = {92}, pages = {101687}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101687}, doi = {10.1016/J.COMGEO.2020.101687}, timestamp = {Mon, 26 Oct 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovDEP21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArsenevaCKMOORR21, author = {Elena Arseneva and Man{-}Kwun Chiu and Matias Korman and Aleksandar Markovic and Yoshio Okamoto and Aur{\'{e}}lien Ooms and Andr{\'{e}} van Renssen and Marcel Roeloffzen}, title = {Rectilinear link diameter and radius in a rectilinear polygonal domain}, journal = {Comput. Geom.}, volume = {92}, pages = {101685}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101685}, doi = {10.1016/J.COMGEO.2020.101685}, timestamp = {Thu, 29 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ArsenevaCKMOORR21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bae21, author = {Sang Won Bae}, title = {On the minimum-area rectangular and square annulus problem}, journal = {Comput. Geom.}, volume = {92}, pages = {101697}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101697}, doi = {10.1016/J.COMGEO.2020.101697}, timestamp = {Thu, 16 Sep 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Bae21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeBM21, author = {Sang Won Bae and Arpita Baral and Priya Ranjan Sinha Mahapatra}, title = {Maximum-width empty square and rectangular annulus}, journal = {Comput. Geom.}, volume = {96}, pages = {101747}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101747}, doi = {10.1016/J.COMGEO.2021.101747}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaeBM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BakhsheshF21, author = {Davood Bakhshesh and Mohammad Farshi}, title = {Angle-monotonicity of Delaunay triangulation}, journal = {Comput. Geom.}, volume = {94}, pages = {101711}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101711}, doi = {10.1016/J.COMGEO.2020.101711}, timestamp = {Thu, 17 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BankovicM21, author = {Milan Bankovic and Filip Maric}, title = {Farad{\v{z}}ev Read-type enumeration of non-isomorphic {CC} systems}, journal = {Comput. Geom.}, volume = {97}, pages = {101770}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101770}, doi = {10.1016/J.COMGEO.2021.101770}, timestamp = {Tue, 01 Jun 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BankovicM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarequetBO21, author = {Gill Barequet and Gil Ben{-}Shachar and Martha C. Osegueda}, title = {Concatenation arguments and their applications to polyominoes and polycubes}, journal = {Comput. Geom.}, volume = {98}, pages = {101790}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101790}, doi = {10.1016/J.COMGEO.2021.101790}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BarequetBO21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BekosGMPST21, author = {Michael A. Bekos and Martin Gronemann and Fabrizio Montecchiani and D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and Antonios Symvonis and Leonidas Theocharous}, title = {Grid drawings of graphs with constant edge-vertex resolution}, journal = {Comput. Geom.}, volume = {98}, pages = {101789}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101789}, doi = {10.1016/J.COMGEO.2021.101789}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BekosGMPST21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhattacharyaBCD21, author = {Binay Bhattacharya and Arijit Bishnu and Otfried Cheong and Sandip Das and Arindam Karmakar and Jack Snoeyink}, title = {Computation of spatial skyline points}, journal = {Comput. Geom.}, volume = {93}, pages = {101698}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101698}, doi = {10.1016/J.COMGEO.2020.101698}, timestamp = {Sat, 14 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaBCD21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlBL21, author = {Therese Biedl and Ahmad Biniaz and Anna Lubiw}, title = {Minimum ply covering of points with disks and squares}, journal = {Comput. Geom.}, volume = {94}, pages = {101712}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101712}, doi = {10.1016/J.COMGEO.2020.101712}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlBL21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCS21, author = {Prosenjit Bose and Paz Carmi and Thomas C. Shermer}, title = {Piercing pairwise intersecting geodesic disks}, journal = {Comput. Geom.}, volume = {98}, pages = {101774}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101774}, doi = {10.1016/J.COMGEO.2021.101774}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseS21, author = {Prosenjit Bose and Thomas C. Shermer}, title = {Attraction-convexity and normal visibility}, journal = {Comput. Geom.}, volume = {96}, pages = {101748}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101748}, doi = {10.1016/J.COMGEO.2021.101748}, timestamp = {Thu, 29 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloM21, author = {Sergio Cabello and Wolfgang Mulzer}, title = {Minimum cuts in geometric intersection graphs}, journal = {Comput. Geom.}, volume = {94}, pages = {101720}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101720}, doi = {10.1016/J.COMGEO.2020.101720}, timestamp = {Thu, 17 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CaraballoDMHLM21, author = {Luis Evaristo Caraballo and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Ruy Fabila Monroy and Carlos Hidalgo{-}Toscano and Jes{\'{u}}s Lea{\~{n}}os and Amanda Montejano}, title = {On the number of order types in integer grids of small size}, journal = {Comput. Geom.}, volume = {95}, pages = {101730}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101730}, doi = {10.1016/J.COMGEO.2020.101730}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CaraballoDMHLM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiKSS21, author = {Paz Carmi and Matthew J. Katz and Rachel Saban and Yael Stein}, title = {Improved PTASs for convex barrier coverage}, journal = {Comput. Geom.}, volume = {92}, pages = {101684}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101684}, doi = {10.1016/J.COMGEO.2020.101684}, timestamp = {Mon, 21 Sep 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiKSS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChoiA21, author = {Jongmin Choi and Hee{-}Kap Ahn}, title = {Efficient planar two-center algorithms}, journal = {Comput. Geom.}, volume = {97}, pages = {101768}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101768}, doi = {10.1016/J.COMGEO.2021.101768}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChoiA21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChoiLA21, author = {Yujin Choi and Seungjun Lee and Hee{-}Kap Ahn}, title = {Maximum-area and maximum-perimeter rectangles in polygons}, journal = {Comput. Geom.}, volume = {94}, pages = {101710}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101710}, doi = {10.1016/J.COMGEO.2020.101710}, timestamp = {Thu, 17 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChoiLA21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChuggEW21, author = {Ben Chugg and William S. Evans and Kelvin Wong}, title = {Simultaneous visibility representations of undirected pairs of graphs}, journal = {Comput. Geom.}, volume = {98}, pages = {101788}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101788}, doi = {10.1016/J.COMGEO.2021.101788}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChuggEW21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DaescuT21, author = {Ovidiu Daescu and Ka Yaw Teo}, title = {Characterization and computation of feasible trajectories for an articulated probe with a variable-length end segment}, journal = {Comput. Geom.}, volume = {96}, pages = {101756}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101756}, doi = {10.1016/J.COMGEO.2021.101756}, timestamp = {Wed, 21 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DaescuT21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DamianF21, author = {Mirela Damian and Robin Y. Flatland}, title = {Unfolding polycube trees with constant refinement}, journal = {Comput. Geom.}, volume = {98}, pages = {101793}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101793}, doi = {10.1016/J.COMGEO.2021.101793}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DamianF21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Diaz-BanezMU21, author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Ruy Fabila Monroy and Jorge Urrutia}, title = {A note on empty balanced tetrahedra in two-colored point sets in {R3}}, journal = {Comput. Geom.}, volume = {96}, pages = {101757}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101757}, doi = {10.1016/J.COMGEO.2021.101757}, timestamp = {Thu, 29 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezMU21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EderHP21, author = {G{\"{u}}nther Eder and Martin Held and Peter Palfrader}, title = {Implementing straight skeletons with exact arithmetic: Challenges and experiences}, journal = {Comput. Geom.}, volume = {96}, pages = {101760}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101760}, doi = {10.1016/J.COMGEO.2021.101760}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EderHP21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Flores-VelazcoM21, author = {Alejandro Flores{-}Velazco and David M. Mount}, title = {Guarantees on nearest-neighbor condensation heuristics}, journal = {Comput. Geom.}, volume = {95}, pages = {101732}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101732}, doi = {10.1016/J.COMGEO.2020.101732}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Flores-VelazcoM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GitikBJ21, author = {Rivka Gitik and Or Bartal and Leo Joskowicz}, title = {Euclidean minimum spanning trees with independent and dependent geometric uncertainties}, journal = {Comput. Geom.}, volume = {96}, pages = {101744}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101744}, doi = {10.1016/J.COMGEO.2020.101744}, timestamp = {Mon, 05 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GitikBJ21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GuimaraesC21, author = {Dilson Almeida Guimar{\~{a}}es and Alexandre Salles da Cunha}, title = {The minimum area spanning tree problem: Formulations, Benders decomposition and branch-and-cut algorithms}, journal = {Comput. Geom.}, volume = {97}, pages = {101771}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101771}, doi = {10.1016/J.COMGEO.2021.101771}, timestamp = {Tue, 01 Jun 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GuimaraesC21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HuangCX21, author = {Ziyun Huang and Danny Z. Chen and Jinhui Xu}, title = {Influence-based Voronoi diagrams of clusters}, journal = {Comput. Geom.}, volume = {96}, pages = {101746}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101746}, doi = {10.1016/J.COMGEO.2021.101746}, timestamp = {Wed, 21 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HuangCX21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JohnsonW21, author = {Christopher Johnson and Haitao Wang}, title = {A linear-time algorithm for radius-optimally augmenting paths in a metric space}, journal = {Comput. Geom.}, volume = {96}, pages = {101759}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101759}, doi = {10.1016/J.COMGEO.2021.101759}, timestamp = {Thu, 29 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/JohnsonW21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KeikhaLM21, author = {Vahideh Keikha and Maarten L{\"{o}}ffler and Ali Mohades}, title = {Largest and smallest area triangles on imprecise points}, journal = {Comput. Geom.}, volume = {95}, pages = {101742}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101742}, doi = {10.1016/J.COMGEO.2020.101742}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KeikhaLM21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Kejlberg-Rasmussen21, author = {Casper Kejlberg{-}Rasmussen and Yufei Tao and Konstantinos Tsakalidis and Kostas Tsichlas and Jeonghun Yoon}, title = {I/O-efficient 2-d orthogonal range skyline and attrition priority queues}, journal = {Comput. Geom.}, volume = {93}, pages = {101689}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101689}, doi = {10.1016/J.COMGEO.2020.101689}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Kejlberg-Rasmussen21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KilicKO21, author = {Mehmet Kili{\c{c}} and Sahin Ko{\c{c}}ak and Yunus {\"{O}}zdemir}, title = {An algorithm for the construction of the tight span of finite subsets of the Manhattan plane}, journal = {Comput. Geom.}, volume = {95}, pages = {101741}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101741}, doi = {10.1016/J.COMGEO.2020.101741}, timestamp = {Tue, 02 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KilicKO21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimKKLS21, author = {Sang{-}Sub Kim and Rolf Klein and David K{\"{u}}bel and Elmar Langetepe and Barbara Schwarzwald}, title = {Geometric firefighting in the half-plane}, journal = {Comput. Geom.}, volume = {95}, pages = {101728}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101728}, doi = {10.1016/J.COMGEO.2020.101728}, timestamp = {Tue, 02 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimKKLS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimYA21, author = {Mincheol Kim and Sang Duk Yoon and Hee{-}Kap Ahn}, title = {Shortest rectilinear path queries to rectangles in a rectangular domain}, journal = {Comput. Geom.}, volume = {99}, pages = {101796}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101796}, doi = {10.1016/J.COMGEO.2021.101796}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimYA21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KipouridisKPT21, author = {Evangelos Kipouridis and Andreas Kosmatopoulos and Apostolos N. Papadopoulos and Kostas Tsichlas}, title = {Dynamic layers of maxima with applications to dominating queries}, journal = {Comput. Geom.}, volume = {93}, pages = {101699}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101699}, doi = {10.1016/J.COMGEO.2020.101699}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KipouridisKPT21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KlimenkoRB21, author = {Georgiy Klimenko and Benjamin Raichel and Gregory Van Buskirk}, title = {Sparse convex hull coverage}, journal = {Comput. Geom.}, volume = {98}, pages = {101787}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101787}, doi = {10.1016/J.COMGEO.2021.101787}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KlimenkoRB21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KluteLN21, author = {Fabian Klute and Maarten L{\"{o}}ffler and Martin N{\"{o}}llenburg}, title = {Labeling nonograms: Boundary labeling for curve arrangements}, journal = {Comput. Geom.}, volume = {98}, pages = {101791}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101791}, doi = {10.1016/J.COMGEO.2021.101791}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KluteLN21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KubelL21, author = {David K{\"{u}}bel and Elmar Langetepe}, title = {On the approximation of shortest escape paths}, journal = {Comput. Geom.}, volume = {93}, pages = {101709}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101709}, doi = {10.1016/J.COMGEO.2020.101709}, timestamp = {Fri, 13 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KubelL21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Laczkovich21, author = {Mikl{\'{o}}s Laczkovich}, title = {Tilings of the regular \emph{N}-gon with triangles of angles \emph{{\(\pi\)}}/\emph{N}, \emph{{\(\pi\)}}/\emph{N}, (\emph{N}{\unicode{8239}}-{\unicode{8239}}2)\emph{{\(\pi\)}}/\emph{N} for \emph{N}{\unicode{8239}}={\unicode{8239}}5, 8, 10 and 12}, journal = {Comput. Geom.}, volume = {92}, pages = {101690}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101690}, doi = {10.1016/J.COMGEO.2020.101690}, timestamp = {Fri, 14 May 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Laczkovich21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LeeEA21, author = {Seungjun Lee and Taekang Eom and Hee{-}Kap Ahn}, title = {Largest triangles in a polygon}, journal = {Comput. Geom.}, volume = {98}, pages = {101792}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101792}, doi = {10.1016/J.COMGEO.2021.101792}, timestamp = {Tue, 13 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LeeEA21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Lund21, author = {Ben Lund}, title = {Two theorems on point-flat incidences}, journal = {Comput. Geom.}, volume = {92}, pages = {101681}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101681}, doi = {10.1016/J.COMGEO.2020.101681}, timestamp = {Thu, 29 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Lund21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/McCoyS21, author = {Stephanie McCoy and N{\'{a}}ndor Sieben}, title = {Impartial achievement games on convex geometries}, journal = {Comput. Geom.}, volume = {98}, pages = {101786}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101786}, doi = {10.1016/J.COMGEO.2021.101786}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/McCoyS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MonroyPT21, author = {Ruy Fabila Monroy and Daniel Perz and Ana Laura Trujillo{-}Negrete}, title = {Empty rainbow triangles in \emph{k}-colored point sets}, journal = {Comput. Geom.}, volume = {95}, pages = {101731}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101731}, doi = {10.1016/J.COMGEO.2020.101731}, timestamp = {Tue, 02 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MonroyPT21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/NassihANANH21, author = {Bouchra Nassih and Aouatif Amine and Mohammed Ngadi and Youssef Azdoud and Driss Naji and Nabil Hmina}, title = {An efficient three-dimensional face recognition system based random forest and geodesic curves}, journal = {Comput. Geom.}, volume = {97}, pages = {101758}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101758}, doi = {10.1016/J.COMGEO.2021.101758}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/NassihANANH21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ParkC21, author = {Ji{-}won Park and Otfried Cheong}, title = {Smallest universal covers for families of triangles}, journal = {Comput. Geom.}, volume = {92}, pages = {101686}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101686}, doi = {10.1016/J.COMGEO.2020.101686}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ParkC21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PilzS21, author = {Alexander Pilz and Patrick Schnider}, title = {Bisecting three classes of lines}, journal = {Comput. Geom.}, volume = {98}, pages = {101775}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101775}, doi = {10.1016/J.COMGEO.2021.101775}, timestamp = {Wed, 27 Jul 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/PilzS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SapucaiaRS21, author = {Allan Sapucaia and Pedro J. de Rezende and Cid C. de Souza}, title = {Solving the minimum convex partition of point sets with integer programming}, journal = {Comput. Geom.}, volume = {99}, pages = {101794}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101794}, doi = {10.1016/J.COMGEO.2021.101794}, timestamp = {Sat, 08 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SapucaiaRS21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Sastry21, author = {Shankar P. Sastry}, title = {A 2D advancing-front Delaunay mesh refinement algorithm}, journal = {Comput. Geom.}, volume = {97}, pages = {101772}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101772}, doi = {10.1016/J.COMGEO.2021.101772}, timestamp = {Mon, 25 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Sastry21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Smid21, author = {Michiel H. M. Smid}, title = {An improved construction for spanners of disks}, journal = {Comput. Geom.}, volume = {92}, pages = {101682}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101682}, doi = {10.1016/J.COMGEO.2020.101682}, timestamp = {Mon, 21 Sep 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Smid21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/TanJ21, author = {Xuehou Tan and Bo Jiang}, title = {On the upper bound on the average distance from the Fermat-Weber center of a convex body}, journal = {Comput. Geom.}, volume = {97}, pages = {101769}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101769}, doi = {10.1016/J.COMGEO.2021.101769}, timestamp = {Tue, 01 Jun 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/TanJ21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/TillmannK21, author = {Andreas M. Tillmann and Leif Kobbelt}, title = {Structured discrete shape approximation: Theoretical complexity and practical algorithm}, journal = {Comput. Geom.}, volume = {99}, pages = {101795}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2021.101795}, doi = {10.1016/J.COMGEO.2021.101795}, timestamp = {Thu, 23 Jun 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/TillmannK21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Verdonschot21, author = {Sander Verdonschot}, title = {Flipping in spirals}, journal = {Comput. Geom.}, volume = {95}, pages = {101729}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101729}, doi = {10.1016/J.COMGEO.2020.101729}, timestamp = {Tue, 02 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Verdonschot21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZhouCY21, author = {Bo Zhou and Yi{-}Jen Chiang and Chee Yap}, title = {Soft subdivision motion planning for complex planar robots}, journal = {Comput. Geom.}, volume = {92}, pages = {101683}, year = {2021}, url = {https://doi.org/10.1016/j.comgeo.2020.101683}, doi = {10.1016/J.COMGEO.2020.101683}, timestamp = {Thu, 29 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ZhouCY21.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AgrawalLXJ20, author = {Akash Agrawal and Yuan Li and Jie Xue and Ravi Janardan}, title = {The most-likely skyline problem for stochastic points}, journal = {Comput. Geom.}, volume = {88}, pages = {101609}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101609}, doi = {10.1016/J.COMGEO.2020.101609}, timestamp = {Fri, 27 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AgrawalLXJ20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnABOSW20, author = {Hee{-}Kap Ahn and Helmut Alt and Maike Buchin and Eunjin Oh and Ludmila Scharf and Carola Wenk}, title = {Middle curves based on discrete Fr{\'{e}}chet distance}, journal = {Comput. Geom.}, volume = {89}, pages = {101621}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101621}, doi = {10.1016/J.COMGEO.2020.101621}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnABOSW20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AigerKS20, author = {Dror Aiger and Haim Kaplan and Micha Sharir}, title = {Output sensitive algorithms for approximate incidences and their applications}, journal = {Comput. Geom.}, volume = {91}, pages = {101666}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101666}, doi = {10.1016/J.COMGEO.2020.101666}, timestamp = {Thu, 23 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AigerKS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Aldana-GalvanAA20, author = {Israel Aldana{-}Galv{\'{a}}n and Carlos Alegr{\'{\i}}a and Jose Luis {\'{A}}lvarez{-}Rebollar and Nestaly Mar{\'{\i}}n{-}Nev{\'{a}}rez and Erick Sol{\'{\i}}s{-}Villarreal and Jorge Urrutia and Carlos Velarde}, title = {Finding minimum witness sets in orthogonal polygons}, journal = {Comput. Geom.}, volume = {90}, pages = {101656}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101656}, doi = {10.1016/J.COMGEO.2020.101656}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Aldana-GalvanAA20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AmentaR20, author = {Nina Amenta and Carlos Rojas}, title = {Dihedral deformation and rigidity}, journal = {Comput. Geom.}, volume = {90}, pages = {101657}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101657}, doi = {10.1016/J.COMGEO.2020.101657}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AmentaR20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BandyapadhyayKS20, author = {Sayan Bandyapadhyay and Neeraj Kumar and Subhash Suri and Kasturi R. Varadarajan}, title = {Improved approximation bounds for the minimum constraint removal problem}, journal = {Comput. Geom.}, volume = {90}, pages = {101650}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101650}, doi = {10.1016/J.COMGEO.2020.101650}, timestamp = {Thu, 06 Aug 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BandyapadhyayKS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanikSS20, author = {Aritra Banik and Vibha Sahlot and Saket Saurabh}, title = {Approximation algorithms for geometric conflict free covering problems}, journal = {Comput. Geom.}, volume = {89}, pages = {101591}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101591}, doi = {10.1016/J.COMGEO.2019.101591}, timestamp = {Tue, 16 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BanikSS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanyassadyCKMRR20, author = {Bahareh Banyassady and Man{-}Kwun Chiu and Matias Korman and Wolfgang Mulzer and Andr{\'{e}} van Renssen and Marcel Roeloffzen and Paul Seiferth and Yannik Stein and Birgit Vogtenhuber and Max Willert}, title = {Routing in polygonal domains}, journal = {Comput. Geom.}, volume = {87}, pages = {101593}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101593}, doi = {10.1016/J.COMGEO.2019.101593}, timestamp = {Mon, 09 Mar 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BanyassadyCKMRR20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyM20, author = {Imre B{\'{a}}r{\'{a}}ny and Nabil H. Mustafa}, title = {An application of the universality theorem for Tverberg partitions to data depth and hitting convex sets}, journal = {Comput. Geom.}, volume = {90}, pages = {101649}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101649}, doi = {10.1016/J.COMGEO.2020.101649}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyM20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeltonFMMMSSSW20, author = {Robin Lynne Belton and Brittany Terese Fasy and Rostik Mertz and Samuel Micka and David L. Millman and Daniel Salinas and Anna Schenfisch and Jordan Schupbach and Lucia Williams}, title = {Reconstructing embedded graphs from persistence diagrams}, journal = {Comput. Geom.}, volume = {90}, pages = {101658}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101658}, doi = {10.1016/J.COMGEO.2020.101658}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BeltonFMMMSSSW20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BenbernouDDL20, author = {Nadia M. Benbernou and Erik D. Demaine and Martin L. Demaine and Anna Lubiw}, title = {Universal hinge patterns for folding strips efficiently into any grid polyhedron}, journal = {Comput. Geom.}, volume = {89}, pages = {101633}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101633}, doi = {10.1016/J.COMGEO.2020.101633}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BenbernouDDL20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhattacharyaM20, author = {Amitava Bhattacharya and Anupam Mondal}, title = {Covering the plane by a sequence of circular disks with a constraint}, journal = {Comput. Geom.}, volume = {91}, pages = {101680}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101680}, doi = {10.1016/J.COMGEO.2020.101680}, timestamp = {Fri, 31 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaM20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlBMM20, author = {Therese Biedl and Ahmad Biniaz and Anil Maheshwari and Saeed Mehrabi}, title = {Packing boundary-anchored rectangles and squares}, journal = {Comput. Geom.}, volume = {88}, pages = {101610}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101610}, doi = {10.1016/J.COMGEO.2020.101610}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlBMM20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Biniaz20, author = {Ahmad Biniaz}, title = {Plane hop spanners for unit disk graphs: Simpler and better}, journal = {Comput. Geom.}, volume = {89}, pages = {101622}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101622}, doi = {10.1016/J.COMGEO.2020.101622}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Biniaz20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazG20, author = {Ahmad Biniaz and Alfredo Garc{\'{\i}}a}, title = {Packing plane spanning trees into a point set}, journal = {Comput. Geom.}, volume = {90}, pages = {101653}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101653}, doi = {10.1016/J.COMGEO.2020.101653}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazG20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BinucciGHLMSW20, author = {Carla Binucci and Emilio Di Giacomo and Seok{-}Hee Hong and Giuseppe Liotta and Henk Meijer and Vera Sacrist{\'{a}}n and Stephen K. Wismath}, title = {Colored anchored visibility representations in 2D and 3D space}, journal = {Comput. Geom.}, volume = {89}, pages = {101592}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101592}, doi = {10.1016/J.COMGEO.2019.101592}, timestamp = {Thu, 27 Apr 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BinucciGHLMSW20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCSS20, author = {Prosenjit Bose and Jean{-}Lou De Carufel and Alina Shaikhet and Michiel H. M. Smid}, title = {Optimal Art Gallery Localization is NP-hard}, journal = {Comput. Geom.}, volume = {88}, pages = {101607}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101607}, doi = {10.1016/J.COMGEO.2020.101607}, timestamp = {Wed, 22 Apr 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCSS20a, author = {Prosenjit Bose and Pilar Cano and Maria Saumell and Rodrigo I. Silveira}, title = {Hamiltonicity for convex shape Delaunay and Gabriel graphs}, journal = {Comput. Geom.}, volume = {89}, pages = {101629}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101629}, doi = {10.1016/J.COMGEO.2020.101629}, timestamp = {Tue, 16 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS20a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseKL20, author = {Prosenjit Bose and Irina Kostitsyna and Stefan Langerman}, title = {Self-approaching paths in simple polygons}, journal = {Comput. Geom.}, volume = {87}, pages = {101595}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101595}, doi = {10.1016/J.COMGEO.2019.101595}, timestamp = {Mon, 09 Mar 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseKL20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseS20, author = {Prosenjit Bose and Thomas C. Shermer}, title = {Gathering by repulsion}, journal = {Comput. Geom.}, volume = {90}, pages = {101627}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101627}, doi = {10.1016/J.COMGEO.2020.101627}, timestamp = {Thu, 06 Aug 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinKR20, author = {Kevin Buchin and Maximilian Konzack and Wim Reddingius}, title = {Progressive simplification of polygonal curves}, journal = {Comput. Geom.}, volume = {88}, pages = {101620}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101620}, doi = {10.1016/J.COMGEO.2020.101620}, timestamp = {Mon, 04 May 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinKR20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiCKKORRSS20, author = {Paz Carmi and Man{-}Kwun Chiu and Matthew J. Katz and Matias Korman and Yoshio Okamoto and Andr{\'{e}} van Renssen and Marcel Roeloffzen and Taichi Shiitada and Shakhar Smorodinsky}, title = {Balanced line separators of unit disk graphs}, journal = {Comput. Geom.}, volume = {86}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101575}, doi = {10.1016/J.COMGEO.2019.101575}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiCKKORRSS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarufelGMSS20, author = {Jean{-}Lou De Carufel and Carsten Grimm and Anil Maheshwari and Stefan Schirra and Michiel H. M. Smid}, title = {Minimizing the continuous diameter when augmenting a geometric tree with a shortcut}, journal = {Comput. Geom.}, volume = {89}, pages = {101631}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101631}, doi = {10.1016/J.COMGEO.2020.101631}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMSS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanR020, author = {Timothy M. Chan and Saladi Rahul and Jie Xue}, title = {Range closest-pair search in higher dimensions}, journal = {Comput. Geom.}, volume = {91}, pages = {101669}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101669}, doi = {10.1016/J.COMGEO.2020.101669}, timestamp = {Fri, 31 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChanR020.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChuangpishitMNO20, author = {Huda Chuangpishit and Saeed Mehrabi and Lata Narayanan and Jaroslav Opatrny}, title = {Evacuating equilateral triangles and squares in the face-to-face model}, journal = {Comput. Geom.}, volume = {89}, pages = {101624}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101624}, doi = {10.1016/J.COMGEO.2020.101624}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChuangpishitMNO20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CleveM20, author = {Jonas Cleve and Wolfgang Mulzer}, title = {Combinatorics of beacon-based routing in three dimensions}, journal = {Comput. Geom.}, volume = {91}, pages = {101667}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101667}, doi = {10.1016/J.COMGEO.2020.101667}, timestamp = {Fri, 31 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CleveM20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineKKMORRUU20, author = {Erik D. Demaine and Matias Korman and Jason S. Ku and Joseph S. B. Mitchell and Yota Otachi and Andr{\'{e}} van Renssen and Marcel Roeloffzen and Ryuhei Uehara and Yushi Uno}, title = {Symmetric assembly puzzles are hard, beyond a few pieces}, journal = {Comput. Geom.}, volume = {90}, pages = {101648}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101648}, doi = {10.1016/J.COMGEO.2020.101648}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineKKMORRUU20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Do20, author = {Thao Do}, title = {Extending Erd{\H{o}}s-Beck's theorem to higher dimensions}, journal = {Comput. Geom.}, volume = {90}, pages = {101625}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101625}, doi = {10.1016/J.COMGEO.2020.101625}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Do20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Dumitrescu20, author = {Adrian Dumitrescu}, title = {On the shortest separating cycle}, journal = {Comput. Geom.}, volume = {88}, pages = {101612}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101612}, doi = {10.1016/J.COMGEO.2020.101612}, timestamp = {Wed, 22 Apr 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuT20, author = {Adrian Dumitrescu and Csaba D. T{\'{o}}th}, title = {Problems on track runners}, journal = {Comput. Geom.}, volume = {88}, pages = {101611}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101611}, doi = {10.1016/J.COMGEO.2020.101611}, timestamp = {Wed, 22 Apr 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuT20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherK20, author = {Stephane Durocher and Shahin Kamali}, title = {Foreword}, journal = {Comput. Geom.}, volume = {90}, pages = {101652}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101652}, doi = {10.1016/J.COMGEO.2020.101652}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherK20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EllenS20, author = {Faith Ellen and J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {Preface}, journal = {Comput. Geom.}, volume = {89}, pages = {101632}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101632}, doi = {10.1016/J.COMGEO.2020.101632}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EllenS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FerresFGHN20, author = {Leo Ferres and Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and Travis Gagie and Meng He and Gonzalo Navarro}, title = {Fast and compact planar embeddings}, journal = {Comput. Geom.}, volume = {89}, pages = {101630}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101630}, doi = {10.1016/J.COMGEO.2020.101630}, timestamp = {Wed, 28 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FerresFGHN20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FriggstadSS20, author = {Zachary Friggstad and J{\"{o}}rg{-}R{\"{u}}diger Sack and Mohammad R. Salavatipour}, title = {Preface}, journal = {Comput. Geom.}, volume = {91}, pages = {101671}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101671}, doi = {10.1016/J.COMGEO.2020.101671}, timestamp = {Thu, 23 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FriggstadSS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GangopadhyayS20, author = {Rahul Gangopadhyay and Saswata Shannigrahi}, title = {\emph{k}-Sets and rectilinear crossings in complete uniform hypergraphs}, journal = {Comput. Geom.}, volume = {86}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101578}, doi = {10.1016/J.COMGEO.2019.101578}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GangopadhyayS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiacomoLM20, author = {Emilio Di Giacomo and Giuseppe Liotta and Fabrizio Montecchiani}, title = {1-bend upward planar slope number of SP-digraphs}, journal = {Comput. Geom.}, volume = {90}, pages = {101628}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101628}, doi = {10.1016/J.COMGEO.2020.101628}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GiacomoLM20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonS20, author = {Joachim Gudmundsson and Michiel H. M. Smid}, title = {Special issue on the 29th Canadian Conference on Computational Geometry, Guest Editors' foreword}, journal = {Comput. Geom.}, volume = {88}, pages = {101608}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101608}, doi = {10.1016/J.COMGEO.2020.101608}, timestamp = {Wed, 22 Apr 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HaverkortKLS20, author = {Herman J. Haverkort and David K{\"{u}}bel and Elmar Langetepe and Barbara Schwarzwald}, title = {How to play hot and cold}, journal = {Comput. Geom.}, volume = {87}, pages = {101596}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101596}, doi = {10.1016/J.COMGEO.2019.101596}, timestamp = {Mon, 09 Mar 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HaverkortKLS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LozzoBF20, author = {Giordano Da Lozzo and Giuseppe Di Battista and Fabrizio Frati}, title = {Extending upward planar graph drawings}, journal = {Comput. Geom.}, volume = {91}, pages = {101668}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101668}, doi = {10.1016/J.COMGEO.2020.101668}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LozzoBF20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LubiwMO20, author = {Anna Lubiw and Daniela Maftuleac and Megan Owen}, title = {Shortest paths and convex hulls in 2D complexes with non-positive curvature}, journal = {Comput. Geom.}, volume = {89}, pages = {101626}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101626}, doi = {10.1016/J.COMGEO.2020.101626}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LubiwMO20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MasoodRN20, author = {Talha Bin Masood and Tathagata Ray and Vijay Natarajan}, title = {Parallel computation of alpha complexes for biomolecules}, journal = {Comput. Geom.}, volume = {90}, pages = {101651}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101651}, doi = {10.1016/J.COMGEO.2020.101651}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MasoodRN20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Messerschmidt20, author = {Miek Messerschmidt}, title = {On compact packings of the plane with circles of three radii}, journal = {Comput. Geom.}, volume = {86}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.05.002}, doi = {10.1016/J.COMGEO.2019.05.002}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Messerschmidt20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Munao20, author = {Simone Munao}, title = {Introducing article numbering to \emph{Computational Geometry: Theory and Applications}}, journal = {Comput. Geom.}, volume = {86}, year = {2020}, url = {https://doi.org/10.1016/S0925-7721(19)30145-2}, doi = {10.1016/S0925-7721(19)30145-2}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Munao20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PolishchukS20, author = {Valentin Polishchuk and Christiane Schmidt}, title = {Special Issue on the 33rd European Workshop on Computational Geometry, Guest Editors' Foreword}, journal = {Comput. Geom.}, volume = {87}, pages = {101590}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101590}, doi = {10.1016/J.COMGEO.2019.101590}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PolishchukS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ScaramucciaIFL20, author = {Sara Scaramuccia and Federico Iuricich and Leila De Floriani and Claudia Landi}, title = {Computing multiparameter persistent homology through a discrete Morse-based approach}, journal = {Comput. Geom.}, volume = {89}, pages = {101623}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101623}, doi = {10.1016/J.COMGEO.2020.101623}, timestamp = {Wed, 15 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ScaramucciaIFL20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Scheucher20, author = {Manfred Scheucher}, title = {Two disjoint 5-holes in point sets}, journal = {Comput. Geom.}, volume = {91}, pages = {101670}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101670}, doi = {10.1016/J.COMGEO.2020.101670}, timestamp = {Fri, 31 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Scheucher20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchiblerS20, author = {Thomas Schibler and Subhash Suri}, title = {K-dominance in multidimensional data: Theory and applications}, journal = {Comput. Geom.}, volume = {87}, pages = {101594}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101594}, doi = {10.1016/J.COMGEO.2019.101594}, timestamp = {Mon, 09 Mar 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchiblerS20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/TeoDF20, author = {Ka Yaw Teo and Ovidiu Daescu and Kyle Fox}, title = {Trajectory planning for an articulated probe}, journal = {Comput. Geom.}, volume = {90}, pages = {101655}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101655}, doi = {10.1016/J.COMGEO.2020.101655}, timestamp = {Thu, 16 Jul 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/TeoDF20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Viglietta20, author = {Giovanni Viglietta}, title = {Optimally guarding 2-reflex orthogonal polyhedra by reflex edge guards}, journal = {Comput. Geom.}, volume = {86}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101589}, doi = {10.1016/J.COMGEO.2019.101589}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Viglietta20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WangW20, author = {Yuan Wang and Bei Wang}, title = {Topological inference of manifolds with boundary}, journal = {Comput. Geom.}, volume = {88}, pages = {101606}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2019.101606}, doi = {10.1016/J.COMGEO.2019.101606}, timestamp = {Mon, 23 Aug 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/WangW20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/XueLJ20, author = {Jie Xue and Yuan Li and Ravi Janardan}, title = {Approximate range closest-pair queries}, journal = {Comput. Geom.}, volume = {90}, pages = {101654}, year = {2020}, url = {https://doi.org/10.1016/j.comgeo.2020.101654}, doi = {10.1016/J.COMGEO.2020.101654}, timestamp = {Fri, 27 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/XueLJ20.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/0001KW19, author = {Matt Gibson and Erik Krohn and Qing Wang}, title = {The VC-dimension of visibility on the boundary of monotone polygons}, journal = {Comput. Geom.}, volume = {77}, pages = {62--72}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.006}, doi = {10.1016/J.COMGEO.2018.10.006}, timestamp = {Tue, 09 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/0001KW19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AcharyyaNPR19, author = {Ankush Acharyya and Subhas C. Nandy and Supantha Pandit and Sasanka Roy}, title = {Covering segments with unit squares}, journal = {Comput. Geom.}, volume = {79}, pages = {1--13}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.001}, doi = {10.1016/J.COMGEO.2019.01.001}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AcharyyaNPR19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ackerman19, author = {Eyal Ackerman}, title = {On topological graphs with at most four crossings per edge}, journal = {Comput. Geom.}, volume = {85}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.101574}, doi = {10.1016/J.COMGEO.2019.101574}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ackerman19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnABCDPS19, author = {Hee{-}Kap Ahn and Judit Abardia and Sang Won Bae and Otfried Cheong and Susanna Dann and Dongwoo Park and Chan{-}Su Shin}, title = {The minimum convex container of two convex polytopes under translations}, journal = {Comput. Geom.}, volume = {77}, pages = {40--50}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.02.004}, doi = {10.1016/J.COMGEO.2018.02.004}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnABCDPS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBCKMOPRV19, author = {Hee{-}Kap Ahn and Sang Won Bae and Jong Min Choi and Matias Korman and Wolfgang Mulzer and Eunjin Oh and Ji{-}won Park and Andr{\'{e}} van Renssen and Antoine Vigneron}, title = {Faster algorithms for growing prioritized disks and rectangles}, journal = {Comput. Geom.}, volume = {80}, pages = {23--39}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.02.001}, doi = {10.1016/J.COMGEO.2019.02.001}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBCKMOPRV19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnOSSS19, author = {Hee{-}Kap Ahn and Eunjin Oh and Lena Schlipf and Fabian Stehn and Darren Strash}, title = {On Romeo and Juliet problems: Minimizing distance-to-sight}, journal = {Comput. Geom.}, volume = {84}, pages = {12--21}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.003}, doi = {10.1016/J.COMGEO.2019.07.003}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnOSSS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerHKPRR19, author = {Oswin Aichholzer and Thomas Hackl and Matias Korman and Alexander Pilz and Andr{\'{e}} van Renssen and Marcel Roeloffzen and G{\"{u}}nter Rote and Birgit Vogtenhuber}, title = {Packing plane spanning graphs with short edges in complete geometric graphs}, journal = {Comput. Geom.}, volume = {82}, pages = {1--15}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.04.001}, doi = {10.1016/J.COMGEO.2019.04.001}, timestamp = {Fri, 31 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHKPRR19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMHPRU19, author = {Oswin Aichholzer and Ruy Fabila Monroy and Ferran Hurtado and Pablo P{\'{e}}rez{-}Lantero and Andres J. Ruiz{-}Vargas and Jorge Urrutia and Birgit Vogtenhuber}, title = {Cross-sections of line configurations in {R3} and (\emph{d} - 2)-flat configurations in Rd}, journal = {Comput. Geom.}, volume = {77}, pages = {51--61}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.02.005}, doi = {10.1016/J.COMGEO.2018.02.005}, timestamp = {Tue, 04 Dec 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHPRU19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisCCKL19, author = {Greg Aloupis and Paz Carmi and Lilach Chaitman{-}Yerushalmi and Matthew J. Katz and Stefan Langerman}, title = {Bottleneck detour tree of points on a path}, journal = {Comput. Geom.}, volume = {79}, pages = {30--36}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.005}, doi = {10.1016/J.COMGEO.2019.01.005}, timestamp = {Thu, 04 Apr 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCKL19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AtalayM19, author = {F. Bet{\"{u}}l Atalay and David M. Mount}, title = {Bounds on the cost of compatible refinement of simplex decomposition trees in arbitrary dimensions}, journal = {Comput. Geom.}, volume = {79}, pages = {14--29}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.004}, doi = {10.1016/J.COMGEO.2019.01.004}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AtalayM19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AurenhammerSK19, author = {Franz Aurenhammer and Michael Steinkogler and Rolf Klein}, title = {Partially walking a polygon}, journal = {Comput. Geom.}, volume = {84}, pages = {3--11}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.002}, doi = {10.1016/J.COMGEO.2019.07.002}, timestamp = {Tue, 10 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AurenhammerSK19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bae19, author = {Sang Won Bae}, title = {Computing a minimum-width square or rectangular annulus with outliers}, journal = {Comput. Geom.}, volume = {76}, pages = {33--45}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.08.002}, doi = {10.1016/J.COMGEO.2018.08.002}, timestamp = {Wed, 25 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Bae19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeBCGL19, author = {Sang Won Bae and Mark de Berg and Otfried Cheong and Joachim Gudmundsson and Christos Levcopoulos}, title = {Shortcuts for the circle}, journal = {Comput. Geom.}, volume = {79}, pages = {37--54}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.006}, doi = {10.1016/J.COMGEO.2019.01.006}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaeBCGL19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeKO19, author = {Sang Won Bae and Matias Korman and Yoshio Okamoto}, title = {Computing the geodesic centers of a polygonal domain}, journal = {Comput. Geom.}, volume = {77}, pages = {3--9}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2015.10.009}, doi = {10.1016/J.COMGEO.2015.10.009}, timestamp = {Wed, 25 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaeKO19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeOS19, author = {Sang Won Bae and Yoshio Okamoto and Chan{-}Su Shin}, title = {Area bounds of rectilinear polygons realized by angle sequences}, journal = {Comput. Geom.}, volume = {83}, pages = {9--29}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.05.004}, doi = {10.1016/J.COMGEO.2019.05.004}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaeOS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeS19, author = {Sang Won Bae and Michiel H. M. Smid}, title = {Closest-pair queries in fat rectangles}, journal = {Comput. Geom.}, volume = {83}, pages = {1--8}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.05.003}, doi = {10.1016/J.COMGEO.2019.05.003}, timestamp = {Fri, 15 Nov 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaeS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeSV19, author = {Sang Won Bae and Chan{-}Su Shin and Antoine Vigneron}, title = {Tight bounds for beacon-based coverage in simple rectilinear polygons}, journal = {Comput. Geom.}, volume = {80}, pages = {40--52}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.02.002}, doi = {10.1016/J.COMGEO.2019.02.002}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaeSV19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BakhsheshF19, author = {Davood Bakhshesh and Mohammad Farshi}, title = {(Weakly) Self-approaching geometric graphs and spanners}, journal = {Comput. Geom.}, volume = {78}, pages = {20--36}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.002}, doi = {10.1016/J.COMGEO.2018.10.002}, timestamp = {Tue, 04 Dec 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BandyapadhyayMM19, author = {Sayan Bandyapadhyay and Anil Maheshwari and Saeed Mehrabi and Subhash Suri}, title = {Approximating dominating set on intersection graphs of rectangles and L-frames}, journal = {Comput. Geom.}, volume = {82}, pages = {32--44}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.04.004}, doi = {10.1016/J.COMGEO.2019.04.004}, timestamp = {Fri, 31 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BandyapadhyayMM19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergM19, author = {Mark de Berg and Aleksandar Markovic}, title = {Dynamic conflict-free colorings in the plane}, journal = {Comput. Geom.}, volume = {78}, pages = {61--73}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.005}, doi = {10.1016/J.COMGEO.2018.10.005}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergM19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMS19, author = {Ahmad Biniaz and Anil Maheshwari and Michiel H. M. Smid}, title = {Flip distance to some plane configurations}, journal = {Comput. Geom.}, volume = {81}, pages = {12--21}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.008}, doi = {10.1016/J.COMGEO.2019.01.008}, timestamp = {Tue, 14 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrazilVZRT19, author = {Marcus Brazil and Marcus Volz and Martin Zachariasen and Charl J. Ras and Doreen A. Thomas}, title = {New pruning rules for the Steiner tree problem and 2-connected Steiner network problem}, journal = {Comput. Geom.}, volume = {78}, pages = {37--49}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.003}, doi = {10.1016/J.COMGEO.2018.10.003}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BrazilVZRT19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinBMS19, author = {Kevin Buchin and Maike Buchin and Wouter Meulemans and Bettina Speckmann}, title = {Locally correct Fr{\'{e}}chet matchings}, journal = {Comput. Geom.}, volume = {76}, pages = {1--18}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.09.002}, doi = {10.1016/J.COMGEO.2018.09.002}, timestamp = {Fri, 27 Mar 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinBMS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiCO19, author = {Paz Carmi and Lilach Chaitman{-}Yerushalmi and Bat{-}Chen Ozeri}, title = {Minimizing the sum of distances to a server in a constraint network}, journal = {Comput. Geom.}, volume = {80}, pages = {1--12}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.003}, doi = {10.1016/J.COMGEO.2019.01.003}, timestamp = {Tue, 14 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiCO19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChaplickLWZ19, author = {Steven Chaplick and Fabian Lipp and Alexander Wolff and Johannes Zink}, title = {Compact drawings of 1-planar graphs with right-angle crossings and few bends}, journal = {Comput. Geom.}, volume = {84}, pages = {50--68}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.006}, doi = {10.1016/J.COMGEO.2019.07.006}, timestamp = {Wed, 14 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChaplickLWZ19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChoudharyG19, author = {Aruni Choudhary and Arijit Ghosh}, title = {Delaunay simplices in diagonally distorted lattices}, journal = {Comput. Geom.}, volume = {81}, pages = {33--44}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.010}, doi = {10.1016/J.COMGEO.2019.01.010}, timestamp = {Fri, 31 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChoudharyG19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DaescuFMPS19, author = {Ovidiu Daescu and Stephan Friedrichs and Hemant Malik and Valentin Polishchuk and Christiane Schmidt}, title = {Altitude terrain guarding and guarding uni-monotone polygons}, journal = {Comput. Geom.}, volume = {84}, pages = {22--35}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.004}, doi = {10.1016/J.COMGEO.2019.07.004}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DaescuFMPS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeyPRS19, author = {Tamal K. Dey and Pan Peng and Alfred Rossi and Anastasios Sidiropoulos}, title = {Spectral concentration and greedy \emph{k}-clustering}, journal = {Comput. Geom.}, volume = {76}, pages = {19--32}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.09.001}, doi = {10.1016/J.COMGEO.2018.09.001}, timestamp = {Fri, 13 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DeyPRS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Dumitrescu19, author = {Adrian Dumitrescu}, title = {A product inequality for extreme distances}, journal = {Comput. Geom.}, volume = {85}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.101577}, doi = {10.1016/J.COMGEO.2019.101577}, timestamp = {Mon, 09 Dec 2019 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherM19, author = {Stephane Durocher and Debajyoti Mondal}, title = {Drawing plane triangulations with few segments}, journal = {Comput. Geom.}, volume = {77}, pages = {27--39}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.02.003}, doi = {10.1016/J.COMGEO.2018.02.003}, timestamp = {Tue, 04 Dec 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherM19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FoxPS19, author = {Jacob Fox and J{\'{a}}nos Pach and Andrew Suk}, title = {Approximating the rectilinear crossing number}, journal = {Comput. Geom.}, volume = {81}, pages = {45--53}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.04.003}, doi = {10.1016/J.COMGEO.2019.04.003}, timestamp = {Tue, 14 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FoxPS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeZ19, author = {Meng He and Norbert Zeh}, title = {Editorial: Special issue on the 26th Canadian Conference on Computational Geometry {(CCCG)}}, journal = {Comput. Geom.}, volume = {77}, pages = {1--2}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.08.001}, doi = {10.1016/J.COMGEO.2018.08.001}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HeZ19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HlinenyPR19, author = {Petr Hlinen{\'{y}} and Filip Pokr{\'{y}}vka and Bodhayan Roy}, title = {{FO} model checking on geometric graphs}, journal = {Comput. Geom.}, volume = {78}, pages = {1--19}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.001}, doi = {10.1016/J.COMGEO.2018.10.001}, timestamp = {Wed, 25 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HlinenyPR19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HuemerPS19, author = {Clemens Huemer and Alexander Pilz and Rodrigo I. Silveira}, title = {A new lower bound on the maximum number of plane graphs using production matrices}, journal = {Comput. Geom.}, volume = {84}, pages = {36--49}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.005}, doi = {10.1016/J.COMGEO.2019.07.005}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HuemerPS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaplanRS19, author = {Haim Kaplan and Sasanka Roy and Micha Sharir}, title = {Finding axis-parallel rectangles of fixed perimeter or area containing the largest number of points}, journal = {Comput. Geom.}, volume = {81}, pages = {1--11}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.007}, doi = {10.1016/J.COMGEO.2019.01.007}, timestamp = {Tue, 14 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KaplanRS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KawamuraMOP19, author = {Akitoshi Kawamura and Sonoko Moriyama and Yota Otachi and J{\'{a}}nos Pach}, title = {A lower bound on opaque sets}, journal = {Comput. Geom.}, volume = {80}, pages = {13--22}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.002}, doi = {10.1016/J.COMGEO.2019.01.002}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KawamuraMOP19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KleistKLSSS19, author = {Linda Kleist and Boris Klemz and Anna Lubiw and Lena Schlipf and Frank Staals and Darren Strash}, title = {Convexity-increasing morphs of planar graphs}, journal = {Comput. Geom.}, volume = {84}, pages = {69--88}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.007}, doi = {10.1016/J.COMGEO.2019.07.007}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KleistKLSSS19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KormanM19, author = {Matias Korman and Wolfgang Mulzer}, title = {Special Issue on the 34th European Workshop on Computational Geometry, Guest Editors' Foreword}, journal = {Comput. Geom.}, volume = {84}, pages = {1--2}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.07.001}, doi = {10.1016/J.COMGEO.2019.07.001}, timestamp = {Tue, 10 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KormanM19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MartinY19, author = {Pedro Mart{\'{\i}}n and Diego Y{\'{a}}{\~{n}}ez}, title = {Geometric clustering in normed planes}, journal = {Comput. Geom.}, volume = {78}, pages = {50--60}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.004}, doi = {10.1016/J.COMGEO.2018.10.004}, timestamp = {Thu, 23 Sep 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/MartinY19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OhA19, author = {Eunjin Oh and Hee{-}Kap Ahn}, title = {Assigning weights to minimize the covering radius in the plane}, journal = {Comput. Geom.}, volume = {81}, pages = {22--32}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2018.10.007}, doi = {10.1016/J.COMGEO.2018.10.007}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/OhA19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OhA19a, author = {Eunjin Oh and Hee{-}Kap Ahn}, title = {Finding pairwise intersections of rectangles in a query rectangle}, journal = {Comput. Geom.}, volume = {85}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.101576}, doi = {10.1016/J.COMGEO.2019.101576}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/OhA19a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OhBA19, author = {Eunjin Oh and Sang Won Bae and Hee{-}Kap Ahn}, title = {Computing a geodesic two-center of points in a simple polygon}, journal = {Comput. Geom.}, volume = {82}, pages = {45--59}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.05.001}, doi = {10.1016/J.COMGEO.2019.05.001}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/OhBA19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RahmatiAKW19, author = {Zahed Rahmati and Mohammad Ali Abam and Valerie King and Sue Whitesides}, title = {Kinetic \emph{k}-Semi-Yao graph and its applications}, journal = {Comput. Geom.}, volume = {77}, pages = {10--26}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2015.11.001}, doi = {10.1016/J.COMGEO.2015.11.001}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/RahmatiAKW19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SattariI19, author = {Sattar Sattari and Mohammad Izadi}, title = {An improved upper bound on dilation of regular polygons}, journal = {Comput. Geom.}, volume = {80}, pages = {53--68}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.01.009}, doi = {10.1016/J.COMGEO.2019.01.009}, timestamp = {Fri, 31 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SattariI19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/XueLJ19, author = {Jie Xue and Yuan Li and Ravi Janardan}, title = {On the expected diameter, width, and complexity of a stochastic convex hull}, journal = {Comput. Geom.}, volume = {82}, pages = {16--31}, year = {2019}, url = {https://doi.org/10.1016/j.comgeo.2019.04.002}, doi = {10.1016/J.COMGEO.2019.04.002}, timestamp = {Fri, 27 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/XueLJ19.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbelDDISU18, author = {Zachary Abel and Erik D. Demaine and Martin L. Demaine and Hiro Ito and Jack Snoeyink and Ryuhei Uehara}, title = {Bumpy pyramid folding}, journal = {Comput. Geom.}, volume = {75}, pages = {22--31}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.007}, doi = {10.1016/J.COMGEO.2018.06.007}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbelDDISU18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerBHPRV18, author = {Oswin Aichholzer and Martin Balko and Thomas Hackl and Alexander Pilz and Pedro Ramos and Pavel Valtr and Birgit Vogtenhuber}, title = {Holes in 2-convex point sets}, journal = {Comput. Geom.}, volume = {74}, pages = {38--49}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.002}, doi = {10.1016/J.COMGEO.2018.06.002}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBHPRV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerBHPV18, author = {Oswin Aichholzer and Luis Barba and Thomas Hackl and Alexander Pilz and Birgit Vogtenhuber}, title = {Linear transformation distance for bichromatic matchings}, journal = {Comput. Geom.}, volume = {68}, pages = {77--88}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.003}, doi = {10.1016/J.COMGEO.2017.05.003}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBHPV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMFHUV18, author = {Oswin Aichholzer and Ruy Fabila Monroy and David Flores{-}Pe{\~{n}}aloza and Thomas Hackl and Jorge Urrutia and Birgit Vogtenhuber}, title = {Modem illumination of monotone polygons}, journal = {Comput. Geom.}, volume = {68}, pages = {101--118}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.010}, doi = {10.1016/J.COMGEO.2017.05.010}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMFHUV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkitayaDDHHKL18, author = {Hugo A. Akitaya and Erik D. Demaine and Martin L. Demaine and Adam Hesterberg and Ferran Hurtado and Jason S. Ku and Jayson Lynch}, title = {Pachinko}, journal = {Comput. Geom.}, volume = {68}, pages = {226--242}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.011}, doi = {10.1016/J.COMGEO.2017.06.011}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AkitayaDDHHKL18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Alegria-Galicia18, author = {Carlos Alegr{\'{\i}}a{-}Galicia and David Orden and Carlos Seara and Jorge Urrutia}, title = {On the {\unicode{119978}}\({}_{\mbox{{\(\beta\)}}}\) of a planar point set}, journal = {Comput. Geom.}, volume = {68}, pages = {277--291}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.003}, doi = {10.1016/J.COMGEO.2017.06.003}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Alegria-Galicia18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArleoBGEGLMMWW18, author = {Alessio Arleo and Carla Binucci and Emilio Di Giacomo and William S. Evans and Luca Grilli and Giuseppe Liotta and Henk Meijer and Fabrizio Montecchiani and Sue Whitesides and Stephen K. Wismath}, title = {Visibility representations of boxes in 2.5 dimensions}, journal = {Comput. Geom.}, volume = {72}, pages = {19--33}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.02.007}, doi = {10.1016/J.COMGEO.2018.02.007}, timestamp = {Mon, 15 Jun 2020 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ArleoBGEGLMMWW18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AsinowskiR18, author = {Andrei Asinowski and G{\"{u}}nter Rote}, title = {Point sets with many non-crossing perfect matchings}, journal = {Comput. Geom.}, volume = {68}, pages = {7--33}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.006}, doi = {10.1016/J.COMGEO.2017.05.006}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AsinowskiR18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BakhsheshBBCDFF18, author = {Davood Bakhshesh and Luis Barba and Prosenjit Bose and Jean{-}Lou De Carufel and Mirela Damian and Rolf Fagerberg and Mohammad Farshi and Andr{\'{e}} van Renssen and Perouz Taslakian and Sander Verdonschot}, title = {Continuous Yao graphs}, journal = {Comput. Geom.}, volume = {67}, pages = {42--52}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.002}, doi = {10.1016/J.COMGEO.2017.10.002}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshBBCDFF18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaramFHHM18, author = {Alon Baram and Efi Fogel and Dan Halperin and Michael Hemmer and Sebastian Morr}, title = {Exact Minkowski sums of polygons with holes}, journal = {Comput. Geom.}, volume = {73}, pages = {46--56}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.005}, doi = {10.1016/J.COMGEO.2018.06.005}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaramFHHM18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyFMMOP18, author = {Imre B{\'{a}}r{\'{a}}ny and Ferenc Fodor and {\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and Luis Montejano and Deborah Oliveros and Attila P{\'{o}}r}, title = {Acknowledgement of priority - {A} fractional Helly theorem for boxes}, journal = {Comput. Geom.}, volume = {67}, pages = {1}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2016.09.001}, doi = {10.1016/J.COMGEO.2016.09.001}, timestamp = {Fri, 29 Jul 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMS18, author = {Ahmad Biniaz and Anil Maheshwari and Michiel H. M. Smid}, title = {Strong matching of points with geometric shapes}, journal = {Comput. Geom.}, volume = {68}, pages = {186--205}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.009}, doi = {10.1016/J.COMGEO.2017.06.009}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BohlerKLL18, author = {Cecilia Bohler and Rolf Klein and Andrzej Lingas and Chih{-}Hung Liu}, title = {Forest-like abstract Voronoi diagrams in linear time}, journal = {Comput. Geom.}, volume = {68}, pages = {134--145}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.013}, doi = {10.1016/J.COMGEO.2017.06.013}, timestamp = {Tue, 14 Sep 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BohlerKLL18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCR18, author = {Prosenjit Bose and Jean{-}Lou De Carufel and Andr{\'{e}} van Renssen}, title = {Constrained generalized Delaunay graphs are plane spanners}, journal = {Comput. Geom.}, volume = {74}, pages = {50--65}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.006}, doi = {10.1016/J.COMGEO.2018.06.006}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCR18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseLPV18, author = {Prosenjit Bose and Anna Lubiw and Vinayak Pathak and Sander Verdonschot}, title = {Flipping edge-labelled triangulations}, journal = {Comput. Geom.}, volume = {68}, pages = {309--326}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.005}, doi = {10.1016/J.COMGEO.2017.06.005}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseLPV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseR18, author = {Prosenjit Bose and Pedro Ramos}, title = {Editorial: Special issue in memory of Dr. Ferran Hurtado}, journal = {Comput. Geom.}, volume = {68}, pages = {1}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.001}, doi = {10.1016/J.COMGEO.2017.10.001}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseR18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Brandenburg18, author = {Franz J. Brandenburg}, title = {T-shape visibility representations of 1-planar graphs}, journal = {Comput. Geom.}, volume = {69}, pages = {16--30}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.007}, doi = {10.1016/J.COMGEO.2017.10.007}, timestamp = {Wed, 20 Dec 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Brenner18, author = {Ulrich Brenner}, title = {\emph{{\(\gamma\)}}-Soft packings of rectangles}, journal = {Comput. Geom.}, volume = {70-71}, pages = {49--64}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.005}, doi = {10.1016/J.COMGEO.2018.01.005}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Brenner18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrodnikC18, author = {Andrej Brodnik and Sergio Cabello}, title = {Editorial: EuroCG2015}, journal = {Comput. Geom.}, volume = {73}, pages = {1}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.010}, doi = {10.1016/J.COMGEO.2018.06.010}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BrodnikC18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinOS18, author = {Kevin Buchin and Tim Ophelders and Bettina Speckmann}, title = {Computing the similarity between moving curves}, journal = {Comput. Geom.}, volume = {73}, pages = {2--14}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.01.002}, doi = {10.1016/J.COMGEO.2017.01.002}, timestamp = {Sun, 02 Jun 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinOS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloM18, author = {Sergio Cabello and Lazar Milinkovic}, title = {Two optimization problems for unit disks}, journal = {Comput. Geom.}, volume = {70-71}, pages = {1--12}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.12.001}, doi = {10.1016/J.COMGEO.2017.12.001}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloM18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CannonFILS18, author = {Sarah Cannon and Thomas G. Fai and Justin Iwerks and Undine Leopold and Christiane Schmidt}, title = {Combinatorics and complexity of guarding polygons with edge and point 2-transmitters}, journal = {Comput. Geom.}, volume = {68}, pages = {89--100}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.004}, doi = {10.1016/J.COMGEO.2017.06.004}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CannonFILS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalHKTW18, author = {Jean Cardinal and Michael Hoffmann and Vincent Kusters and Csaba D. T{\'{o}}th and Manuel Wettstein}, title = {Arc diagrams, flip distances, and Hamiltonian triangulations}, journal = {Comput. Geom.}, volume = {68}, pages = {206--225}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.001}, doi = {10.1016/J.COMGEO.2017.06.001}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalHKTW18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChambersFHMMVSW18, author = {Erin W. Chambers and S{\'{a}}ndor P. Fekete and Hella{-}Franziska Hoffmann and Dimitri Marinakis and Joseph S. B. Mitchell and Srinivasan Venkatesh and Ulrike Stege and Sue Whitesides}, title = {Connecting a set of circles with minimum sum of radii}, journal = {Comput. Geom.}, volume = {68}, pages = {62--76}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.002}, doi = {10.1016/J.COMGEO.2017.06.002}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChambersFHMMVSW18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ClaverolOGST18, author = {Merc{\`{e}} Claverol and Alfredo Garc{\'{\i}}a Olaverri and Delia Garijo and Carlos Seara and Javier Tejel}, title = {On Hamiltonian alternating cycles and paths}, journal = {Comput. Geom.}, volume = {68}, pages = {146--166}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.009}, doi = {10.1016/J.COMGEO.2017.05.009}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ClaverolOGST18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Damian18, author = {Mirela Damian}, title = {Cone-based spanners of constant degree}, journal = {Comput. Geom.}, volume = {68}, pages = {48--61}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.004}, doi = {10.1016/J.COMGEO.2017.05.004}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Damian18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DevroyeM18, author = {Luc Devroye and Pat Morin}, title = {A note on interference in random networks}, journal = {Comput. Geom.}, volume = {67}, pages = {2--10}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.006}, doi = {10.1016/J.COMGEO.2017.10.006}, timestamp = {Wed, 25 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DevroyeM18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuJ18, author = {Adrian Dumitrescu and Minghui Jiang}, title = {Minimum rectilinear Steiner tree of n points in the unit square}, journal = {Comput. Geom.}, volume = {68}, pages = {253--261}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.007}, doi = {10.1016/J.COMGEO.2017.06.007}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EdelsbrunnerH18, author = {Herbert Edelsbrunner and Mabel Iglesias Ham}, title = {Multiple covers with balls {I:} Inclusion-exclusion}, journal = {Comput. Geom.}, volume = {68}, pages = {119--133}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.014}, doi = {10.1016/J.COMGEO.2017.06.014}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerH18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EderHP18, author = {G{\"{u}}nther Eder and Martin Held and Peter Palfrader}, title = {Parallelized ear clipping for the triangulation and constrained Delaunay triangulation of polygons}, journal = {Comput. Geom.}, volume = {73}, pages = {15--23}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.004}, doi = {10.1016/J.COMGEO.2018.01.004}, timestamp = {Mon, 03 Feb 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EderHP18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvansFKKMNV18, author = {William S. Evans and Stefan Felsner and Michael Kaufmann and Stephen G. Kobourov and Debajyoti Mondal and Rahnuma Islam Nishat and Kevin Verbeek}, title = {Table cartogram}, journal = {Comput. Geom.}, volume = {68}, pages = {174--185}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.010}, doi = {10.1016/J.COMGEO.2017.06.010}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EvansFKKMNV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GyorgyiHK18, author = {P{\'{e}}ter Gy{\"{o}}rgyi and B{\'{a}}lint Hujter and S{\'{a}}ndor Kisfaludi{-}Bak}, title = {On the number of touching pairs in a set of planar curves}, journal = {Comput. Geom.}, volume = {67}, pages = {29--37}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.004}, doi = {10.1016/J.COMGEO.2017.10.004}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GyorgyiHK18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HoffmannKSVW18, author = {Frank Hoffmann and Klaus Kriegel and Subhash Suri and Kevin Verbeek and Max Willert}, title = {Tight bounds for conflict-free chromatic guarding of orthogonal art galleries}, journal = {Comput. Geom.}, volume = {73}, pages = {24--34}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.003}, doi = {10.1016/J.COMGEO.2018.01.003}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HoffmannKSVW18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HurtadoKKLSSSST18, author = {Ferran Hurtado and Matias Korman and Marc J. van Kreveld and Maarten L{\"{o}}ffler and Vera Sacrist{\'{a}}n and Akiyoshi Shioura and Rodrigo I. Silveira and Bettina Speckmann and Takeshi Tokuyama}, title = {Colored spanning graphs for set visualization}, journal = {Comput. Geom.}, volume = {68}, pages = {262--276}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.006}, doi = {10.1016/J.COMGEO.2017.06.006}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HurtadoKKLSSSST18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KanoK18, author = {Mikio Kano and Jan Kyncl}, title = {The hamburger theorem}, journal = {Comput. Geom.}, volume = {68}, pages = {167--173}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.012}, doi = {10.1016/J.COMGEO.2017.06.012}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KanoK18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KellerS18, author = {Chaya Keller and Yael Stein}, title = {Reconstruction of the path graph}, journal = {Comput. Geom.}, volume = {72}, pages = {1--10}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.02.002}, doi = {10.1016/J.COMGEO.2018.02.002}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KellerS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KellerS18a, author = {Chaya Keller and Shakhar Smorodinsky}, title = {On piercing numbers of families satisfying the (\emph{p}, \emph{q})\({}_{\mbox{\emph{r}}}\) property}, journal = {Comput. Geom.}, volume = {72}, pages = {11--18}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.02.001}, doi = {10.1016/J.COMGEO.2018.02.001}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KellerS18a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Klein18, author = {Rolf Klein}, title = {Reversibility properties of the fire-fighting problem in graphs}, journal = {Comput. Geom.}, volume = {67}, pages = {38--41}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.003}, doi = {10.1016/J.COMGEO.2017.10.003}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Klein18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KnauerSS18, author = {Christian Knauer and Luise Sommer and Fabian Stehn}, title = {Elastic geometric shape matching for translations under the Manhattan norm}, journal = {Comput. Geom.}, volume = {73}, pages = {57--69}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.002}, doi = {10.1016/J.COMGEO.2018.01.002}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KnauerSS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KormanLMPSV18, author = {Matias Korman and Stefan Langerman and Wolfgang Mulzer and Alexander Pilz and Maria Saumell and Birgit Vogtenhuber}, title = {The dual diameter of triangulations}, journal = {Comput. Geom.}, volume = {68}, pages = {243--252}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.008}, doi = {10.1016/J.COMGEO.2017.06.008}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KormanLMPSV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KormanLSS18, author = {Matias Korman and Maarten L{\"{o}}ffler and Rodrigo I. Silveira and Darren Strash}, title = {On the complexity of barrier resilience for fat regions and bounded ply}, journal = {Comput. Geom.}, volume = {72}, pages = {34--51}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.02.006}, doi = {10.1016/J.COMGEO.2018.02.006}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KormanLSS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KormanMRRSS18, author = {Matias Korman and Wolfgang Mulzer and Andr{\'{e}} van Renssen and Marcel Roeloffzen and Paul Seiferth and Yannik Stein}, title = {Time-space trade-offs for triangulations and Voronoi diagrams}, journal = {Comput. Geom.}, volume = {73}, pages = {35--45}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.01.001}, doi = {10.1016/J.COMGEO.2017.01.001}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KormanMRRSS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KouhestaniRS18, author = {Bahram Kouhestani and David Rappaport and Kai Salomaa}, title = {Routing in a polygonal terrain with the shortest beacon watchtower}, journal = {Comput. Geom.}, volume = {68}, pages = {34--47}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.005}, doi = {10.1016/J.COMGEO.2017.05.005}, timestamp = {Mon, 27 Nov 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KouhestaniRS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LeeY18, author = {Seunghun Lee and Kang Min Yoo}, title = {On a conjecture of Karasev}, journal = {Comput. Geom.}, volume = {75}, pages = {1--10}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.003}, doi = {10.1016/J.COMGEO.2018.06.003}, timestamp = {Sun, 22 Oct 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LeeY18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MaheshwariSS18, author = {Anil Maheshwari and J{\"{o}}rg{-}R{\"{u}}diger Sack and Christian Scheffer}, title = {Approximating the integral Fr{\'{e}}chet distance}, journal = {Comput. Geom.}, volume = {70-71}, pages = {13--30}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.001}, doi = {10.1016/J.COMGEO.2018.01.001}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MonroyOHJPSSTU18, author = {Ruy Fabila Monroy and Alfredo Garc{\'{\i}}a Olaverri and Ferran Hurtado and Rafel Jaume and Pablo P{\'{e}}rez{-}Lantero and Maria Saumell and Rodrigo I. Silveira and Javier Tejel and Jorge Urrutia}, title = {Colored ray configurations}, journal = {Comput. Geom.}, volume = {68}, pages = {292--308}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.008}, doi = {10.1016/J.COMGEO.2017.05.008}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MonroyOHJPSSTU18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OhCA18, author = {Eunjin Oh and Jean{-}Lou De Carufel and Hee{-}Kap Ahn}, title = {The geodesic 2-center problem in a simple polygon}, journal = {Comput. Geom.}, volume = {74}, pages = {21--37}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.02.008}, doi = {10.1016/J.COMGEO.2018.02.008}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/OhCA18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PachSTT18, author = {J{\'{a}}nos Pach and L{\'{a}}szl{\'{o}} A. Sz{\'{e}}kely and Csaba D. T{\'{o}}th and G{\'{e}}za T{\'{o}}th}, title = {Note on k-planar crossing numbers}, journal = {Comput. Geom.}, volume = {68}, pages = {2--6}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.06.015}, doi = {10.1016/J.COMGEO.2017.06.015}, timestamp = {Mon, 20 May 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/PachSTT18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RamaswamiS18, author = {Suneeta Ramaswami and Marcelo Siqueira}, title = {A fast algorithm for computing irreducible triangulations of closed surfaces in {\(\mathbb{E}\)}\({}^{\mbox{d}}\)}, journal = {Comput. Geom.}, volume = {68}, pages = {327--357}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.05.007}, doi = {10.1016/J.COMGEO.2017.05.007}, timestamp = {Tue, 21 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RamaswamiS18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Sack18, author = {J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {Editor's note}, journal = {Comput. Geom.}, volume = {69}, pages = {1}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.11.002}, doi = {10.1016/J.COMGEO.2017.11.002}, timestamp = {Wed, 20 Dec 2017 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Sack18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SharirSVZ18, author = {Micha Sharir and Shakhar Smorodinsky and Claudiu Valculescu and Frank de Zeeuw}, title = {Distinct distances between points and lines}, journal = {Comput. Geom.}, volume = {69}, pages = {2--15}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.008}, doi = {10.1016/J.COMGEO.2017.10.008}, timestamp = {Sat, 19 Oct 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SharirSVZ18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SpeckmannV18, author = {Bettina Speckmann and Kevin Verbeek}, title = {Homotopic {\unicode{119966}}-oriented routing with few links and thick edges}, journal = {Comput. Geom.}, volume = {67}, pages = {11--28}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.10.005}, doi = {10.1016/J.COMGEO.2017.10.005}, timestamp = {Sun, 02 Jun 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SpeckmannV18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SultanaHRMH18, author = {Shaheena Sultana and Md. Iqbal Hossain and Md. Saidur Rahman and Nazmun Nessa Moon and Tahsina Hashem}, title = {On triangle cover contact graphs}, journal = {Comput. Geom.}, volume = {69}, pages = {31--38}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2017.11.001}, doi = {10.1016/J.COMGEO.2017.11.001}, timestamp = {Tue, 12 Mar 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SultanaHRMH18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Wang18, author = {Haitao Wang}, title = {An improved algorithm for diameter-optimally augmenting paths in a metric space}, journal = {Comput. Geom.}, volume = {75}, pages = {11--21}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.004}, doi = {10.1016/J.COMGEO.2018.06.004}, timestamp = {Sun, 18 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Wang18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/XueLJ18, author = {Jie Xue and Yuan Li and Ravi Janardan}, title = {On the separability of stochastic geometric objects, with applications}, journal = {Comput. Geom.}, volume = {74}, pages = {1--20}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.06.001}, doi = {10.1016/J.COMGEO.2018.06.001}, timestamp = {Fri, 27 Nov 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/XueLJ18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZangenehO18, author = {Reza Zangeneh and Carl Ollivier{-}Gooch}, title = {Thread-parallel mesh improvement using face and edge swapping and vertex insertion}, journal = {Comput. Geom.}, volume = {70-71}, pages = {31--48}, year = {2018}, url = {https://doi.org/10.1016/j.comgeo.2018.01.006}, doi = {10.1016/J.COMGEO.2018.01.006}, timestamp = {Mon, 29 Oct 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZangenehO18.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkiyamaM17, author = {Jin Akiyama and Kiyoko Matsunaga}, title = {Reversibility and foldability of Conway tiles}, journal = {Comput. Geom.}, volume = {64}, pages = {30--45}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.03.003}, doi = {10.1016/J.COMGEO.2017.03.003}, timestamp = {Wed, 17 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaM17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlamKM17, author = {Md. Jawaherul Alam and Stephen G. Kobourov and Debajyoti Mondal}, title = {Orthogonal layout with optimal face complexity}, journal = {Comput. Geom.}, volume = {63}, pages = {40--52}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.02.005}, doi = {10.1016/J.COMGEO.2017.02.005}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AlamKM17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AnshuGSV17, author = {Anurag Anshu and Rahul Gangopadhyay and Saswata Shannigrahi and Satyanarayana Vusirikala}, title = {On the rectilinear crossing number of complete uniform hypergraphs}, journal = {Comput. Geom.}, volume = {61}, pages = {38--47}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.11.001}, doi = {10.1016/J.COMGEO.2016.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AnshuGSV17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanikBDM17, author = {Aritra Banik and Bhaswar B. Bhattacharya and Sandip Das and Satyaki Mukherjee}, title = {The discrete Voronoi game in R\({}^{\mbox{2}}\)}, journal = {Comput. Geom.}, volume = {63}, pages = {53--62}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.02.003}, doi = {10.1016/J.COMGEO.2017.02.003}, timestamp = {Sat, 14 Oct 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BanikBDM17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarbaDMH17, author = {Luis Barba and Frank Duque and Ruy Fabila Monroy and Carlos Hidalgo{-}Toscano}, title = {Drawing the Horton set in an integer grid of minimum size}, journal = {Comput. Geom.}, volume = {63}, pages = {10--19}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.02.002}, doi = {10.1016/J.COMGEO.2017.02.002}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BarbaDMH17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BennettY17, author = {Huck Bennett and Chee Yap}, title = {Amortized analysis of smooth quadtrees in all dimensions}, journal = {Comput. Geom.}, volume = {63}, pages = {20--39}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.02.001}, doi = {10.1016/J.COMGEO.2017.02.001}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BennettY17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazLMS17, author = {Ahmad Biniaz and Paul Liu and Anil Maheshwari and Michiel H. M. Smid}, title = {Approximation algorithms for the unit disk cover problem in 2D and 3D}, journal = {Comput. Geom.}, volume = {60}, pages = {8--18}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.04.002}, doi = {10.1016/J.COMGEO.2016.04.002}, timestamp = {Tue, 19 Dec 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazLMS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMNS17, author = {Ahmad Biniaz and Anil Maheshwari and Subhas C. Nandy and Michiel H. M. Smid}, title = {An optimal algorithm for plane matchings in multipartite geometric graphs}, journal = {Comput. Geom.}, volume = {63}, pages = {1--9}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.02.004}, doi = {10.1016/J.COMGEO.2017.02.004}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMNS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoissonnatDGO17, author = {Jean{-}Daniel Boissonnat and Ramsay Dyer and Arijit Ghosh and Steve Y. Oudot}, title = {Only distances are required to reconstruct submanifolds}, journal = {Comput. Geom.}, volume = {66}, pages = {32--67}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.08.001}, doi = {10.1016/J.COMGEO.2017.08.001}, timestamp = {Tue, 26 Sep 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatDGO17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseV17, author = {Prosenjit Bose and Sander Verdonschot}, title = {Flips in edge-labelled pseudo-triangulations}, journal = {Comput. Geom.}, volume = {60}, pages = {45--54}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.08.001}, doi = {10.1016/J.COMGEO.2016.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseV17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanR17, author = {Timothy M. Chan and Zahed Rahmati}, title = {Approximating the minimum closest pair distance and nearest neighbor distances of linearly moving points}, journal = {Comput. Geom.}, volume = {60}, pages = {2--7}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.04.001}, doi = {10.1016/J.COMGEO.2016.04.001}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChanR17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanS17, author = {Timothy M. Chan and Dimitrios Skrepetos}, title = {Dynamic data structures for approximate Hausdorff distance in the word {RAM}}, journal = {Comput. Geom.}, volume = {60}, pages = {37--44}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.08.002}, doi = {10.1016/J.COMGEO.2016.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChangY17, author = {Yi{-}Jun Chang and Hsu{-}Chun Yen}, title = {On orthogonally convex drawings of plane graphs}, journal = {Comput. Geom.}, volume = {62}, pages = {34--51}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.01.003}, doi = {10.1016/J.COMGEO.2017.01.003}, timestamp = {Mon, 16 Sep 2019 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChangY17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DamianN17, author = {Mirela Damian and Naresh Nelavalli}, title = {Improved bounds on the stretch factor of Y\({}_{\mbox{4}}\)}, journal = {Comput. Geom.}, volume = {62}, pages = {14--24}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.12.001}, doi = {10.1016/J.COMGEO.2016.12.001}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DamianN17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DuqueMHP17, author = {Frank Duque and Ruy Fabila Monroy and Carlos Hidalgo{-}Toscano and Pablo P{\'{e}}rez{-}Lantero}, title = {Drawing the almost convex set in an integer grid of minimum size}, journal = {Comput. Geom.}, volume = {65}, pages = {1--11}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.04.002}, doi = {10.1016/J.COMGEO.2017.04.002}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DuqueMHP17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherFFMM17, author = {Stephane Durocher and Omrit Filtser and Robert Fraser and Ali D. Mehrabi and Saeed Mehrabi}, title = {Guarding orthogonal art galleries with sliding cameras}, journal = {Comput. Geom.}, volume = {65}, pages = {12--26}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.04.001}, doi = {10.1016/J.COMGEO.2017.04.001}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherFFMM17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Fulek17, author = {Radoslav Fulek}, title = {C-planarity of embedded cyclic c-graphs}, journal = {Comput. Geom.}, volume = {66}, pages = {1--13}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.06.016}, doi = {10.1016/J.COMGEO.2017.06.016}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Fulek17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FulekMNSSS17, author = {Radoslav Fulek and Hossein Nassajian Mojarrad and M{\'{a}}rton Nasz{\'{o}}di and J{\'{o}}zsef Solymosi and Sebastian U. Stich and May Szedl{\'{a}}k}, title = {On the existence of ordinary triangles}, journal = {Comput. Geom.}, volume = {66}, pages = {28--31}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.07.002}, doi = {10.1016/J.COMGEO.2017.07.002}, timestamp = {Fri, 30 Nov 2018 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FulekMNSSS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HatamiZ17, author = {Behnam Hatami and Hamid Zarrabi{-}Zadeh}, title = {A streaming algorithm for 2-center with outliers in high dimensions}, journal = {Comput. Geom.}, volume = {60}, pages = {26--36}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.07.002}, doi = {10.1016/J.COMGEO.2016.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HatamiZ17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeldK17, author = {Stephan Held and Nicolas K{\"{a}}mmerling}, title = {Two-level rectilinear Steiner trees}, journal = {Comput. Geom.}, volume = {61}, pages = {48--59}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.11.002}, doi = {10.1016/J.COMGEO.2016.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HeldK17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HolmsenKV17, author = {Andreas F. Holmsen and Jan Kyncl and Claudiu Valculescu}, title = {Near equipartitions of colored point sets}, journal = {Comput. Geom.}, volume = {65}, pages = {35--42}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.05.001}, doi = {10.1016/J.COMGEO.2017.05.001}, timestamp = {Sat, 16 Sep 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HolmsenKV17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KeilMPV17, author = {J. Mark Keil and Joseph S. B. Mitchell and Dinabandhu Pradhan and Martin Vatshelle}, title = {An algorithm for the maximum weight independent set problem on outerstring graphs}, journal = {Comput. Geom.}, volume = {60}, pages = {19--25}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.05.001}, doi = {10.1016/J.COMGEO.2016.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KeilMPV17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LubiwSV17, author = {Anna Lubiw and Jack Snoeyink and Hamideh Vosoughpour}, title = {Visibility graphs, dismantlability, and the cops and robbers game}, journal = {Comput. Geom.}, volume = {66}, pages = {14--27}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.07.001}, doi = {10.1016/J.COMGEO.2017.07.001}, timestamp = {Tue, 26 Sep 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LubiwSV17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OrickSC17, author = {Gerald L. Orick and Kenneth Stephenson and Charles R. Collins}, title = {A linearized circle packing algorithm}, journal = {Comput. Geom.}, volume = {64}, pages = {13--29}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.03.002}, doi = {10.1016/J.COMGEO.2017.03.002}, timestamp = {Wed, 17 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/OrickSC17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Rappaport17, author = {David Rappaport}, title = {Guest Editor's foreword}, journal = {Comput. Geom.}, volume = {60}, pages = {1}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.08.005}, doi = {10.1016/J.COMGEO.2016.08.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Rappaport17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RathodMN17, author = {Abhishek Rathod and Talha Bin Masood and Vijay Natarajan}, title = {Approximation algorithms for Max Morse Matching}, journal = {Comput. Geom.}, volume = {61}, pages = {1--23}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.10.002}, doi = {10.1016/J.COMGEO.2016.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RathodMN17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RazSS17, author = {Orit E. Raz and Micha Sharir and Ilya D. Shkredov}, title = {On the number of unit-area triangles spanned by convex grids in the plane}, journal = {Comput. Geom.}, volume = {62}, pages = {25--33}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.12.002}, doi = {10.1016/J.COMGEO.2016.12.002}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/RazSS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ruiz-Vargas17, author = {Andres J. Ruiz{-}Vargas}, title = {Many disjoint edges in topological graphs}, journal = {Comput. Geom.}, volume = {62}, pages = {1--13}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.11.003}, doi = {10.1016/J.COMGEO.2016.11.003}, timestamp = {Sat, 20 May 2017 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Ruiz-Vargas17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SavicS17, author = {Marko Savic and Milos Stojakovic}, title = {Faster bottleneck non-crossing matchings of points in convex position}, journal = {Comput. Geom.}, volume = {65}, pages = {27--34}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.05.002}, doi = {10.1016/J.COMGEO.2017.05.002}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SavicS17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SheikhiMBM17, author = {Farnaz Sheikhi and Ali Mohades and Mark de Berg and Ali D. Mehrabi}, title = {Separability of imprecise points}, journal = {Comput. Geom.}, volume = {61}, pages = {24--37}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2016.10.001}, doi = {10.1016/J.COMGEO.2016.10.001}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SheikhiMBM17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/XuHSU17, author = {Dawei Xu and Takashi Horiyama and Toshihiro Shirakawa and Ryuhei Uehara}, title = {Common developments of three incongruent boxes of area 30}, journal = {Comput. Geom.}, volume = {64}, pages = {1--12}, year = {2017}, url = {https://doi.org/10.1016/j.comgeo.2017.03.001}, doi = {10.1016/J.COMGEO.2017.03.001}, timestamp = {Tue, 29 Dec 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/XuHSU17.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AdamaszekS16, author = {Michal Adamaszek and Juraj Stacho}, title = {Complexity of simplicial homology and independence complexes of chordal graphs}, journal = {Comput. Geom.}, volume = {57}, pages = {8--18}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.05.003}, doi = {10.1016/J.COMGEO.2016.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AdamaszekS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovBERS16, author = {Boris Aronov and Mark de Berg and David Eppstein and Marcel Roeloffzen and Bettina Speckmann}, title = {Distance-sensitive planar point location}, journal = {Comput. Geom.}, volume = {54}, pages = {17--31}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.02.001}, doi = {10.1016/J.COMGEO.2016.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovBERS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bae16, author = {Sang Won Bae}, title = {An almost optimal algorithm for Voronoi diagrams of non-disjoint line segments}, journal = {Comput. Geom.}, volume = {52}, pages = {34--43}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.11.002}, doi = {10.1016/J.COMGEO.2015.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bae16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanikCMS16, author = {Aritra Banik and Jean{-}Lou De Carufel and Anil Maheshwari and Michiel H. M. Smid}, title = {Discrete Voronoi games and {\unicode{1013}}-nets, in two and three dimensions}, journal = {Comput. Geom.}, volume = {55}, pages = {41--58}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.02.002}, doi = {10.1016/J.COMGEO.2016.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BanikCMS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregHKPT16, author = {Sergey Bereg and Seok{-}Hee Hong and Naoki Katoh and Sheung{-}Hung Poon and Shin{-}ichi Tanigawa}, title = {On the edge crossing properties of Euclidean minimum weight Laman graphs}, journal = {Comput. Geom.}, volume = {51}, pages = {15--24}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.002}, doi = {10.1016/J.COMGEO.2015.10.002}, timestamp = {Thu, 27 Apr 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BeregHKPT16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazBMS16, author = {Ahmad Biniaz and Prosenjit Bose and Anil Maheshwari and Michiel H. M. Smid}, title = {Plane geodesic spanning trees, Hamiltonian cycles, and perfect matchings in a simple polygon}, journal = {Comput. Geom.}, volume = {57}, pages = {27--39}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.05.004}, doi = {10.1016/J.COMGEO.2016.05.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazBMS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BlasiusLR16, author = {Thomas Bl{\"{a}}sius and Sebastian Lehmann and Ignaz Rutter}, title = {Orthogonal graph drawing with inflexible edges}, journal = {Comput. Geom.}, volume = {55}, pages = {26--40}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.03.001}, doi = {10.1016/J.COMGEO.2016.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BlasiusLR16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BohlerLPZ16, author = {Cecilia Bohler and Chih{-}Hung Liu and Evanthia Papadopoulou and Maksym Zavershynskyi}, title = {A randomized divide and conquer algorithm for higher-order abstract Voronoi diagrams}, journal = {Comput. Geom.}, volume = {59}, pages = {26--38}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.08.004}, doi = {10.1016/J.COMGEO.2016.08.004}, timestamp = {Tue, 14 Sep 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BohlerLPZ16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCSS16, author = {Prosenjit Bose and Jean{-}Lou De Carufel and Alina Shaikhet and Michiel H. M. Smid}, title = {Probing convex polygons with a wedge}, journal = {Comput. Geom.}, volume = {58}, pages = {34--59}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.06.001}, doi = {10.1016/J.COMGEO.2016.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchetCOS16, author = {Micka{\"{e}}l Buchet and Fr{\'{e}}d{\'{e}}ric Chazal and Steve Y. Oudot and Donald R. Sheehy}, title = {Efficient and robust persistent homology for measures}, journal = {Comput. Geom.}, volume = {58}, pages = {70--96}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.07.001}, doi = {10.1016/J.COMGEO.2016.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchetCOS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BusGMR16, author = {Norbert Bus and Shashwat Garg and Nabil H. Mustafa and Saurabh Ray}, title = {Tighter estimates for {\unicode{1013}}-nets for disks}, journal = {Comput. Geom.}, volume = {53}, pages = {27--35}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.12.002}, doi = {10.1016/J.COMGEO.2015.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BusGMR16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloCKS16, author = {Sergio Cabello and Otfried Cheong and Christian Knauer and Lena Schlipf}, title = {Finding largest rectangles in convex polygons}, journal = {Comput. Geom.}, volume = {51}, pages = {67--74}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.08.001}, doi = {10.1016/J.COMGEO.2015.08.001}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloCKS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Capitelli16, author = {Nicolas Ariel Capitelli}, title = {The non-pure version of the simplex and the boundary of the simplex}, journal = {Comput. Geom.}, volume = {57}, pages = {19--26}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.05.002}, doi = {10.1016/J.COMGEO.2016.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Capitelli16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChattopadhyayCD16, author = {Amit Chattopadhyay and Hamish A. Carr and David J. Duke and Zhao Geng and Osamu Saeki}, title = {Multivariate topology simplification}, journal = {Comput. Geom.}, volume = {58}, pages = {1--24}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.05.006}, doi = {10.1016/J.COMGEO.2016.05.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChattopadhyayCD16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChavezCL16, author = {Edgar Ch{\'{a}}vez and Ana C. Ch{\'{a}}vez{-}C{\'{a}}liz and Jorge L. L{\'{o}}pez{-}L{\'{o}}pez}, title = {Affine invariants of generalized polygons and matching under affine transformations}, journal = {Comput. Geom.}, volume = {58}, pages = {60--69}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.06.003}, doi = {10.1016/J.COMGEO.2016.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChavezCL16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DaiKL16, author = {Bang{-}Sin Dai and Mong{-}Jen Kao and D. T. Lee}, title = {Optimal time-convex hull for a straight-line highway in L\({}_{\mbox{p}}\)-metrics}, journal = {Comput. Geom.}, volume = {53}, pages = {1--20}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.007}, doi = {10.1016/J.COMGEO.2015.10.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DaiKL16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Diaz-BanezHPSUV16, author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Marco A. Heredia and Canek Pel{\'{a}}ez and Joan Antoni Sellar{\`{e}}s and Jorge Urrutia and Inmaculada Ventura}, title = {Convex blocking and partial orders on the plane}, journal = {Comput. Geom.}, volume = {51}, pages = {55--66}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.08.003}, doi = {10.1016/J.COMGEO.2015.08.003}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezHPSUV16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DobrevHMMPNOS16, author = {Stefan Dobrev and Mohsen Eftekhari Hesari and Fraser MacQuarie and J{\'{a}}n Manuch and Oscar Morales{-}Ponce and Lata Narayanan and Jaroslav Opatrny and Ladislav Stacho}, title = {Connectivity with directional antennas in the symmetric communication model}, journal = {Comput. Geom.}, volume = {55}, pages = {1--25}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.03.002}, doi = {10.1016/J.COMGEO.2016.03.002}, timestamp = {Mon, 03 May 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DobrevHMMPNOS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherGM16, author = {Stephane Durocher and Ellen Gethner and Debajyoti Mondal}, title = {Thickness and colorability of geometric graphs}, journal = {Comput. Geom.}, volume = {56}, pages = {1--18}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.03.003}, doi = {10.1016/J.COMGEO.2016.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherGM16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvansLMW16, author = {William S. Evans and Giuseppe Liotta and Henk Meijer and Stephen K. Wismath}, title = {Alternating paths and cycles of minimum length}, journal = {Comput. Geom.}, volume = {58}, pages = {124--135}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.07.005}, doi = {10.1016/J.COMGEO.2016.07.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EvansLMW16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvrendilekGH16, author = {Cem Evrendilek and Burkay Gen{\c{c}} and Brahim Hnich}, title = {Covering points with minimum/maximum area orthogonally convex polygons}, journal = {Comput. Geom.}, volume = {54}, pages = {32--44}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.02.003}, doi = {10.1016/J.COMGEO.2016.02.003}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EvrendilekGH16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FarshiP16, author = {Mohammad Farshi and Abolfazl Poureidi}, title = {A lower bound for computing geometric spanners}, journal = {Comput. Geom.}, volume = {53}, pages = {21--26}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.12.004}, doi = {10.1016/J.COMGEO.2015.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FarshiP16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FisikopoulosP16, author = {Vissarion Fisikopoulos and Luis Mariano Pe{\~{n}}aranda}, title = {Faster geometric algorithms via dynamic determinant computation}, journal = {Comput. Geom.}, volume = {54}, pages = {1--16}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.12.001}, doi = {10.1016/J.COMGEO.2015.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FisikopoulosP16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Garcia-MarcoK16, author = {Ignacio Garc{\'{\i}}a{-}Marco and Kolja Knauer}, title = {Drawing graphs with vertices and edges in convex position}, journal = {Comput. Geom.}, volume = {58}, pages = {25--33}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.06.002}, doi = {10.1016/J.COMGEO.2016.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Garcia-MarcoK16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GyoriM16, author = {Ervin Gy{\"{o}}ri and Tam{\'{a}}s R{\'{o}}bert Mezei}, title = {Partitioning orthogonal polygons into {\(\leq\)} 8-vertex pieces, with application to an art gallery theorem}, journal = {Comput. Geom.}, volume = {59}, pages = {13--25}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.07.003}, doi = {10.1016/J.COMGEO.2016.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GyoriM16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HaCGY16, author = {Jae{-}Soon Ha and Otfried Cheong and Xavier Goaoc and Jungwoo Yang}, title = {Geometric permutations of non-overlapping unit balls revisited}, journal = {Comput. Geom.}, volume = {53}, pages = {36--50}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.12.003}, doi = {10.1016/J.COMGEO.2015.12.003}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HaCGY16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HemmerKH16, author = {Michael Hemmer and Michal Kleinbort and Dan Halperin}, title = {Optimal randomized incremental construction for guaranteed logarithmic planar point location}, journal = {Comput. Geom.}, volume = {58}, pages = {110--123}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.07.006}, doi = {10.1016/J.COMGEO.2016.07.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HemmerKH16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HenzeJ16, author = {Matthias Henze and Rafel Jaume}, title = {Bottleneck partial-matching Voronoi diagrams and applications}, journal = {Comput. Geom.}, volume = {51}, pages = {40--54}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.001}, doi = {10.1016/J.COMGEO.2015.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HenzeJ16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/IgamberdievS16, author = {Alexander Igamberdiev and Andr{\'{e}} Schulz}, title = {A duality transform for constructing small grid embeddings of 3d polytopes}, journal = {Comput. Geom.}, volume = {56}, pages = {19--36}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.03.004}, doi = {10.1016/J.COMGEO.2016.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/IgamberdievS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ItoNOOUUU16, author = {Takehiro Ito and Shin{-}Ichi Nakano and Yoshio Okamoto and Yota Otachi and Ryuhei Uehara and Takeaki Uno and Yushi Uno}, title = {A polynomial-time approximation scheme for the geometric unique coverage problem on unit squares}, journal = {Comput. Geom.}, volume = {51}, pages = {25--39}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.004}, doi = {10.1016/J.COMGEO.2015.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ItoNOOUUU16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KamousiLMW16, author = {Pegah Kamousi and Sylvain Lazard and Anil Maheshwari and Stefanie Wuhrer}, title = {Analysis of farthest point sampling for approximating geodesics in a graph}, journal = {Comput. Geom.}, volume = {57}, pages = {1--7}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.05.005}, doi = {10.1016/J.COMGEO.2016.05.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KamousiLMW16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ParkBAA16, author = {Dongwoo Park and Sang Won Bae and Helmut Alt and Hee{-}Kap Ahn}, title = {Bundling three convex polygons to minimize area or perimeter}, journal = {Comput. Geom.}, volume = {51}, pages = {1--14}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.003}, doi = {10.1016/J.COMGEO.2015.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ParkBAA16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PupyrevNBH16, author = {Sergey Pupyrev and Lev Nachmanson and Sergey Bereg and Alexander E. Holroyd}, title = {Edge routing with ordered bundles}, journal = {Comput. Geom.}, volume = {52}, pages = {18--33}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.005}, doi = {10.1016/J.COMGEO.2015.10.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PupyrevNBH16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/TokekarI16, author = {Pratap Tokekar and Volkan Isler}, title = {Polygon guarding with orientation}, journal = {Comput. Geom.}, volume = {58}, pages = {97--109}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.07.004}, doi = {10.1016/J.COMGEO.2016.07.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/TokekarI16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/VerbeekS16, author = {Kevin Verbeek and Subhash Suri}, title = {Metric embedding, hyperbolic space, and social networks}, journal = {Comput. Geom.}, volume = {59}, pages = {1--12}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2016.08.003}, doi = {10.1016/J.COMGEO.2016.08.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/VerbeekS16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/YankelevskyB16, author = {Yael Yankelevsky and Alfred M. Bruckstein}, title = {On optimal disc covers and a new characterization of the Steiner center}, journal = {Comput. Geom.}, volume = {52}, pages = {1--8}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.006}, doi = {10.1016/J.COMGEO.2015.10.006}, timestamp = {Sat, 09 Apr 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/YankelevskyB16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZhangK16, author = {Huaming Zhang and Xiang{-}Zhi Kong}, title = {On k-greedy routing algorithms}, journal = {Comput. Geom.}, volume = {52}, pages = {9--17}, year = {2016}, url = {https://doi.org/10.1016/j.comgeo.2015.10.008}, doi = {10.1016/J.COMGEO.2015.10.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZhangK16.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Abu-AffashBCMS15, author = {A. Karim Abu{-}Affash and Ahmad Biniaz and Paz Carmi and Anil Maheshwari and Michiel H. M. Smid}, title = {Approximating the bottleneck plane perfect matching of a point set}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {718--731}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.005}, doi = {10.1016/J.COMGEO.2015.06.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashBCMS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerBBBKR15, author = {Oswin Aichholzer and Sang Won Bae and Luis Barba and Prosenjit Bose and Matias Korman and Andr{\'{e}} van Renssen and Perouz Taslakian and Sander Verdonschot}, title = {Reprint of: Theta-3 is connected}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {407--414}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.01.002}, doi = {10.1016/J.COMGEO.2015.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKR15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMGHHH15, author = {Oswin Aichholzer and Ruy Fabila Monroy and Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and Thomas Hackl and Marco A. Heredia and Clemens Huemer and Jorge Urrutia and Pavel Valtr and Birgit Vogtenhuber}, title = {On k-gons and k-holes in point sets}, journal = {Comput. Geom.}, volume = {48}, number = {7}, pages = {528--537}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.007}, doi = {10.1016/J.COMGEO.2014.12.007}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHH15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlonF15, author = {Noga Alon and Ohad N. Feldheim}, title = {Drawing outerplanar graphs using three edge lengths}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {260--267}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.006}, doi = {10.1016/J.COMGEO.2014.10.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlonF15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisBLS15, author = {Greg Aloupis and Luis Barba and Stefan Langerman and Diane L. Souvaine}, title = {Bichromatic compatible matchings}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {622--633}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.009}, doi = {10.1016/J.COMGEO.2014.08.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisBLS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlvarezBRS15, author = {Victor Alvarez and Karl Bringmann and Saurabh Ray and Raimund Seidel}, title = {Counting triangulations and other crossing-free structures approximately}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {386--397}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.006}, doi = {10.1016/J.COMGEO.2014.12.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlvarezBRS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AngeliniBLDGMPT15, author = {Patrizio Angelini and Carla Binucci and Giordano Da Lozzo and Walter Didimo and Luca Grilli and Fabrizio Montecchiani and Maurizio Patrignani and Ioannis G. Tollis}, title = {Algorithms and bounds for drawing non-planar graphs with crossing-free subgraphs}, journal = {Comput. Geom.}, volume = {50}, pages = {34--48}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.07.002}, doi = {10.1016/J.COMGEO.2015.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AngeliniBLDGMPT15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AngeliniLBFPR15, author = {Patrizio Angelini and Giordano Da Lozzo and Giuseppe Di Battista and Fabrizio Frati and Maurizio Patrignani and Vincenzo Roselli}, title = {Relaxing the constraints of clustered planarity}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {42--75}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.001}, doi = {10.1016/J.COMGEO.2014.08.001}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AngeliniLBFPR15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinAMM15, author = {Esther M. Arkin and Antonio Fern{\'{a}}ndez Anta and Joseph S. B. Mitchell and Miguel A. Mosteiro}, title = {Probabilistic bounds on the length of a longest edge in Delaunay graphs of random points in d-dimensions}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {134--146}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.008}, doi = {10.1016/J.COMGEO.2014.08.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinAMM15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinDHKMPPSS15, author = {Esther M. Arkin and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Ferran Hurtado and Piyush Kumar and Joseph S. B. Mitchell and Bel{\'{e}}n Palop and Pablo P{\'{e}}rez{-}Lantero and Maria Saumell and Rodrigo I. Silveira}, title = {Bichromatic 2-center of pairs of points}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {94--107}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.004}, doi = {10.1016/J.COMGEO.2014.08.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinDHKMPPSS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AttaliBDGL15, author = {Dominique Attali and Ulrich Bauer and Olivier Devillers and Marc Glisse and Andr{\'{e}} Lieutier}, title = {Homological reconstruction and simplification in R\({}^{\mbox{3}}\)}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {606--621}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.010}, doi = {10.1016/J.COMGEO.2014.08.010}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AttaliBDGL15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeKOW15, author = {Sang Won Bae and Matias Korman and Yoshio Okamoto and Haitao Wang}, title = {Computing the {L1} geodesic diameter and center of a simple polygon in linear time}, journal = {Comput. Geom.}, volume = {48}, number = {6}, pages = {495--505}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.02.005}, doi = {10.1016/J.COMGEO.2015.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaeKOW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyFMMOP15, author = {Imre B{\'{a}}r{\'{a}}ny and Ferenc Fodor and {\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and Luis Montejano and Deborah Oliveros and Attila P{\'{o}}r}, title = {A fractional Helly theorem for boxes}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {221--224}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.007}, doi = {10.1016/J.COMGEO.2014.09.007}, timestamp = {Fri, 29 Jul 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregDMPRSUV15, author = {Sergey Bereg and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Ruy Fabila Monroy and Pablo P{\'{e}}rez{-}Lantero and Adriana Ram{\'{\i}}rez{-}Vigueras and Toshinori Sakai and Jorge Urrutia and Inmaculada Ventura}, title = {On balanced 4-holes in bichromatic point sets}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {169--179}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.004}, doi = {10.1016/J.COMGEO.2014.09.004}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BeregDMPRSUV15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhatiaWNPB15, author = {Harsh Bhatia and Bei Wang and Gregory Norgard and Valerio Pascucci and Peer{-}Timo Bremer}, title = {Local, smooth, and consistent Jacobi set simplification}, journal = {Comput. Geom.}, volume = {48}, number = {4}, pages = {311--332}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.009}, doi = {10.1016/J.COMGEO.2014.10.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BhatiaWNPB15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlHHKP15, author = {Therese Biedl and Martin Held and Stefan Huber and Dominik Kaaser and Peter Palfrader}, title = {Weighted straight skeletons in the plane}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {120--133}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.006}, doi = {10.1016/J.COMGEO.2014.08.006}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlHHKP15a, author = {Therese Biedl and Martin Held and Stefan Huber and Dominik Kaaser and Peter Palfrader}, title = {Reprint of: Weighted straight skeletons in the plane}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {429--442}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.01.004}, doi = {10.1016/J.COMGEO.2015.01.004}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMS15, author = {Ahmad Biniaz and Anil Maheshwari and Michiel H. M. Smid}, title = {On full Steiner trees in unit disk graphs}, journal = {Comput. Geom.}, volume = {48}, number = {6}, pages = {453--458}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.02.004}, doi = {10.1016/J.COMGEO.2015.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMS15a, author = {Ahmad Biniaz and Anil Maheshwari and Michiel H. M. Smid}, title = {Higher-order triangular-distance Delaunay graphs: Graph-theoretical properties}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {646--660}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.07.003}, doi = {10.1016/J.COMGEO.2015.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS15a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BlasiusR15, author = {Thomas Bl{\"{a}}sius and Ignaz Rutter}, title = {Disconnectivity and relative positions in simultaneous embeddings}, journal = {Comput. Geom.}, volume = {48}, number = {6}, pages = {459--478}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.02.002}, doi = {10.1016/J.COMGEO.2015.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BlasiusR15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BohlerCKLPZ15, author = {Cecilia Bohler and Panagiotis Cheilaris and Rolf Klein and Chih{-}Hung Liu and Evanthia Papadopoulou and Maksym Zavershynskyi}, title = {On the complexity of higher order abstract Voronoi diagrams}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {539--551}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.008}, doi = {10.1016/J.COMGEO.2015.04.008}, timestamp = {Tue, 14 Sep 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BohlerCKLPZ15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BonichonGHP15, author = {Nicolas Bonichon and Cyril Gavoille and Nicolas Hanusse and Ljubomir Perkovic}, title = {Tight stretch factors for L\({}_{\mbox{1}}\)- and L\({}_{\mbox{{\(\infty\)}}}\)-Delaunay triangulations}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {237--250}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.005}, doi = {10.1016/J.COMGEO.2014.10.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BonichonGHP15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BorradaileE15, author = {Glencora Borradaile and David Eppstein}, title = {Near-linear-time deterministic plane Steiner spanners for well-spaced point sets}, journal = {Comput. Geom.}, volume = {49}, pages = {8--16}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.005}, doi = {10.1016/J.COMGEO.2015.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BorradaileE15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseMRV15, author = {Prosenjit Bose and Pat Morin and Andr{\'{e}} van Renssen and Sander Verdonschot}, title = {The {\texttheta}\({}_{\mbox{5}}\)-graph is a spanner}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {108--119}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.005}, doi = {10.1016/J.COMGEO.2014.08.005}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseMRV15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BozokiLR15, author = {S{\'{a}}ndor Boz{\'{o}}ki and Tsung{-}Lin Lee and Lajos R{\'{o}}nyai}, title = {Seven mutually touching infinite cylinders}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {87--93}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.007}, doi = {10.1016/J.COMGEO.2014.08.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BozokiLR15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrassVX15, author = {Peter Brass and Ivo Vigan and Ning Xu}, title = {Shortest path planning for a tethered robot}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {732--742}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.004}, doi = {10.1016/J.COMGEO.2015.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BrassVX15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloJ15, author = {Sergio Cabello and Miha Jejcic}, title = {Shortest paths in intersection graphs of unit disks}, journal = {Comput. Geom.}, volume = {48}, number = {4}, pages = {360--367}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.003}, doi = {10.1016/J.COMGEO.2014.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloJ15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CaoET15, author = {Thanh{-}Tung Cao and Herbert Edelsbrunner and Tiow Seng Tan}, title = {Triangulations from topologically correct digital Voronoi diagrams}, journal = {Comput. Geom.}, volume = {48}, number = {7}, pages = {507--519}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.001}, doi = {10.1016/J.COMGEO.2015.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CaoET15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiFK15, author = {Paz Carmi and Eran Friedman and Matthew J. Katz}, title = {Spiderman graph: Visibility in urban regions}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {251--259}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.004}, doi = {10.1016/J.COMGEO.2014.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiFK15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanH15, author = {Timothy M. Chan and Nan Hu}, title = {Geometric red-blue set cover for unit squares and related problems}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {380--385}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.005}, doi = {10.1016/J.COMGEO.2014.12.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanH15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanK15, author = {Timothy M. Chan and Rolf Klein}, title = {Guest Editor's foreword}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {552--553}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.003}, doi = {10.1016/J.COMGEO.2014.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanK15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenM15, author = {Dan Chen and Pat Morin}, title = {Reprint of: Approximating majority depth}, journal = {Comput. Geom.}, volume = {49}, pages = {2--7}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2013.11.005}, doi = {10.1016/J.COMGEO.2013.11.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenM15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenW15, author = {Danny Z. Chen and Haitao Wang}, title = {Visibility and ray shooting queries in polygonal domains}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {31--41}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.003}, doi = {10.1016/J.COMGEO.2014.08.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenW15a, author = {Danny Ziyi Chen and Haitao Wang}, title = {Weak visibility queries of line segments in simple polygons}, journal = {Comput. Geom.}, volume = {48}, number = {6}, pages = {443--452}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.02.001}, doi = {10.1016/J.COMGEO.2015.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenW15a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CookDSW15, author = {Atlas F. Cook IV and Anne Driemel and Jessica Sherette and Carola Wenk}, title = {Computing the Fr{\'{e}}chet distance between folded polygons}, journal = {Comput. Geom.}, volume = {50}, pages = {1--16}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.08.002}, doi = {10.1016/J.COMGEO.2015.08.002}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CookDSW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CrepaldiRS15, author = {Bruno E. Crepaldi and Pedro J. de Rezende and Cid C. de Souza}, title = {Solving the natural wireless localization problem to optimality efficiently}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {370--379}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.004}, doi = {10.1016/J.COMGEO.2014.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CrepaldiRS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeyFW15, author = {Tamal K. Dey and Fengtao Fan and Yusu Wang}, title = {Graph induced complex on point data}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {575--588}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.003}, doi = {10.1016/J.COMGEO.2015.04.003}, timestamp = {Mon, 02 Jan 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DeyFW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Diaz-BanezKPPSS15, author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Matias Korman and Pablo P{\'{e}}rez{-}Lantero and Alexander Pilz and Carlos Seara and Rodrigo I. Silveira}, title = {New results on stabbing segments with a polygon}, journal = {Comput. Geom.}, volume = {48}, number = {1}, pages = {14--29}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.06.002}, doi = {10.1016/J.COMGEO.2014.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezKPPSS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuJ15, author = {Adrian Dumitrescu and Minghui Jiang}, title = {On the approximability of covering points by lines and related problems}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {703--717}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.006}, doi = {10.1016/J.COMGEO.2015.06.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FriedlerM15, author = {Sorelle A. Friedler and David M. Mount}, title = {A sensor-based framework for kinetic data compression}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {147--168}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.002}, doi = {10.1016/J.COMGEO.2014.09.002}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FriedlerM15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FunkeMMW15, author = {Stefan Funke and Theocharis Malamatos and Domagoj Matijevic and Nicola Wolpert}, title = {Conic nearest neighbor queries and approximate Voronoi diagrams}, journal = {Comput. Geom.}, volume = {48}, number = {2}, pages = {76--86}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.08.002}, doi = {10.1016/J.COMGEO.2014.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FunkeMMW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonS15, author = {Joachim Gudmundsson and Michiel H. M. Smid}, title = {Fast algorithms for approximate Fr{\'{e}}chet matching queries in geometric trees}, journal = {Comput. Geom.}, volume = {48}, number = {6}, pages = {479--494}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.02.003}, doi = {10.1016/J.COMGEO.2015.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Hosono15, author = {Kiyoshi Hosono}, title = {On the minimum number of mutually disjoint holes in planar point sets}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {661--672}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.07.001}, doi = {10.1016/J.COMGEO.2015.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Hosono15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimA15, author = {Sang{-}Sub Kim and Hee{-}Kap Ahn}, title = {An improved data stream algorithm for clustering}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {635--645}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.003}, doi = {10.1016/J.COMGEO.2015.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimA15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KleinS15, author = {Kyle Klein and Subhash Suri}, title = {Capture bounds for visibility-based pursuit evasion}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {205--220}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.002}, doi = {10.1016/J.COMGEO.2014.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KleinS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KynclPRT15, author = {Jan Kyncl and J{\'{a}}nos Pach and Rados Radoicic and G{\'{e}}za T{\'{o}}th}, title = {Saturated simple and k-simple topological graphs}, journal = {Comput. Geom.}, volume = {48}, number = {4}, pages = {295--310}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.008}, doi = {10.1016/J.COMGEO.2014.10.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KynclPRT15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Lopez-Ortiz15, author = {Alejandro L{\'{o}}pez{-}Ortiz}, title = {Guest editorial: Special issue on the 25th Canadian Conference on Computational Geometry {(CCCG)}}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {369}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.001}, doi = {10.1016/J.COMGEO.2014.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Lopez-Ortiz15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LubiwP15, author = {Anna Lubiw and Vinayak Pathak}, title = {Flip distance between two triangulations of a point set is NP-complete}, journal = {Comput. Geom.}, volume = {49}, pages = {17--23}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.11.001}, doi = {10.1016/J.COMGEO.2014.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/LubiwP15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MoricP15, author = {Filip Moric and J{\'{a}}nos Pach}, title = {Remarks on Schur's conjecture}, journal = {Comput. Geom.}, volume = {48}, number = {7}, pages = {520--527}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.007}, doi = {10.1016/J.COMGEO.2014.10.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MoricP15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PanahiS15, author = {Fatemeh Panahi and A. Frank van der Stappen}, title = {Reprint of: Bounding the locus of the center of mass for a part with shape variation}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {398--406}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.01.001}, doi = {10.1016/J.COMGEO.2015.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PanahiS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RahmatiAKWZ15, author = {Zahed Rahmati and Mohammad Ali Abam and Valerie King and Sue Whitesides and Alireza Zarei}, title = {A simple, faster method for kinetic proximity problems}, journal = {Comput. Geom.}, volume = {48}, number = {4}, pages = {342--359}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.002}, doi = {10.1016/J.COMGEO.2014.12.002}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/RahmatiAKWZ15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ras15, author = {Charl J. Ras}, title = {Survivable minimum bottleneck networks}, journal = {Comput. Geom.}, volume = {50}, pages = {17--23}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.002}, doi = {10.1016/J.COMGEO.2015.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ras15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Raz15, author = {Orit E. Raz}, title = {On the zone of the boundary of a convex body}, journal = {Comput. Geom.}, volume = {48}, number = {4}, pages = {333--341}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.12.001}, doi = {10.1016/J.COMGEO.2014.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Raz15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RusuF15, author = {Adrian Rusu and Andrew J. Fabian}, title = {A straight-line order-preserving binary tree drawing algorithm with linear area and arbitrary aspect ratio}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {268--294}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.001}, doi = {10.1016/J.COMGEO.2014.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RusuF15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SavicS15, author = {Marko Savic and Milos Stojakovic}, title = {Linear time algorithm for optimal feed-link placement}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {189--204}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.006}, doi = {10.1016/J.COMGEO.2014.09.006}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SavicS15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchmidtV15, author = {Jens M. Schmidt and Pavel Valtr}, title = {Cubic plane graphs on a given point set}, journal = {Comput. Geom.}, volume = {48}, number = {1}, pages = {1--13}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.06.001}, doi = {10.1016/J.COMGEO.2014.06.001}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchmidtV15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SharmaBVRT15, author = {Gokarna Sharma and Costas Busch and Ramachandran Vaidyanathan and Suresh Rai and Jerry L. Trahan}, title = {Efficient transformations for Klee's measure problem in the streaming model}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {688--702}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.007}, doi = {10.1016/J.COMGEO.2015.06.007}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SharmaBVRT15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SheikhiMBD15, author = {Farnaz Sheikhi and Ali Mohades and Mark de Berg and Mansoor Davoodi}, title = {Separating bichromatic point sets by L-shapes}, journal = {Comput. Geom.}, volume = {48}, number = {9}, pages = {673--687}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.008}, doi = {10.1016/J.COMGEO.2015.06.008}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/SheikhiMBD15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ShewchukB15, author = {Jonathan Richard Shewchuk and Brielin C. Brown}, title = {Fast segment insertion and incremental construction of constrained Delaunay triangulations}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {554--574}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.006}, doi = {10.1016/J.COMGEO.2015.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ShewchukB15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SukW15, author = {Andrew Suk and Bartosz Walczak}, title = {New bounds on the maximum number of edges in k-quasi-planar graphs}, journal = {Comput. Geom.}, volume = {50}, pages = {24--33}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.06.001}, doi = {10.1016/J.COMGEO.2015.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SukW15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Sukilovic15, author = {Tijana Sukilovic}, title = {Curvature based shape detection}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {180--188}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.09.005}, doi = {10.1016/J.COMGEO.2014.09.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Sukilovic15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Traub15, author = {Cynthia M. Traub}, title = {Steiner reducing sets of minimum weight triangulations: Structure and topology}, journal = {Comput. Geom.}, volume = {49}, pages = {24--36}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.004}, doi = {10.1016/J.COMGEO.2015.04.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Traub15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Viglietta15, author = {Giovanni Viglietta}, title = {Reprint of: Face-guarding polyhedra}, journal = {Comput. Geom.}, volume = {48}, number = {5}, pages = {415--428}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.01.003}, doi = {10.1016/J.COMGEO.2015.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Viglietta15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WangCY15, author = {Cong Wang and Yi{-}Jen Chiang and Chee{-}Keng Yap}, title = {On soft predicates in subdivision motion planning}, journal = {Comput. Geom.}, volume = {48}, number = {8}, pages = {589--605}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2015.04.002}, doi = {10.1016/J.COMGEO.2015.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WangCY15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Zivaljevic15, author = {Rade T. Zivaljevic}, title = {Illumination complexes, {\(\Delta\)}-zonotopes, and the polyhedral curtain theorem}, journal = {Comput. Geom.}, volume = {48}, number = {3}, pages = {225--236}, year = {2015}, url = {https://doi.org/10.1016/j.comgeo.2014.10.003}, doi = {10.1016/J.COMGEO.2014.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Zivaljevic15.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/0006X14, author = {Lei Xu and Jinhui Xu}, title = {Approximating minimum bending energy path in a simple corridor}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {349--366}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.09.001}, doi = {10.1016/J.COMGEO.2013.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/0006X14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbamDDEG14, author = {Mohammad Ali Abam and Shervin Daneshpajouh and Lasse Deleuran and Shayan Ehsani and Mohammad Ghodsi}, title = {Computing homotopic line simplification}, journal = {Comput. Geom.}, volume = {47}, number = {7}, pages = {728--739}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.02.002}, doi = {10.1016/J.COMGEO.2014.02.002}, timestamp = {Sat, 16 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AbamDDEG14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Abu-AffashCKT14, author = {A. Karim Abu{-}Affash and Paz Carmi and Matthew J. Katz and Yohai Trabelsi}, title = {Bottleneck non-crossing matching in the plane}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {447--457}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.10.005}, doi = {10.1016/J.COMGEO.2013.10.005}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashCKT14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AckermanFPS14, author = {Eyal Ackerman and Jacob Fox and J{\'{a}}nos Pach and Andrew Suk}, title = {On grids in topological graphs}, journal = {Comput. Geom.}, volume = {47}, number = {7}, pages = {710--723}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.02.003}, doi = {10.1016/J.COMGEO.2014.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AckermanFPS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnCKY14, author = {Hee{-}Kap Ahn and Siu{-}Wing Cheng and Hyuk Jun Kweon and Juyoung Yon}, title = {Overlap of convex polytopes under rigid motion}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {15--24}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.001}, doi = {10.1016/J.COMGEO.2013.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnCKY14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerAHHPRUVV14, author = {Oswin Aichholzer and Franz Aurenhammer and Thomas Hackl and Ferran Hurtado and Alexander Pilz and Pedro Ramos and Jorge Urrutia and Pavel Valtr and Birgit Vogtenhuber}, title = {On k-convex point sets}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {809--832}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.004}, doi = {10.1016/J.COMGEO.2014.04.004}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAHHPRUVV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerBBBKRTV14, author = {Oswin Aichholzer and Sang Won Bae and Luis Barba and Prosenjit Bose and Matias Korman and Andr{\'{e}} van Renssen and Perouz Taslakian and Sander Verdonschot}, title = {Theta-3 is connected}, journal = {Comput. Geom.}, volume = {47}, number = {9}, pages = {910--917}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.05.001}, doi = {10.1016/J.COMGEO.2014.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKRTV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMGHHHUV14, author = {Oswin Aichholzer and Ruy Fabila Monroy and Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and Thomas Hackl and Marco A. Heredia and Clemens Huemer and Jorge Urrutia and Birgit Vogtenhuber}, title = {4-Holes in point sets}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {644--650}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.004}, doi = {10.1016/J.COMGEO.2013.12.004}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHHUV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMHHPV14, author = {Oswin Aichholzer and Ruy Fabila Monroy and Thomas Hackl and Clemens Huemer and Alexander Pilz and Birgit Vogtenhuber}, title = {Lower bounds for the number of small convex k-holes}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {605--613}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.002}, doi = {10.1016/J.COMGEO.2013.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHHPV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMP14, author = {Oswin Aichholzer and Tillmann Miltzow and Alexander Pilz}, title = {Reprint of: Extreme point and halving edge search in abstract order types}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {518--526}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.002}, doi = {10.1016/J.COMGEO.2013.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMP14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisB14, author = {Greg Aloupis and David Bremner}, title = {Editorial}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {111}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.004}, doi = {10.1016/J.COMGEO.2013.08.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisB14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisBDGLS14, author = {Greg Aloupis and Prosenjit Bose and Vida Dujmovic and Chris Gray and Stefan Langerman and Bettina Speckmann}, title = {Triangulating and guarding realistic polygons}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {296--306}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.03.005}, doi = {10.1016/J.COMGEO.2013.03.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisBDGLS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisCCHLO14, author = {Greg Aloupis and Jean Cardinal and S{\'{e}}bastien Collette and Ferran Hurtado and Stefan Langerman and Joseph O'Rourke}, title = {Draining a polygon - or - rolling a ball out of a polygon}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {316--328}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2009.08.002}, doi = {10.1016/J.COMGEO.2009.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCHLO14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AngeliniBCFKS14, author = {Patrizio Angelini and Till Bruckdorfer and Marco Chiesa and Fabrizio Frati and Michael Kaufmann and Claudio Squarcella}, title = {On the area requirements of Euclidean minimum spanning trees}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {200--213}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.011}, doi = {10.1016/J.COMGEO.2012.10.011}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AngeliniBCFKS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinDKMPSY14, author = {Esther M. Arkin and Claudia Dieckmann and Christian Knauer and Joseph S. B. Mitchell and Valentin Polishchuk and Lena Schlipf and Shang Yang}, title = {Convex transversals}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {224--239}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.009}, doi = {10.1016/J.COMGEO.2012.10.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinDKMPSY14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AsanoBBKMRS14, author = {Tetsuo Asano and Kevin Buchin and Maike Buchin and Matias Korman and Wolfgang Mulzer and G{\"{u}}nter Rote and Andr{\'{e}} Schulz}, title = {Reprint of: Memory-constrained algorithms for simple polygons}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {469--479}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.004}, doi = {10.1016/J.COMGEO.2013.11.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AshokAG14, author = {Pradeesha Ashok and Umair Azmi and Sathish Govindarajan}, title = {Small strong epsilon nets}, journal = {Comput. Geom.}, volume = {47}, number = {9}, pages = {899--909}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.05.002}, doi = {10.1016/J.COMGEO.2014.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AshokAG14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bae14, author = {Sang Won Bae}, title = {Tight bound and improved algorithm for farthest-color Voronoi diagrams of line segments}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {779--788}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.005}, doi = {10.1016/J.COMGEO.2014.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bae14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Balko14, author = {Martin Balko}, title = {Reprint of: Grid representations and the chromatic number}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {480--492}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.006}, doi = {10.1016/J.COMGEO.2013.11.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Balko14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BanikBD14, author = {Aritra Banik and Bhaswar B. Bhattacharya and Sandip Das}, title = {Minimum enclosing circle of a set of fixed points and a mobile point}, journal = {Comput. Geom.}, volume = {47}, number = {9}, pages = {891--898}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.006}, doi = {10.1016/J.COMGEO.2014.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BanikBD14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyR14, author = {Imre B{\'{a}}r{\'{a}}ny and Edgardo Rold{\'{a}}n{-}Pensado}, title = {Longest convex lattice chains}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {367--376}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.09.002}, doi = {10.1016/J.COMGEO.2013.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyR14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarbaKLS14, author = {Luis Barba and Matias Korman and Stefan Langerman and Rodrigo I. Silveira}, title = {Computing a visibility polygon using few variables}, journal = {Comput. Geom.}, volume = {47}, number = {9}, pages = {918--926}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.001}, doi = {10.1016/J.COMGEO.2014.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BarbaKLS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarequetG14, author = {Gill Barequet and Alex Goryachev}, title = {Offset polygon and annulus placement problems}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {407--434}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.10.003}, doi = {10.1016/J.COMGEO.2013.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BarequetG14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergSW14, author = {Mark de Berg and Bettina Speckmann and Vincent van der Weele}, title = {Treemaps with bounded aspect ratio}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {683--693}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.008}, doi = {10.1016/J.COMGEO.2013.12.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergSW14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhattacharyaS14, author = {Binay K. Bhattacharya and Qiaosheng Shi}, title = {Improved algorithms to network p-center location problems}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {307--315}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2009.07.003}, doi = {10.1016/J.COMGEO.2009.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlV14, author = {Therese Biedl and Lesvia Elena Ruiz Vel{\'{a}}zquez}, title = {Orthogonal cartograms with at most 12 corners per face}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {282--294}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.005}, doi = {10.1016/J.COMGEO.2013.08.005}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiniazMS14, author = {Ahmad Biniaz and Anil Maheshwari and Michiel H. M. Smid}, title = {An optimal algorithm for the Euclidean bottleneck full Steiner tree problem}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {377--380}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.10.001}, doi = {10.1016/J.COMGEO.2013.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BokowskiP14, author = {J{\"{u}}rgen Bokowski and Vincent Pilaud}, title = {Enumerating topological (n\({}_{\mbox{k}}\))-configurations}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {175--186}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.002}, doi = {10.1016/J.COMGEO.2012.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BokowskiP14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseC14, author = {Prosenjit Bose and Jean{-}Lou De Carufel}, title = {Minimum-area enclosing triangle with a fixed angle}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {90--109}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.07.002}, doi = {10.1016/J.COMGEO.2013.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseC14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseJRSV14, author = {Prosenjit Bose and Dana Jansens and Andr{\'{e}} van Renssen and Maria Saumell and Sander Verdonschot}, title = {Making triangulations 4-connected using flips}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {187--197}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.012}, doi = {10.1016/J.COMGEO.2012.10.012}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseJRSV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BotanaA14, author = {Francisco Botana and Miguel A. Ab{\'{a}}nades}, title = {Automatic deduction in (dynamic) geometry: Loci computation}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {75--89}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.07.001}, doi = {10.1016/J.COMGEO.2013.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BotanaA14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bourrieres14, author = {Jean{-}Paul Bourri{\`{e}}res}, title = {The Minkowski sum of simplices in 3-dimensional space: An analytical description}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {856--867}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.002}, doi = {10.1016/J.COMGEO.2014.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bourrieres14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Brandenburg14, author = {Franz{-}Josef Brandenburg}, title = {Upward planar drawings on the standing and the rolling cylinders}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {25--41}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.003}, doi = {10.1016/J.COMGEO.2013.08.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CalinescuK14, author = {Gruia C{\u{a}}linescu and Howard J. Karloff}, title = {Sequential dependency computation via geometric data structures}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {141--148}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.009}, doi = {10.1016/J.COMGEO.2013.08.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CalinescuK14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarufelGMOS14, author = {Jean{-}Lou De Carufel and Carsten Grimm and Anil Maheshwari and Megan Owen and Michiel H. M. Smid}, title = {A note on the unsolvability of the weighted region shortest path problem}, journal = {Comput. Geom.}, volume = {47}, number = {7}, pages = {724--727}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.02.004}, doi = {10.1016/J.COMGEO.2014.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMOS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarufelGMSS14, author = {Jean{-}Lou De Carufel and Amin Gheibi and Anil Maheshwari and J{\"{o}}rg{-}R{\"{u}}diger Sack and Christian Scheffer}, title = {Similarity of polygonal curves in the presence of outliers}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {625--641}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.01.002}, doi = {10.1016/J.COMGEO.2014.01.002}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMSS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanG14, author = {Timothy M. Chan and Elyot Grant}, title = {Exact algorithms and APX-hardness results for geometric packing and covering problems}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {112--124}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.04.001}, doi = {10.1016/J.COMGEO.2012.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanG14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanP14, author = {Timothy M. Chan and Vinayak Pathak}, title = {Streaming and dynamic algorithms for minimum enclosing balls in high dimensions}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {240--247}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.05.007}, doi = {10.1016/J.COMGEO.2013.05.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanP14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DehlingerD14, author = {Christophe Dehlinger and Jean{-}Fran{\c{c}}ois Dufourd}, title = {Formal specification and proofs for the topology and classification of combinatorial surfaces}, journal = {Comput. Geom.}, volume = {47}, number = {9}, pages = {869--890}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.007}, doi = {10.1016/J.COMGEO.2014.04.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DehlingerD14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DehneI14, author = {Frank Dehne and John Iacono}, title = {Foreword}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {199}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.05.006}, doi = {10.1016/J.COMGEO.2013.05.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DehneI14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DellingGNPR14, author = {Daniel Delling and Andreas Gemsa and Martin N{\"{o}}llenburg and Thomas Pajor and Ignaz Rutter}, title = {On d-regular schematization of embedded paths}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {381--406}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.10.002}, doi = {10.1016/J.COMGEO.2013.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DellingGNPR14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineDILNO14, author = {Erik D. Demaine and Martin L. Demaine and Jin{-}ichi Itoh and Anna Lubiw and Chie Nara and Joseph O'Rourke}, title = {Reprint of: Refold rigidity of convex polyhedra}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {507--517}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.001}, doi = {10.1016/J.COMGEO.2013.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineDILNO14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DidimoL14, author = {Walter Didimo and Giuseppe Liotta}, title = {Special Issue on the 28th European Workshop on Computational Geometry, Guest Editors' Foreword}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {459}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.03.003}, doi = {10.1016/J.COMGEO.2013.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DidimoL14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuMZ14, author = {Adrian Dumitrescu and Joseph S. B. Mitchell and Pawel Zylinski}, title = {Watchman routes for lines and line segments}, journal = {Comput. Geom.}, volume = {47}, number = {4}, pages = {527--538}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.008}, doi = {10.1016/J.COMGEO.2013.11.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuMZ14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FarzanGN14, author = {Arash Farzan and Travis Gagie and Gonzalo Navarro}, title = {Entropy-bounded representation of point grids}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {1--14}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.002}, doi = {10.1016/J.COMGEO.2013.08.002}, timestamp = {Wed, 28 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FarzanGN14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FelsnerKV14, author = {Stefan Felsner and Michael Kaufmann and Pavel Valtr}, title = {Bend-optimal orthogonal graph drawing in the general position model}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {460--468}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.03.002}, doi = {10.1016/J.COMGEO.2013.03.002}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FelsnerKV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FoteinosCC14, author = {Panagiotis A. Foteinos and Andrey N. Chernikov and Nikos Chrisochoides}, title = {Guaranteed quality tetrahedral Delaunay meshing for medical images}, journal = {Comput. Geom.}, volume = {47}, number = {4}, pages = {539--562}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.009}, doi = {10.1016/J.COMGEO.2013.11.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FoteinosCC14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GeissKPR14, author = {Darius Gei{\ss} and Rolf Klein and Rainer Penninger and G{\"{u}}nter Rote}, title = {Reprint of: Optimally solving a transportation problem using Voronoi diagrams}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {499--506}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.003}, doi = {10.1016/J.COMGEO.2013.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GeissKPR14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GhodsiMBSZ14, author = {Mohammad Ghodsi and Anil Maheshwari and Mostafa Nouri Baygi and J{\"{o}}rg{-}R{\"{u}}diger Sack and Hamid Zarrabi{-}Zadeh}, title = {{\(\alpha\)}-Visibility}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {435--446}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.10.004}, doi = {10.1016/J.COMGEO.2013.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GhodsiMBSZ14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GilbersK14, author = {Alexander Gilbers and Rolf Klein}, title = {A new upper bound for the VC-dimension of visibility regions}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {61--74}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.012}, doi = {10.1016/J.COMGEO.2013.08.012}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GilbersK14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GuptaJKS14, author = {Prosenjit Gupta and Ravi Janardan and Yokesh Kumar and Michiel H. M. Smid}, title = {Data structures for range-aggregate extent queries}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {329--347}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2009.08.001}, doi = {10.1016/J.COMGEO.2009.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GuptaJKS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HarrenJPS14, author = {Rolf Harren and Klaus Jansen and Lars Pr{\"{a}}del and Rob van Stee}, title = {A {(5/3} + {\(\epsilon\)})-approximation for strip packing}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {248--267}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.008}, doi = {10.1016/J.COMGEO.2013.08.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HarrenJPS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HeM14, author = {Meng He and J. Ian Munro}, title = {Space efficient data structures for dynamic orthogonal range counting}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {268--281}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.007}, doi = {10.1016/J.COMGEO.2013.08.007}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HeM14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HoffmannW14, author = {Michael Hoffmann and Emo Welzl}, title = {Editorial}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {643}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.003}, doi = {10.1016/J.COMGEO.2013.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HoffmannW14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Jiang0G14, author = {Xiaoye Jiang and Jian Sun and Leonidas J. Guibas}, title = {A Fourier-theoretic approach for inferring symmetries}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {164--174}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.001}, doi = {10.1016/J.COMGEO.2012.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Jiang0G14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KamousiCS14, author = {Pegah Kamousi and Timothy M. Chan and Subhash Suri}, title = {Closest pair and the post office problem for stochastic points}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {214--223}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.10.010}, doi = {10.1016/J.COMGEO.2012.10.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KamousiCS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KeszeghP14, author = {Bal{\'{a}}zs Keszegh and D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi}, title = {Octants are cover-decomposable into many coverings}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {585--588}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.001}, doi = {10.1016/J.COMGEO.2013.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KeszeghP14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KnauerMW14, author = {Kolja B. Knauer and Piotr Micek and Bartosz Walczak}, title = {Outerplanar graph drawings with few slopes}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {614--624}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.01.003}, doi = {10.1016/J.COMGEO.2014.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KnauerMW14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Mchedlidze14, author = {Tamara Mchedlidze}, title = {Reprint of: Upward planar embedding of an n-vertex oriented path on O(n\({}^{\mbox{2}}\)) points}, journal = {Comput. Geom.}, volume = {47}, number = {3}, pages = {493--498}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.11.007}, doi = {10.1016/J.COMGEO.2013.11.007}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Mchedlidze14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MitchellPS14, author = {Joseph S. B. Mitchell and Valentin Polishchuk and Mikko Sysikaski}, title = {Minimum-link paths revisited}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {651--667}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.005}, doi = {10.1016/J.COMGEO.2013.12.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MitchellPS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Morin14, author = {Pat Morin}, title = {Guest Editor's Introduction}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {295}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.03.006}, doi = {10.1016/J.COMGEO.2013.03.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Morin14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MustafaTW14, author = {Nabil H. Mustafa and Hans Raj Tiwary and Daniel Werner}, title = {A proof of the Oja depth conjecture in the plane}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {668--674}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.006}, doi = {10.1016/J.COMGEO.2013.12.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MustafaTW14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/NivaschPT14, author = {Gabriel Nivasch and J{\'{a}}nos Pach and G{\'{a}}bor Tardos}, title = {The visible perimeter of an arrangement of disks}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {42--51}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.006}, doi = {10.1016/J.COMGEO.2013.08.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/NivaschPT14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ORourkeV14, author = {Joseph O'Rourke and Costin V{\^{\i}}lcu}, title = {Development of curves on polyhedra via conical existence}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {149--163}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.010}, doi = {10.1016/J.COMGEO.2013.08.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ORourkeV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/OlaverriHHT14, author = {Alfredo Garc{\'{\i}}a Olaverri and Clemens Huemer and Ferran Hurtado and Javier Tejel}, title = {Compatible spanning trees}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {563--584}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.009}, doi = {10.1016/J.COMGEO.2013.12.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/OlaverriHHT14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PanahiS14, author = {Fatemeh Panahi and A. Frank van der Stappen}, title = {Bounding the locus of the center of mass for a part with shape variation}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {847--855}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.008}, doi = {10.1016/J.COMGEO.2014.04.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PanahiS14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Pilz14, author = {Alexander Pilz}, title = {Flip distance between triangulations of a planar point set is APX-hard}, journal = {Comput. Geom.}, volume = {47}, number = {5}, pages = {589--604}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.01.001}, doi = {10.1016/J.COMGEO.2014.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Pilz14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchefferV14, author = {Christian Scheffer and Jan Vahrenhold}, title = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\)}, journal = {Comput. Geom.}, volume = {47}, number = {2}, pages = {125--140}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2012.05.001}, doi = {10.1016/J.COMGEO.2012.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchefferV14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchefferV14a, author = {Christian Scheffer and Jan Vahrenhold}, title = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\): The weighted case}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {789--808}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.003}, doi = {10.1016/J.COMGEO.2014.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchefferV14a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ShawiGL14, author = {Radwa El Shawi and Joachim Gudmundsson and Christos Levcopoulos}, title = {Quickest path queries on transportation network}, journal = {Comput. Geom.}, volume = {47}, number = {7}, pages = {695--709}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.01.004}, doi = {10.1016/J.COMGEO.2014.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ShawiGL14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Shewchuk14, author = {Jonathan Richard Shewchuk}, title = {Reprint of: Delaunay refinement algorithms for triangular mesh generation}, journal = {Comput. Geom.}, volume = {47}, number = {7}, pages = {741--778}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.02.005}, doi = {10.1016/J.COMGEO.2014.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Shewchuk14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Sugihara14, author = {Kokichi Sugihara}, title = {Design of solids for antigravity motion illusion}, journal = {Comput. Geom.}, volume = {47}, number = {6}, pages = {675--682}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.12.007}, doi = {10.1016/J.COMGEO.2013.12.007}, timestamp = {Tue, 04 Feb 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Sugihara14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Viglietta14, author = {Giovanni Viglietta}, title = {Face-guarding polyhedra}, journal = {Comput. Geom.}, volume = {47}, number = {8}, pages = {833--846}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2014.04.009}, doi = {10.1016/J.COMGEO.2014.04.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Viglietta14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WalzerAU14, author = {Stefan Walzer and Maria Axenovich and Torsten Ueckerdt}, title = {Packing polyominoes clumsily}, journal = {Comput. Geom.}, volume = {47}, number = {1}, pages = {52--60}, year = {2014}, url = {https://doi.org/10.1016/j.comgeo.2013.08.011}, doi = {10.1016/J.COMGEO.2013.08.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WalzerAU14.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbamCFS13, author = {Mohammad Ali Abam and Paz Carmi and Mohammad Farshi and Michiel H. M. Smid}, title = {On the power of the semi-separated pair decomposition}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {631--639}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.02.003}, doi = {10.1016/J.COMGEO.2013.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbamCFS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AcarCHT13, author = {Umut A. Acar and Andrew Cotter and Beno{\^{\i}}t Hudson and Duru T{\"{u}}rkoglu}, title = {Dynamic well-spaced point sets}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {756--773}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.007}, doi = {10.1016/J.COMGEO.2012.11.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AcarCHT13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AckermanGP13, author = {Eyal Ackerman and Tsachik Gelander and Rom Pinchasi}, title = {Ice-creams and wedge graphs}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {213--218}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.07.003}, doi = {10.1016/J.COMGEO.2012.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AckermanGP13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AckermanPSS13, author = {Eyal Ackerman and Rom Pinchasi and Ludmila Scharf and Marc Scherfenberg}, title = {On inducing polygons and related problems}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {861--878}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.06.003}, doi = {10.1016/J.COMGEO.2011.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AckermanPSS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Adamatzky13, author = {Andrew Adamatzky}, title = {On growing connected {\(\beta\)}-skeletons}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {805--816}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.009}, doi = {10.1016/J.COMGEO.2012.11.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Adamatzky13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AgarwalAG0Y13, author = {Pankaj K. Agarwal and Lars Arge and Sathish Govindarajan and Jun Yang and Ke Yi}, title = {Efficient external memory structures for range-aggregate queries}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {358--370}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.003}, doi = {10.1016/J.COMGEO.2012.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AgarwalAG0Y13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AgarwalAS13, author = {Pankaj K. Agarwal and Rinat Ben Avraham and Micha Sharir}, title = {The 2-center problem in three dimensions}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {734--746}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.005}, doi = {10.1016/J.COMGEO.2012.11.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AgarwalAS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhipasaogluT13, author = {Selin Damla Ahipasaoglu and Michael J. Todd}, title = {A modified Frank-Wolfe algorithm for computing minimum-area enclosing ellipsoidal cylinders: Theory and algorithms}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {494--519}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.11.004}, doi = {10.1016/J.COMGEO.2011.11.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhipasaogluT13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBKLSV13, author = {Hee{-}Kap Ahn and Sang Won Bae and Christian Knauer and Mira Lee and Chan{-}Su Shin and Antoine Vigneron}, title = {Realistic roofs over a rectilinear polygon}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1042--1055}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.06.002}, doi = {10.1016/J.COMGEO.2013.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBKLSV13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnCR13, author = {Hee{-}Kap Ahn and Siu{-}Wing Cheng and Iris Reinbacher}, title = {Maximum overlap of convex polytopes under translation}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {552--565}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.11.003}, doi = {10.1016/J.COMGEO.2011.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnCR13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnKKSSV13, author = {Hee{-}Kap Ahn and Sang{-}Sub Kim and Christian Knauer and Lena Schlipf and Chan{-}Su Shin and Antoine Vigneron}, title = {Covering and piercing disks with two centers}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {253--262}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.002}, doi = {10.1016/J.COMGEO.2012.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnKKSSV13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerHHHPSSV13, author = {Oswin Aichholzer and Thomas Hackl and Michael Hoffmann and Clemens Huemer and Attila P{\'{o}}r and Francisco Santos and Bettina Speckmann and Birgit Vogtenhuber}, title = {Maximizing maximal angles for plane straight-line graphs}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {17--28}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.03.002}, doi = {10.1016/J.COMGEO.2012.03.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHHHPSSV13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMHKPRV13, author = {Oswin Aichholzer and Ruy Fabila Monroy and Thomas Hackl and Marc J. van Kreveld and Alexander Pilz and Pedro Ramos and Birgit Vogtenhuber}, title = {Blocking Delaunay triangulations}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {154--159}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.005}, doi = {10.1016/J.COMGEO.2012.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHKPRV13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMP13, author = {Oswin Aichholzer and Tillmann Miltzow and Alexander Pilz}, title = {Extreme point and halving edge search in abstract order types}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {970--978}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.001}, doi = {10.1016/J.COMGEO.2013.05.001}, timestamp = {Tue, 04 Feb 2020 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMP13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisBDDFIW13, author = {Greg Aloupis and Nadia M. Benbernou and Mirela Damian and Erik D. Demaine and Robin Y. Flatland and John Iacono and Stefanie Wuhrer}, title = {Efficient reconfiguration of lattice-based modular robots}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {917--928}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.03.004}, doi = {10.1016/J.COMGEO.2013.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisBDDFIW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisCCDDDMHHLSST13, author = {Greg Aloupis and Jean Cardinal and S{\'{e}}bastien Collette and Erik D. Demaine and Martin L. Demaine and Muriel Dulieu and Ruy Fabila Monroy and Vi Hart and Ferran Hurtado and Stefan Langerman and Maria Saumell and Carlos Seara and Perouz Taslakian}, title = {Non-crossing matchings of points with geometric objects}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {78--92}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.005}, doi = {10.1016/J.COMGEO.2012.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCDDDMHHLSST13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisDFKORW13, author = {Greg Aloupis and Mirela Damian and Robin Y. Flatland and Matias Korman and {\"{O}}zg{\"{u}}r {\"{O}}zkan and David Rappaport and Stefanie Wuhrer}, title = {Establishing strong connectivity using optimal radius half-disk antennas}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {328--339}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.008}, doi = {10.1016/J.COMGEO.2012.09.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisDFKORW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArnaudonN13, author = {Marc Arnaudon and Frank Nielsen}, title = {On approximating the Riemannian 1-center}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {93--104}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.007}, doi = {10.1016/J.COMGEO.2012.04.007}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ArnaudonN13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovD13, author = {Boris Aronov and Muriel Dulieu}, title = {How to cover a point set with a V-shape of minimum width}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {298--309}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.006}, doi = {10.1016/J.COMGEO.2012.09.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovD13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovDH13, author = {Boris Aronov and Muriel Dulieu and Ferran Hurtado}, title = {Witness Gabriel graphs}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {894--908}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.06.004}, doi = {10.1016/J.COMGEO.2011.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovDH13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AsanoBBKMRS13, author = {Tetsuo Asano and Kevin Buchin and Maike Buchin and Matias Korman and Wolfgang Mulzer and G{\"{u}}nter Rote and Andr{\'{e}} Schulz}, title = {Memory-constrained algorithms for simple polygons}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {959--969}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.04.005}, doi = {10.1016/J.COMGEO.2013.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AschnerKM13, author = {Rom Aschner and Matthew J. Katz and Gila Morgenstern}, title = {Symmetric connectivity with directional antennas}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1017--1026}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.06.003}, doi = {10.1016/J.COMGEO.2013.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AschnerKM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AttaliLS13, author = {Dominique Attali and Andr{\'{e}} Lieutier and David Salinas}, title = {Vietoris-Rips complexes also provide topologically correct reconstructions of sampled shapes}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {448--465}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.009}, doi = {10.1016/J.COMGEO.2012.02.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AttaliLS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AugustineDMNRS13, author = {John Augustine and Sandip Das and Anil Maheshwari and Subhas C. Nandy and Sasanka Roy and Swami Sarvattomananda}, title = {Localized geometric query problems}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {340--357}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.009}, doi = {10.1016/J.COMGEO.2012.09.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AugustineDMNRS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AvisMM13, author = {David Avis and Hiroyuki Miyata and Sonoko Moriyama}, title = {Families of polytopal digraphs that do not satisfy the shelling property}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {382--393}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.005}, doi = {10.1016/J.COMGEO.2012.10.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AvisMM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Balko13, author = {Martin Balko}, title = {Grid representations and the chromatic number}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {990--1002}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.003}, doi = {10.1016/J.COMGEO.2013.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Balko13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaloghGS13, author = {J{\'{o}}zsef Balogh and Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and Gelasio Salazar}, title = {Large convex holes in random point sets}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {725--733}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.004}, doi = {10.1016/J.COMGEO.2012.11.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaloghGS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bar-YehudaR13, author = {Reuven Bar{-}Yehuda and Dror Rawitz}, title = {A note on multicovering with disks}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {394--399}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.006}, doi = {10.1016/J.COMGEO.2012.10.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bar-YehudaR13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyS13, author = {Imre B{\'{a}}r{\'{a}}ny and William L. Steiger}, title = {On the variance of random polygons}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {173--180}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.003}, doi = {10.1016/J.COMGEO.2012.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarequetBCDDILSSTW13, author = {Gill Barequet and Nadia M. Benbernou and David Charlton and Erik D. Demaine and Martin L. Demaine and Mashhood Ishaque and Anna Lubiw and Andr{\'{e}} Schulz and Diane L. Souvaine and Godfried T. Toussaint and Andrew Winslow}, title = {Bounded-degree polyhedronization of point sets}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {148--153}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.008}, doi = {10.1016/J.COMGEO.2012.02.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BarequetBCDDILSSTW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaygiG13, author = {Mostafa Nouri Baygi and Mohammad Ghodsi}, title = {Space/query-time tradeoff for computing the visibility polygon}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {371--381}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.004}, doi = {10.1016/J.COMGEO.2012.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaygiG13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ben-NerSS13, author = {Moria Ben{-}Ner and Andr{\'{e}} Schulz and Adam Sheffer}, title = {On numbers of pseudo-triangulations}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {688--699}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.002}, doi = {10.1016/J.COMGEO.2012.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ben-NerSS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregDLPSU13, author = {Sergey Bereg and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Dolores Lara and Pablo P{\'{e}}rez{-}Lantero and Carlos Seara and Jorge Urrutia}, title = {On the coarseness of bicolored point sets}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {65--77}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.003}, doi = {10.1016/J.COMGEO.2012.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeregDLPSU13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergCG13, author = {Mark de Berg and Atlas F. Cook IV and Joachim Gudmundsson}, title = {Fast Fr{\'{e}}chet queries}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {747--755}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.006}, doi = {10.1016/J.COMGEO.2012.11.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergCG13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlV13, author = {Therese Biedl and Lesvia Elena Ruiz Vel{\'{a}}zquez}, title = {Drawing planar 3-trees with given face areas}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {276--285}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.004}, doi = {10.1016/J.COMGEO.2012.09.004}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlV13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BokowskiS13, author = {J{\"{u}}rgen Bokowski and Lars Schewe}, title = {On the finite set of missing geometric configurations (\emph{n}\({}_{\mbox{4}}\))}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {532--540}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.11.001}, doi = {10.1016/J.COMGEO.2011.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BokowskiS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCCCKL13, author = {Prosenjit Bose and Paz Carmi and Lilach Chaitman{-}Yerushalmi and S{\'{e}}bastien Collette and Matthew J. Katz and Stefan Langerman}, title = {Stable Roommates Spanner}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {120--130}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.07.001}, doi = {10.1016/J.COMGEO.2012.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCCCKL13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCHKLSS13, author = {Prosenjit Bose and S{\'{e}}bastien Collette and Ferran Hurtado and Matias Korman and Stefan Langerman and Vera Sacrist{\'{a}}n and Maria Saumell}, title = {Some properties of k-Delaunay and k-Gabriel graphs}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {131--139}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.006}, doi = {10.1016/J.COMGEO.2012.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCHKLSS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseDDHM13, author = {Prosenjit Bose and Karim Dou{\"{\i}}eb and Vida Dujmovic and John Howat and Pat Morin}, title = {Fast local searches and updates in bounded universes}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {181--189}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.002}, doi = {10.1016/J.COMGEO.2012.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseDDHM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseS13, author = {Prosenjit Bose and Michiel H. M. Smid}, title = {On plane geometric spanners: {A} survey and open problems}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {818--830}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.04.002}, doi = {10.1016/J.COMGEO.2013.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrandtsDHK13, author = {Jan Brandts and Sander Dijkhuis and Vincent de Haan and Michal Kr{\'{\i}}zek}, title = {There are only two nonobtuse binary triangulations of the unit n-cube}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {286--297}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.005}, doi = {10.1016/J.COMGEO.2012.09.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BrandtsDHK13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BremnerDIM13, author = {David Bremner and Antoine Deza and Hiroshi Imai and Sonoko Moriyama}, title = {Editorial}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {493}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.009}, doi = {10.1016/J.COMGEO.2012.01.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BremnerDIM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloDP13, author = {Sergio Cabello and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Pablo P{\'{e}}rez{-}Lantero}, title = {Covering a bichromatic point set with two disjoint monochromatic disks}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {203--212}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.06.002}, doi = {10.1016/J.COMGEO.2012.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloDP13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CanoTU13, author = {Javier Cano and Csaba D. T{\'{o}}th and Jorge Urrutia}, title = {A tight bound for point guards in piecewise convex art galleries}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {945--958}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.04.004}, doi = {10.1016/J.COMGEO.2013.04.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CanoTU13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalK13, author = {Jean Cardinal and Matias Korman}, title = {Coloring planar homothets and three-dimensional hypergraphs}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1027--1035}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.06.004}, doi = {10.1016/J.COMGEO.2013.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalK13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenDILM13, author = {Dan Chen and Olivier Devillers and John Iacono and Stefan Langerman and Pat Morin}, title = {Oja centers and centers of gravity}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {140--147}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.004}, doi = {10.1016/J.COMGEO.2012.04.004}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChenDILM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenK13, author = {Chao Chen and Michael Kerber}, title = {An output-sensitive algorithm for persistent homology}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {435--447}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.010}, doi = {10.1016/J.COMGEO.2012.02.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenK13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenM13, author = {Dan Chen and Pat Morin}, title = {Approximating majority depth}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1059--1064}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.06.005}, doi = {10.1016/J.COMGEO.2013.06.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenMW13, author = {Dan Chen and Pat Morin and Uli Wagner}, title = {Absolute approximation of Tukey depth: Theory and experiments}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {566--573}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.03.001}, doi = {10.1016/J.COMGEO.2012.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenMW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChengL13, author = {Siu{-}Wing Cheng and Chi{-}Kit Lam}, title = {Shape matching under rigid motion}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {591--603}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.01.002}, doi = {10.1016/J.COMGEO.2013.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChengL13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChepoiF13, author = {Victor Chepoi and Stefan Felsner}, title = {Approximating hitting sets of axis-parallel rectangles intersecting a monotone curve}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1036--1041}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.008}, doi = {10.1016/J.COMGEO.2013.05.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChepoiF13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChepoiM13, author = {Victor Chepoi and Daniela Maftuleac}, title = {Shortest path problem in rectangular complexes of global nonpositive curvature}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {51--64}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.04.002}, doi = {10.1016/J.COMGEO.2012.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChepoiM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ColletteL13, author = {S{\'{e}}bastien Collette and Stefan Langerman}, title = {Editorial}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {817}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.04.001}, doi = {10.1016/J.COMGEO.2013.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ColletteL13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeMNS13, author = {Minati De and Anil Maheshwari and Subhas C. Nandy and Michiel H. M. Smid}, title = {An in-place min-max priority search tree}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {310--327}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.007}, doi = {10.1016/J.COMGEO.2012.09.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DeMNS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineDILNO13, author = {Erik D. Demaine and Martin L. Demaine and Jin{-}ichi Itoh and Anna Lubiw and Chie Nara and Joseph O'Rourke}, title = {Refold rigidity of convex polyhedra}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {979--989}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.002}, doi = {10.1016/J.COMGEO.2013.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineDILNO13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DoradoPT13, author = {Rub{\'{e}}n Dorado and B. Pivec and Eloisa Torres{-}Jim{\'{e}}nez}, title = {Advancing front circle packing to approximate conformal strips}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {105--118}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.05.002}, doi = {10.1016/J.COMGEO.2012.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DoradoPT13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DujmovicELLLRW13, author = {Vida Dujmovic and William S. Evans and Sylvain Lazard and William J. Lenhart and Giuseppe Liotta and David Rappaport and Stephen K. Wismath}, title = {On point-sets that support planar graphs}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {29--50}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.03.003}, doi = {10.1016/J.COMGEO.2012.03.003}, timestamp = {Tue, 20 Sep 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DujmovicELLLRW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuJ13, author = {Adrian Dumitrescu and Minghui Jiang}, title = {On reconfiguration of disks in the plane and related problems}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {191--202}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.06.001}, doi = {10.1016/J.COMGEO.2012.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherM13, author = {Stephane Durocher and Jason Morrison}, title = {Foreword}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {119}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.07.002}, doi = {10.1016/J.COMGEO.2012.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EvansGKLMS13, author = {William S. Evans and Emden R. Gansner and Michael Kaufmann and Giuseppe Liotta and Henk Meijer and Andreas Spillner}, title = {Approximate proximity drawings}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {604--614}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.01.001}, doi = {10.1016/J.COMGEO.2013.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EvansGKLMS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EzraM13, author = {Esther Ezra and Wolfgang Mulzer}, title = {Convex hull of points lying on lines in time after preprocessing}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {417--434}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.03.004}, doi = {10.1016/J.COMGEO.2012.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EzraM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GeissKPR13, author = {Darius Gei{\ss} and Rolf Klein and Rainer Penninger and G{\"{u}}nter Rote}, title = {Optimally solving a transportation problem using Voronoi diagrams}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {1009--1016}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.005}, doi = {10.1016/J.COMGEO.2013.05.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GeissKPR13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GerbnerT13, author = {D{\'{a}}niel Gerbner and G{\'{e}}za T{\'{o}}th}, title = {Separating families of convex sets}, journal = {Comput. Geom.}, volume = {46}, number = {9}, pages = {1056--1058}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.06.001}, doi = {10.1016/J.COMGEO.2013.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GerbnerT13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiacomoDLM13, author = {Emilio Di Giacomo and Walter Didimo and Giuseppe Liotta and Fabrizio Montecchiani}, title = {Area requirement of graph drawings with few crossings per edge}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {909--916}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.03.001}, doi = {10.1016/J.COMGEO.2013.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiacomoDLM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiacomoFFGK13, author = {Emilio Di Giacomo and Fabrizio Frati and Radoslav Fulek and Luca Grilli and Marcus Krug}, title = {Orthogeodesic point-set embedding of trees}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {929--944}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.04.003}, doi = {10.1016/J.COMGEO.2013.04.003}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GiacomoFFGK13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiannopoulosKRW13, author = {Panos Giannopoulos and Christian Knauer and G{\"{u}}nter Rote and Daniel Werner}, title = {Fixed-parameter tractability and lower bounds for stabbing problems}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {839--860}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.06.005}, doi = {10.1016/J.COMGEO.2011.06.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiannopoulosKRW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GuibasMM13, author = {Leonidas J. Guibas and Nikola Milosavljevic and Arik Motskin}, title = {Connected dominating sets on dynamic geometric graphs}, journal = {Comput. Geom.}, volume = {46}, number = {2}, pages = {160--172}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.004}, doi = {10.1016/J.COMGEO.2012.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GuibasMM13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HerrmannJP13, author = {Sven Herrmann and Michael Joswig and Marc E. Pfetsch}, title = {Computing the bounded subcomplex of an unbounded polyhedron}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {541--551}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.11.002}, doi = {10.1016/J.COMGEO.2011.11.002}, timestamp = {Mon, 28 Aug 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HerrmannJP13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Hershberger13, author = {John Hershberger}, title = {Stable snap rounding}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {403--416}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.011}, doi = {10.1016/J.COMGEO.2012.02.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Hershberger13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HurtadoK13, author = {Ferran Hurtado and Marc J. van Kreveld}, title = {Guest Editors' foreword}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {401}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.007}, doi = {10.1016/J.COMGEO.2012.10.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HurtadoK13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JelinekKR13, author = {V{\'{\i}}t Jel{\'{\i}}nek and Jan Kratochv{\'{\i}}l and Ignaz Rutter}, title = {A Kuratowski-type theorem for planarity of partially embedded graphs}, journal = {Comput. Geom.}, volume = {46}, number = {4}, pages = {466--492}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.07.005}, doi = {10.1016/J.COMGEO.2012.07.005}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/JelinekKR13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaravelasST13, author = {Menelaos I. Karavelas and Raimund Seidel and Eleni Tzanaki}, title = {Convex hulls of spheres and convex hulls of disjoint convex polytopes}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {615--630}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.02.001}, doi = {10.1016/J.COMGEO.2013.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KaravelasST13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaufmannMS13, author = {Michael Kaufmann and Tamara Mchedlidze and Antonios Symvonis}, title = {On upward point set embeddability}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {774--804}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.008}, doi = {10.1016/J.COMGEO.2012.11.008}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KaufmannMS13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimC13, author = {Hyo{-}Sil Kim and Otfried Cheong}, title = {The cost of bounded curvature}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {648--672}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.10.008}, doi = {10.1016/J.COMGEO.2012.10.008}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KimC13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/King13, author = {James King}, title = {Fast vertex guarding for polygons with and without holes}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {219--231}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.07.004}, doi = {10.1016/J.COMGEO.2012.07.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/King13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KulkarniZ13, author = {Omkar Kulkarni and Huaming Zhang}, title = {An optimal greedy routing algorithm for triangulated polygons}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {640--647}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.02.002}, doi = {10.1016/J.COMGEO.2013.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KulkarniZ13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LaarhovenA13, author = {Jon W. Van Laarhoven and Kurt M. Anstreicher}, title = {Geometric conditions for Euclidean Steiner trees in {\(\mathfrak{R}\)}\({}^{\mbox{\emph{d}}}\)}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {520--531}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.11.007}, doi = {10.1016/J.COMGEO.2011.11.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/LaarhovenA13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LoeraDKMPW13, author = {Jes{\'{u}}s A. De Loera and Brandon E. Dutra and Matthias K{\"{o}}ppe and S. Moreinis and G. Pinto and J. Wu}, title = {Software for exact integration of polynomials over polyhedra}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {232--252}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.001}, doi = {10.1016/J.COMGEO.2012.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/LoeraDKMPW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MaierP13, author = {Georg Maier and Georg Pisinger}, title = {Approximation of a closed polygon with a minimum number of circular arcs and line segments}, journal = {Comput. Geom.}, volume = {46}, number = {3}, pages = {263--275}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.09.003}, doi = {10.1016/J.COMGEO.2012.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MaierP13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Mchedlidze13, author = {Tamara Mchedlidze}, title = {Upward planar embedding of an n-vertex oriented path on O(n\({}^{\mbox{2}}\)) points}, journal = {Comput. Geom.}, volume = {46}, number = {8}, pages = {1003--1008}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2013.05.004}, doi = {10.1016/J.COMGEO.2013.05.004}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Mchedlidze13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RazenW13, author = {Andreas Razen and Emo Welzl}, title = {On the number of crossing-free partitions}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {879--893}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2011.07.001}, doi = {10.1016/J.COMGEO.2011.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RazenW13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Rivera-CampoU13, author = {Eduardo Rivera{-}Campo and Virginia Urrutia{-}Galicia}, title = {A sufficient condition for the existence of plane spanning trees on geometric graphs}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {1--6}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.006}, doi = {10.1016/J.COMGEO.2012.02.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Rivera-CampoU13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchulzT13, author = {Andr{\'{e}} Schulz and Csaba D. T{\'{o}}th}, title = {The union of colorful simplices spanned by a colored point set}, journal = {Comput. Geom.}, volume = {46}, number = {5}, pages = {574--590}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.006}, doi = {10.1016/J.COMGEO.2012.01.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchulzT13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Sunic13, author = {Zoran Sunic}, title = {Normal art galleries: Wall in - all in}, journal = {Comput. Geom.}, volume = {46}, number = {1}, pages = {7--16}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.02.007}, doi = {10.1016/J.COMGEO.2012.02.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Sunic13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/VanderZeeHGZR13, author = {Evan VanderZee and Anil N. Hirani and Damrong Guoy and Vadim Zharnitsky and Edgar A. Ramos}, title = {Geometric and combinatorial properties of well-centered triangulations in three and higher dimensions}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {700--724}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.003}, doi = {10.1016/J.COMGEO.2012.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/VanderZeeHGZR13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WuDBB13, author = {Xiaodong Wu and Xin Dou and John E. Bayouth and John M. Buatti}, title = {An almost linear time algorithm for field splitting in radiation therapy}, journal = {Comput. Geom.}, volume = {46}, number = {6}, pages = {673--687}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.11.001}, doi = {10.1016/J.COMGEO.2012.11.001}, timestamp = {Mon, 01 Mar 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WuDBB13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Wulff-Nilsen13, author = {Christian Wulff{-}Nilsen}, title = {Constant time distance queries in planar unweighted graphs with subquadratic preprocessing time}, journal = {Comput. Geom.}, volume = {46}, number = {7}, pages = {831--838}, year = {2013}, url = {https://doi.org/10.1016/j.comgeo.2012.01.016}, doi = {10.1016/J.COMGEO.2012.01.016}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen13.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbamH12, author = {Mohammad Ali Abam and Sariel Har{-}Peled}, title = {New constructions of SSPDs and their applications}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {200--214}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.003}, doi = {10.1016/J.COMGEO.2011.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbamH12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Abu-AffashACK12, author = {A. Karim Abu{-}Affash and Rom Aschner and Paz Carmi and Matthew J. Katz}, title = {The {MST} of symmetric disk graphs is light}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {54--61}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.08.002}, doi = {10.1016/J.COMGEO.2011.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashACK12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnCMV12, author = {Hee{-}Kap Ahn and Otfried Cheong and Jir{\'{\i}} Matousek and Antoine Vigneron}, title = {Reachability by paths of bounded curvature in a convex polygon}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {21--32}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.07.003}, doi = {10.1016/J.COMGEO.2011.07.003}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnCMV12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerADHRU12, author = {Oswin Aichholzer and Franz Aurenhammer and Erik D. Demaine and Ferran Hurtado and Pedro Ramos and Jorge Urrutia}, title = {On k-convex polygons}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {73--87}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.09.001}, doi = {10.1016/J.COMGEO.2011.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerADHRU12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerRSV12, author = {Oswin Aichholzer and G{\"{u}}nter Rote and Andr{\'{e}} Schulz and Birgit Vogtenhuber}, title = {Pointed drawings of planar graphs}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {482--494}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.08.001}, doi = {10.1016/J.COMGEO.2010.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerRSV12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlonsoMS12, author = {Javier Alonso and Horst Martini and Margarita Spirova}, title = {Minimal enclosing discs, circumcircles, and circumcenters in normed planes (Part {I)}}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {258--274}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.007}, doi = {10.1016/J.COMGEO.2012.01.007}, timestamp = {Thu, 28 Mar 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlonsoMS12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlonsoMS12a, author = {Javier Alonso and Horst Martini and Margarita Spirova}, title = {Minimal enclosing discs, circumcircles, and circumcenters in normed planes (Part {II)}}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {350--369}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.02.003}, doi = {10.1016/J.COMGEO.2012.02.003}, timestamp = {Thu, 28 Mar 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlonsoMS12a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArikushiFKMT12, author = {Karin Arikushi and Radoslav Fulek and Bal{\'{a}}zs Keszegh and Filip Moric and Csaba D. T{\'{o}}th}, title = {Graphs that admit right angle crossing drawings}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {169--177}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.11.008}, doi = {10.1016/J.COMGEO.2011.11.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArikushiFKMT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeO12, author = {Sang Won Bae and Yoshio Okamoto}, title = {Querying two boundary points for shortest paths in a polygonal domain}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {284--293}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.012}, doi = {10.1016/J.COMGEO.2012.01.012}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaeO12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaranyMT12, author = {Imre B{\'{a}}r{\'{a}}ny and Hiroshi Maehara and Norihide Tokushige}, title = {Tetrahedra passing through a triangular hole, and tetrahedra fixed by a planar frame}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {14--20}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.07.004}, doi = {10.1016/J.COMGEO.2011.07.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaranyMT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeckersB12, author = {Benoit Beckers and Pierre Beckers}, title = {A general rule for disk and hemisphere partition into equal-area cells}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {275--283}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.011}, doi = {10.1016/J.COMGEO.2012.01.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeckersB12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregCDPSV12, author = {Sergey Bereg and Sergio Cabello and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Pablo P{\'{e}}rez{-}Lantero and Carlos Seara and Inmaculada Ventura}, title = {The class cover problem with boxes}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {294--304}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.014}, doi = {10.1016/J.COMGEO.2012.01.014}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeregCDPSV12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergG12, author = {Mark de Berg and Dirk H. P. Gerrits}, title = {Approximation algorithms for free-label maximization}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {153--168}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.10.004}, doi = {10.1016/J.COMGEO.2011.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergG12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BitnerD12, author = {Steven Bitner and Ovidiu Daescu}, title = {Minimum-sum dipolar spanning tree in R\({}^{\mbox{3}}\)}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {476--481}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.09.011}, doi = {10.1016/J.COMGEO.2010.09.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BitnerD12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseC12, author = {Prosenjit Bose and Paz Carmi}, title = {Editorial}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {475}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.010}, doi = {10.1016/J.COMGEO.2012.01.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseC12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bringmann12, author = {Karl Bringmann}, title = {An improved algorithm for Klee's measure problem on fat boxes}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {225--233}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.001}, doi = {10.1016/J.COMGEO.2011.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bringmann12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrunDM12, author = {Christophe Brun and Jean{-}Fran{\c{c}}ois Dufourd and Nicolas Magaud}, title = {Designing and proving correct a convex hull algorithm with hypermaps in Coq}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {436--457}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.06.006}, doi = {10.1016/J.COMGEO.2010.06.006}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BrunDM12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloVL12, author = {Sergio Cabello and {\'{E}}ric Colin de Verdi{\`{e}}re and Francis Lazarus}, title = {Algorithms for the edge-width of an embedded graph}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {215--224}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.002}, doi = {10.1016/J.COMGEO.2011.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloVL12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CazalsC12, author = {Fr{\'{e}}d{\'{e}}ric Cazals and David Cohen{-}Steiner}, title = {Reconstructing 3D compact sets}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {1--13}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.07.005}, doi = {10.1016/J.COMGEO.2011.07.005}, timestamp = {Mon, 05 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CazalsC12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenDDM12, author = {Dan Chen and Luc Devroye and Vida Dujmovic and Pat Morin}, title = {Memoryless routing in convex subdivisions: Random walks are optimal}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {178--185}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.005}, doi = {10.1016/J.COMGEO.2011.12.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenDDM12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenHT12, author = {Wei{-}Mei Chen and Hsien{-}Kuei Hwang and Tsung{-}Hsi Tsai}, title = {Maxima-finding algorithms for multidimensional samples: {A} two-phase approach}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {33--53}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.08.001}, doi = {10.1016/J.COMGEO.2011.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenHT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenW12, author = {Danny Z. Chen and Haitao Wang}, title = {An improved algorithm for reconstructing a simple polygon from its visibility angles}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {254--257}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.005}, doi = {10.1016/J.COMGEO.2012.01.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenW12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChiangHR12, author = {Ching{-}Shoei Chiang and Christoph M. Hoffmann and Paul Rosen}, title = {A generalized Malfatti problem}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {425--435}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.06.005}, doi = {10.1016/J.COMGEO.2010.06.005}, timestamp = {Tue, 15 Jun 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChiangHR12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Davis12, author = {Ernest Davis}, title = {Preserving geometric properties in reconstructing regions from internal and nearby points}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {234--253}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.001}, doi = {10.1016/J.COMGEO.2012.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Davis12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DulaL12, author = {Jos{\'{e}} H. Dul{\'{a}} and Francisco J. L{\'{o}}pez}, title = {Competing output-sensitive frame algorithms}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {186--197}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.006}, doi = {10.1016/J.COMGEO.2011.12.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DulaL12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Dumitrescu12, author = {Adrian Dumitrescu}, title = {Going around in circles}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {370--381}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.02.004}, doi = {10.1016/J.COMGEO.2012.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuT12, author = {Adrian Dumitrescu and Csaba D. T{\'{o}}th}, title = {Watchman tours for polygons with holes}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {326--333}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.02.001}, doi = {10.1016/J.COMGEO.2012.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Frati12, author = {Fabrizio Frati}, title = {Straight-line drawings of outerplanar graphs in O(dn log n) area}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {524--533}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.03.007}, doi = {10.1016/J.COMGEO.2010.03.007}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Frati12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GajentaanO12, author = {Anka Gajentaan and Mark H. Overmars}, title = {On a class of O(n\({}^{\mbox{2}}\)) problems in computational geometry}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {140--152}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.11.006}, doi = {10.1016/J.COMGEO.2011.11.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GajentaanO12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GaoJM12, author = {Xiao{-}Shan Gao and Robert Joan{-}Arinyo and Dominique Michelucci}, title = {Special issue on geometric constraints and reasoning}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {383--384}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.008}, doi = {10.1016/J.COMGEO.2012.01.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GaoJM12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiesenMP12, author = {Joachim Giesen and Balint Miklos and Mark Pauly}, title = {The medial axis of the union of inner Voronoi balls in the plane}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {515--523}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.03.006}, doi = {10.1016/J.COMGEO.2010.03.006}, timestamp = {Mon, 05 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiesenMP12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GrayKLS12, author = {Chris Gray and Frank Kammer and Maarten L{\"{o}}ffler and Rodrigo I. Silveira}, title = {Removing local extrema from imprecise terrains}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {334--349}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.02.002}, doi = {10.1016/J.COMGEO.2012.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GrayKLS12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HallerJSSW12, author = {Kirk Haller and Audrey Lee{-}St. John and Meera Sitharam and Ileana Streinu and Neil White}, title = {Body-and-cad geometric constraint systems}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {385--405}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.06.003}, doi = {10.1016/J.COMGEO.2010.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HallerJSSW12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HararyT12, author = {Gur Harary and Ayellet Tal}, title = {3D Euler spirals for 3D curve completion}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {115--126}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.10.001}, doi = {10.1016/J.COMGEO.2011.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HararyT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HechtKT12, author = {Fr{\'{e}}d{\'{e}}ric Hecht and Rapha{\"{e}}l Kuate and Timothy Tautges}, title = {Local transformations of hexahedral meshes of lower valence}, journal = {Comput. Geom.}, volume = {45}, number = {1-2}, pages = {62--71}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.07.002}, doi = {10.1016/J.COMGEO.2011.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HechtKT12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KatzLM12, author = {Matthew J. Katz and Nissan Lev{-}Tov and Gila Morgenstern}, title = {Conflict-Free Coloring of points on a line with respect to a set of intervals}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {508--514}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.013}, doi = {10.1016/J.COMGEO.2012.01.013}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KatzLM12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Keszegh12, author = {Bal{\'{a}}zs Keszegh}, title = {Coloring half-planes and bottomless rectangles}, journal = {Comput. Geom.}, volume = {45}, number = {9}, pages = {495--507}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.09.004}, doi = {10.1016/J.COMGEO.2011.09.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Keszegh12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KimMPYZ12, author = {Joondong Kim and Joseph S. B. Mitchell and Valentin Polishchuk and Shang Yang and Jingyu Zou}, title = {Routing multi-class traffic flows in the plane}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {99--114}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.09.003}, doi = {10.1016/J.COMGEO.2011.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KimMPYZ12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Kirkpatrick12, author = {David G. Kirkpatrick}, title = {Guest editor's foreword}, journal = {Comput. Geom.}, volume = {45}, number = {5-6}, pages = {199}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.12.004}, doi = {10.1016/J.COMGEO.2011.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Kirkpatrick12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MagaudNS12, author = {Nicolas Magaud and Julien Narboux and Pascal Schreck}, title = {A case study in formalizing projective geometry in Coq: Desargues theorem}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {406--424}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.06.004}, doi = {10.1016/J.COMGEO.2010.06.004}, timestamp = {Mon, 26 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/MagaudNS12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MehlhornS12, author = {Kurt Mehlhorn and J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {CGTA-Awards 2011}, journal = {Comput. Geom.}, volume = {45}, number = {4}, pages = {139}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.11.005}, doi = {10.1016/J.COMGEO.2011.11.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MehlhornS12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MukhopadhyayG12, author = {Asish Mukhopadhyay and Eugene Greene}, title = {The ordinary line problem revisited}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {127--130}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.10.003}, doi = {10.1016/J.COMGEO.2011.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MukhopadhyayG12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/NishatMR12, author = {Rahnuma Islam Nishat and Debajyoti Mondal and Md. Saidur Rahman}, title = {Point-set embeddings of plane 3-trees}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {88--98}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.09.002}, doi = {10.1016/J.COMGEO.2011.09.002}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/NishatMR12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PachST12, author = {J{\'{a}}nos Pach and Andrew Suk and Miroslav Treml}, title = {Tangencies between families of disjoint regions in the plane}, journal = {Comput. Geom.}, volume = {45}, number = {3}, pages = {131--138}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2011.10.002}, doi = {10.1016/J.COMGEO.2011.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PachST12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/YanXD12, author = {Chenyu Yan and Yang Xiang and Feodor F. Dragan}, title = {Compact and low delay routing labeling scheme for Unit Disk Graphs}, journal = {Comput. Geom.}, volume = {45}, number = {7}, pages = {305--325}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2012.01.015}, doi = {10.1016/J.COMGEO.2012.01.015}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/YanXD12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Zhang12, author = {Gui{-}Fang Zhang}, title = {Classification of direct kinematics to planar generalized Stewart platforms}, journal = {Comput. Geom.}, volume = {45}, number = {8}, pages = {458--473}, year = {2012}, url = {https://doi.org/10.1016/j.comgeo.2010.06.007}, doi = {10.1016/J.COMGEO.2010.06.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Zhang12.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbregoMFFHSS11, author = {Bernardo M. {\'{A}}brego and Ruy Fabila Monroy and Silvia Fern{\'{a}}ndez{-}Merchant and David Flores{-}Pe{\~{n}}aloza and Ferran Hurtado and Vera Sacrist{\'{a}}n and Maria Saumell}, title = {On crossing numbers of geometric proximity graphs}, journal = {Comput. Geom.}, volume = {44}, number = {4}, pages = {216--233}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.11.003}, doi = {10.1016/J.COMGEO.2010.11.003}, timestamp = {Mon, 26 Jun 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AbregoMFFHSS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBDDKKRS11, author = {Hee{-}Kap Ahn and Sang Won Bae and Erik D. Demaine and Martin L. Demaine and Sang{-}Sub Kim and Matias Korman and Iris Reinbacher and Wanbin Son}, title = {Covering points by disjoint boxes with outliers}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {178--190}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.10.002}, doi = {10.1016/J.COMGEO.2010.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBDDKKRS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlonsoR11, author = {Laurent Alonso and Edward M. Reingold}, title = {Improved bounds for cops-and-robber pursuit}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {365--369}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.03.001}, doi = {10.1016/J.COMGEO.2011.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlonsoR11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinBMP11, author = {Esther M. Arkin and Michael A. Bender and Joseph S. B. Mitchell and Valentin Polishchuk}, title = {The snowblower problem}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {370--384}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.03.003}, doi = {10.1016/J.COMGEO.2011.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinBMP11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovDH11, author = {Boris Aronov and Muriel Dulieu and Ferran Hurtado}, title = {Witness (Delaunay) graphs}, journal = {Comput. Geom.}, volume = {44}, number = {6-7}, pages = {329--344}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.01.001}, doi = {10.1016/J.COMGEO.2011.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovDH11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bar-YehudaHR11, author = {Reuven Bar{-}Yehuda and Danny Hermelin and Dror Rawitz}, title = {Minimum vertex cover in rectangle graphs}, journal = {Comput. Geom.}, volume = {44}, number = {6-7}, pages = {356--364}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.03.002}, doi = {10.1016/J.COMGEO.2011.03.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bar-YehudaHR11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlG11, author = {Therese Biedl and Burkay Gen{\c{c}}}, title = {Reconstructing orthogonal polyhedra from putative vertex sets}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {409--417}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.04.002}, doi = {10.1016/J.COMGEO.2011.04.002}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlG11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlHL11, author = {Therese Biedl and Masud Hasan and Alejandro L{\'{o}}pez{-}Ortiz}, title = {Efficient view point selection for silhouettes of convex polyhedra}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {399--408}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.04.001}, doi = {10.1016/J.COMGEO.2011.04.001}, timestamp = {Thu, 11 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlHL11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCCSX11, author = {Prosenjit Bose and Paz Carmi and Mathieu Couture and Michiel H. M. Smid and Daming Xu}, title = {On a family of strong geometric spanners that admit local routing strategies}, journal = {Comput. Geom.}, volume = {44}, number = {6-7}, pages = {319--328}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.01.002}, doi = {10.1016/J.COMGEO.2011.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCCSX11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCD11, author = {Prosenjit Bose and Otfried Cheong and Vida Dujmovic}, title = {A note on the perimeter of fat objects}, journal = {Comput. Geom.}, volume = {44}, number = {1}, pages = {1--8}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.06.002}, doi = {10.1016/J.COMGEO.2010.06.002}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCD11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseDLSV11, author = {Prosenjit Bose and Luc Devroye and Maarten L{\"{o}}ffler and Jack Snoeyink and Vishal Verma}, title = {Almost all Delaunay triangulations have stretch factor greater than pi/2}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {121--127}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.009}, doi = {10.1016/J.COMGEO.2010.09.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseDLSV11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseMSW11, author = {Prosenjit Bose and Anil Maheshwari and Chang Shu and Stefanie Wuhrer}, title = {A survey of geodesic paths on 3D surfaces}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {486--498}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.006}, doi = {10.1016/J.COMGEO.2011.05.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseMSW11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BriseG11, author = {Yves Brise and Bernd G{\"{a}}rtner}, title = {Clarkson's algorithm for violator spaces}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {70--81}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.003}, doi = {10.1016/J.COMGEO.2010.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BriseG11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinBKL11, author = {Kevin Buchin and Maike Buchin and Marc J. van Kreveld and Jun Luo}, title = {Finding long and similar parts of trajectories}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {465--476}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.004}, doi = {10.1016/J.COMGEO.2011.05.004}, timestamp = {Tue, 16 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinBKL11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiKLR11, author = {Paz Carmi and Matthew J. Katz and Zvi Lotker and Adi Ros{\'{e}}n}, title = {Connectivity guarantees for wireless networks with directional antennas}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {477--485}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.003}, doi = {10.1016/J.COMGEO.2011.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiKLR11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CheongEGGHLLN11, author = {Otfried Cheong and Hazel Everett and Marc Glisse and Joachim Gudmundsson and Samuel Hornus and Sylvain Lazard and Mira Lee and Hyeon{-}Suk Na}, title = {Farthest-polygon Voronoi diagrams}, journal = {Comput. Geom.}, volume = {44}, number = {4}, pages = {234--247}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.11.004}, doi = {10.1016/J.COMGEO.2010.11.004}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CheongEGGHLLN11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ClaverolGGMS11, author = {Merc{\`{e}} Claverol and Delia Garijo and Clara I. Grima and Alberto M{\'{a}}rquez and Carlos Seara}, title = {Stabbers of line segments in the plane}, journal = {Comput. Geom.}, volume = {44}, number = {5}, pages = {303--318}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.12.004}, doi = {10.1016/J.COMGEO.2010.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ClaverolGGMS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CookW11, author = {Atlas F. Cook and Carola Wenk}, title = {Link distance and shortest path problems in the plane}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {442--455}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.04.004}, doi = {10.1016/J.COMGEO.2011.04.004}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CookW11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CordascoCF11, author = {Gennaro Cordasco and Rosario De Chiara and Andrew Fish}, title = {Efficient on-line algorithms for Euler diagram region computation}, journal = {Comput. Geom.}, volume = {44}, number = {1}, pages = {52--68}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.07.003}, doi = {10.1016/J.COMGEO.2010.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CordascoCF11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CuiKX11, author = {Shiliang Cui and Iyad A. Kanj and Ge Xia}, title = {On the stretch factor of Delaunay triangulations of points in convex position}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {104--109}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.007}, doi = {10.1016/J.COMGEO.2010.09.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CuiKX11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineFRSSZ11, author = {Erik D. Demaine and S{\'{a}}ndor P. Fekete and G{\"{u}}nter Rote and Nils Schweer and Daria Schymura and Mariano Zelke}, title = {Integer point sets minimizing average pairwise L\({}_{\mbox{1}}\) distance: What is the optimal shape of a town?}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {82--94}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.004}, doi = {10.1016/J.COMGEO.2010.09.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineFRSSZ11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Devillers11, author = {Olivier Devillers}, title = {Vertex removal in two-dimensional Delaunay triangulation: Speed-up by low degrees optimization}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {169--177}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.10.001}, doi = {10.1016/J.COMGEO.2010.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Devillers11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DevillersT11, author = {Olivier Devillers and Monique Teillaud}, title = {Perturbations for Delaunay and weighted Delaunay 3D triangulations}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {160--168}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.010}, doi = {10.1016/J.COMGEO.2010.09.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DevillersT11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Diaz-BanezLMSV11, author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Mario Alberto L{\'{o}}pez and Merc{\`{e}} Mora and Carlos Seara and Inmaculada Ventura}, title = {Fitting a two-joint orthogonal chain to a point set}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {135--147}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.07.005}, doi = {10.1016/J.COMGEO.2010.07.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezLMSV11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DisserMW11, author = {Yann Disser and Mat{\'{u}}s Mihal{\'{a}}k and Peter Widmayer}, title = {A polygon is determined by its angles}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {418--426}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.04.003}, doi = {10.1016/J.COMGEO.2011.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DisserMW11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Duncan11, author = {Christian A. Duncan}, title = {On graph thickness, geometric thickness, and separator theorems}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {95--99}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.005}, doi = {10.1016/J.COMGEO.2010.09.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Duncan11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherJLN11, author = {Stephane Durocher and Krishnam Raju Jampani and Anna Lubiw and Lata Narayanan}, title = {Modelling gateway placement in wireless networks: Geometric k-centres of unit disc graphs}, journal = {Comput. Geom.}, volume = {44}, number = {5}, pages = {286--302}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.12.003}, doi = {10.1016/J.COMGEO.2010.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherJLN11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ElbassioniT11, author = {Khaled M. Elbassioni and Hans Raj Tiwary}, title = {On a cone covering problem}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {129--134}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.07.004}, doi = {10.1016/J.COMGEO.2010.07.004}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ElbassioniT11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Evans11, author = {William Evans}, title = {Guest Editor's foreword}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {69}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.002}, doi = {10.1016/J.COMGEO.2010.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Evans11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FowlerJKS11, author = {J. Joseph Fowler and Michael J{\"{u}}nger and Stephen G. Kobourov and Michael Schulz}, title = {Characterizations of restricted pairs of planar graphs allowing simultaneous embedding with fixed edges}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {385--398}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.02.002}, doi = {10.1016/J.COMGEO.2011.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FowlerJKS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FratiK11, author = {Fabrizio Frati and Michael Kaufmann}, title = {Polynomial area bounds for {MST} embeddings of trees}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {529--543}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.005}, doi = {10.1016/J.COMGEO.2011.05.005}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FratiK11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FulekP11, author = {Radoslav Fulek and J{\'{a}}nos Pach}, title = {A computational approach to Conway's thrackle conjecture}, journal = {Comput. Geom.}, volume = {44}, number = {6-7}, pages = {345--355}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.02.001}, doi = {10.1016/J.COMGEO.2011.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FulekP11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GencEH11, author = {Burkay Gen{\c{c}} and Cem Evrendilek and Brahim Hnich}, title = {Covering points with orthogonally convex polygons}, journal = {Comput. Geom.}, volume = {44}, number = {5}, pages = {249--264}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.12.001}, doi = {10.1016/J.COMGEO.2010.12.001}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GencEH11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Hougardy11, author = {Stefan Hougardy}, title = {On packing squares into a rectangle}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {456--463}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.001}, doi = {10.1016/J.COMGEO.2011.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Hougardy11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Jiang11, author = {Minghui Jiang}, title = {An inequality on the edge lengths of triangular meshes}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {100--103}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.006}, doi = {10.1016/J.COMGEO.2010.09.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Jiang11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaplanRS11, author = {Haim Kaplan and Natan Rubin and Micha Sharir}, title = {A kinetic triangulation scheme for moving points in the plane}, journal = {Comput. Geom.}, volume = {44}, number = {4}, pages = {191--205}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.11.001}, doi = {10.1016/J.COMGEO.2010.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KaplanRS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Karavelas11, author = {Menelaos I. Karavelas}, title = {Guarding curvilinear art galleries with edge or mobile guards via 2-dominance of triangulation graphs}, journal = {Comput. Geom.}, volume = {44}, number = {1}, pages = {20--51}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.07.002}, doi = {10.1016/J.COMGEO.2010.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Karavelas11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KashyapKS11, author = {Abhishek Kashyap and Samir Khuller and Mark A. Shayman}, title = {Relay placement for fault tolerance in wireless networks in higher dimensions}, journal = {Comput. Geom.}, volume = {44}, number = {4}, pages = {206--215}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.11.002}, doi = {10.1016/J.COMGEO.2010.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KashyapKS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Kreveld11, author = {Marc J. van Kreveld}, title = {Bold graph drawings}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {499--506}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.06.002}, doi = {10.1016/J.COMGEO.2011.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Kreveld11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MaheshwariSSZ11, author = {Anil Maheshwari and J{\"{o}}rg{-}R{\"{u}}diger Sack and Kaveh Shahbaz and Hamid Zarrabi{-}Zadeh}, title = {Fr{\'{e}}chet distance with speed limits}, journal = {Comput. Geom.}, volume = {44}, number = {2}, pages = {110--120}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.008}, doi = {10.1016/J.COMGEO.2010.09.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSSZ11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MartinW11, author = {Shawn Martin and Jean{-}Paul Watson}, title = {Non-manifold surface reconstruction from high-dimensional point cloud data}, journal = {Comput. Geom.}, volume = {44}, number = {8}, pages = {427--441}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.05.002}, doi = {10.1016/J.COMGEO.2011.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MartinW11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MehlhornOS11, author = {Kurt Mehlhorn and Ralf Osbild and Michael Sagraloff}, title = {A general approach to the analysis of controlled perturbation algorithms}, journal = {Comput. Geom.}, volume = {44}, number = {9}, pages = {507--528}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2011.06.001}, doi = {10.1016/J.COMGEO.2011.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MehlhornOS11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Packer11, author = {Eli Packer}, title = {Controlled Perturbation of sets of line segments in {\(\mathbb{R}\)}\({}^{\mbox{2}}\) with smart processing order}, journal = {Comput. Geom.}, volume = {44}, number = {5}, pages = {265--285}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.12.002}, doi = {10.1016/J.COMGEO.2010.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Packer11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SadasivamZ11, author = {Sadish Sadasivam and Huaming Zhang}, title = {Closed rectangle-of-influence drawings for irreducible triangulations}, journal = {Comput. Geom.}, volume = {44}, number = {1}, pages = {9--19}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.07.001}, doi = {10.1016/J.COMGEO.2010.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SadasivamZ11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/YuHW11, author = {Chih{-}Chiang Yu and Wing{-}Kai Hon and Biing{-}Feng Wang}, title = {Improved data structures for the orthogonal range successor problem}, journal = {Comput. Geom.}, volume = {44}, number = {3}, pages = {148--159}, year = {2011}, url = {https://doi.org/10.1016/j.comgeo.2010.09.001}, doi = {10.1016/J.COMGEO.2010.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/YuHW11.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbamBG10, author = {Mohammad Ali Abam and Mark de Berg and Joachim Gudmundsson}, title = {A simple and efficient kinetic spanner}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {251--256}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.01.008}, doi = {10.1016/J.COMGEO.2009.01.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbamBG10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AfshaniHZ10, author = {Peyman Afshani and Chris H. Hamilton and Norbert Zeh}, title = {A general approach for cache-oblivious range reporting and approximate range counting}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {700--712}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.003}, doi = {10.1016/J.COMGEO.2010.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AfshaniHZ10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBKNS10, author = {Hee{-}Kap Ahn and Peter Brass and Christian Knauer and Hyeon{-}Suk Na and Chan{-}Su Shin}, title = {Covering a simple polygon by monotone directions}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {514--523}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.11.002}, doi = {10.1016/J.COMGEO.2009.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBKNS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerAAHJPR10, author = {Oswin Aichholzer and Wolfgang Aigner and Franz Aurenhammer and Thomas Hackl and Bert J{\"{u}}ttler and Elisabeth Pilgerstorfer and Margot Rabl}, title = {Divide-and-conquer for Voronoi diagrams revisited}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {688--699}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.004}, doi = {10.1016/J.COMGEO.2010.04.004}, timestamp = {Mon, 03 Jan 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAAHJPR10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlonsoR10, author = {Laurent Alonso and Edward M. Reingold}, title = {Bounds for cops and robber pursuit}, journal = {Comput. Geom.}, volume = {43}, number = {9}, pages = {749--766}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.02.002}, doi = {10.1016/J.COMGEO.2010.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlonsoR10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisCCHLOP10, author = {Greg Aloupis and Jean Cardinal and S{\'{e}}bastien Collette and Ferran Hurtado and Stefan Langerman and Joseph O'Rourke and Bel{\'{e}}n Palop}, title = {Highway hull revisited}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {115--130}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.001}, doi = {10.1016/J.COMGEO.2009.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCHLOP10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AltSS10, author = {Helmut Alt and Ludmila Scharf and Daria Schymura}, title = {Probabilistic matching of planar regions}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {99--114}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.04.006}, doi = {10.1016/J.COMGEO.2009.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AltSS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlvarezS10, author = {Victor Alvarez and Raimund Seidel}, title = {Approximating the minimum weight spanning tree of a set of points in the Hausdorff metric}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {94--98}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.04.005}, doi = {10.1016/J.COMGEO.2009.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlvarezS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinMP10, author = {Esther M. Arkin and Joseph S. B. Mitchell and Valentin Polishchuk}, title = {Maximum thick paths in static and dynamic environments}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {279--294}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.02.007}, doi = {10.1016/J.COMGEO.2009.02.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinMP10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BagnaraHZ10, author = {Roberto Bagnara and Patricia M. Hill and Enea Zaffanella}, title = {Exact join detection for convex polyhedra and other numerical abstractions}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {453--473}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.09.002}, doi = {10.1016/J.COMGEO.2009.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BagnaraHZ10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BasitMRR10, author = {Abdul Basit and Nabil H. Mustafa and Saurabh Ray and Sarfraz Raza}, title = {Centerpoints and Tverberg's technique}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {593--600}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.03.002}, doi = {10.1016/J.COMGEO.2010.03.002}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BasitMRR10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BatistaMPS10, author = {Vicente H. F. Batista and David L. Millman and Sylvain Pion and Johannes Singler}, title = {Parallel geometric algorithms for multi-core computers}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {663--677}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.008}, doi = {10.1016/J.COMGEO.2010.04.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BatistaMPS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeenNPW10, author = {Ken Been and Martin N{\"{o}}llenburg and Sheung{-}Hung Poon and Alexander Wolff}, title = {Optimizing active ranges for consistent dynamic map labeling}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {312--328}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.03.006}, doi = {10.1016/J.COMGEO.2009.03.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeenNPW10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ben-DanPZ10, author = {Itay Ben{-}Dan and Rom Pinchasi and Ran Ziv}, title = {On a problem about quadrant-depth}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {587--592}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.02.001}, doi = {10.1016/J.COMGEO.2010.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ben-DanPZ10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BerberichKS10, author = {Eric Berberich and Michael Kerber and Michael Sagraloff}, title = {An efficient algorithm for the stratification and triangulation of an algebraic surface}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {257--278}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.01.009}, doi = {10.1016/J.COMGEO.2009.01.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BerberichKS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergCHLT10, author = {Mark de Berg and Otfried Cheong and Herman J. Haverkort and Jung Gun Lim and Laura Toma}, title = {The complexity of flow on fat terrains and its i/o-efficient computation}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {331--356}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2008.12.008}, doi = {10.1016/J.COMGEO.2008.12.008}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BergCHLT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergG10, author = {Mark de Berg and Chris Gray}, title = {Decompositions and boundary coverings of non-convex fat polyhedra}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {73--83}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.04.003}, doi = {10.1016/J.COMGEO.2009.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergG10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergG10a, author = {Mark de Berg and Chris Gray}, title = {Computing the visibility map of fat objects}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {410--418}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2008.12.010}, doi = {10.1016/J.COMGEO.2008.12.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergG10a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergHTT10, author = {Mark de Berg and Herman J. Haverkort and Shripad Thite and Laura Toma}, title = {Star-quadtrees and guard-quadtrees: I/O-efficient indexes for fat triangulations and low-density planar subdivisions}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {493--513}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.11.001}, doi = {10.1016/J.COMGEO.2009.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergHTT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BinucciGDEFKL10, author = {Carla Binucci and Emilio Di Giacomo and Walter Didimo and Alejandro Estrella{-}Balderrama and Fabrizio Frati and Stephen G. Kobourov and Giuseppe Liotta}, title = {Upward straight-line embeddings of directed graphs into point sets}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {219--232}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.07.002}, doi = {10.1016/J.COMGEO.2009.07.002}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BinucciGDEFKL10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BorradaileLS10, author = {Glencora Borradaile and James R. Lee and Anastasios Sidiropoulos}, title = {Randomly removing g handles at once}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {655--662}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.007}, doi = {10.1016/J.COMGEO.2010.04.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BorradaileLS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BringmannF10, author = {Karl Bringmann and Tobias Friedrich}, title = {Approximating the volume of unions and intersections of high-dimensional geometric objects}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {601--610}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.03.004}, doi = {10.1016/J.COMGEO.2010.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BringmannF10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarrSP10, author = {Hamish A. Carr and Jack Snoeyink and Michiel van de Panne}, title = {Flexible isosurfaces: Simplifying and displaying scalar topology using the contour tree}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {42--58}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2006.05.009}, doi = {10.1016/J.COMGEO.2006.05.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarrSP10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CaryRSV10, author = {Matthew Cary and Atri Rudra and Ashish Sabharwal and Erik Vee}, title = {Floodlight illumination of infinite wedges}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {23--34}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2007.01.004}, doi = {10.1016/J.COMGEO.2007.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CaryRSV10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ceyhan10, author = {Elvan Ceyhan}, title = {Extension of one-dimensional proximity regions to higher dimensions}, journal = {Comput. Geom.}, volume = {43}, number = {9}, pages = {721--748}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.05.002}, doi = {10.1016/J.COMGEO.2010.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ceyhan10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChambersVELLT10, author = {Erin W. Chambers and {\'{E}}ric Colin de Verdi{\`{e}}re and Jeff Erickson and Sylvain Lazard and Francis Lazarus and Shripad Thite}, title = {Homotopic Fr{\'{e}}chet distance between curves or, walking your dog in the woods in polynomial time}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {295--311}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.02.008}, doi = {10.1016/J.COMGEO.2009.02.008}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChambersVELLT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Chan10, author = {Timothy M. Chan}, title = {A (slightly) faster algorithm for Klee's measure problem}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {243--250}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.01.007}, doi = {10.1016/J.COMGEO.2009.01.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Chan10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChanC10, author = {Timothy M. Chan and Eric Y. Chen}, title = {Optimal in-place and cache-oblivious algorithms for 3-d convex hulls and 2-d segment intersection}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {636--646}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.005}, doi = {10.1016/J.COMGEO.2010.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChanC10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenF10, author = {Chao Chen and Daniel Freedman}, title = {Measuring and computing natural generators for homology groups}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {169--181}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.004}, doi = {10.1016/J.COMGEO.2009.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenF10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChernovSR10, author = {Nikolai I. Chernov and Yu. G. Stoyan and Tatiana E. Romanova}, title = {Mathematical model and efficient algorithms for object packing problem}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {535--553}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.12.003}, doi = {10.1016/J.COMGEO.2009.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChernovSR10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DasDN10, author = {Gautam K. Das and Sandip Das and Subhas C. Nandy}, title = {Homogeneous 2-hop broadcast in 2D}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {182--190}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.005}, doi = {10.1016/J.COMGEO.2009.06.005}, timestamp = {Wed, 31 Mar 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DasDN10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FeketeS10, author = {S{\'{a}}ndor P. Fekete and Christiane Schmidt}, title = {Polygon exploration with time-discrete vision}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {148--168}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.003}, doi = {10.1016/J.COMGEO.2009.06.003}, timestamp = {Wed, 07 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FeketeS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FonsecaM10, author = {Guilherme Dias da Fonseca and David M. Mount}, title = {Approximate range searching: The absolute model}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {434--444}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2008.09.009}, doi = {10.1016/J.COMGEO.2008.09.009}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FonsecaM10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FriedlerM10, author = {Sorelle A. Friedler and David M. Mount}, title = {Approximation algorithm for the kinetic robust K-center problem}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {572--586}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.01.001}, doi = {10.1016/J.COMGEO.2010.01.001}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/FriedlerM10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GrilliHLMW10, author = {Luca Grilli and Seok{-}Hee Hong and Giuseppe Liotta and Henk Meijer and Stephen K. Wismath}, title = {Matched drawability of graph pairs and of graph triples}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {611--634}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.03.005}, doi = {10.1016/J.COMGEO.2010.03.005}, timestamp = {Thu, 27 Apr 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GrilliHLMW10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HasheminezhadHMT10, author = {Mahdieh Hasheminezhad and S. Mehdi Hashemi and Brendan D. McKay and Maryam Tahmasbi}, title = {Rectangular-radial drawings of cubic plane graphs}, journal = {Comput. Geom.}, volume = {43}, number = {9}, pages = {767--780}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.06.001}, doi = {10.1016/J.COMGEO.2010.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HasheminezhadHMT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HaverkortW10, author = {Herman J. Haverkort and Freek van Walderveen}, title = {Locality and bounding-box quality of two-dimensional space-filling curves}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {131--147}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.002}, doi = {10.1016/J.COMGEO.2009.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HaverkortW10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HoffmannST10, author = {Michael Hoffmann and Bettina Speckmann and Csaba D. T{\'{o}}th}, title = {Pointed binary encompassing trees: Simple and optimal}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {35--41}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2006.12.005}, doi = {10.1016/J.COMGEO.2006.12.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HoffmannST10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HongN10, author = {Seok{-}Hee Hong and Hiroshi Nagamochi}, title = {An algorithm for constructing star-shaped drawings of plane graphs}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {191--206}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.008}, doi = {10.1016/J.COMGEO.2009.06.008}, timestamp = {Thu, 27 Apr 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/HongN10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Iacono10, author = {John Iacono}, title = {Editorial}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {1}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.03.003}, doi = {10.1016/J.COMGEO.2009.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Iacono10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ImaiKMRT10, author = {Keiko Imai and Akitoshi Kawamura and Jir{\'{\i}} Matousek and Daniel Reem and Takeshi Tokuyama}, title = {Distance k-sectors exist}, journal = {Comput. Geom.}, volume = {43}, number = {9}, pages = {713--720}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.05.001}, doi = {10.1016/J.COMGEO.2010.05.001}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ImaiKMRT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JimenezSF10, author = {Juan Jos{\'{e}} Jim{\'{e}}nez{-}Delgado and Rafael Jes{\'{u}}s Segura and Francisco R. Feito}, title = {A robust segment/triangle intersection algorithm for interference tests. Efficiency study}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {474--492}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.10.001}, doi = {10.1016/J.COMGEO.2009.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/JimenezSF10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KreveldLS10, author = {Marc J. van Kreveld and Maarten L{\"{o}}ffler and Rodrigo I. Silveira}, title = {Optimization for first order Delaunay triangulations}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {377--394}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.01.010}, doi = {10.1016/J.COMGEO.2009.01.010}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KreveldLS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Lazard10, author = {Sylvain Lazard}, title = {Editorial}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {67}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.006}, doi = {10.1016/J.COMGEO.2009.06.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Lazard10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LofflerK10, author = {Maarten L{\"{o}}ffler and Marc J. van Kreveld}, title = {Largest bounding box, smallest diameter, and related problems on imprecise points}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {419--433}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.03.007}, doi = {10.1016/J.COMGEO.2009.03.007}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/LofflerK10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/LofflerS10, author = {Maarten L{\"{o}}ffler and Jack Snoeyink}, title = {Delaunay triangulation of imprecise points in linear time after preprocessing}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {234--242}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2008.12.007}, doi = {10.1016/J.COMGEO.2008.12.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/LofflerS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MatijevicO10, author = {Domagoj Matijevic and Ralf Osbild}, title = {Finding the Theta-guarded region}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {207--218}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.07.001}, doi = {10.1016/J.COMGEO.2009.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MatijevicO10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MehlhornS10, author = {Kurt Mehlhorn and J{\"{o}}rg{-}R{\"{u}}diger Sack}, title = {Editorial}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {555}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.03.001}, doi = {10.1016/J.COMGEO.2010.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MehlhornS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MillerS10, author = {Gary L. Miller and Donald R. Sheehy}, title = {Approximate centerpoints with proofs}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {647--654}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.006}, doi = {10.1016/J.COMGEO.2010.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MillerS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Muller-HannemannT10, author = {Matthias M{\"{u}}ller{-}Hannemann and Siamak Tazari}, title = {A near linear time approximation scheme for Steiner tree among obstacles in the plane}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {395--409}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.01.011}, doi = {10.1016/J.COMGEO.2009.01.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Muller-HannemannT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MustafaR10, author = {Nabil H. Mustafa and Saurabh Ray}, title = {Reprint of: Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon)) in any dimension}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {565--571}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2007.02.007}, doi = {10.1016/J.COMGEO.2007.02.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MustafaR10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PaninaS10, author = {Gaiane Panina and Ileana Streinu}, title = {Flattening single-vertex origami: The non-expansive case}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {678--687}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.002}, doi = {10.1016/J.COMGEO.2010.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PaninaS10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RemySW10, author = {Jan Remy and Reto Sp{\"{o}}hel and Andreas Wei{\ss}l}, title = {On Euclidean vehicle routing with allocation}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {357--376}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2008.12.009}, doi = {10.1016/J.COMGEO.2008.12.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RemySW10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Seidel10, author = {Raimund Seidel}, title = {Reprint of: {A} simple and fast incremental randomized algorithm for computing trapezoidal decompositions and for triangulating polygons}, journal = {Comput. Geom.}, volume = {43}, number = {6-7}, pages = {556--564}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.03.003}, doi = {10.1016/J.COMGEO.2010.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Seidel10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SteffensT10, author = {Reinhard Steffens and Thorsten Theobald}, title = {Mixed volume techniques for embeddings of Laman graphs}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {84--93}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.04.004}, doi = {10.1016/J.COMGEO.2009.04.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SteffensT10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Teillaud10, author = {Monique Teillaud}, title = {Foreword}, journal = {Comput. Geom.}, volume = {43}, number = {3}, pages = {233}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.04.001}, doi = {10.1016/J.COMGEO.2009.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Teillaud10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Toussaint10, author = {Godfried T. Toussaint}, title = {Computational geometric aspects of rhythm, melody, and voice-leading}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {2--22}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2007.01.003}, doi = {10.1016/J.COMGEO.2007.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Toussaint10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/VanderZeeHZG10, author = {Evan VanderZee and Anil N. Hirani and Vadim Zharnitsky and Damrong Guoy}, title = {A dihedral acute triangulation of the cube}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {445--452}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.09.001}, doi = {10.1016/J.COMGEO.2009.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/VanderZeeHZG10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WenkZ10, author = {Carola Wenk and Afra Zomorodian}, title = {Guest Editors' foreword}, journal = {Comput. Geom.}, volume = {43}, number = {8}, pages = {635}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2010.04.001}, doi = {10.1016/J.COMGEO.2010.04.001}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WenkZ10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Wulff-Nilsen10, author = {Christian Wulff{-}Nilsen}, title = {Computing the dilation of edge-augmented graphs in metric spaces}, journal = {Comput. Geom.}, volume = {43}, number = {2}, pages = {68--72}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.03.008}, doi = {10.1016/J.COMGEO.2009.03.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/XuX10, author = {Guang Xu and Jinhui Xu}, title = {Efficient approximation algorithms for clustering point-sets}, journal = {Comput. Geom.}, volume = {43}, number = {1}, pages = {59--66}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2007.12.002}, doi = {10.1016/J.COMGEO.2007.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/XuX10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Zeh10, author = {Norbert Zeh}, title = {Editorial}, journal = {Comput. Geom.}, volume = {43}, number = {4}, pages = {329--330}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.06.007}, doi = {10.1016/J.COMGEO.2009.06.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Zeh10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZhangW10, author = {Heping Zhang and Guangfu Wang}, title = {Embeddability of open-ended carbon nanotubes in hypercubes}, journal = {Comput. Geom.}, volume = {43}, number = {5}, pages = {524--534}, year = {2010}, url = {https://doi.org/10.1016/j.comgeo.2009.12.001}, doi = {10.1016/J.COMGEO.2009.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZhangW10.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbbottBCDDHKLNRSY09, author = {Timothy G. Abbott and Michael A. Burr and Timothy M. Chan and Erik D. Demaine and Martin L. Demaine and John Hugg and Daniel Kane and Stefan Langerman and Jelani Nelson and Eynat Rafalin and Kathryn Seyboth and Vincent Yeung}, title = {Dynamic ham-sandwich cuts in the plane}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {419--428}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.008}, doi = {10.1016/J.COMGEO.2008.09.008}, timestamp = {Thu, 04 Apr 2024 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AbbottBCDDHKLNRSY09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AckermanAK09, author = {Eyal Ackerman and Oswin Aichholzer and Bal{\'{a}}zs Keszegh}, title = {Improved upper bounds on the reflexivity of point sets}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {241--249}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.05.004}, doi = {10.1016/J.COMGEO.2008.05.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AckermanAK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhmedL09, author = {Mustaq Ahmed and Anna Lubiw}, title = {Shortest descending paths through given faces}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {464--470}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2007.10.011}, doi = {10.1016/J.COMGEO.2007.10.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhmedL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBNS09, author = {Hee{-}Kap Ahn and Peter Brass and Hyeon{-}Suk Na and Chan{-}Su Shin}, title = {On the minimum total length of interval systems expressing all intervals, and range-restricted queries}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {207--213}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.03.004}, doi = {10.1016/J.COMGEO.2008.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBNS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerA09, author = {Oswin Aichholzer and Franz Aurenhammer}, title = {Editorial}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {723}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.003}, doi = {10.1016/J.COMGEO.2009.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerA09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerAHS09, author = {Oswin Aichholzer and Franz Aurenhammer and Thomas Hackl and Bettina Speckmann}, title = {On minimum weight pseudo-triangulations}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {627--631}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.002}, doi = {10.1016/J.COMGEO.2008.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAHS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerBDGHHKMRSSUW09, author = {Oswin Aichholzer and Sergey Bereg and Adrian Dumitrescu and Alfredo Garc{\'{\i}}a Olaverri and Clemens Huemer and Ferran Hurtado and Mikio Kano and Alberto M{\'{a}}rquez and David Rappaport and Shakhar Smorodinsky and Diane L. Souvaine and Jorge Urrutia and David R. Wood}, title = {Compatible geometric matchings}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {617--626}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.005}, doi = {10.1016/J.COMGEO.2008.12.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBDGHHKMRSSUW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerMFHHU09, author = {Oswin Aichholzer and Ruy Fabila Monroy and David Flores{-}Pe{\~{n}}aloza and Thomas Hackl and Clemens Huemer and Jorge Urrutia}, title = {Empty monochromatic triangles}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {934--938}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.04.002}, doi = {10.1016/J.COMGEO.2009.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMFHHU09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisCDDFLORAW09, author = {Greg Aloupis and S{\'{e}}bastien Collette and Mirela Damian and Erik D. Demaine and Robin Y. Flatland and Stefan Langerman and Joseph O'Rourke and Suneeta Ramaswami and Vera Sacrist{\'{a}}n Adinolfi and Stefanie Wuhrer}, title = {Linear reconfiguration of cube-style modular robots}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {652--663}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.11.003}, doi = {10.1016/J.COMGEO.2008.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisCDDFLORAW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ArkinFIMMRPRX09, author = {Esther M. Arkin and S{\'{a}}ndor P. Fekete and Kamrul Islam and Henk Meijer and Joseph S. B. Mitchell and Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and Valentin Polishchuk and David Rappaport and Henry Xiao}, title = {Not being (super)thin or solid is hard: {A} study of grid Hamiltonicity}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {582--605}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.11.004}, doi = {10.1016/J.COMGEO.2008.11.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ArkinFIMMRPRX09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovAHLRSS09, author = {Boris Aronov and Franz Aurenhammer and Ferran Hurtado and Stefan Langerman and David Rappaport and Carlos Seara and Shakhar Smorodinsky}, title = {Small weak epsilon-nets}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {455--462}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.02.005}, doi = {10.1016/J.COMGEO.2008.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovAHLRSS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AsanoBCMSSW09, author = {Tetsuo Asano and Prosenjit Bose and Paz Carmi and Anil Maheshwari and Chang Shu and Michiel H. M. Smid and Stefanie Wuhrer}, title = {A linear-space algorithm for distance preserving graph embedding}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {289--304}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.004}, doi = {10.1016/J.COMGEO.2008.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AsanoBCMSSW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BaeLACC09, author = {Sang Won Bae and Chunseok Lee and Hee{-}Kap Ahn and Sunghee Choi and Kyung{-}Yong Chwa}, title = {Computing minimum-area rectilinear convex hull and L-shape}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {903--912}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.006}, doi = {10.1016/J.COMGEO.2009.02.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BaeLACC09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BenkocziBDS09, author = {Robert Benkoczi and Binay K. Bhattacharya and Sandip Das and Jeff Sember}, title = {Single facility collection depots location problem in the plane}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {403--418}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.004}, doi = {10.1016/J.COMGEO.2008.04.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BenkocziBDS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bereg09, author = {Sergey Bereg}, title = {Orthogonal equipartitions}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {305--314}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.004}, doi = {10.1016/J.COMGEO.2008.09.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bereg09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregMW09, author = {Sergey Bereg and Nikolaus Mutsanas and Alexander Wolff}, title = {Matching points with rectangles and squares}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {93--108}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.05.001}, doi = {10.1016/J.COMGEO.2008.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeregMW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergHS09, author = {Mark de Berg and Herman J. Haverkort and Micha Streppel}, title = {Efficient c-oriented range searching with DOP-trees}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {250--267}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.05.002}, doi = {10.1016/J.COMGEO.2008.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergHS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BiedlLS09, author = {Therese C. Biedl and Anna Lubiw and Michael J. Spriggs}, title = {Morphing polyhedra with parallel faces: Counterexamples}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {395--402}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.006}, doi = {10.1016/J.COMGEO.2008.09.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BiedlLS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BodlaenderFGPSW09, author = {Hans L. Bodlaender and Corinne Feremans and Alexander Grigoriev and Eelko Penninkx and Ren{\'{e}} Sitters and Thomas Wolle}, title = {On the minimum corridor connection problem and other generalized geometric problems}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {939--951}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.05.001}, doi = {10.1016/J.COMGEO.2009.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BodlaenderFGPSW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseCCMSZ09, author = {Prosenjit Bose and Paz Carmi and Mathieu Couture and Anil Maheshwari and Michiel H. M. Smid and Norbert Zeh}, title = {Geometric spanners with small chromatic number}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {134--146}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.003}, doi = {10.1016/J.COMGEO.2008.04.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseCCMSZ09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseH09, author = {Prosenjit Bose and Ferran Hurtado}, title = {Flips in planar graphs}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {60--80}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.001}, doi = {10.1016/J.COMGEO.2008.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseH09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseM09, author = {Prosenjit Bose and Asish Mukhopadhyay}, title = {Editorial {CCCG} 2005}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {363}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.001}, doi = {10.1016/J.COMGEO.2008.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseM09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseMSW09, author = {Prosenjit Bose and Pat Morin and Michiel H. M. Smid and Stefanie Wuhrer}, title = {Rotationally monotone polygons}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {471--483}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2007.02.004}, doi = {10.1016/J.COMGEO.2007.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseMSW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrassKNS09, author = {Peter Brass and Kyue D. Kim and Hyeon{-}Suk Na and Chan{-}Su Shin}, title = {Escaping offline searchers and isoperimetric theorems}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {119--126}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.08.001}, doi = {10.1016/J.COMGEO.2008.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BrassKNS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinRUW09, author = {Kevin Buchin and Andreas Razen and Takeaki Uno and Uli Wagner}, title = {Transforming spanning trees: {A} lower bound}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {724--730}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.03.005}, doi = {10.1016/J.COMGEO.2008.03.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinRUW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Buzer09, author = {Lilian Buzer}, title = {Optimal simplification of polygonal chains for subpixel-accurate rendering}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {45--59}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.03.002}, doi = {10.1016/J.COMGEO.2008.03.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Buzer09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloK09, author = {Sergio Cabello and Christian Knauer}, title = {Algorithms for graphs of bounded treewidth via orthogonal range searching}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {815--824}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.001}, doi = {10.1016/J.COMGEO.2009.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CapposEFK09, author = {Justin Cappos and Alejandro Estrella{-}Balderrama and J. Joseph Fowler and Stephen G. Kobourov}, title = {Simultaneous graph embedding with bends and circular arcs}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {173--182}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.05.003}, doi = {10.1016/J.COMGEO.2008.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CapposEFK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalCL09, author = {Jean Cardinal and S{\'{e}}bastien Collette and Stefan Langerman}, title = {Empty region graphs}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {183--195}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.003}, doi = {10.1016/J.COMGEO.2008.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalCL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CastroCLT09, author = {Pedro Machado Manh{\~{a}}es de Castro and Fr{\'{e}}d{\'{e}}ric Cazals and S{\'{e}}bastien Loriot and Monique Teillaud}, title = {Design of the {CGAL} 3D Spherical Kernel and application to arrangements of circles on a sphere}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {536--550}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.003}, doi = {10.1016/J.COMGEO.2008.10.003}, timestamp = {Mon, 05 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CastroCLT09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CazalsL09, author = {Fr{\'{e}}d{\'{e}}ric Cazals and S{\'{e}}bastien Loriot}, title = {Computing the arrangement of circles on a sphere, with applications in structural biology}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {551--565}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.004}, doi = {10.1016/J.COMGEO.2008.10.004}, timestamp = {Mon, 05 Feb 2024 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CazalsL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChaudhuriK09, author = {Siddhartha Chaudhuri and Vladlen Koltun}, title = {Smoothed analysis of probabilistic roadmaps}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {731--747}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.005}, doi = {10.1016/J.COMGEO.2008.10.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChaudhuriK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChazalCL09, author = {Fr{\'{e}}d{\'{e}}ric Chazal and David Cohen{-}Steiner and Andr{\'{e}} Lieutier}, title = {Normal cone approximation and offset shape isotopy}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {566--581}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.002}, doi = {10.1016/J.COMGEO.2008.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChazalCL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChenHL09, author = {Chieh{-}Yu Chen and Ya{-}Fei Hung and Hsueh{-}I Lu}, title = {Visibility representations of four-connected plane graphs with near optimal heights}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {865--872}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.006}, doi = {10.1016/J.COMGEO.2009.01.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChenHL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChengS09, author = {Ho{-}Lun Cheng and Xinwei Shi}, title = {Quality mesh generation for molecular skin surfaces using restricted union of balls}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {196--206}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.001}, doi = {10.1016/J.COMGEO.2008.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChengS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineDIL09, author = {Erik D. Demaine and Martin L. Demaine and John Iacono and Stefan Langerman}, title = {Wrapping spheres with flat paper}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {748--757}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.10.006}, doi = {10.1016/J.COMGEO.2008.10.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineDIL09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemaineGMRTTWW09, author = {Erik D. Demaine and Francisco Gomez{-}Martin and Henk Meijer and David Rappaport and Perouz Taslakian and Godfried T. Toussaint and Terry Winograd and David R. Wood}, title = {The distance geometry of music}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {429--454}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.005}, doi = {10.1016/J.COMGEO.2008.04.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemaineGMRTTWW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DemouthDEGLS09, author = {Julien Demouth and Olivier Devillers and Hazel Everett and Marc Glisse and Sylvain Lazard and Raimund Seidel}, title = {On the complexity of umbra and penumbra}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {758--771}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.007}, doi = {10.1016/J.COMGEO.2008.04.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DemouthDEGLS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DimitrovKKR09, author = {Darko Dimitrov and Christian Knauer and Klaus Kriegel and G{\"{u}}nter Rote}, title = {Bounds on the quality of the {PCA} bounding boxes}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {772--789}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.02.007}, doi = {10.1016/J.COMGEO.2008.02.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DimitrovKKR09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DoraiswamyN09, author = {Harish Doraiswamy and Vijay Natarajan}, title = {Efficient algorithms for computing Reeb graphs}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {606--616}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.003}, doi = {10.1016/J.COMGEO.2008.12.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DoraiswamyN09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DurocherK09, author = {Stephane Durocher and David G. Kirkpatrick}, title = {The projection median of a set of points}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {364--375}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.006}, doi = {10.1016/J.COMGEO.2008.06.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DurocherK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EgebladNB09, author = {Jens Egeblad and Benny K. Nielsen and Marcus Brazil}, title = {Translational packing of arbitrary polytopes}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {269--288}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.003}, doi = {10.1016/J.COMGEO.2008.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EgebladNB09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EppsteinKMS09, author = {David Eppstein and Marc J. van Kreveld and Elena Mumford and Bettina Speckmann}, title = {Edges and switches, tunnels and bridges}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {790--802}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.05.005}, doi = {10.1016/J.COMGEO.2008.05.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EppsteinKMS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Estrella-BalderramaFK09, author = {Alejandro Estrella{-}Balderrama and J. Joseph Fowler and Stephen G. Kobourov}, title = {Characterization of unlabeled level planar trees}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {704--721}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.006}, doi = {10.1016/J.COMGEO.2008.12.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Estrella-BalderramaFK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EverettLLZ09, author = {Hazel Everett and Sylvain Lazard and William J. Lenhart and Linqiao Zhang}, title = {On the degree of standard geometric predicates for line transversals in 3D}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {484--494}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2007.11.002}, doi = {10.1016/J.COMGEO.2007.11.002}, timestamp = {Tue, 20 Sep 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EverettLLZ09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Figueroa09, author = {Ana Paulina Figueroa}, title = {A note on a theorem of Perles concerning non-crossing paths in convex geometric graphs}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {90--91}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.07.002}, doi = {10.1016/J.COMGEO.2008.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Figueroa09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FranekM09, author = {Vojtech Franek and Jir{\'{\i}} Matousek}, title = {Computing D-convex hulls in the plane}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {81--89}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.03.003}, doi = {10.1016/J.COMGEO.2008.03.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FranekM09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GarciaHHTV09, author = {Alfredo Garc{\'{\i}}a Olaverri and Ferran Hurtado and Clemens Huemer and Javier Tejel and Pavel Valtr}, title = {On triconnected and cubic plane graphs on given point sets}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {913--922}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.03.005}, doi = {10.1016/J.COMGEO.2009.03.005}, timestamp = {Tue, 27 Dec 2022 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GarciaHHTV09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiacomoDLMW09, author = {Emilio Di Giacomo and Walter Didimo and Giuseppe Liotta and Henk Meijer and Stephen K. Wismath}, title = {Point-set embeddings of trees with given partial drawings}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {664--676}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.001}, doi = {10.1016/J.COMGEO.2009.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiacomoDLMW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonKMOW09, author = {Joachim Gudmundsson and Jyrki Katajainen and Damian Merrick and Cahya Ong and Thomas Wolle}, title = {Compressing spatio-temporal trajectories}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {825--841}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.002}, doi = {10.1016/J.COMGEO.2009.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonKMOW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonKN09, author = {Joachim Gudmundsson and Marc J. van Kreveld and Giri Narasimhan}, title = {Region-restricted clustering for geographic data mining}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {231--240}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.08.003}, doi = {10.1016/J.COMGEO.2008.08.003}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonKN09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/InkuluK09, author = {Rajasekhar Inkulu and Sanjiv Kapoor}, title = {Visibility queries in a polygonal region}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {852--864}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.004}, doi = {10.1016/J.COMGEO.2009.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/InkuluK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/InkuluK09a, author = {Rajasekhar Inkulu and Sanjiv Kapoor}, title = {Planar rectilinear shortest path computation using corridors}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {873--884}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.02.005}, doi = {10.1016/J.COMGEO.2009.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/InkuluK09a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JerseK09, author = {Gregor Jerse and Neza Mramor{-}Kosta}, title = {Ascending and descending regions of a discrete Morse function}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {639--651}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.11.001}, doi = {10.1016/J.COMGEO.2008.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/JerseK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/JordanS09, author = {Tibor Jord{\'{a}}n and Zoltan Szabadka}, title = {Operations preserving the global rigidity of graphs and frameworks in the plane}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {511--521}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.007}, doi = {10.1016/J.COMGEO.2008.09.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/JordanS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KaravelasTT09, author = {Menelaos I. Karavelas and Csaba D. T{\'{o}}th and Elias P. Tsigaridas}, title = {Guarding curvilinear art galleries with vertex or point guards}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {522--535}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.11.002}, doi = {10.1016/J.COMGEO.2008.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KaravelasTT09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KleinKNS09, author = {Rolf Klein and Christian Knauer and Giri Narasimhan and Michiel H. M. Smid}, title = {On the dilation spectrum of paths, cycles, and trees}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {923--933}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.03.004}, doi = {10.1016/J.COMGEO.2009.03.004}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KleinKNS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KleinLN09, author = {Rolf Klein and Elmar Langetepe and Zahra Nilforoushan}, title = {Abstract Voronoi diagrams revisited}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {885--902}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.03.002}, doi = {10.1016/J.COMGEO.2009.03.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KleinLN09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Lucier09, author = {Brendan Lucier}, title = {Local overlaps in special unfoldings of convex polyhedra}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {495--504}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2007.07.008}, doi = {10.1016/J.COMGEO.2007.07.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Lucier09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MartiniW09, author = {Horst Martini and Senlin Wu}, title = {Geometric dilation of closed curves in normed planes}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {315--321}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.001}, doi = {10.1016/J.COMGEO.2008.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MartiniW09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MehlhornSZ09, author = {Kurt Mehlhorn and J{\"{o}}rg{-}R{\"{u}}diger Sack and Joseph Zaks}, title = {Note on the paper "K-vertex guarding simple polygons" [Computational Geometry 42 {(4)} (May 2009) 352-361]}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {722}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.03.001}, doi = {10.1016/J.COMGEO.2009.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MehlhornSZ09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MeijerR09, author = {Henk Meijer and David Rappaport}, title = {Editorial {CCCG} 2006}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {463}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.12.004}, doi = {10.1016/J.COMGEO.2008.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MeijerR09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MeijerRR09, author = {Henk Meijer and Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and David Rappaport}, title = {Bounds for point recolouring in geometric graphs}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {690--703}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.004}, doi = {10.1016/J.COMGEO.2009.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MeijerRR09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MukkamalaS09, author = {Padmini Mukkamala and Mario Szegedy}, title = {Geometric representation of cubic graphs with four directions}, journal = {Comput. Geom.}, volume = {42}, number = {9}, pages = {842--851}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.005}, doi = {10.1016/J.COMGEO.2009.01.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MukkamalaS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MustafaR09, author = {Nabil H. Mustafa and Saurabh Ray}, title = {An optimal extension of the centerpoint theorem}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {505--510}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2007.10.004}, doi = {10.1016/J.COMGEO.2007.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MustafaR09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Nekrich09, author = {Yakov Nekrich}, title = {Orthogonal range searching in linear and almost-linear space}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {342--351}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.001}, doi = {10.1016/J.COMGEO.2008.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Nekrich09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/NguyenBGJS09, author = {Hoa Nguyen and John V. Burkardt and Max D. Gunzburger and Lili Ju and Yuki Saka}, title = {Constrained {CVT} meshes and a comparison of triangular mesh generators}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {1--19}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.002}, doi = {10.1016/J.COMGEO.2008.04.002}, timestamp = {Thu, 14 Oct 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/NguyenBGJS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PachT09, author = {J{\'{a}}nos Pach and G{\'{e}}za T{\'{o}}th}, title = {Decomposition of multiple coverings into many parts}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {127--133}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.08.002}, doi = {10.1016/J.COMGEO.2008.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PachT09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PanagiotakisAT09, author = {Costas Panagiotakis and Konstantin Athanassopoulos and Georgios Tziritas}, title = {The equipartition of curves}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {677--689}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.003}, doi = {10.1016/J.COMGEO.2009.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PanagiotakisAT09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RahmanMN09, author = {Md. Saidur Rahman and Kazuyuki Miura and Takao Nishizeki}, title = {Octagonal drawings of plane graphs with prescribed face areas}, journal = {Comput. Geom.}, volume = {42}, number = {3}, pages = {214--230}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.002}, doi = {10.1016/J.COMGEO.2008.09.002}, timestamp = {Tue, 21 Mar 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RahmanMN09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RamosV09, author = {Pedro A. Ramos and Raquel Via{\~{n}}a}, title = {Depth of segments and circles through points enclosing many points: a note}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {338--341}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.07.001}, doi = {10.1016/J.COMGEO.2008.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RamosV09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RoyKDN09, author = {Sasanka Roy and Arindam Karmakar and Sandip Das and Subhas C. Nandy}, title = {Constrained minimum enclosing circle with center on a query line segment}, journal = {Comput. Geom.}, volume = {42}, number = {6-7}, pages = {632--638}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2009.01.002}, doi = {10.1016/J.COMGEO.2009.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RoyKDN09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Rybnikov09, author = {Konstantin A. Rybnikov}, title = {An efficient local approach to convexity testing of piecewise-linear hypersurfaces}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {147--172}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.02.004}, doi = {10.1016/J.COMGEO.2008.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Rybnikov09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Salleh09, author = {Ihsan Salleh}, title = {K-vertex guarding simple polygons}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {352--361}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.07.004}, doi = {10.1016/J.COMGEO.2008.07.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Salleh09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SilveiraK09, author = {Rodrigo I. Silveira and Marc J. van Kreveld}, title = {Towards a definition of higher order constrained Delaunay triangulations}, journal = {Comput. Geom.}, volume = {42}, number = {4}, pages = {322--337}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.09.005}, doi = {10.1016/J.COMGEO.2008.09.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SilveiraK09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SilveiraK09a, author = {Rodrigo I. Silveira and Marc J. van Kreveld}, title = {Optimal higher order Delaunay triangulations of polygons}, journal = {Comput. Geom.}, volume = {42}, number = {8}, pages = {803--813}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.02.006}, doi = {10.1016/J.COMGEO.2008.02.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SilveiraK09a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SouvaineT09, author = {Diane L. Souvaine and Csaba D. T{\'{o}}th}, title = {A vertex-face assignment for plane graphs}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {388--394}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.005}, doi = {10.1016/J.COMGEO.2008.06.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SouvaineT09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Thite09, author = {Shripad Thite}, title = {Adaptive spacetime meshing for discontinuous Galerkin methods}, journal = {Comput. Geom.}, volume = {42}, number = {1}, pages = {20--44}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.07.003}, doi = {10.1016/J.COMGEO.2008.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Thite09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ungor09, author = {Alper {\"{U}}ng{\"{o}}r}, title = {Off-centers: {A} new type of Steiner points for computing size-optimal quality-guaranteed Delaunay triangulations}, journal = {Comput. Geom.}, volume = {42}, number = {2}, pages = {109--118}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.06.002}, doi = {10.1016/J.COMGEO.2008.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ungor09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WagnerDS09, author = {David P. Wagner and Robert L. Scot Drysdale and Clifford Stein}, title = {An O(n\({}^{\mbox{5/2}}\)logn) algorithm for the Rectilinear Minimum Link-Distance Problem in three dimensions}, journal = {Comput. Geom.}, volume = {42}, number = {5}, pages = {376--387}, year = {2009}, url = {https://doi.org/10.1016/j.comgeo.2008.04.006}, doi = {10.1016/J.COMGEO.2008.04.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WagnerDS09.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbellanasBOHRRT08, author = {Manuel Abellanas and Prosenjit Bose and Alfredo Garc{\'{\i}}a Olaverri and Ferran Hurtado and Pedro Ramos and Eduardo Rivera{-}Campo and Javier Tejel}, title = {On local transformations in plane geometric graphs embedded on small grids}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {65--77}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.12.004}, doi = {10.1016/J.COMGEO.2006.12.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbellanasBOHRRT08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbellanasOHTU08, author = {Manuel Abellanas and Alfredo Garc{\'{\i}}a Olaverri and Ferran Hurtado and Javier Tejel and Jorge Urrutia}, title = {Augmenting the connectivity of geometric graphs}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {220--230}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.09.001}, doi = {10.1016/J.COMGEO.2007.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbellanasOHTU08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBS08, author = {Hee{-}Kap Ahn and Peter Brass and Chan{-}Su Shin}, title = {Maximum overlap and minimum convex hull of two convex polyhedra under translations}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {171--177}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.08.001}, doi = {10.1016/J.COMGEO.2007.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerAGHHHKRV08, author = {Oswin Aichholzer and Franz Aurenhammer and Paola Gonzalez{-}Nava and Thomas Hackl and Clemens Huemer and Ferran Hurtado and Hannes Krasser and Saurabh Ray and Birgit Vogtenhuber}, title = {Matching edges and faces in polygonal partitions}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {134--141}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.002}, doi = {10.1016/J.COMGEO.2007.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAGHHHKRV08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerHK08, author = {Oswin Aichholzer and Clemens Huemer and Hannes Krasser}, title = {Triangulations without pointed spanning trees}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {79--83}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.006}, doi = {10.1016/J.COMGEO.2007.07.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHK08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AloupisDLMOST08, author = {Greg Aloupis and Erik D. Demaine and Stefan Langerman and Pat Morin and Joseph O'Rourke and Ileana Streinu and Godfried T. Toussaint}, title = {Edge-unfolding nested polyhedral bands}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {30--42}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.009}, doi = {10.1016/J.COMGEO.2007.05.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AloupisDLMOST08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovBCGHSV08, author = {Boris Aronov and Mark de Berg and Otfried Cheong and Joachim Gudmundsson and Herman J. Haverkort and Michiel H. M. Smid and Antoine Vigneron}, title = {Sparse geometric graphs with small dilation}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {207--219}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.004}, doi = {10.1016/J.COMGEO.2007.07.004}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AronovBCGHSV08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovBG08, author = {Boris Aronov and Mark de Berg and Chris Gray}, title = {Ray shooting and intersection searching amidst fat convex polyhedra in 3-space}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {68--76}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.006}, doi = {10.1016/J.COMGEO.2007.10.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovBG08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Aurenhammer08, author = {Franz Aurenhammer}, title = {Weighted skeletons and fixed-share decomposition}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {93--101}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.08.002}, doi = {10.1016/J.COMGEO.2007.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Aurenhammer08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BadoiuC08, author = {Mihai Badoiu and Kenneth L. Clarkson}, title = {Optimal core-sets for balls}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {14--22}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.04.002}, doi = {10.1016/J.COMGEO.2007.04.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BadoiuC08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BarequetDS08, author = {Gill Barequet and Matthew T. Dickerson and Yuval Scharf}, title = {Covering points with a polygon}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {143--162}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.001}, doi = {10.1016/J.COMGEO.2007.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BarequetDS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BenkertGHW08, author = {Marc Benkert and Joachim Gudmundsson and Herman J. Haverkort and Alexander Wolff}, title = {Constructing minimum-interference networks}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {179--194}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.06.004}, doi = {10.1016/J.COMGEO.2007.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BenkertGHW08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BenkertGHW08a, author = {Marc Benkert and Joachim Gudmundsson and Florian H{\"{u}}bner and Thomas Wolle}, title = {Reporting flock patterns}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {111--125}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.003}, doi = {10.1016/J.COMGEO.2007.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BenkertGHW08a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Bereg08, author = {Sergey Bereg}, title = {Efficient algorithms for the d-dimensional rigidity matroid of sparse graphs}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {37--44}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.11.005}, doi = {10.1016/J.COMGEO.2006.11.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Bereg08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BinucciDG08, author = {Carla Binucci and Walter Didimo and Francesco Giordano}, title = {Maximum upward planar subgraphs of embedded planar digraphs}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {230--246}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2008.02.001}, doi = {10.1016/J.COMGEO.2008.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BinucciDG08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseF08, author = {Prosenjit Bose and Thomas Fevens}, title = {Editorial}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {1}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.06.002}, doi = {10.1016/J.COMGEO.2007.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseF08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinBW08, author = {Kevin Buchin and Maike Buchin and Carola Wenk}, title = {Computing the Fr{\'{e}}chet distance between simple polygons}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {2--20}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.08.003}, doi = {10.1016/J.COMGEO.2007.08.003}, timestamp = {Sun, 12 Nov 2023 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinBW08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BuchinDGJ08, author = {Kevin Buchin and Tamal K. Dey and Joachim Giesen and Matthias John}, title = {Recursive geometry of the flow complex and topology of the flow complex filtration}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {115--137}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.005}, doi = {10.1016/J.COMGEO.2007.05.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BuchinDGJ08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloDSSUV08, author = {Sergio Cabello and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Carlos Seara and Joan Antoni Sellar{\`{e}}s and Jorge Urrutia and Inmaculada Ventura}, title = {Covering point sets with two disjoint disks or squares}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {195--206}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.001}, doi = {10.1016/J.COMGEO.2007.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloDSSUV08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CabelloGKR08, author = {Sergio Cabello and Panos Giannopoulos and Christian Knauer and G{\"{u}}nter Rote}, title = {Matching point sets with respect to the Earth Mover's Distance}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {118--133}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.10.001}, doi = {10.1016/J.COMGEO.2006.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CabelloGKR08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CaravantesG08, author = {Jorge Caravantes and Laureano Gonz{\'{a}}lez{-}Vega}, title = {Improving the topology computation of an arrangement of cubics}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {206--218}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2008.03.001}, doi = {10.1016/J.COMGEO.2008.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CaravantesG08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalCHLP08, author = {Jean Cardinal and S{\'{e}}bastien Collette and Ferran Hurtado and Stefan Langerman and Bel{\'{e}}n Palop}, title = {Optimal location of transportation devices}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {219--229}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2008.01.001}, doi = {10.1016/J.COMGEO.2008.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalCHLP08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CardinalCL08, author = {Jean Cardinal and S{\'{e}}bastien Collette and Stefan Langerman}, title = {Local properties of geometric graphs}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {55--64}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.011}, doi = {10.1016/J.COMGEO.2007.05.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CardinalCL08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiKL08, author = {Paz Carmi and Matthew J. Katz and Nissan Lev{-}Tov}, title = {Polynomial-time approximation schemes for piercing and covering with applications in wireless networks}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {209--218}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.01.001}, doi = {10.1016/J.COMGEO.2007.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiKL08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChambersVELW08, author = {Erin W. Chambers and {\'{E}}ric Colin de Verdi{\`{e}}re and Jeff Erickson and Francis Lazarus and Kim Whittlesey}, title = {Splitting (complicated) surfaces is hard}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {94--110}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.010}, doi = {10.1016/J.COMGEO.2007.10.010}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/ChambersVELW08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChazalL08, author = {Fr{\'{e}}d{\'{e}}ric Chazal and Andr{\'{e}} Lieutier}, title = {Smooth manifold reconstruction from noisy and non-uniform approximation with guarantees}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {156--170}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.001}, doi = {10.1016/J.COMGEO.2007.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChazalL08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChazelleLM08, author = {Bernard Chazelle and Ding Liu and Avner Magen}, title = {Approximate range searching in higher dimension}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {24--29}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.008}, doi = {10.1016/J.COMGEO.2007.05.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChazelleLM08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ChengT08, author = {Ho{-}Lun Cheng and Tony Tan}, title = {Approximating polyhedral objects with deformable smooth surfaces}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {104--117}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.10.003}, doi = {10.1016/J.COMGEO.2006.10.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ChengT08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CheongHL08, author = {Otfried Cheong and Herman J. Haverkort and Mira Lee}, title = {Computing a minimum-dilation spanning tree is NP-hard}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {188--205}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.12.001}, doi = {10.1016/J.COMGEO.2007.12.001}, timestamp = {Sun, 25 Jul 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/CheongHL08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DamianFO08, author = {Mirela Damian and Robin Y. Flatland and Joseph O'Rourke}, title = {Unfolding Manhattan Towers}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {102--114}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.003}, doi = {10.1016/J.COMGEO.2007.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DamianFO08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DamianO08, author = {Mirela Damian and Joseph O'Rourke}, title = {On corners of objects built from parallelepiped bricks}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {43--54}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.010}, doi = {10.1016/J.COMGEO.2007.05.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DamianO08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DrysdaleRS08, author = {Robert L. Scot Drysdale and G{\"{u}}nter Rote and Astrid Sturm}, title = {Approximation of an open polygonal curve with a minimum number of circular arcs and biarcs}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {31--47}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.009}, doi = {10.1016/J.COMGEO.2007.10.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DrysdaleRS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EdelsbrunnerHMPS08, author = {Herbert Edelsbrunner and John Harer and Ajith Mascarenhas and Valerio Pascucci and Jack Snoeyink}, title = {Time-varying Reeb graphs for continuous space-time data}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {149--166}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.11.001}, doi = {10.1016/J.COMGEO.2007.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerHMPS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EmirisP08, author = {Ioannis Z. Emiris and Leonidas Palios}, title = {Editorial}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {1}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2008.02.002}, doi = {10.1016/J.COMGEO.2008.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EmirisP08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EzraSE08, author = {Esther Ezra and Micha Sharir and Alon Efrat}, title = {On the performance of the {ICP} algorithm}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {77--93}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.007}, doi = {10.1016/J.COMGEO.2007.10.007}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EzraSE08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GerdjikovW08, author = {Stefan Gerdjikov and Alexander Wolff}, title = {Decomposing a simple polygon into pseudo-triangles and convex polygons}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {21--30}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.005}, doi = {10.1016/J.COMGEO.2007.10.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GerdjikovW08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GiesenJ08, author = {Joachim Giesen and Matthias John}, title = {The flow complex: {A} data structure for geometric modeling}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {178--190}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.01.002}, doi = {10.1016/J.COMGEO.2007.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GiesenJ08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GoldschmidtG08, author = {Nir Goldschmidt and Dan Gordon}, title = {The {BOXEL} framework for 2.5D data with applications to virtual drivethroughs and ray tracing}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {167--187}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.09.003}, doi = {10.1016/J.COMGEO.2007.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GoldschmidtG08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GopalaM08, author = {Harish Gopala and Pat Morin}, title = {Algorithms for bivariate zonoid depth}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {2--13}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.007}, doi = {10.1016/J.COMGEO.2007.05.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GopalaM08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GruneK08, author = {Ansgar Gr{\"{u}}ne and Sanaz Kamali}, title = {On the density of iterated line segment intersections}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {23--36}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.005}, doi = {10.1016/J.COMGEO.2007.07.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GruneK08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HasanL08, author = {Masud Hasan and Anna Lubiw}, title = {Equiprojective polyhedra}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {148--155}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.002}, doi = {10.1016/J.COMGEO.2007.05.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HasanL08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HershbergerS08, author = {John Hershberger and Subhash Suri}, title = {Adaptive sampling for geometric problems over data streams}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {191--208}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.10.004}, doi = {10.1016/J.COMGEO.2006.10.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HershbergerS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HurtadoKRT08, author = {Ferran Hurtado and Mikio Kano and David Rappaport and Csaba D. T{\'{o}}th}, title = {Encompassing colored planar straight line graphs}, journal = {Comput. Geom.}, volume = {39}, number = {1}, pages = {14--23}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.006}, doi = {10.1016/J.COMGEO.2007.05.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HurtadoKRT08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KatzR08, author = {Matthew J. Katz and Gabriel S. Roisman}, title = {On guarding the vertices of rectilinear domains}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {219--228}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.02.002}, doi = {10.1016/J.COMGEO.2007.02.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KatzR08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KeszeghPPT08, author = {Bal{\'{a}}zs Keszegh and J{\'{a}}nos Pach and D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and G{\'{e}}za T{\'{o}}th}, title = {Drawing cubic graphs with at most five slopes}, journal = {Comput. Geom.}, volume = {40}, number = {2}, pages = {138--147}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.05.003}, doi = {10.1016/J.COMGEO.2007.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KeszeghPPT08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KettnerMPSY08, author = {Lutz Kettner and Kurt Mehlhorn and Sylvain Pion and Stefan Schirra and Chee{-}Keng Yap}, title = {Classroom examples of robustness problems in geometric computations}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {61--78}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.06.003}, doi = {10.1016/J.COMGEO.2007.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KettnerMPSY08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MaheshwariSZ08, author = {Anil Maheshwari and Michiel H. M. Smid and Norbert Zeh}, title = {I/O-efficient algorithms for computing planar geometric spanners}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {252--271}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.07.007}, doi = {10.1016/J.COMGEO.2007.07.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSZ08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Malamatos08, author = {Theocharis Malamatos}, title = {Lower bounds for expected-case planar point location}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {91--103}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.06.001}, doi = {10.1016/J.COMGEO.2007.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Malamatos08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MoetKK08, author = {Esther Moet and Christian Knauer and Marc J. van Kreveld}, title = {Visibility maps of segments and triangles in 3D}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {163--177}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.11.001}, doi = {10.1016/J.COMGEO.2006.11.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MoetKK08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MoetKS08, author = {Esther Moet and Marc J. van Kreveld and A. Frank van der Stappen}, title = {On realistic terrains}, journal = {Comput. Geom.}, volume = {41}, number = {1-2}, pages = {48--67}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.008}, doi = {10.1016/J.COMGEO.2007.10.008}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/MoetKS08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Morin08, author = {Pat Morin}, title = {An optimal randomized algorithm for d-variate zonoid depth}, journal = {Comput. Geom.}, volume = {39}, number = {3}, pages = {229--235}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2006.12.002}, doi = {10.1016/J.COMGEO.2006.12.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Morin08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/MustafaR08, author = {Nabil H. Mustafa and Saurabh Ray}, title = {Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon)) in any dimension}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {84--91}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.02.006}, doi = {10.1016/J.COMGEO.2007.02.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/MustafaR08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Packer08, author = {Eli Packer}, title = {Iterated snap rounding with bounded drift}, journal = {Comput. Geom.}, volume = {40}, number = {3}, pages = {231--251}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.09.002}, doi = {10.1016/J.COMGEO.2007.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Packer08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Tan08, author = {Xuehou Tan}, title = {A unified and efficient solution to the room search problem}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {45--60}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.04.001}, doi = {10.1016/J.COMGEO.2007.04.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Tan08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Wulff-Nilsen08, author = {Christian Wulff{-}Nilsen}, title = {Steiner hull algorithm for the uniform orientation metrics}, journal = {Comput. Geom.}, volume = {40}, number = {1}, pages = {1--13}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.10.002}, doi = {10.1016/J.COMGEO.2007.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZareiG08, author = {Alireza Zarei and Mohammad Ghodsi}, title = {Query point visibility computation in polygons with holes}, journal = {Comput. Geom.}, volume = {39}, number = {2}, pages = {78--90}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2007.02.005}, doi = {10.1016/J.COMGEO.2007.02.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZareiG08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/ZomorodianC08, author = {Afra Zomorodian and Gunnar E. Carlsson}, title = {Localized homology}, journal = {Comput. Geom.}, volume = {41}, number = {3}, pages = {126--148}, year = {2008}, url = {https://doi.org/10.1016/j.comgeo.2008.02.003}, doi = {10.1016/J.COMGEO.2008.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/ZomorodianC08.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbamB07, author = {Mohammad Ali Abam and Mark de Berg}, title = {Kinetic sorting and kinetic convex hulls}, journal = {Comput. Geom.}, volume = {37}, number = {1}, pages = {16--26}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.02.004}, doi = {10.1016/J.COMGEO.2006.02.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbamB07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnCPSV07, author = {Hee{-}Kap Ahn and Otfried Cheong and Chong{-}Dae Park and Chan{-}Su Shin and Antoine Vigneron}, title = {Maximizing the overlap of two planar convex sets under rigid motions}, journal = {Comput. Geom.}, volume = {37}, number = {1}, pages = {3--15}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.01.005}, doi = {10.1016/J.COMGEO.2006.01.005}, timestamp = {Tue, 16 Aug 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/AhnCPSV07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerK07, author = {Oswin Aichholzer and Hannes Krasser}, title = {Abstract order type extension and new results on the rectilinear crossing number}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {2--15}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2005.07.005}, doi = {10.1016/J.COMGEO.2005.07.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerK07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AichholzerR07, author = {Oswin Aichholzer and Klaus Reinhardt}, title = {A quadratic distance bound on sliding between crossing-free spanning trees}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {155--161}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2004.12.010}, doi = {10.1016/J.COMGEO.2004.12.010}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AichholzerR07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AlexandronKS07, author = {Giora Alexandron and Haim Kaplan and Micha Sharir}, title = {Kinetic and dynamic data structures for convex hulls and upper envelopes}, journal = {Comput. Geom.}, volume = {36}, number = {2}, pages = {144--158}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.01.002}, doi = {10.1016/J.COMGEO.2006.01.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AlexandronKS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AnderssonGL07, author = {Mattias Andersson and Joachim Gudmundsson and Christos Levcopoulos}, title = {Approximate distance oracles for graphs with dense clusters}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {142--154}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2004.12.011}, doi = {10.1016/J.COMGEO.2004.12.011}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AnderssonGL07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BandyopadhyayS07, author = {Deepak Bandyopadhyay and Jack Snoeyink}, title = {Almost-Delaunay simplices: Robust neighbor relations for imprecise 3D points using {CGAL}}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {4--15}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.003}, doi = {10.1016/J.COMGEO.2006.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BandyopadhyayS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BekosKSW07, author = {Michael A. Bekos and Michael Kaufmann and Antonios Symvonis and Alexander Wolff}, title = {Boundary labeling: Models and efficient algorithms for rectangular maps}, journal = {Comput. Geom.}, volume = {36}, number = {3}, pages = {215--236}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.003}, doi = {10.1016/J.COMGEO.2006.05.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BekosKSW07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregDSV07, author = {Sergey Bereg and Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and Carlos Seara and Inmaculada Ventura}, title = {On finding widest empty curved corridors}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {154--169}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2007.02.003}, doi = {10.1016/J.COMGEO.2007.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeregDSV07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergGOS07, author = {Mark de Berg and Joachim Gudmundsson and Ren{\'{e}} van Oostrum and Bettina Speckmann}, title = {Editorial}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {1}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.001}, doi = {10.1016/J.COMGEO.2006.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergGOS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergHO07, author = {Mark de Berg and Dan Halperin and Mark H. Overmars}, title = {An intersection-sensitive algorithm for snap rounding}, journal = {Comput. Geom.}, volume = {36}, number = {3}, pages = {159--165}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.03.002}, doi = {10.1016/J.COMGEO.2006.03.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergHO07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoissonnatGO07, author = {Jean{-}Daniel Boissonnat and Leonidas J. Guibas and Steve Oudot}, title = {Learning smooth shapes by probing}, journal = {Comput. Geom.}, volume = {37}, number = {1}, pages = {38--58}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.008}, doi = {10.1016/J.COMGEO.2006.05.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatGO07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseD07, author = {Prosenjit Bose and Luc Devroye}, title = {On the stabbing number of a random Delaunay triangulation}, journal = {Comput. Geom.}, volume = {36}, number = {2}, pages = {89--105}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.005}, doi = {10.1016/J.COMGEO.2006.05.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseD07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseMMMSV07, author = {Prosenjit Bose and Anil Maheshwari and Pat Morin and Jason Morrison and Michiel H. M. Smid and Jan Vahrenhold}, title = {Space-efficient geometric divide-and-conquer algorithms}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {209--227}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.03.006}, doi = {10.1016/J.COMGEO.2006.03.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseMMMSV07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BrassCDEEIKLM07, author = {Peter Bra{\ss} and Eowyn Cenek and Christian A. Duncan and Alon Efrat and Cesim Erten and Dan Ismailescu and Stephen G. Kobourov and Anna Lubiw and Joseph S. B. Mitchell}, title = {On simultaneous planar graph embeddings}, journal = {Comput. Geom.}, volume = {36}, number = {2}, pages = {117--130}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.006}, doi = {10.1016/J.COMGEO.2006.05.006}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/BrassCDEEIKLM07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CortesM07, author = {Carmen Cort{\'{e}}s and Alberto M{\'{a}}rquez}, title = {Editorial}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {141}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.08.001}, doi = {10.1016/J.COMGEO.2006.08.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CortesM07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeyGG07, author = {Tamal K. Dey and Joachim Giesen and Samrat Goswami}, title = {Delaunay triangulations approximate anchor hulls}, journal = {Comput. Geom.}, volume = {36}, number = {2}, pages = {131--143}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.01.001}, doi = {10.1016/J.COMGEO.2006.01.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DeyGG07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DujmovicESW07, author = {Vida Dujmovic and David Eppstein and Matthew Suderman and David R. Wood}, title = {Drawings of planar graphs with few slopes and segments}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {194--212}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.09.002}, doi = {10.1016/J.COMGEO.2006.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DujmovicESW07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DujmovicSW07, author = {Vida Dujmovic and Matthew Suderman and David R. Wood}, title = {Graph drawings with few slopes}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {181--193}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.08.002}, doi = {10.1016/J.COMGEO.2006.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DujmovicSW07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DumitrescuEGKR07, author = {Adrian Dumitrescu and Annette Ebbers{-}Baumann and Ansgar Gr{\"{u}}ne and Rolf Klein and G{\"{u}}nter Rote}, title = {On the geometric dilation of closed curves, graphs, and point sets}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {16--38}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2005.07.004}, doi = {10.1016/J.COMGEO.2005.07.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuEGKR07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Ebbers-BaumannGK07, author = {Annette Ebbers{-}Baumann and Ansgar Gr{\"{u}}ne and Rolf Klein}, title = {Geometric dilation of closed planar curves: New lower bounds}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {188--208}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2004.12.009}, doi = {10.1016/J.COMGEO.2004.12.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Ebbers-BaumannGK07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EfratGHZ07, author = {Alon Efrat and Leonidas J. Guibas and Olaf A. Hall{-}Holt and Li Zhang}, title = {On incremental rendering of silhouette maps of a polyhedral scene}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {129--138}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.12.003}, doi = {10.1016/J.COMGEO.2006.12.003}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EfratGHZ07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EppsteinW07, author = {David Eppstein and Kevin A. Wortman}, title = {Minimum dilation stars}, journal = {Comput. Geom.}, volume = {37}, number = {1}, pages = {27--37}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.007}, doi = {10.1016/J.COMGEO.2006.05.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EppsteinW07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FragoudakisMZ07, author = {Christodoulos Fragoudakis and Euripides Markou and Stathis Zachos}, title = {Maximizing the guarded boundary of an Art Gallery is APX-complete}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {170--180}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.12.001}, doi = {10.1016/J.COMGEO.2006.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FragoudakisMZ07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Freedman07, author = {Daniel Freedman}, title = {An incremental algorithm for reconstruction of surfaces of arbitrary codimension}, journal = {Comput. Geom.}, volume = {36}, number = {2}, pages = {106--116}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.004}, doi = {10.1016/J.COMGEO.2006.05.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Freedman07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GartnerV07, author = {Bernd G{\"{a}}rtner and Remco C. Veltkamp}, title = {A decade of {CGAL}}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {1--3}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2007.02.001}, doi = {10.1016/J.COMGEO.2007.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GartnerV07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Gonzalez-GutierrezG07, author = {Arturo Gonzalez{-}Gutierrez and Teofilo F. Gonzalez}, title = {Complexity of the minimum-length corridor problem}, journal = {Comput. Geom.}, volume = {37}, number = {2}, pages = {72--103}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.10.002}, doi = {10.1016/J.COMGEO.2006.10.002}, timestamp = {Sun, 02 Oct 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/Gonzalez-GutierrezG07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonL07, author = {Joachim Gudmundsson and Christos Levcopoulos}, title = {Minimum weight pseudo-triangulations}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {139--153}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2007.05.004}, doi = {10.1016/J.COMGEO.2007.05.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonL07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GudmundssonNS07, author = {Joachim Gudmundsson and Giri Narasimhan and Michiel H. M. Smid}, title = {Distance-preserving approximations of polygonal paths}, journal = {Comput. Geom.}, volume = {36}, number = {3}, pages = {183--196}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.05.002}, doi = {10.1016/J.COMGEO.2006.05.002}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonNS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HachenbergerKM07, author = {Peter Hachenberger and Lutz Kettner and Kurt Mehlhorn}, title = {Boolean operations on 3D selective Nef complexes: Data structure, algorithms, optimized implementation and experiments}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {64--99}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.009}, doi = {10.1016/J.COMGEO.2006.11.009}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HachenbergerKM07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Har-Peled07, author = {Sariel Har{-}Peled}, title = {How to get close to the median shape}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {39--51}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.02.003}, doi = {10.1016/J.COMGEO.2006.02.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Har-Peled07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HertHKPS07, author = {Susan Hert and Michael Hoffmann and Lutz Kettner and Sylvain Pion and Michael Seel}, title = {An adaptable and extensible geometry kernel}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {16--36}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.004}, doi = {10.1016/J.COMGEO.2006.11.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HertHKPS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HurtadoM07, author = {Ferran Hurtado and Joseph S. B. Mitchell}, title = {Editorial}, journal = {Comput. Geom.}, volume = {37}, number = {1}, pages = {1--2}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.07.002}, doi = {10.1016/J.COMGEO.2006.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HurtadoM07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KnauerSSW07, author = {Christian Knauer and {\'{E}}tienne Schramm and Andreas Spillner and Alexander Wolff}, title = {Configurations with few crossings in topological graphs}, journal = {Comput. Geom.}, volume = {37}, number = {2}, pages = {104--114}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.06.001}, doi = {10.1016/J.COMGEO.2006.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KnauerSSW07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KokKL07, author = {Thierry de Kok and Marc J. van Kreveld and Maarten L{\"{o}}ffler}, title = {Generating realistic terrains with higher-order Delaunay triangulations}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {52--65}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2005.09.005}, doi = {10.1016/J.COMGEO.2005.09.005}, timestamp = {Fri, 09 Apr 2021 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/KokKL07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KosowskiMZ07, author = {Adrian Kosowski and Michal Malafiejski and Pawel Zylinski}, title = {Cooperative mobile guards in grids}, journal = {Comput. Geom.}, volume = {37}, number = {2}, pages = {59--71}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.002}, doi = {10.1016/J.COMGEO.2006.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KosowskiMZ07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KreveldS07, author = {Marc J. van Kreveld and Bettina Speckmann}, title = {On rectangular cartograms}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {175--187}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.06.002}, doi = {10.1016/J.COMGEO.2006.06.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KreveldS07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KruithofV07, author = {Nico Kruithof and Gert Vegter}, title = {Meshing skin surfaces with certified topology}, journal = {Comput. Geom.}, volume = {36}, number = {3}, pages = {166--182}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.01.003}, doi = {10.1016/J.COMGEO.2006.01.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KruithofV07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/PourninL07, author = {Lionel Pournin and Thomas M. Liebling}, title = {Constrained paths in the flip-graph of regular triangulations}, journal = {Comput. Geom.}, volume = {37}, number = {2}, pages = {134--140}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.07.001}, doi = {10.1016/J.COMGEO.2006.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/PourninL07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RineauY07, author = {Laurent Rineau and Mariette Yvinec}, title = {A generic software design for Delaunay refinement meshing}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {100--110}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.008}, doi = {10.1016/J.COMGEO.2006.11.008}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RineauY07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Rote07, author = {G{\"{u}}nter Rote}, title = {Computing the Fr{\'{e}}chet distance between piecewise smooth curves}, journal = {Comput. Geom.}, volume = {37}, number = {3}, pages = {162--174}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2005.01.004}, doi = {10.1016/J.COMGEO.2005.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Rote07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RoyDN07, author = {Sasanka Roy and Sandip Das and Subhas C. Nandy}, title = {Shortest monotone descent path problem in polyhedral terrain}, journal = {Comput. Geom.}, volume = {37}, number = {2}, pages = {115--133}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.06.003}, doi = {10.1016/J.COMGEO.2006.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RoyDN07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/RusselKG07, author = {Daniel Russel and Menelaos I. Karavelas and Leonidas J. Guibas}, title = {A package for exact kinetic data structures and sweepline algorithms}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {111--127}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.006}, doi = {10.1016/J.COMGEO.2006.11.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/RusselKG07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/SchindelhauerVZ07, author = {Christian Schindelhauer and Klaus Volbert and Martin Ziegler}, title = {Geometric spanners with applications in wireless networks}, journal = {Comput. Geom.}, volume = {36}, number = {3}, pages = {197--214}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.02.001}, doi = {10.1016/J.COMGEO.2006.02.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/SchindelhauerVZ07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Vahrenhold07, author = {Jan Vahrenhold}, title = {Line-segment intersection made in-place}, journal = {Comput. Geom.}, volume = {38}, number = {3}, pages = {213--230}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.09.001}, doi = {10.1016/J.COMGEO.2006.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Vahrenhold07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WeinBH07, author = {Ron Wein and Jur P. van den Berg and Dan Halperin}, title = {The visibility-Voronoi complex and its applications}, journal = {Comput. Geom.}, volume = {36}, number = {1}, pages = {66--87}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2005.11.007}, doi = {10.1016/J.COMGEO.2005.11.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WeinBH07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/WeinFZH07, author = {Ron Wein and Efi Fogel and Baruch Zukerman and Dan Halperin}, title = {Advanced programming techniques applied to Cgal's arrangement package}, journal = {Comput. Geom.}, volume = {38}, number = {1-2}, pages = {37--63}, year = {2007}, url = {https://doi.org/10.1016/j.comgeo.2006.11.007}, doi = {10.1016/J.COMGEO.2006.11.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/WeinFZH07.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AbellanasBHORT06, author = {Manuel Abellanas and Sergey Bereg and Ferran Hurtado and Alfredo Garc{\'{\i}}a Olaverri and David Rappaport and Javier Tejel}, title = {Moving coins}, journal = {Comput. Geom.}, volume = {34}, number = {1}, pages = {35--48}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.06.005}, doi = {10.1016/J.COMGEO.2005.06.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AbellanasBHORT06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AgarwalM06, author = {Pankaj K. Agarwal and Nabil H. Mustafa}, title = {Independent set of intersection graphs of convex objects in 2D}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {83--95}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.12.001}, doi = {10.1016/J.COMGEO.2005.12.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AgarwalM06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AhnBCNSV06, author = {Hee{-}Kap Ahn and Peter Bra{\ss} and Otfried Cheong and Hyeon{-}Suk Na and Chan{-}Su Shin and Antoine Vigneron}, title = {Inscribing an axially symmetric polygon and other approximation algorithms for planar convex sets}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {152--164}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.06.001}, doi = {10.1016/J.COMGEO.2005.06.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AhnBCNSV06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkiyamaHKN06, author = {Jin Akiyama and Koichi Hirata and Midori Kobayashi and Gisaku Nakamura}, title = {Convex developments of a regular tetrahedron}, journal = {Comput. Geom.}, volume = {34}, number = {1}, pages = {2--10}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.07.003}, doi = {10.1016/J.COMGEO.2005.07.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaHKN06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AkiyamaKT06, author = {Jin Akiyama and Mikio Kano and Xuehou Tan}, title = {Editorial}, journal = {Comput. Geom.}, volume = {34}, number = {1}, pages = {1}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.09.001}, doi = {10.1016/J.COMGEO.2005.09.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaKT06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/AronovBCC06, author = {Boris Aronov and Herv{\'{e}} Br{\"{o}}nnimann and Allen Y. Chang and Yi{-}Jen Chiang}, title = {Cost prediction for ray shooting in octrees}, journal = {Comput. Geom.}, volume = {34}, number = {3}, pages = {159--181}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.09.002}, doi = {10.1016/J.COMGEO.2005.09.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/AronovBCC06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BenkertWWS06, author = {Marc Benkert and Alexander Wolff and Florian Widmann and Takeshi Shirabe}, title = {The minimum Manhattan network problem: Approximations and exact solutions}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {188--208}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.09.004}, doi = {10.1016/J.COMGEO.2005.09.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BenkertWWS06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BeregBK06, author = {Sergey Bereg and Prosenjit Bose and David G. Kirkpatrick}, title = {Equitable subdivisions within polygonal regions}, journal = {Comput. Geom.}, volume = {34}, number = {1}, pages = {20--27}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.06.003}, doi = {10.1016/J.COMGEO.2005.06.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BeregBK06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BergS06, author = {Mark de Berg and Micha Streppel}, title = {Approximate range searching using binary space partitions}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {139--151}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.003}, doi = {10.1016/J.COMGEO.2005.08.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BergS06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BhattacharyaGS06, author = {Binay K. Bhattacharya and Subir Kumar Ghosh and Thomas C. Shermer}, title = {A linear time algorithm to remove winding of a simple polygon}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {165--173}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.05.001}, doi = {10.1016/J.COMGEO.2005.05.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaGS06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoissonnatS06, author = {Jean{-}Daniel Boissonnat and Jack Snoeyink}, title = {Editorial}, journal = {Comput. Geom.}, volume = {35}, number = {1-2}, pages = {1}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.10.007}, doi = {10.1016/J.COMGEO.2005.10.007}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatS06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BoseHRW06, author = {Prosenjit Bose and Ferran Hurtado and Eduardo Rivera{-}Campo and David R. Wood}, title = {Partitions of complete geometric graphs into plane trees}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {116--125}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.006}, doi = {10.1016/J.COMGEO.2005.08.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BoseHRW06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BronnimannC06, author = {Herv{\'{e}} Br{\"{o}}nnimann and Timothy M. Chan}, title = {Space-efficient algorithms for computing the convex hull of a simple polygonal line in linear time}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {75--82}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.11.005}, doi = {10.1016/J.COMGEO.2005.11.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BronnimannC06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/BronnimannG06, author = {Herv{\'{e}} Br{\"{o}}nnimann and Marc Glisse}, title = {Octrees with near optimal cost for ray-shooting}, journal = {Comput. Geom.}, volume = {34}, number = {3}, pages = {182--194}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.09.003}, doi = {10.1016/J.COMGEO.2005.09.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/BronnimannG06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/CarmiKM06, author = {Paz Carmi and Matthew J. Katz and Joseph S. B. Mitchell}, title = {The minimum-area spanning tree problem}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {218--225}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2006.03.001}, doi = {10.1016/J.COMGEO.2006.03.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/CarmiKM06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Chan06, author = {Timothy M. Chan}, title = {Faster core-set constructions and data-stream algorithms in fixed dimensions}, journal = {Comput. Geom.}, volume = {35}, number = {1-2}, pages = {20--35}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.10.002}, doi = {10.1016/J.COMGEO.2005.10.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Chan06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Chan06a, author = {Timothy M. Chan}, title = {Three problems about simple polygons}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {209--217}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.11.002}, doi = {10.1016/J.COMGEO.2005.11.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Chan06a.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Cheng06, author = {Siu{-}Wing Cheng}, title = {On the sizes of Delaunay meshes}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {130--138}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.002}, doi = {10.1016/J.COMGEO.2005.08.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Cheng06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DaescuLM06, author = {Ovidiu Daescu and Jun Luo and David M. Mount}, title = {Proximity problems on line segments spanned by points}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {115--129}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.007}, doi = {10.1016/J.COMGEO.2005.08.007}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/DaescuLM06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DaescuMSW06, author = {Ovidiu Daescu and Ningfang Mi and Chan{-}Su Shin and Alexander Wolff}, title = {Farthest-point queries with geometric and combinatorial constraints}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {174--185}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.07.002}, doi = {10.1016/J.COMGEO.2005.07.002}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DaescuMSW06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DancigerDS06, author = {Jeff Danciger and Satyan L. Devadoss and Don Sheehy}, title = {Compatible triangulations and point partitions by series-triangular graphs}, journal = {Comput. Geom.}, volume = {34}, number = {3}, pages = {195--202}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.11.003}, doi = {10.1016/J.COMGEO.2005.11.003}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DancigerDS06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DevillersG06, author = {Olivier Devillers and Philippe Guigue}, title = {Inner and outer rounding of Boolean operations on lattice polygonal regions}, journal = {Comput. Geom.}, volume = {33}, number = {1-2}, pages = {3--17}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2004.08.005}, doi = {10.1016/J.COMGEO.2004.08.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DevillersG06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DeyG06, author = {Tamal K. Dey and Samrat Goswami}, title = {Provable surface reconstruction from noisy samples}, journal = {Comput. Geom.}, volume = {35}, number = {1-2}, pages = {124--141}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.10.006}, doi = {10.1016/J.COMGEO.2005.10.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DeyG06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/DykenF06, author = {Christopher Dyken and Michael S. Floater}, title = {Preferred directions for resolving the non-uniqueness of Delaunay triangulations}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {96--101}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.004}, doi = {10.1016/J.COMGEO.2005.08.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/DykenF06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EfratKL06, author = {Alon Efrat and Stephen G. Kobourov and Anna Lubiw}, title = {Computing homotopic shortest paths efficiently}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {162--172}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2006.03.003}, doi = {10.1016/J.COMGEO.2006.03.003}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EfratKL06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/Eidenbenz06, author = {Stephan J. Eidenbenz}, title = {Finding minimum hidden guard sets in polygons - tight approximability results}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {49--57}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2006.01.004}, doi = {10.1016/J.COMGEO.2006.01.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/Eidenbenz06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EigenwilligKSW06, author = {Arno Eigenwillig and Lutz Kettner and Elmar Sch{\"{o}}mer and Nicola Wolpert}, title = {Exact, efficient, and complete arrangement computation for cubic curves}, journal = {Comput. Geom.}, volume = {35}, number = {1-2}, pages = {36--73}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.10.003}, doi = {10.1016/J.COMGEO.2005.10.003}, timestamp = {Sat, 30 Sep 2023 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/EigenwilligKSW06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/EmirisK06, author = {Ioannis Z. Emiris and Menelaos I. Karavelas}, title = {The predicates of the Apollonius diagram: Algorithmic analysis and implementation}, journal = {Comput. Geom.}, volume = {33}, number = {1-2}, pages = {18--57}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2004.02.006}, doi = {10.1016/J.COMGEO.2004.02.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/EmirisK06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/FeketeKN06, author = {S{\'{a}}ndor P. Fekete and Rolf Klein and Andreas N{\"{u}}chter}, title = {Online searching with an autonomous robot}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {102--115}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.08.005}, doi = {10.1016/J.COMGEO.2005.08.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/FeketeKN06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GaoGN06, author = {Jie Gao and Leonidas J. Guibas and An Thai Nguyen}, title = {Deformable spanners and applications}, journal = {Comput. Geom.}, volume = {35}, number = {1-2}, pages = {2--19}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.10.001}, doi = {10.1016/J.COMGEO.2005.10.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/GaoGN06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/GrimaMO06, author = {Clara I. Grima and Alberto M{\'{a}}rquez and Lidia M. Ortega}, title = {A new 2D tessellation for angle problems: The polar diagram}, journal = {Comput. Geom.}, volume = {34}, number = {2}, pages = {58--74}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.11.004}, doi = {10.1016/J.COMGEO.2005.11.004}, timestamp = {Tue, 14 Jun 2022 01:00:00 +0200}, biburl = {https://dblp.org/rec/journals/comgeo/GrimaMO06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HillarR06, author = {Christopher J. Hillar and Darren L. Rhea}, title = {A result about the density of iterated line intersections in the plane}, journal = {Comput. Geom.}, volume = {33}, number = {3}, pages = {106--114}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.07.001}, doi = {10.1016/J.COMGEO.2005.07.001}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HillarR06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/HoffmannO06, author = {Michael Hoffmann and Yoshio Okamoto}, title = {The minimum weight triangulation problem with few inner points}, journal = {Comput. Geom.}, volume = {34}, number = {3}, pages = {149--158}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.11.006}, doi = {10.1016/J.COMGEO.2005.11.006}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/HoffmannO06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KakoulisT06, author = {Konstantinos G. Kakoulis and Ioannis G. Tollis}, title = {Algorithms for the multiple label placement problem}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {143--161}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2006.03.005}, doi = {10.1016/J.COMGEO.2006.03.005}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KakoulisT06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KeilV06, author = {J. Mark Keil and Tzvetalin S. Vassilev}, title = {Algorithms for optimal area triangulations of a convex polygon}, journal = {Comput. Geom.}, volume = {35}, number = {3}, pages = {173--187}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2006.03.004}, doi = {10.1016/J.COMGEO.2006.03.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KeilV06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
@article{DBLP:journals/comgeo/KleinLL06, author = {Rolf Klein and Christos Levcopoulos and Andrzej Lingas}, title = {A {PTAS} for minimum vertex dilation triangulation of a simple polygon with a constant number of sources of dilation}, journal = {Comput. Geom.}, volume = {34}, number = {1}, pages = {28--34}, year = {2006}, url = {https://doi.org/10.1016/j.comgeo.2005.06.004}, doi = {10.1016/J.COMGEO.2005.06.004}, timestamp = {Thu, 11 Feb 2021 00:00:00 +0100}, biburl = {https://dblp.org/rec/journals/comgeo/KleinLL06.bib}, bibsource = {dblp computer science bibliography, https://dblp.org} }
manage site settings
To protect your privacy, all features that rely on external API calls from your browser are turned off by default. You need to opt-in for them to become active. All settings here will be stored as cookies with your web browser. For more information see our F.A.Q.