Stop the war!Остановите войну!
for scientists:
default search action
Google
Google Scholar
Semantic Scholar
Internet Archive Scholar
CiteSeerX
ORCIDSearch dblp for Publications
export results for "stream:streams/journals/comgeo:"
more than 1000 matches, exporting first 1000 hits only!
download as .bib file
@article{DBLP:journals/comgeo/AgarwalKS24,
author = {Pankaj K. Agarwal and
Matthew J. Katz and
Micha Sharir},
title = {On reverse shortest paths in geometric proximity graphs},
journal = {Comput. Geom.},
volume = {117},
pages = {102053},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102053},
doi = {10.1016/J.COMGEO.2023.102053},
timestamp = {Fri, 20 Oct 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AgarwalKS24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg24,
author = {Franz J. Brandenburg},
title = {Straight-line drawings of 1-planar graphs},
journal = {Comput. Geom.},
volume = {116},
pages = {102036},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102036},
doi = {10.1016/J.COMGEO.2023.102036},
timestamp = {Thu, 31 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CurryDGHKM24,
author = {Justin Curry and
Jordan DeSha and
Ad{\'{e}}lie Garin and
Kathryn Hess and
Lida Kanari and
Brendan Mallery},
title = {From trees to barcodes and back again {II:} Combinatorial and probabilistic
aspects of a topological inverse problem},
journal = {Comput. Geom.},
volume = {116},
pages = {102031},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102031},
doi = {10.1016/J.COMGEO.2023.102031},
timestamp = {Mon, 04 Dec 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CurryDGHKM24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoxHR24,
author = {Emily Fox and
Hongyao Huang and
Benjamin Raichel},
title = {Clustering with faulty centers},
journal = {Comput. Geom.},
volume = {117},
pages = {102052},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102052},
doi = {10.1016/J.COMGEO.2023.102052},
timestamp = {Fri, 20 Oct 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FoxHR24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Glickenstein24,
author = {David Glickenstein},
title = {Geometric triangulations and discrete Laplacians on manifolds: An
update},
journal = {Comput. Geom.},
volume = {118},
pages = {102063},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102063},
doi = {10.1016/J.COMGEO.2023.102063},
timestamp = {Sun, 31 Dec 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Glickenstein24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeS24,
author = {Meng He and
Don Sheehy},
title = {Guest editorial: Special issue on the 33rd Canadian Conference on
Computational Geometry {(CCCG)}},
journal = {Comput. Geom.},
volume = {116},
pages = {102035},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102035},
doi = {10.1016/J.COMGEO.2023.102035},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HeS24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MajhiVW24,
author = {Sushovan Majhi and
Jeffrey Vitter and
Carola Wenk},
title = {Approximating Gromov-Hausdorff distance in Euclidean space},
journal = {Comput. Geom.},
volume = {116},
pages = {102034},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102034},
doi = {10.1016/J.COMGEO.2023.102034},
timestamp = {Thu, 31 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/MajhiVW24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MajhiW24,
author = {Sushovan Majhi and
Carola Wenk},
title = {Distance measures for geometric graphs},
journal = {Comput. Geom.},
volume = {118},
pages = {102056},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102056},
doi = {10.1016/J.COMGEO.2023.102056},
timestamp = {Sun, 31 Dec 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MajhiW24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MalicS24,
author = {Goran Malic and
Ileana Streinu},
title = {Enumerating combinatorial resultant trees},
journal = {Comput. Geom.},
volume = {118},
pages = {102064},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102064},
doi = {10.1016/J.COMGEO.2023.102064},
timestamp = {Fri, 08 Mar 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MalicS24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PoureidiF24,
author = {Abolfazl Poureidi and
Mohammad Farshi},
title = {On algorithmic complexity of imprecise spanners},
journal = {Comput. Geom.},
volume = {117},
pages = {102051},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102051},
doi = {10.1016/J.COMGEO.2023.102051},
timestamp = {Fri, 27 Oct 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/PoureidiF24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Radons24,
author = {Manuel Radons},
title = {Edge-unfolding nested prismatoids},
journal = {Comput. Geom.},
volume = {116},
pages = {102033},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102033},
doi = {10.1016/J.COMGEO.2023.102033},
timestamp = {Thu, 31 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Radons24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RieckS24,
author = {Christian Rieck and
Christian Scheffer},
title = {The dispersive art gallery problem},
journal = {Comput. Geom.},
volume = {117},
pages = {102054},
year = {2024},
url = {https://doi.org/10.1016/j.comgeo.2023.102054},
doi = {10.1016/J.COMGEO.2023.102054},
timestamp = {Fri, 08 Mar 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RieckS24.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashCM23,
author = {A. Karim Abu{-}Affash and
Paz Carmi and
Meytal Maman},
title = {Piercing pairwise intersecting geodesic disks by five points},
journal = {Comput. Geom.},
volume = {109},
pages = {101947},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101947},
doi = {10.1016/J.COMGEO.2022.101947},
timestamp = {Thu, 10 Nov 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashCM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AfshaniK23,
author = {Peyman Afshani and
Rasmus Killmann},
title = {Rectangle stabbing and orthogonal range reporting lower bounds in
moderate dimensions},
journal = {Comput. Geom.},
volume = {111},
pages = {101959},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101959},
doi = {10.1016/J.COMGEO.2022.101959},
timestamp = {Thu, 16 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AfshaniK23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalGHT23,
author = {Pankaj K. Agarwal and
Tzvika Geft and
Dan Halperin and
Erin Taylor},
title = {Multi-robot motion planning for unit discs with revolving areas},
journal = {Comput. Geom.},
volume = {114},
pages = {102019},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102019},
doi = {10.1016/J.COMGEO.2023.102019},
timestamp = {Tue, 20 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AgarwalGHT23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerEH23,
author = {Oswin Aichholzer and
David Eppstein and
Eva{-}Maria Hainzl},
title = {Geometric dominating sets - a minimum version of the No-Three-In-Line
Problem},
journal = {Comput. Geom.},
volume = {108},
pages = {101913},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101913},
doi = {10.1016/J.COMGEO.2022.101913},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerEH23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCEIS23,
author = {Boris Aronov and
Mark de Berg and
Jean Cardinal and
Esther Ezra and
John Iacono and
Micha Sharir},
title = {Subquadratic algorithms for some 3Sum-hard geometric problems in the
algebraic decision-tree model},
journal = {Comput. Geom.},
volume = {109},
pages = {101945},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101945},
doi = {10.1016/J.COMGEO.2022.101945},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AronovBCEIS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovESZ23,
author = {Boris Aronov and
Esther Ezra and
Micha Sharir and
Guy Zigdon},
title = {Time and space efficient collinearity indexing},
journal = {Comput. Geom.},
volume = {110},
pages = {101963},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101963},
doi = {10.1016/J.COMGEO.2022.101963},
timestamp = {Fri, 20 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovESZ23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshurK23,
author = {Stav Ashur and
Matthew J. Katz},
title = {A 4-approximation of the 2{\(\pi\)}3-MST},
journal = {Comput. Geom.},
volume = {108},
pages = {101914},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101914},
doi = {10.1016/J.COMGEO.2022.101914},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AshurK23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhajianF23,
author = {Ziv Bakhajian and
Ohad Noy Feldheim},
title = {Drawing outerplanar graphs using thirteen edge lengths},
journal = {Comput. Geom.},
volume = {110},
pages = {101964},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101964},
doi = {10.1016/J.COMGEO.2022.101964},
timestamp = {Tue, 31 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BakhajianF23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BalkoST23,
author = {Martin Balko and
Adam Sheffer and
Ruiwen Tang},
title = {The constant of point-line incidence constructions},
journal = {Comput. Geom.},
volume = {114},
pages = {102009},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102009},
doi = {10.1016/J.COMGEO.2023.102009},
timestamp = {Fri, 07 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BalkoST23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikRR23,
author = {Aritra Banik and
Rajiv Raman and
Saurabh Ray},
title = {On the geometric priority set cover problem},
journal = {Comput. Geom.},
volume = {112},
pages = {101984},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101984},
doi = {10.1016/J.COMGEO.2023.101984},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BanikRR23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetM23,
author = {Gill Barequet and
Bar Magal},
title = {Automatic generation of formulae for polyominoes with a fixed perimeter
defect},
journal = {Comput. Geom.},
volume = {108},
pages = {101919},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101919},
doi = {10.1016/J.COMGEO.2022.101919},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BarequetM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaumeisterK23,
author = {Markus Baumeister and
Leif Kobbelt},
title = {How close is a quad mesh to a polycube?},
journal = {Comput. Geom.},
volume = {111},
pages = {101978},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101978},
doi = {10.1016/J.COMGEO.2022.101978},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaumeisterK23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergS23,
author = {Sarita de Berg and
Frank Staals},
title = {Dynamic data structures for \emph{k}-nearest neighbor queries},
journal = {Comput. Geom.},
volume = {111},
pages = {101976},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101976},
doi = {10.1016/J.COMGEO.2022.101976},
timestamp = {Sat, 13 May 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BergS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BertschingerRM23,
author = {Daniel Bertschinger and
Meghana M. Reddy and
Enrico Mann},
title = {Lions and contamination: Monotone clearings},
journal = {Comput. Geom.},
volume = {110},
pages = {101961},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101961},
doi = {10.1016/J.COMGEO.2022.101961},
timestamp = {Tue, 31 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BertschingerRM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhoreLNRW23,
author = {Sujoy Bhore and
Guangping Li and
Martin N{\"{o}}llenburg and
Ignaz Rutter and
Hsiang{-}Yun Wu},
title = {Untangling circular drawings: Algorithms and complexity},
journal = {Comput. Geom.},
volume = {111},
pages = {101975},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101975},
doi = {10.1016/J.COMGEO.2022.101975},
timestamp = {Sat, 13 May 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BhoreLNRW23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazBW23,
author = {Ahmad Biniaz and
Prosenjit Bose and
Yunkai Wang},
title = {Simple linear time algorithms for piercing pairwise intersecting disks},
journal = {Comput. Geom.},
volume = {114},
pages = {102011},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102011},
doi = {10.1016/J.COMGEO.2023.102011},
timestamp = {Mon, 26 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazBW23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciDM23,
author = {Carla Binucci and
Walter Didimo and
Fabrizio Montecchiani},
title = {1-planarity testing and embedding: An experimental study},
journal = {Comput. Geom.},
volume = {108},
pages = {101900},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101900},
doi = {10.1016/J.COMGEO.2022.101900},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BinucciDM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusFKM23,
author = {Thomas Bl{\"{a}}sius and
Tobias Friedrich and
Martin S. Krejca and
Louise Molitor},
title = {The impact of geometry on monochrome regions in the flip Schelling
process},
journal = {Comput. Geom.},
volume = {108},
pages = {101902},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101902},
doi = {10.1016/J.COMGEO.2022.101902},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BlasiusFKM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BonerathHMN23,
author = {Annika Bonerath and
Jan{-}Henrik Haunert and
Joseph S. B. Mitchell and
Benjamin Niedermann},
title = {Shortcut hulls: Vertex-restricted outer simplifications of polygons},
journal = {Comput. Geom.},
volume = {112},
pages = {101983},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101983},
doi = {10.1016/J.COMGEO.2023.101983},
timestamp = {Tue, 21 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BonerathHMN23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCDMMMS23,
author = {Prosenjit Bose and
Paz Carmi and
Vida Dujmovic and
Saeed Mehrabi and
Fabrizio Montecchiani and
Pat Morin and
Lu{\'{\i}}s Fernando Schultz Xavier da Silveira},
title = {Geodesic obstacle representation of graphs},
journal = {Comput. Geom.},
volume = {109},
pages = {101946},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101946},
doi = {10.1016/J.COMGEO.2022.101946},
timestamp = {Sun, 13 Nov 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCDMMMS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Buchin23,
author = {Kevin Buchin},
title = {Editorial},
journal = {Comput. Geom.},
volume = {113},
pages = {102008},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102008},
doi = {10.1016/J.COMGEO.2023.102008},
timestamp = {Wed, 17 May 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Buchin23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinLOPUV23,
author = {Kevin Buchin and
Maarten L{\"{o}}ffler and
Tim Ophelders and
Aleksandr Popov and
J{\'{e}}r{\^{o}}me Urhausen and
Kevin Verbeek},
title = {Computing the Fr{\'{e}}chet distance between uncertain curves
in one dimension},
journal = {Comput. Geom.},
volume = {109},
pages = {101923},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101923},
doi = {10.1016/J.COMGEO.2022.101923},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinLOPUV23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CalesCEF23,
author = {Ludovic Cal{\`{e}}s and
Apostolos Chalkis and
Ioannis Z. Emiris and
Vissarion Fisikopoulos},
title = {Practical volume approximation of high-dimensional convex bodies,
applied to modeling portfolio dependencies and financial crises},
journal = {Comput. Geom.},
volume = {109},
pages = {101916},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101916},
doi = {10.1016/J.COMGEO.2022.101916},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CalesCEF23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalKMPUV23,
author = {Jean Cardinal and
Kolja Knauer and
Piotr Micek and
D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
Torsten Ueckerdt and
Narmada Varadarajan},
title = {Colouring bottomless rectangles and arborescences},
journal = {Comput. Geom.},
volume = {115},
pages = {102020},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102020},
doi = {10.1016/J.COMGEO.2023.102020},
timestamp = {Fri, 21 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalKMPUV23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChacholskiGJL23,
author = {Wojciech Chach{\'{o}}lski and
Barbara Giunti and
Alvin Jin and
Claudia Landi},
title = {Decomposing filtered chain complexes: Geometry behind barcoding algorithms},
journal = {Comput. Geom.},
volume = {109},
pages = {101938},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101938},
doi = {10.1016/J.COMGEO.2022.101938},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChacholskiGJL23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoO23,
author = {Kyungjin Cho and
Eunjin Oh},
title = {Linear-time approximation scheme for \emph{k}-means clustering of
axis-parallel affine subspaces},
journal = {Comput. Geom.},
volume = {112},
pages = {101981},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101981},
doi = {10.1016/J.COMGEO.2023.101981},
timestamp = {Thu, 16 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChoO23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiJA23,
author = {Jongmin Choi and
Dahye Jeong and
Hee{-}Kap Ahn},
title = {Covering convex polygons by two congruent disks},
journal = {Comput. Geom.},
volume = {109},
pages = {101936},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101936},
doi = {10.1016/J.COMGEO.2022.101936},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChoiJA23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianF23,
author = {Mirela Damian and
Robin Y. Flatland},
title = {Unfolding 3-separated polycube graphs of arbitrary genus},
journal = {Comput. Geom.},
volume = {109},
pages = {101944},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101944},
doi = {10.1016/J.COMGEO.2022.101944},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DamianF23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DasDFGR23,
author = {Arun Kumar Das and
Sandip Das and
Guilherme Dias da Fonseca and
Yan Gerard and
Bastien Rivier},
title = {Complexity results on untangling red-blue matchings},
journal = {Comput. Geom.},
volume = {111},
pages = {101974},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101974},
doi = {10.1016/J.COMGEO.2022.101974},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DasDFGR23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeL23,
author = {Minati De and
Abhiruk Lahiri},
title = {Geometric dominating-set and set-cover via local-search},
journal = {Comput. Geom.},
volume = {113},
pages = {102007},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102007},
doi = {10.1016/J.COMGEO.2023.102007},
timestamp = {Fri, 02 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DeL23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeVW23,
author = {Anway De and
Thong Vo and
Matthew Wright},
title = {Value-offset bifiltrations for digital images},
journal = {Comput. Geom.},
volume = {109},
pages = {101939},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101939},
doi = {10.1016/J.COMGEO.2022.101939},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DeVW23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDDKUZ23,
author = {Erik D. Demaine and
Martin L. Demaine and
Yevhenii Diomidov and
Tonan Kamata and
Ryuhei Uehara and
Hanyu Alice Zhang},
title = {Any platonic solid can transform to another by \emph{O}(1) refoldings},
journal = {Comput. Geom.},
volume = {113},
pages = {101995},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101995},
doi = {10.1016/J.COMGEO.2023.101995},
timestamp = {Wed, 17 May 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineDDKUZ23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDU23,
author = {Erik D. Demaine and
Martin L. Demaine and
Ryuhei Uehara},
title = {Developing a tetramonohedron with minimum cut length},
journal = {Comput. Geom.},
volume = {108},
pages = {101903},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101903},
doi = {10.1016/J.COMGEO.2022.101903},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineDU23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineLS23,
author = {Erik D. Demaine and
Maarten L{\"{o}}ffler and
Christiane Schmidt},
title = {Rectangular Spiral Galaxies are still hard},
journal = {Comput. Geom.},
volume = {110},
pages = {101949},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101949},
doi = {10.1016/J.COMGEO.2022.101949},
timestamp = {Tue, 31 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineLS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevadossH23,
author = {Satyan L. Devadoss and
Matthew S. Harvey},
title = {Unfoldings and nets of regular polytopes},
journal = {Comput. Geom.},
volume = {111},
pages = {101977},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101977},
doi = {10.1016/J.COMGEO.2022.101977},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DevadossH23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EastHP23,
author = {James East and
Michael Hendriksen and
Laurence Park},
title = {On the enumeration of integer tetrahedra},
journal = {Comput. Geom.},
volume = {108},
pages = {101915},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101915},
doi = {10.1016/J.COMGEO.2022.101915},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EastHP23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHLP23,
author = {G{\"{u}}nther Eder and
Martin Held and
Stefan de Lorenzo and
Peter Palfrader},
title = {On the recognition and reconstruction of weighted Voronoi diagrams
and bisector graphs},
journal = {Comput. Geom.},
volume = {109},
pages = {101935},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101935},
doi = {10.1016/J.COMGEO.2022.101935},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EderHLP23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ElkindSS23,
author = {Edith Elkind and
Erel Segal{-}Halevi and
Warut Suksompong},
title = {Keep your distance: Land division with separation},
journal = {Comput. Geom.},
volume = {113},
pages = {102006},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102006},
doi = {10.1016/J.COMGEO.2023.102006},
timestamp = {Tue, 12 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ElkindSS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinFO23,
author = {David Eppstein and
Daniel Frishberg and
Martha C. Osegueda},
title = {Angles of arc-polygons and Lombardi drawings of cacti},
journal = {Comput. Geom.},
volume = {112},
pages = {101982},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101982},
doi = {10.1016/J.COMGEO.2023.101982},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EppsteinFO23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansS23,
author = {William S. Evans and
Lucca Morais de Arruda Siaudzionis},
title = {On path-greedy geometric spanners},
journal = {Comput. Geom.},
volume = {110},
pages = {101948},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101948},
doi = {10.1016/J.COMGEO.2022.101948},
timestamp = {Tue, 31 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EvansS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FerniqueP23,
author = {Thomas Fernique and
Daria Pchelina},
title = {Density of triangulated ternary disc packings},
journal = {Comput. Geom.},
volume = {115},
pages = {102032},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102032},
doi = {10.1016/J.COMGEO.2023.102032},
timestamp = {Fri, 21 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FerniqueP23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriederichGGHS23,
author = {Rachel Friederich and
Anirban Ghosh and
Matthew Graham and
Brian Hicks and
Ronald Shevchenko},
title = {Experiments with unit disk cover algorithms for covering massive pointsets},
journal = {Comput. Geom.},
volume = {109},
pages = {101925},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101925},
doi = {10.1016/J.COMGEO.2022.101925},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FriederichGGHS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Fuentes-Sepulveda23,
author = {Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and
Gonzalo Navarro and
Diego Seco},
title = {Navigating planar topologies in near-optimal space and time},
journal = {Comput. Geom.},
volume = {109},
pages = {101922},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101922},
doi = {10.1016/J.COMGEO.2022.101922},
timestamp = {Wed, 28 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Fuentes-Sepulveda23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FugacciKR23,
author = {Ulderico Fugacci and
Michael Kerber and
Alexander Rolle},
title = {Compression for 2-parameter persistent homology},
journal = {Comput. Geom.},
volume = {109},
pages = {101940},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101940},
doi = {10.1016/J.COMGEO.2022.101940},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FugacciKR23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoM23,
author = {Emilio Di Giacomo and
Fabrizio Montecchiani},
title = {Editorial},
journal = {Comput. Geom.},
volume = {111},
pages = {101980},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101980},
doi = {10.1016/J.COMGEO.2022.101980},
timestamp = {Thu, 16 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiacomoM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GitikJ23,
author = {Rivka Gitik and
Leo Joskowicz},
title = {Half-plane point retrieval queries with independent and dependent
geometric uncertainties},
journal = {Comput. Geom.},
volume = {115},
pages = {102021},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102021},
doi = {10.1016/J.COMGEO.2023.102021},
timestamp = {Fri, 21 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GitikJ23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GonzalezDiazST23,
author = {Roc{\'{\i}}o Gonz{\'{a}}lez{-}D{\'{\i}}az and
M. Soriano{-}Trigueros and
{\'{A}}lvaro Torras{-}Casas},
title = {Partial matchings induced by morphisms between persistence modules},
journal = {Comput. Geom.},
volume = {112},
pages = {101985},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101985},
doi = {10.1016/J.COMGEO.2023.101985},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GonzalezDiazST23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS23,
author = {Joachim Gudmundsson and
Yuan Sha},
title = {Augmenting graphs to minimize the radius},
journal = {Comput. Geom.},
volume = {113},
pages = {101996},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101996},
doi = {10.1016/J.COMGEO.2023.101996},
timestamp = {Fri, 02 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS23a,
author = {Joachim Gudmundsson and
Yuan Sha},
title = {Algorithms for radius-optimally augmenting trees in a metric space},
journal = {Comput. Geom.},
volume = {114},
pages = {102018},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102018},
doi = {10.1016/J.COMGEO.2023.102018},
timestamp = {Fri, 07 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS23a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonSW23,
author = {Joachim Gudmundsson and
Yuan Sha and
Sampson Wong},
title = {Approximating the packedness of polygonal curves},
journal = {Comput. Geom.},
volume = {108},
pages = {101920},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101920},
doi = {10.1016/J.COMGEO.2022.101920},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonSW23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeLS23,
author = {Meng He and
Anna Lubiw and
Mohammad R. Salavatipour},
title = {Preface},
journal = {Comput. Geom.},
volume = {110},
pages = {101958},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101958},
doi = {10.1016/J.COMGEO.2022.101958},
timestamp = {Thu, 24 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HeLS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeldNS23,
author = {Martin Held and
Martin N{\"{o}}llenburg and
Peter Sanders},
title = {Editorial},
journal = {Comput. Geom.},
volume = {110},
pages = {101950},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101950},
doi = {10.1016/J.COMGEO.2022.101950},
timestamp = {Fri, 20 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HeldNS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HiraniKWW23,
author = {Anil N. Hirani and
Kaushik Kalyanaraman and
Han Wang and
Seth Watts},
title = {Computing discrete harmonic differential forms in a given cohomology
class using finite element exterior calculus},
journal = {Comput. Geom.},
volume = {109},
pages = {101937},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101937},
doi = {10.1016/J.COMGEO.2022.101937},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HiraniKWW23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KangCA23,
author = {Byeonguk Kang and
Jongmin Choi and
Hee{-}Kap Ahn},
title = {Intersecting disks using two congruent disks},
journal = {Comput. Geom.},
volume = {110},
pages = {101966},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101966},
doi = {10.1016/J.COMGEO.2022.101966},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KangCA23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KarlT23,
author = {J{\'{a}}nos Karl and
G{\'{e}}za T{\'{o}}th},
title = {Crossing lemma for the odd-crossing number},
journal = {Comput. Geom.},
volume = {108},
pages = {101901},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101901},
doi = {10.1016/J.COMGEO.2022.101901},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KarlT23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzS23,
author = {Matthew J. Katz and
Micha Sharir},
title = {Bottleneck matching in the plane},
journal = {Comput. Geom.},
volume = {112},
pages = {101986},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.101986},
doi = {10.1016/J.COMGEO.2023.101986},
timestamp = {Thu, 16 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KatzS23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimLA23,
author = {Hwi Kim and
Jaegun Lee and
Hee{-}Kap Ahn},
title = {Rectangular partitions of a rectilinear polygon},
journal = {Comput. Geom.},
volume = {110},
pages = {101965},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101965},
doi = {10.1016/J.COMGEO.2022.101965},
timestamp = {Tue, 31 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimLA23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Klost23,
author = {Katharina Klost},
title = {An algorithmic framework for the single source shortest path problem
with applications to disk graphs},
journal = {Comput. Geom.},
volume = {111},
pages = {101979},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101979},
doi = {10.1016/J.COMGEO.2022.101979},
timestamp = {Tue, 28 Mar 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Klost23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LavasaniP23,
author = {Ali Mohammad Lavasani and
Denis Pankratov},
title = {Advice complexity of online non-crossing matching},
journal = {Comput. Geom.},
volume = {110},
pages = {101943},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101943},
doi = {10.1016/J.COMGEO.2022.101943},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LavasaniP23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LuT23,
author = {Shangqi Lu and
Yufei Tao},
title = {Range updates and range sum queries on multidimensional points with
monoid weights},
journal = {Comput. Geom.},
volume = {115},
pages = {102030},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102030},
doi = {10.1016/J.COMGEO.2023.102030},
timestamp = {Fri, 21 Jul 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LuT23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MchedlidzeA23,
author = {Tamara Mchedlidze and
Elena Arseneva},
title = {Editorial},
journal = {Comput. Geom.},
volume = {110},
pages = {101962},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101962},
doi = {10.1016/J.COMGEO.2022.101962},
timestamp = {Fri, 20 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MchedlidzeA23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Medina-Mardones23,
author = {Anibal M. Medina{-}Mardones},
title = {New formulas for cup-\emph{i} products and fast computation of Steenrod
squares},
journal = {Comput. Geom.},
volume = {109},
pages = {101921},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101921},
doi = {10.1016/J.COMGEO.2022.101921},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Medina-Mardones23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ORourkeV23,
author = {Joseph O'Rourke and
Costin V{\^{\i}}lcu},
title = {Cut locus realizations on convex polyhedra},
journal = {Comput. Geom.},
volume = {114},
pages = {102010},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2023.102010},
doi = {10.1016/J.COMGEO.2023.102010},
timestamp = {Mon, 26 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ORourkeV23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Raussen23,
author = {Martin Raussen},
title = {Connectivity of spaces of directed paths in geometric models for concurrent
computation},
journal = {Comput. Geom.},
volume = {109},
pages = {101942},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101942},
doi = {10.1016/J.COMGEO.2022.101942},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Raussen23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheucher23,
author = {Manfred Scheucher},
title = {Many order types on integer grids of polynomial size},
journal = {Comput. Geom.},
volume = {109},
pages = {101924},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101924},
doi = {10.1016/J.COMGEO.2022.101924},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Scheucher23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SethMN23,
author = {Ritesh Seth and
Anil Maheshwari and
Subhas C. Nandy},
title = {Acrophobic guard watchtower problem},
journal = {Comput. Geom.},
volume = {109},
pages = {101918},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101918},
doi = {10.1016/J.COMGEO.2022.101918},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SethMN23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/StehrK23,
author = {Eva Stehr and
Linda Kleist},
title = {Folding polyiamonds into octahedra},
journal = {Comput. Geom.},
volume = {108},
pages = {101917},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101917},
doi = {10.1016/J.COMGEO.2022.101917},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/StehrK23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/UngerKM23,
author = {Florian Unger and
Jonathan Krebs and
Michael G. M{\"{u}}ller},
title = {Simplex closing probabilities in directed graphs},
journal = {Comput. Geom.},
volume = {109},
pages = {101941},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101941},
doi = {10.1016/J.COMGEO.2022.101941},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/UngerKM23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Vodolazskiy23,
author = {Evgeniy Vodolazskiy},
title = {Discrete Fr{\'{e}}chet distance for closed curves},
journal = {Comput. Geom.},
volume = {111},
pages = {101967},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101967},
doi = {10.1016/J.COMGEO.2022.101967},
timestamp = {Sat, 13 May 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Vodolazskiy23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangZ23,
author = {Haitao Wang and
Yiming Zhao},
title = {An optimal algorithm for \emph{L}\({}_{\mbox{1}}\) shortest paths
in unit-disk graphs},
journal = {Comput. Geom.},
volume = {110},
pages = {101960},
year = {2023},
url = {https://doi.org/10.1016/j.comgeo.2022.101960},
doi = {10.1016/J.COMGEO.2022.101960},
timestamp = {Fri, 20 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WangZ23.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashBC22,
author = {A. Karim Abu{-}Affash and
Gali Bar{-}On and
Paz Carmi},
title = {\emph{{\(\delta\)}}-Greedy \emph{t}-spanner},
journal = {Comput. Geom.},
volume = {100},
pages = {101807},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101807},
doi = {10.1016/J.COMGEO.2021.101807},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashBC22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCCABY22,
author = {Taehoon Ahn and
Jongmin Choi and
Chaeyoon Chung and
Hee{-}Kap Ahn and
Sang Won Bae and
Sang Duk Yoon},
title = {Rearranging a sequence of points onto a line},
journal = {Comput. Geom.},
volume = {107},
pages = {101887},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101887},
doi = {10.1016/J.COMGEO.2022.101887},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnCCABY22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnMS22,
author = {Hee{-}Kap Ahn and
Tamara Mtsentlintze and
J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {{CGTA} Awards},
journal = {Comput. Geom.},
volume = {107},
pages = {101896},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101896},
doi = {10.1016/J.COMGEO.2022.101896},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnMS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerKSVV22,
author = {Oswin Aichholzer and
Jan Kyncl and
Manfred Scheucher and
Birgit Vogtenhuber and
Pavel Valtr},
title = {On crossing-families in planar point sets},
journal = {Comput. Geom.},
volume = {107},
pages = {101899},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101899},
doi = {10.1016/J.COMGEO.2022.101899},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerKSVV22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaBB22,
author = {Hugo A. Akitaya and
Ahmad Biniaz and
Prosenjit Bose},
title = {On the spanning and routing ratios of the directed {\(\Theta\)}\({}_{\mbox{6}}\)-graph},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101881},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101881},
doi = {10.1016/J.COMGEO.2022.101881},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AkitayaBB22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaDETU22,
author = {Hugo A. Akitaya and
Erik D. Demaine and
David Eppstein and
Tomohiro Tachi and
Ryuhei Uehara},
title = {Ununfoldable polyhedra with 6 vertices or 6 faces},
journal = {Comput. Geom.},
volume = {103},
pages = {101857},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101857},
doi = {10.1016/J.COMGEO.2021.101857},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AkitayaDETU22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Almendra-Hernandez22,
author = {V{\'{\i}}ctor Hugo Almendra{-}Hern{\'{a}}ndez and
Leonardo Mart{\'{\i}}nez{-}Sandoval},
title = {On prescribing total orders and preorders to pairwise distances of
points in Euclidean space},
journal = {Comput. Geom.},
volume = {107},
pages = {101898},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101898},
doi = {10.1016/J.COMGEO.2022.101898},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Almendra-Hernandez22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlpertBBMNTY22,
author = {Hannah Alpert and
Russell J. Barnes and
Seth Bell and
Anna Mauro and
Na'ama Nevo and
Nataya Tucker and
Hanna Yang},
title = {Routing by matching on convex pieces of grid graphs},
journal = {Comput. Geom.},
volume = {104},
pages = {101862},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101862},
doi = {10.1016/J.COMGEO.2022.101862},
timestamp = {Fri, 13 May 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AlpertBBMNTY22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsashibaBENY22,
author = {Hideto Asashiba and
Micka{\"{e}}l Buchet and
Emerson G. Escolar and
Ken Nakashima and
Michio Yoshiwaki},
title = {On interval decomposability of 2D persistence modules},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101879},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101879},
doi = {10.1016/J.COMGEO.2022.101879},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AsashibaBENY22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshurFKS22,
author = {Stav Ashur and
Omrit Filtser and
Matthew J. Katz and
Rachel Saban},
title = {Terrain-like graphs: PTASs for guarding weakly-visible polygons and
terrains},
journal = {Comput. Geom.},
volume = {101},
pages = {101832},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101832},
doi = {10.1016/J.COMGEO.2021.101832},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AshurFKS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF22,
author = {Davood Bakhshesh and
Mohammad Farshi},
title = {On the plane angle-monotone graphs},
journal = {Comput. Geom.},
volume = {100},
pages = {101818},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101818},
doi = {10.1016/J.COMGEO.2021.101818},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaloghCL22,
author = {J{\'{o}}zsef Balogh and
Felix Christian Clemen and
Bernard Lidick{\'{y}}},
title = {Maximum number of almost similar triangles in the plane},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101880},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101880},
doi = {10.1016/J.COMGEO.2022.101880},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaloghCL22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BauernoppelMS22,
author = {Frank Bauern{\"{o}}ppel and
Anil Maheshwari and
J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {An {\(\Omega\)}(\emph{n}\({}^{\mbox{\emph{d}}}\)) lower bound on the
number of cell crossings for weighted shortest paths in \emph{d}-dimensional
polyhedral structures},
journal = {Comput. Geom.},
volume = {107},
pages = {101897},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101897},
doi = {10.1016/J.COMGEO.2022.101897},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BauernoppelMS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeltramoS22,
author = {Gabriele Beltramo and
Primoz Skraba},
title = {Persistent homology in \emph{{\(\mathscr{l}\)}}\({}_{\mbox{{\(\infty\)}}}\)
metric},
journal = {Comput. Geom.},
volume = {101},
pages = {101821},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101821},
doi = {10.1016/J.COMGEO.2021.101821},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeltramoS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCKM0MS22,
author = {Prosenjit Bose and
Paz Carmi and
J. Mark Keil and
Anil Maheshwari and
Saeed Mehrabi and
Debajyoti Mondal and
Michiel Smid},
title = {Computing maximum independent set on outerstring graphs and their
relatives},
journal = {Comput. Geom.},
volume = {103},
pages = {101852},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101852},
doi = {10.1016/J.COMGEO.2021.101852},
timestamp = {Tue, 15 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCKM0MS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BubenikE22,
author = {Peter Bubenik and
Alex Elchesen},
title = {Universality of persistence diagrams and the bottleneck and Wasserstein
distances},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101882},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101882},
doi = {10.1016/J.COMGEO.2022.101882},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BubenikE22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinK22,
author = {Maike Buchin and
Bernhard Kilgus},
title = {Fr{\'{e}}chet distance between two point sets},
journal = {Comput. Geom.},
volume = {102},
pages = {101842},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101842},
doi = {10.1016/J.COMGEO.2021.101842},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinK22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CanoTUV22,
author = {Javier Cano and
Csaba D. T{\'{o}}th and
Jorge Urrutia and
Giovanni Viglietta},
title = {Edge guards for polyhedra in three-space},
journal = {Comput. Geom.},
volume = {104},
pages = {101859},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101859},
doi = {10.1016/J.COMGEO.2022.101859},
timestamp = {Fri, 01 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CanoTUV22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelF22,
author = {Jean{-}Lou De Carufel and
Zachary Friggstad},
title = {Preface},
journal = {Comput. Geom.},
volume = {101},
pages = {101776},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101776},
doi = {10.1016/J.COMGEO.2021.101776},
timestamp = {Mon, 27 Dec 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarufelF22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChakrabortyDM22,
author = {Dibyayan Chakraborty and
Sandip Das and
Joydeep Mukherjee},
title = {On dominating set of some subclasses of string graphs},
journal = {Comput. Geom.},
volume = {107},
pages = {101884},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101884},
doi = {10.1016/J.COMGEO.2022.101884},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChakrabortyDM22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR22,
author = {Timothy M. Chan and
Zahed Rahmati},
title = {Corrigendum to "Approximating the minimum closest pair distance and
nearest neighbor distances of linearly moving points" [Comput. Geom.
60 {(2017)} 2-7]},
journal = {Comput. Geom.},
volume = {101},
pages = {101831},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101831},
doi = {10.1016/J.COMGEO.2021.101831},
timestamp = {Mon, 27 Dec 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanR22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DezaP22,
author = {Antoine Deza and
Lionel Pournin},
title = {A linear optimization oracle for zonotope computation},
journal = {Comput. Geom.},
volume = {100},
pages = {101809},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101809},
doi = {10.1016/J.COMGEO.2021.101809},
timestamp = {Mon, 27 Dec 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DezaP22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuGT22,
author = {Adrian Dumitrescu and
Anirban Ghosh and
Csaba D. T{\'{o}}th},
title = {Sparse hop spanners for unit disk graphs},
journal = {Comput. Geom.},
volume = {100},
pages = {101808},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101808},
doi = {10.1016/J.COMGEO.2021.101808},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuGT22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansFKSSW22,
author = {William S. Evans and
Krzysztof Fleszar and
Philipp Kindermann and
Noushin Saeedi and
Chan{-}Su Shin and
Alexander Wolff},
title = {Minimum rectilinear polygons for given angle sequences},
journal = {Comput. Geom.},
volume = {100},
pages = {101820},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101820},
doi = {10.1016/J.COMGEO.2021.101820},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EvansFKSSW22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Frati22,
author = {Fabrizio Frati},
title = {Planar rectilinear drawings of outerplanar graphs in linear time},
journal = {Comput. Geom.},
volume = {103},
pages = {101854},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101854},
doi = {10.1016/J.COMGEO.2021.101854},
timestamp = {Tue, 01 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Frati22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Guo0P22,
author = {Zhengyang Guo and
Yi Li and
Shaoyu Pei},
title = {Expected size of random Tukey layers and convex layers},
journal = {Comput. Geom.},
volume = {103},
pages = {101856},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101856},
doi = {10.1016/J.COMGEO.2021.101856},
timestamp = {Tue, 15 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Guo0P22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoriyamaKKPUY22,
author = {Takashi Horiyama and
Fabian Klute and
Matias Korman and
Irene Parada and
Ryuhei Uehara and
Katsuhisa Yamanaka},
title = {Efficient segment folding is hard},
journal = {Comput. Geom.},
volume = {104},
pages = {101860},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101860},
doi = {10.1016/J.COMGEO.2022.101860},
timestamp = {Fri, 01 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HoriyamaKKPUY22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuicocheaLR22,
author = {Mario Huicochea and
Jes{\'{u}}s Lea{\~{n}}os and
Luis Manuel Rivera},
title = {A note on the minimum number of red lines needed to pierce the intersections
of blue lines},
journal = {Comput. Geom.},
volume = {104},
pages = {101863},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101863},
doi = {10.1016/J.COMGEO.2022.101863},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HuicocheaLR22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JanaMR22,
author = {Satyabrata Jana and
Anil Maheshwari and
Sasanka Roy},
title = {Linear-size planar Manhattan network for convex point sets},
journal = {Comput. Geom.},
volume = {100},
pages = {101819},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101819},
doi = {10.1016/J.COMGEO.2021.101819},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/JanaMR22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaziS22,
author = {Abrar Kazi and
Michiel Smid},
title = {Closest-pair queries and minimum-weight queries are equivalent for
squares},
journal = {Comput. Geom.},
volume = {100},
pages = {101810},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101810},
doi = {10.1016/J.COMGEO.2021.101810},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KaziS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimA22,
author = {Mincheol Kim and
Hee{-}Kap Ahn},
title = {Minimum-link shortest paths for polygons amidst rectilinear obstacles},
journal = {Comput. Geom.},
volume = {103},
pages = {101858},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101858},
doi = {10.1016/J.COMGEO.2022.101858},
timestamp = {Tue, 15 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimA22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KodmonL22,
author = {Csenge Lili K{\"{o}}dm{\"{o}}n and
Zsolt L{\'{a}}ngi},
title = {Extremal convex polygons inscribed in a given convex polygon},
journal = {Comput. Geom.},
volume = {102},
pages = {101844},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101844},
doi = {10.1016/J.COMGEO.2021.101844},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KodmonL22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldMOSV22,
author = {Marc J. van Kreveld and
Tillmann Miltzow and
Tim Ophelders and
Willem Sonke and
Jordi L. Vermeulen},
title = {Between shapes, using the Hausdorff distance},
journal = {Comput. Geom.},
volume = {100},
pages = {101817},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101817},
doi = {10.1016/J.COMGEO.2021.101817},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KreveldMOSV22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KumarSS22,
author = {Neeraj Kumar and
Stavros Sintos and
Subhash Suri},
title = {The maximum exposure problem},
journal = {Comput. Geom.},
volume = {104},
pages = {101861},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101861},
doi = {10.1016/J.COMGEO.2022.101861},
timestamp = {Fri, 01 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KumarSS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LenchnerP22,
author = {Jonathan Lenchner and
Eli Packer},
title = {Line segment visibility with sidedness constraints},
journal = {Comput. Geom.},
volume = {107},
pages = {101885},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101885},
doi = {10.1016/J.COMGEO.2022.101885},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LenchnerP22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Matthews22,
author = {Polly Matthews Jr.},
title = {Distinct distances with \emph{{\(\mathscr{l}\)}}\({}_{\mbox{\emph{p}}}\)
metrics},
journal = {Comput. Geom.},
volume = {100},
pages = {101785},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101785},
doi = {10.1016/J.COMGEO.2021.101785},
timestamp = {Mon, 27 Dec 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Matthews22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MessinaS22,
author = {John A. Messina and
Pablo Sober{\'{o}}n},
title = {Isometric and affine copies of a set in volumetric Helly results},
journal = {Comput. Geom.},
volume = {103},
pages = {101855},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101855},
doi = {10.1016/J.COMGEO.2021.101855},
timestamp = {Tue, 15 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MessinaS22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PedersenW22,
author = {Logan Pedersen and
Haitao Wang},
title = {Algorithms for the line-constrained disk coverage and related problems},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101883},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101883},
doi = {10.1016/J.COMGEO.2022.101883},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/PedersenW22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RadermacherR22,
author = {Marcel Radermacher and
Ignaz Rutter},
title = {Inserting an edge into a geometric embedding},
journal = {Comput. Geom.},
volume = {102},
pages = {101843},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101843},
doi = {10.1016/J.COMGEO.2021.101843},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RadermacherR22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheffer22,
author = {Christian Scheffer},
title = {The prefix Fr{\'{e}}chet similarity},
journal = {Comput. Geom.},
volume = {103},
pages = {101853},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101853},
doi = {10.1016/J.COMGEO.2021.101853},
timestamp = {Tue, 15 Mar 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Scheffer22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangX22,
author = {Haitao Wang and
Jie Xue},
title = {Improved algorithms for the bichromatic two-center problem for pairs
of points},
journal = {Comput. Geom.},
volume = {100},
pages = {101806},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2021.101806},
doi = {10.1016/J.COMGEO.2021.101806},
timestamp = {Thu, 04 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/WangX22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZinkWBW22,
author = {Johannes Zink and
Julian Walter and
Joachim Baumeister and
Alexander Wolff},
title = {Layered drawing of undirected graphs with generalized port constraints},
journal = {Comput. Geom.},
volume = {105-106},
pages = {101886},
year = {2022},
url = {https://doi.org/10.1016/j.comgeo.2022.101886},
doi = {10.1016/J.COMGEO.2022.101886},
timestamp = {Wed, 14 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZinkWBW22.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelACDDHKLRR21,
author = {Zachary Abel and
Hugo A. Akitaya and
Man{-}Kwun Chiu and
Erik D. Demaine and
Martin L. Demaine and
Adam Hesterberg and
Matias Korman and
Jayson Lynch and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen},
title = {Snipperclips: Cutting tools into desired polygons using themselves},
journal = {Comput. Geom.},
volume = {98},
pages = {101784},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101784},
doi = {10.1016/J.COMGEO.2021.101784},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AbelACDDHKLRR21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelDDKLIN21,
author = {Zachary Abel and
Erik D. Demaine and
Martin L. Demaine and
Jason S. Ku and
Jayson Lynch and
Jin{-}ichi Itoh and
Chie Nara},
title = {Continuous flattening of all polyhedral manifolds using countably
infinite creases},
journal = {Comput. Geom.},
volume = {98},
pages = {101773},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101773},
doi = {10.1016/J.COMGEO.2021.101773},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AbelDDKLIN21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanKP21,
author = {Eyal Ackerman and
Bal{\'{a}}zs Keszegh and
D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi},
title = {Coloring Delaunay-edges and their generalizations},
journal = {Comput. Geom.},
volume = {96},
pages = {101745},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101745},
doi = {10.1016/J.COMGEO.2021.101745},
timestamp = {Thu, 29 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AckermanKP21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerACDDF21,
author = {Oswin Aichholzer and
Hugo A. Akitaya and
Kenneth C. Cheung and
Erik D. Demaine and
Martin L. Demaine and
S{\'{a}}ndor P. Fekete and
Linda Kleist and
Irina Kostitsyna and
Maarten L{\"{o}}ffler and
Zuzana Mas{\'{a}}rov{\'{a}} and
Klara Mundilova and
Christiane Schmidt},
title = {Folding polyominoes with holes into a cube},
journal = {Comput. Geom.},
volume = {93},
pages = {101700},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101700},
doi = {10.1016/J.COMGEO.2020.101700},
timestamp = {Sat, 14 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerACDDF21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaBKSW21,
author = {Hugo A. Akitaya and
Maike Buchin and
Bernhard Kilgus and
Stef Sijben and
Carola Wenk},
title = {Distance measures for embedded graphs},
journal = {Comput. Geom.},
volume = {95},
pages = {101743},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101743},
doi = {10.1016/J.COMGEO.2020.101743},
timestamp = {Tue, 02 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AkitayaBKSW21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDEP21,
author = {Boris Aronov and
Anirudh Donakonda and
Esther Ezra and
Rom Pinchasi},
title = {On pseudo-disk hypergraphs},
journal = {Comput. Geom.},
volume = {92},
pages = {101687},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101687},
doi = {10.1016/J.COMGEO.2020.101687},
timestamp = {Mon, 26 Oct 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovDEP21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArsenevaCKMOORR21,
author = {Elena Arseneva and
Man{-}Kwun Chiu and
Matias Korman and
Aleksandar Markovic and
Yoshio Okamoto and
Aur{\'{e}}lien Ooms and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen},
title = {Rectilinear link diameter and radius in a rectilinear polygonal domain},
journal = {Comput. Geom.},
volume = {92},
pages = {101685},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101685},
doi = {10.1016/J.COMGEO.2020.101685},
timestamp = {Thu, 29 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ArsenevaCKMOORR21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae21,
author = {Sang Won Bae},
title = {On the minimum-area rectangular and square annulus problem},
journal = {Comput. Geom.},
volume = {92},
pages = {101697},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101697},
doi = {10.1016/J.COMGEO.2020.101697},
timestamp = {Thu, 16 Sep 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Bae21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeBM21,
author = {Sang Won Bae and
Arpita Baral and
Priya Ranjan Sinha Mahapatra},
title = {Maximum-width empty square and rectangular annulus},
journal = {Comput. Geom.},
volume = {96},
pages = {101747},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101747},
doi = {10.1016/J.COMGEO.2021.101747},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaeBM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF21,
author = {Davood Bakhshesh and
Mohammad Farshi},
title = {Angle-monotonicity of Delaunay triangulation},
journal = {Comput. Geom.},
volume = {94},
pages = {101711},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101711},
doi = {10.1016/J.COMGEO.2020.101711},
timestamp = {Thu, 17 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BankovicM21,
author = {Milan Bankovic and
Filip Maric},
title = {Farad{\v{z}}ev Read-type enumeration of non-isomorphic {CC} systems},
journal = {Comput. Geom.},
volume = {97},
pages = {101770},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101770},
doi = {10.1016/J.COMGEO.2021.101770},
timestamp = {Tue, 01 Jun 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BankovicM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetBO21,
author = {Gill Barequet and
Gil Ben{-}Shachar and
Martha C. Osegueda},
title = {Concatenation arguments and their applications to polyominoes and
polycubes},
journal = {Comput. Geom.},
volume = {98},
pages = {101790},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101790},
doi = {10.1016/J.COMGEO.2021.101790},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BarequetBO21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BekosGMPST21,
author = {Michael A. Bekos and
Martin Gronemann and
Fabrizio Montecchiani and
D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
Antonios Symvonis and
Leonidas Theocharous},
title = {Grid drawings of graphs with constant edge-vertex resolution},
journal = {Comput. Geom.},
volume = {98},
pages = {101789},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101789},
doi = {10.1016/J.COMGEO.2021.101789},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BekosGMPST21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaBCD21,
author = {Binay Bhattacharya and
Arijit Bishnu and
Otfried Cheong and
Sandip Das and
Arindam Karmakar and
Jack Snoeyink},
title = {Computation of spatial skyline points},
journal = {Comput. Geom.},
volume = {93},
pages = {101698},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101698},
doi = {10.1016/J.COMGEO.2020.101698},
timestamp = {Sat, 14 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaBCD21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlBL21,
author = {Therese Biedl and
Ahmad Biniaz and
Anna Lubiw},
title = {Minimum ply covering of points with disks and squares},
journal = {Comput. Geom.},
volume = {94},
pages = {101712},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101712},
doi = {10.1016/J.COMGEO.2020.101712},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlBL21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCS21,
author = {Prosenjit Bose and
Paz Carmi and
Thomas C. Shermer},
title = {Piercing pairwise intersecting geodesic disks},
journal = {Comput. Geom.},
volume = {98},
pages = {101774},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101774},
doi = {10.1016/J.COMGEO.2021.101774},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS21,
author = {Prosenjit Bose and
Thomas C. Shermer},
title = {Attraction-convexity and normal visibility},
journal = {Comput. Geom.},
volume = {96},
pages = {101748},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101748},
doi = {10.1016/J.COMGEO.2021.101748},
timestamp = {Thu, 29 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloM21,
author = {Sergio Cabello and
Wolfgang Mulzer},
title = {Minimum cuts in geometric intersection graphs},
journal = {Comput. Geom.},
volume = {94},
pages = {101720},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101720},
doi = {10.1016/J.COMGEO.2020.101720},
timestamp = {Thu, 17 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaraballoDMHLM21,
author = {Luis Evaristo Caraballo and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Ruy Fabila Monroy and
Carlos Hidalgo{-}Toscano and
Jes{\'{u}}s Lea{\~{n}}os and
Amanda Montejano},
title = {On the number of order types in integer grids of small size},
journal = {Comput. Geom.},
volume = {95},
pages = {101730},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101730},
doi = {10.1016/J.COMGEO.2020.101730},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CaraballoDMHLM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKSS21,
author = {Paz Carmi and
Matthew J. Katz and
Rachel Saban and
Yael Stein},
title = {Improved PTASs for convex barrier coverage},
journal = {Comput. Geom.},
volume = {92},
pages = {101684},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101684},
doi = {10.1016/J.COMGEO.2020.101684},
timestamp = {Mon, 21 Sep 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiKSS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiA21,
author = {Jongmin Choi and
Hee{-}Kap Ahn},
title = {Efficient planar two-center algorithms},
journal = {Comput. Geom.},
volume = {97},
pages = {101768},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101768},
doi = {10.1016/J.COMGEO.2021.101768},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChoiA21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoiLA21,
author = {Yujin Choi and
Seungjun Lee and
Hee{-}Kap Ahn},
title = {Maximum-area and maximum-perimeter rectangles in polygons},
journal = {Comput. Geom.},
volume = {94},
pages = {101710},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101710},
doi = {10.1016/J.COMGEO.2020.101710},
timestamp = {Thu, 17 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChoiLA21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChuggEW21,
author = {Ben Chugg and
William S. Evans and
Kelvin Wong},
title = {Simultaneous visibility representations of undirected pairs of graphs},
journal = {Comput. Geom.},
volume = {98},
pages = {101788},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101788},
doi = {10.1016/J.COMGEO.2021.101788},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChuggEW21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuT21,
author = {Ovidiu Daescu and
Ka Yaw Teo},
title = {Characterization and computation of feasible trajectories for an articulated
probe with a variable-length end segment},
journal = {Comput. Geom.},
volume = {96},
pages = {101756},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101756},
doi = {10.1016/J.COMGEO.2021.101756},
timestamp = {Wed, 21 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DaescuT21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianF21,
author = {Mirela Damian and
Robin Y. Flatland},
title = {Unfolding polycube trees with constant refinement},
journal = {Comput. Geom.},
volume = {98},
pages = {101793},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101793},
doi = {10.1016/J.COMGEO.2021.101793},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DamianF21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezMU21,
author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Ruy Fabila Monroy and
Jorge Urrutia},
title = {A note on empty balanced tetrahedra in two-colored point sets in {R3}},
journal = {Comput. Geom.},
volume = {96},
pages = {101757},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101757},
doi = {10.1016/J.COMGEO.2021.101757},
timestamp = {Thu, 29 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezMU21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHP21,
author = {G{\"{u}}nther Eder and
Martin Held and
Peter Palfrader},
title = {Implementing straight skeletons with exact arithmetic: Challenges
and experiences},
journal = {Comput. Geom.},
volume = {96},
pages = {101760},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101760},
doi = {10.1016/J.COMGEO.2021.101760},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EderHP21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Flores-VelazcoM21,
author = {Alejandro Flores{-}Velazco and
David M. Mount},
title = {Guarantees on nearest-neighbor condensation heuristics},
journal = {Comput. Geom.},
volume = {95},
pages = {101732},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101732},
doi = {10.1016/J.COMGEO.2020.101732},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Flores-VelazcoM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GitikBJ21,
author = {Rivka Gitik and
Or Bartal and
Leo Joskowicz},
title = {Euclidean minimum spanning trees with independent and dependent geometric
uncertainties},
journal = {Comput. Geom.},
volume = {96},
pages = {101744},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101744},
doi = {10.1016/J.COMGEO.2020.101744},
timestamp = {Mon, 05 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GitikBJ21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuimaraesC21,
author = {Dilson Almeida Guimar{\~{a}}es and
Alexandre Salles da Cunha},
title = {The minimum area spanning tree problem: Formulations, Benders decomposition
and branch-and-cut algorithms},
journal = {Comput. Geom.},
volume = {97},
pages = {101771},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101771},
doi = {10.1016/J.COMGEO.2021.101771},
timestamp = {Tue, 01 Jun 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GuimaraesC21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuangCX21,
author = {Ziyun Huang and
Danny Z. Chen and
Jinhui Xu},
title = {Influence-based Voronoi diagrams of clusters},
journal = {Comput. Geom.},
volume = {96},
pages = {101746},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101746},
doi = {10.1016/J.COMGEO.2021.101746},
timestamp = {Wed, 21 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HuangCX21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JohnsonW21,
author = {Christopher Johnson and
Haitao Wang},
title = {A linear-time algorithm for radius-optimally augmenting paths in a
metric space},
journal = {Comput. Geom.},
volume = {96},
pages = {101759},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101759},
doi = {10.1016/J.COMGEO.2021.101759},
timestamp = {Thu, 29 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/JohnsonW21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeikhaLM21,
author = {Vahideh Keikha and
Maarten L{\"{o}}ffler and
Ali Mohades},
title = {Largest and smallest area triangles on imprecise points},
journal = {Comput. Geom.},
volume = {95},
pages = {101742},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101742},
doi = {10.1016/J.COMGEO.2020.101742},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KeikhaLM21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kejlberg-Rasmussen21,
author = {Casper Kejlberg{-}Rasmussen and
Yufei Tao and
Konstantinos Tsakalidis and
Kostas Tsichlas and
Jeonghun Yoon},
title = {I/O-efficient 2-d orthogonal range skyline and attrition priority
queues},
journal = {Comput. Geom.},
volume = {93},
pages = {101689},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101689},
doi = {10.1016/J.COMGEO.2020.101689},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Kejlberg-Rasmussen21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KilicKO21,
author = {Mehmet Kili{\c{c}} and
Sahin Ko{\c{c}}ak and
Yunus {\"{O}}zdemir},
title = {An algorithm for the construction of the tight span of finite subsets
of the Manhattan plane},
journal = {Comput. Geom.},
volume = {95},
pages = {101741},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101741},
doi = {10.1016/J.COMGEO.2020.101741},
timestamp = {Tue, 02 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KilicKO21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimKKLS21,
author = {Sang{-}Sub Kim and
Rolf Klein and
David K{\"{u}}bel and
Elmar Langetepe and
Barbara Schwarzwald},
title = {Geometric firefighting in the half-plane},
journal = {Comput. Geom.},
volume = {95},
pages = {101728},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101728},
doi = {10.1016/J.COMGEO.2020.101728},
timestamp = {Tue, 02 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimKKLS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimYA21,
author = {Mincheol Kim and
Sang Duk Yoon and
Hee{-}Kap Ahn},
title = {Shortest rectilinear path queries to rectangles in a rectangular domain},
journal = {Comput. Geom.},
volume = {99},
pages = {101796},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101796},
doi = {10.1016/J.COMGEO.2021.101796},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimYA21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KipouridisKPT21,
author = {Evangelos Kipouridis and
Andreas Kosmatopoulos and
Apostolos N. Papadopoulos and
Kostas Tsichlas},
title = {Dynamic layers of maxima with applications to dominating queries},
journal = {Comput. Geom.},
volume = {93},
pages = {101699},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101699},
doi = {10.1016/J.COMGEO.2020.101699},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KipouridisKPT21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KlimenkoRB21,
author = {Georgiy Klimenko and
Benjamin Raichel and
Gregory Van Buskirk},
title = {Sparse convex hull coverage},
journal = {Comput. Geom.},
volume = {98},
pages = {101787},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101787},
doi = {10.1016/J.COMGEO.2021.101787},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KlimenkoRB21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KluteLN21,
author = {Fabian Klute and
Maarten L{\"{o}}ffler and
Martin N{\"{o}}llenburg},
title = {Labeling nonograms: Boundary labeling for curve arrangements},
journal = {Comput. Geom.},
volume = {98},
pages = {101791},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101791},
doi = {10.1016/J.COMGEO.2021.101791},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KluteLN21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KubelL21,
author = {David K{\"{u}}bel and
Elmar Langetepe},
title = {On the approximation of shortest escape paths},
journal = {Comput. Geom.},
volume = {93},
pages = {101709},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101709},
doi = {10.1016/J.COMGEO.2020.101709},
timestamp = {Fri, 13 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KubelL21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Laczkovich21,
author = {Mikl{\'{o}}s Laczkovich},
title = {Tilings of the regular \emph{N}-gon with triangles of angles \emph{{\(\pi\)}}/\emph{N},
\emph{{\(\pi\)}}/\emph{N}, (\emph{N}{\unicode{8239}}-{\unicode{8239}}2)\emph{{\(\pi\)}}/\emph{N}
for \emph{N}{\unicode{8239}}={\unicode{8239}}5, 8, 10 and 12},
journal = {Comput. Geom.},
volume = {92},
pages = {101690},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101690},
doi = {10.1016/J.COMGEO.2020.101690},
timestamp = {Fri, 14 May 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Laczkovich21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LeeEA21,
author = {Seungjun Lee and
Taekang Eom and
Hee{-}Kap Ahn},
title = {Largest triangles in a polygon},
journal = {Comput. Geom.},
volume = {98},
pages = {101792},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101792},
doi = {10.1016/J.COMGEO.2021.101792},
timestamp = {Tue, 13 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LeeEA21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lund21,
author = {Ben Lund},
title = {Two theorems on point-flat incidences},
journal = {Comput. Geom.},
volume = {92},
pages = {101681},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101681},
doi = {10.1016/J.COMGEO.2020.101681},
timestamp = {Thu, 29 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Lund21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/McCoyS21,
author = {Stephanie McCoy and
N{\'{a}}ndor Sieben},
title = {Impartial achievement games on convex geometries},
journal = {Comput. Geom.},
volume = {98},
pages = {101786},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101786},
doi = {10.1016/J.COMGEO.2021.101786},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/McCoyS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MonroyPT21,
author = {Ruy Fabila Monroy and
Daniel Perz and
Ana Laura Trujillo{-}Negrete},
title = {Empty rainbow triangles in \emph{k}-colored point sets},
journal = {Comput. Geom.},
volume = {95},
pages = {101731},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101731},
doi = {10.1016/J.COMGEO.2020.101731},
timestamp = {Tue, 02 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MonroyPT21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NassihANANH21,
author = {Bouchra Nassih and
Aouatif Amine and
Mohammed Ngadi and
Youssef Azdoud and
Driss Naji and
Nabil Hmina},
title = {An efficient three-dimensional face recognition system based random
forest and geodesic curves},
journal = {Comput. Geom.},
volume = {97},
pages = {101758},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101758},
doi = {10.1016/J.COMGEO.2021.101758},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/NassihANANH21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ParkC21,
author = {Ji{-}won Park and
Otfried Cheong},
title = {Smallest universal covers for families of triangles},
journal = {Comput. Geom.},
volume = {92},
pages = {101686},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101686},
doi = {10.1016/J.COMGEO.2020.101686},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ParkC21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PilzS21,
author = {Alexander Pilz and
Patrick Schnider},
title = {Bisecting three classes of lines},
journal = {Comput. Geom.},
volume = {98},
pages = {101775},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101775},
doi = {10.1016/J.COMGEO.2021.101775},
timestamp = {Wed, 27 Jul 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/PilzS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SapucaiaRS21,
author = {Allan Sapucaia and
Pedro J. de Rezende and
Cid C. de Souza},
title = {Solving the minimum convex partition of point sets with integer programming},
journal = {Comput. Geom.},
volume = {99},
pages = {101794},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101794},
doi = {10.1016/J.COMGEO.2021.101794},
timestamp = {Sat, 08 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SapucaiaRS21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sastry21,
author = {Shankar P. Sastry},
title = {A 2D advancing-front Delaunay mesh refinement algorithm},
journal = {Comput. Geom.},
volume = {97},
pages = {101772},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101772},
doi = {10.1016/J.COMGEO.2021.101772},
timestamp = {Mon, 25 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Sastry21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Smid21,
author = {Michiel H. M. Smid},
title = {An improved construction for spanners of disks},
journal = {Comput. Geom.},
volume = {92},
pages = {101682},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101682},
doi = {10.1016/J.COMGEO.2020.101682},
timestamp = {Mon, 21 Sep 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Smid21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TanJ21,
author = {Xuehou Tan and
Bo Jiang},
title = {On the upper bound on the average distance from the Fermat-Weber center
of a convex body},
journal = {Comput. Geom.},
volume = {97},
pages = {101769},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101769},
doi = {10.1016/J.COMGEO.2021.101769},
timestamp = {Tue, 01 Jun 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/TanJ21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TillmannK21,
author = {Andreas M. Tillmann and
Leif Kobbelt},
title = {Structured discrete shape approximation: Theoretical complexity and
practical algorithm},
journal = {Comput. Geom.},
volume = {99},
pages = {101795},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2021.101795},
doi = {10.1016/J.COMGEO.2021.101795},
timestamp = {Thu, 23 Jun 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/TillmannK21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Verdonschot21,
author = {Sander Verdonschot},
title = {Flipping in spirals},
journal = {Comput. Geom.},
volume = {95},
pages = {101729},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101729},
doi = {10.1016/J.COMGEO.2020.101729},
timestamp = {Tue, 02 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Verdonschot21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhouCY21,
author = {Bo Zhou and
Yi{-}Jen Chiang and
Chee Yap},
title = {Soft subdivision motion planning for complex planar robots},
journal = {Comput. Geom.},
volume = {92},
pages = {101683},
year = {2021},
url = {https://doi.org/10.1016/j.comgeo.2020.101683},
doi = {10.1016/J.COMGEO.2020.101683},
timestamp = {Thu, 29 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ZhouCY21.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgrawalLXJ20,
author = {Akash Agrawal and
Yuan Li and
Jie Xue and
Ravi Janardan},
title = {The most-likely skyline problem for stochastic points},
journal = {Comput. Geom.},
volume = {88},
pages = {101609},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101609},
doi = {10.1016/J.COMGEO.2020.101609},
timestamp = {Fri, 27 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AgrawalLXJ20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnABOSW20,
author = {Hee{-}Kap Ahn and
Helmut Alt and
Maike Buchin and
Eunjin Oh and
Ludmila Scharf and
Carola Wenk},
title = {Middle curves based on discrete Fr{\'{e}}chet distance},
journal = {Comput. Geom.},
volume = {89},
pages = {101621},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101621},
doi = {10.1016/J.COMGEO.2020.101621},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnABOSW20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AigerKS20,
author = {Dror Aiger and
Haim Kaplan and
Micha Sharir},
title = {Output sensitive algorithms for approximate incidences and their applications},
journal = {Comput. Geom.},
volume = {91},
pages = {101666},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101666},
doi = {10.1016/J.COMGEO.2020.101666},
timestamp = {Thu, 23 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AigerKS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Aldana-GalvanAA20,
author = {Israel Aldana{-}Galv{\'{a}}n and
Carlos Alegr{\'{\i}}a and
Jose Luis {\'{A}}lvarez{-}Rebollar and
Nestaly Mar{\'{\i}}n{-}Nev{\'{a}}rez and
Erick Sol{\'{\i}}s{-}Villarreal and
Jorge Urrutia and
Carlos Velarde},
title = {Finding minimum witness sets in orthogonal polygons},
journal = {Comput. Geom.},
volume = {90},
pages = {101656},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101656},
doi = {10.1016/J.COMGEO.2020.101656},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Aldana-GalvanAA20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AmentaR20,
author = {Nina Amenta and
Carlos Rojas},
title = {Dihedral deformation and rigidity},
journal = {Comput. Geom.},
volume = {90},
pages = {101657},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101657},
doi = {10.1016/J.COMGEO.2020.101657},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AmentaR20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyapadhyayKS20,
author = {Sayan Bandyapadhyay and
Neeraj Kumar and
Subhash Suri and
Kasturi R. Varadarajan},
title = {Improved approximation bounds for the minimum constraint removal problem},
journal = {Comput. Geom.},
volume = {90},
pages = {101650},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101650},
doi = {10.1016/J.COMGEO.2020.101650},
timestamp = {Thu, 06 Aug 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BandyapadhyayKS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikSS20,
author = {Aritra Banik and
Vibha Sahlot and
Saket Saurabh},
title = {Approximation algorithms for geometric conflict free covering problems},
journal = {Comput. Geom.},
volume = {89},
pages = {101591},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101591},
doi = {10.1016/J.COMGEO.2019.101591},
timestamp = {Tue, 16 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BanikSS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanyassadyCKMRR20,
author = {Bahareh Banyassady and
Man{-}Kwun Chiu and
Matias Korman and
Wolfgang Mulzer and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen and
Paul Seiferth and
Yannik Stein and
Birgit Vogtenhuber and
Max Willert},
title = {Routing in polygonal domains},
journal = {Comput. Geom.},
volume = {87},
pages = {101593},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101593},
doi = {10.1016/J.COMGEO.2019.101593},
timestamp = {Mon, 09 Mar 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BanyassadyCKMRR20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyM20,
author = {Imre B{\'{a}}r{\'{a}}ny and
Nabil H. Mustafa},
title = {An application of the universality theorem for Tverberg partitions
to data depth and hitting convex sets},
journal = {Comput. Geom.},
volume = {90},
pages = {101649},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101649},
doi = {10.1016/J.COMGEO.2020.101649},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyM20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeltonFMMMSSSW20,
author = {Robin Lynne Belton and
Brittany Terese Fasy and
Rostik Mertz and
Samuel Micka and
David L. Millman and
Daniel Salinas and
Anna Schenfisch and
Jordan Schupbach and
Lucia Williams},
title = {Reconstructing embedded graphs from persistence diagrams},
journal = {Comput. Geom.},
volume = {90},
pages = {101658},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101658},
doi = {10.1016/J.COMGEO.2020.101658},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BeltonFMMMSSSW20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenbernouDDL20,
author = {Nadia M. Benbernou and
Erik D. Demaine and
Martin L. Demaine and
Anna Lubiw},
title = {Universal hinge patterns for folding strips efficiently into any grid
polyhedron},
journal = {Comput. Geom.},
volume = {89},
pages = {101633},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101633},
doi = {10.1016/J.COMGEO.2020.101633},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BenbernouDDL20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaM20,
author = {Amitava Bhattacharya and
Anupam Mondal},
title = {Covering the plane by a sequence of circular disks with a constraint},
journal = {Comput. Geom.},
volume = {91},
pages = {101680},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101680},
doi = {10.1016/J.COMGEO.2020.101680},
timestamp = {Fri, 31 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaM20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlBMM20,
author = {Therese Biedl and
Ahmad Biniaz and
Anil Maheshwari and
Saeed Mehrabi},
title = {Packing boundary-anchored rectangles and squares},
journal = {Comput. Geom.},
volume = {88},
pages = {101610},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101610},
doi = {10.1016/J.COMGEO.2020.101610},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlBMM20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Biniaz20,
author = {Ahmad Biniaz},
title = {Plane hop spanners for unit disk graphs: Simpler and better},
journal = {Comput. Geom.},
volume = {89},
pages = {101622},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101622},
doi = {10.1016/J.COMGEO.2020.101622},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Biniaz20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazG20,
author = {Ahmad Biniaz and
Alfredo Garc{\'{\i}}a},
title = {Packing plane spanning trees into a point set},
journal = {Comput. Geom.},
volume = {90},
pages = {101653},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101653},
doi = {10.1016/J.COMGEO.2020.101653},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazG20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciGHLMSW20,
author = {Carla Binucci and
Emilio Di Giacomo and
Seok{-}Hee Hong and
Giuseppe Liotta and
Henk Meijer and
Vera Sacrist{\'{a}}n and
Stephen K. Wismath},
title = {Colored anchored visibility representations in 2D and 3D space},
journal = {Comput. Geom.},
volume = {89},
pages = {101592},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101592},
doi = {10.1016/J.COMGEO.2019.101592},
timestamp = {Thu, 27 Apr 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BinucciGHLMSW20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS20,
author = {Prosenjit Bose and
Jean{-}Lou De Carufel and
Alina Shaikhet and
Michiel H. M. Smid},
title = {Optimal Art Gallery Localization is NP-hard},
journal = {Comput. Geom.},
volume = {88},
pages = {101607},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101607},
doi = {10.1016/J.COMGEO.2020.101607},
timestamp = {Wed, 22 Apr 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS20a,
author = {Prosenjit Bose and
Pilar Cano and
Maria Saumell and
Rodrigo I. Silveira},
title = {Hamiltonicity for convex shape Delaunay and Gabriel graphs},
journal = {Comput. Geom.},
volume = {89},
pages = {101629},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101629},
doi = {10.1016/J.COMGEO.2020.101629},
timestamp = {Tue, 16 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS20a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseKL20,
author = {Prosenjit Bose and
Irina Kostitsyna and
Stefan Langerman},
title = {Self-approaching paths in simple polygons},
journal = {Comput. Geom.},
volume = {87},
pages = {101595},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101595},
doi = {10.1016/J.COMGEO.2019.101595},
timestamp = {Mon, 09 Mar 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseKL20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS20,
author = {Prosenjit Bose and
Thomas C. Shermer},
title = {Gathering by repulsion},
journal = {Comput. Geom.},
volume = {90},
pages = {101627},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101627},
doi = {10.1016/J.COMGEO.2020.101627},
timestamp = {Thu, 06 Aug 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinKR20,
author = {Kevin Buchin and
Maximilian Konzack and
Wim Reddingius},
title = {Progressive simplification of polygonal curves},
journal = {Comput. Geom.},
volume = {88},
pages = {101620},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101620},
doi = {10.1016/J.COMGEO.2020.101620},
timestamp = {Mon, 04 May 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinKR20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiCKKORRSS20,
author = {Paz Carmi and
Man{-}Kwun Chiu and
Matthew J. Katz and
Matias Korman and
Yoshio Okamoto and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen and
Taichi Shiitada and
Shakhar Smorodinsky},
title = {Balanced line separators of unit disk graphs},
journal = {Comput. Geom.},
volume = {86},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101575},
doi = {10.1016/J.COMGEO.2019.101575},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiCKKORRSS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMSS20,
author = {Jean{-}Lou De Carufel and
Carsten Grimm and
Anil Maheshwari and
Stefan Schirra and
Michiel H. M. Smid},
title = {Minimizing the continuous diameter when augmenting a geometric tree
with a shortcut},
journal = {Comput. Geom.},
volume = {89},
pages = {101631},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101631},
doi = {10.1016/J.COMGEO.2020.101631},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMSS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR020,
author = {Timothy M. Chan and
Saladi Rahul and
Jie Xue},
title = {Range closest-pair search in higher dimensions},
journal = {Comput. Geom.},
volume = {91},
pages = {101669},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101669},
doi = {10.1016/J.COMGEO.2020.101669},
timestamp = {Fri, 31 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChanR020.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChuangpishitMNO20,
author = {Huda Chuangpishit and
Saeed Mehrabi and
Lata Narayanan and
Jaroslav Opatrny},
title = {Evacuating equilateral triangles and squares in the face-to-face model},
journal = {Comput. Geom.},
volume = {89},
pages = {101624},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101624},
doi = {10.1016/J.COMGEO.2020.101624},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChuangpishitMNO20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CleveM20,
author = {Jonas Cleve and
Wolfgang Mulzer},
title = {Combinatorics of beacon-based routing in three dimensions},
journal = {Comput. Geom.},
volume = {91},
pages = {101667},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101667},
doi = {10.1016/J.COMGEO.2020.101667},
timestamp = {Fri, 31 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CleveM20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineKKMORRUU20,
author = {Erik D. Demaine and
Matias Korman and
Jason S. Ku and
Joseph S. B. Mitchell and
Yota Otachi and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen and
Ryuhei Uehara and
Yushi Uno},
title = {Symmetric assembly puzzles are hard, beyond a few pieces},
journal = {Comput. Geom.},
volume = {90},
pages = {101648},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101648},
doi = {10.1016/J.COMGEO.2020.101648},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineKKMORRUU20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Do20,
author = {Thao Do},
title = {Extending Erd{\H{o}}s-Beck's theorem to higher dimensions},
journal = {Comput. Geom.},
volume = {90},
pages = {101625},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101625},
doi = {10.1016/J.COMGEO.2020.101625},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Do20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu20,
author = {Adrian Dumitrescu},
title = {On the shortest separating cycle},
journal = {Comput. Geom.},
volume = {88},
pages = {101612},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101612},
doi = {10.1016/J.COMGEO.2020.101612},
timestamp = {Wed, 22 Apr 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuT20,
author = {Adrian Dumitrescu and
Csaba D. T{\'{o}}th},
title = {Problems on track runners},
journal = {Comput. Geom.},
volume = {88},
pages = {101611},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101611},
doi = {10.1016/J.COMGEO.2020.101611},
timestamp = {Wed, 22 Apr 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuT20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherK20,
author = {Stephane Durocher and
Shahin Kamali},
title = {Foreword},
journal = {Comput. Geom.},
volume = {90},
pages = {101652},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101652},
doi = {10.1016/J.COMGEO.2020.101652},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherK20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EllenS20,
author = {Faith Ellen and
J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {Preface},
journal = {Comput. Geom.},
volume = {89},
pages = {101632},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101632},
doi = {10.1016/J.COMGEO.2020.101632},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EllenS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FerresFGHN20,
author = {Leo Ferres and
Jos{\'{e}} Fuentes{-}Sep{\'{u}}lveda and
Travis Gagie and
Meng He and
Gonzalo Navarro},
title = {Fast and compact planar embeddings},
journal = {Comput. Geom.},
volume = {89},
pages = {101630},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101630},
doi = {10.1016/J.COMGEO.2020.101630},
timestamp = {Wed, 28 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FerresFGHN20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriggstadSS20,
author = {Zachary Friggstad and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Mohammad R. Salavatipour},
title = {Preface},
journal = {Comput. Geom.},
volume = {91},
pages = {101671},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101671},
doi = {10.1016/J.COMGEO.2020.101671},
timestamp = {Thu, 23 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FriggstadSS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GangopadhyayS20,
author = {Rahul Gangopadhyay and
Saswata Shannigrahi},
title = {\emph{k}-Sets and rectilinear crossings in complete uniform hypergraphs},
journal = {Comput. Geom.},
volume = {86},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101578},
doi = {10.1016/J.COMGEO.2019.101578},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GangopadhyayS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoLM20,
author = {Emilio Di Giacomo and
Giuseppe Liotta and
Fabrizio Montecchiani},
title = {1-bend upward planar slope number of SP-digraphs},
journal = {Comput. Geom.},
volume = {90},
pages = {101628},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101628},
doi = {10.1016/J.COMGEO.2020.101628},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GiacomoLM20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS20,
author = {Joachim Gudmundsson and
Michiel H. M. Smid},
title = {Special issue on the 29th Canadian Conference on Computational Geometry,
Guest Editors' foreword},
journal = {Comput. Geom.},
volume = {88},
pages = {101608},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101608},
doi = {10.1016/J.COMGEO.2020.101608},
timestamp = {Wed, 22 Apr 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaverkortKLS20,
author = {Herman J. Haverkort and
David K{\"{u}}bel and
Elmar Langetepe and
Barbara Schwarzwald},
title = {How to play hot and cold},
journal = {Comput. Geom.},
volume = {87},
pages = {101596},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101596},
doi = {10.1016/J.COMGEO.2019.101596},
timestamp = {Mon, 09 Mar 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HaverkortKLS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LozzoBF20,
author = {Giordano Da Lozzo and
Giuseppe Di Battista and
Fabrizio Frati},
title = {Extending upward planar graph drawings},
journal = {Comput. Geom.},
volume = {91},
pages = {101668},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101668},
doi = {10.1016/J.COMGEO.2020.101668},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LozzoBF20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwMO20,
author = {Anna Lubiw and
Daniela Maftuleac and
Megan Owen},
title = {Shortest paths and convex hulls in 2D complexes with non-positive
curvature},
journal = {Comput. Geom.},
volume = {89},
pages = {101626},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101626},
doi = {10.1016/J.COMGEO.2020.101626},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LubiwMO20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MasoodRN20,
author = {Talha Bin Masood and
Tathagata Ray and
Vijay Natarajan},
title = {Parallel computation of alpha complexes for biomolecules},
journal = {Comput. Geom.},
volume = {90},
pages = {101651},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101651},
doi = {10.1016/J.COMGEO.2020.101651},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MasoodRN20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Messerschmidt20,
author = {Miek Messerschmidt},
title = {On compact packings of the plane with circles of three radii},
journal = {Comput. Geom.},
volume = {86},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.05.002},
doi = {10.1016/J.COMGEO.2019.05.002},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Messerschmidt20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Munao20,
author = {Simone Munao},
title = {Introducing article numbering to \emph{Computational Geometry: Theory
and Applications}},
journal = {Comput. Geom.},
volume = {86},
year = {2020},
url = {https://doi.org/10.1016/S0925-7721(19)30145-2},
doi = {10.1016/S0925-7721(19)30145-2},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Munao20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PolishchukS20,
author = {Valentin Polishchuk and
Christiane Schmidt},
title = {Special Issue on the 33rd European Workshop on Computational Geometry,
Guest Editors' Foreword},
journal = {Comput. Geom.},
volume = {87},
pages = {101590},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101590},
doi = {10.1016/J.COMGEO.2019.101590},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PolishchukS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ScaramucciaIFL20,
author = {Sara Scaramuccia and
Federico Iuricich and
Leila De Floriani and
Claudia Landi},
title = {Computing multiparameter persistent homology through a discrete Morse-based
approach},
journal = {Comput. Geom.},
volume = {89},
pages = {101623},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101623},
doi = {10.1016/J.COMGEO.2020.101623},
timestamp = {Wed, 15 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ScaramucciaIFL20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Scheucher20,
author = {Manfred Scheucher},
title = {Two disjoint 5-holes in point sets},
journal = {Comput. Geom.},
volume = {91},
pages = {101670},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101670},
doi = {10.1016/J.COMGEO.2020.101670},
timestamp = {Fri, 31 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Scheucher20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchiblerS20,
author = {Thomas Schibler and
Subhash Suri},
title = {K-dominance in multidimensional data: Theory and applications},
journal = {Comput. Geom.},
volume = {87},
pages = {101594},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101594},
doi = {10.1016/J.COMGEO.2019.101594},
timestamp = {Mon, 09 Mar 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchiblerS20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TeoDF20,
author = {Ka Yaw Teo and
Ovidiu Daescu and
Kyle Fox},
title = {Trajectory planning for an articulated probe},
journal = {Comput. Geom.},
volume = {90},
pages = {101655},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101655},
doi = {10.1016/J.COMGEO.2020.101655},
timestamp = {Thu, 16 Jul 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/TeoDF20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta20,
author = {Giovanni Viglietta},
title = {Optimally guarding 2-reflex orthogonal polyhedra by reflex edge guards},
journal = {Comput. Geom.},
volume = {86},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101589},
doi = {10.1016/J.COMGEO.2019.101589},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Viglietta20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangW20,
author = {Yuan Wang and
Bei Wang},
title = {Topological inference of manifolds with boundary},
journal = {Comput. Geom.},
volume = {88},
pages = {101606},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2019.101606},
doi = {10.1016/J.COMGEO.2019.101606},
timestamp = {Mon, 23 Aug 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/WangW20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ20,
author = {Jie Xue and
Yuan Li and
Ravi Janardan},
title = {Approximate range closest-pair queries},
journal = {Comput. Geom.},
volume = {90},
pages = {101654},
year = {2020},
url = {https://doi.org/10.1016/j.comgeo.2020.101654},
doi = {10.1016/J.COMGEO.2020.101654},
timestamp = {Fri, 27 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/XueLJ20.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/0001KW19,
author = {Matt Gibson and
Erik Krohn and
Qing Wang},
title = {The VC-dimension of visibility on the boundary of monotone polygons},
journal = {Comput. Geom.},
volume = {77},
pages = {62--72},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.006},
doi = {10.1016/J.COMGEO.2018.10.006},
timestamp = {Tue, 09 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/0001KW19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AcharyyaNPR19,
author = {Ankush Acharyya and
Subhas C. Nandy and
Supantha Pandit and
Sasanka Roy},
title = {Covering segments with unit squares},
journal = {Comput. Geom.},
volume = {79},
pages = {1--13},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.001},
doi = {10.1016/J.COMGEO.2019.01.001},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AcharyyaNPR19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ackerman19,
author = {Eyal Ackerman},
title = {On topological graphs with at most four crossings per edge},
journal = {Comput. Geom.},
volume = {85},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.101574},
doi = {10.1016/J.COMGEO.2019.101574},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ackerman19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnABCDPS19,
author = {Hee{-}Kap Ahn and
Judit Abardia and
Sang Won Bae and
Otfried Cheong and
Susanna Dann and
Dongwoo Park and
Chan{-}Su Shin},
title = {The minimum convex container of two convex polytopes under translations},
journal = {Comput. Geom.},
volume = {77},
pages = {40--50},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.02.004},
doi = {10.1016/J.COMGEO.2018.02.004},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnABCDPS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBCKMOPRV19,
author = {Hee{-}Kap Ahn and
Sang Won Bae and
Jong Min Choi and
Matias Korman and
Wolfgang Mulzer and
Eunjin Oh and
Ji{-}won Park and
Andr{\'{e}} van Renssen and
Antoine Vigneron},
title = {Faster algorithms for growing prioritized disks and rectangles},
journal = {Comput. Geom.},
volume = {80},
pages = {23--39},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.02.001},
doi = {10.1016/J.COMGEO.2019.02.001},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBCKMOPRV19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnOSSS19,
author = {Hee{-}Kap Ahn and
Eunjin Oh and
Lena Schlipf and
Fabian Stehn and
Darren Strash},
title = {On Romeo and Juliet problems: Minimizing distance-to-sight},
journal = {Comput. Geom.},
volume = {84},
pages = {12--21},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.003},
doi = {10.1016/J.COMGEO.2019.07.003},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnOSSS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHKPRR19,
author = {Oswin Aichholzer and
Thomas Hackl and
Matias Korman and
Alexander Pilz and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen and
G{\"{u}}nter Rote and
Birgit Vogtenhuber},
title = {Packing plane spanning graphs with short edges in complete geometric
graphs},
journal = {Comput. Geom.},
volume = {82},
pages = {1--15},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.04.001},
doi = {10.1016/J.COMGEO.2019.04.001},
timestamp = {Fri, 31 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHKPRR19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHPRU19,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
Ferran Hurtado and
Pablo P{\'{e}}rez{-}Lantero and
Andres J. Ruiz{-}Vargas and
Jorge Urrutia and
Birgit Vogtenhuber},
title = {Cross-sections of line configurations in {R3} and (\emph{d} - 2)-flat
configurations in Rd},
journal = {Comput. Geom.},
volume = {77},
pages = {51--61},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.02.005},
doi = {10.1016/J.COMGEO.2018.02.005},
timestamp = {Tue, 04 Dec 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHPRU19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCKL19,
author = {Greg Aloupis and
Paz Carmi and
Lilach Chaitman{-}Yerushalmi and
Matthew J. Katz and
Stefan Langerman},
title = {Bottleneck detour tree of points on a path},
journal = {Comput. Geom.},
volume = {79},
pages = {30--36},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.005},
doi = {10.1016/J.COMGEO.2019.01.005},
timestamp = {Thu, 04 Apr 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCKL19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AtalayM19,
author = {F. Bet{\"{u}}l Atalay and
David M. Mount},
title = {Bounds on the cost of compatible refinement of simplex decomposition
trees in arbitrary dimensions},
journal = {Comput. Geom.},
volume = {79},
pages = {14--29},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.004},
doi = {10.1016/J.COMGEO.2019.01.004},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AtalayM19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AurenhammerSK19,
author = {Franz Aurenhammer and
Michael Steinkogler and
Rolf Klein},
title = {Partially walking a polygon},
journal = {Comput. Geom.},
volume = {84},
pages = {3--11},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.002},
doi = {10.1016/J.COMGEO.2019.07.002},
timestamp = {Tue, 10 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AurenhammerSK19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae19,
author = {Sang Won Bae},
title = {Computing a minimum-width square or rectangular annulus with outliers},
journal = {Comput. Geom.},
volume = {76},
pages = {33--45},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.08.002},
doi = {10.1016/J.COMGEO.2018.08.002},
timestamp = {Wed, 25 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Bae19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeBCGL19,
author = {Sang Won Bae and
Mark de Berg and
Otfried Cheong and
Joachim Gudmundsson and
Christos Levcopoulos},
title = {Shortcuts for the circle},
journal = {Comput. Geom.},
volume = {79},
pages = {37--54},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.006},
doi = {10.1016/J.COMGEO.2019.01.006},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaeBCGL19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeKO19,
author = {Sang Won Bae and
Matias Korman and
Yoshio Okamoto},
title = {Computing the geodesic centers of a polygonal domain},
journal = {Comput. Geom.},
volume = {77},
pages = {3--9},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2015.10.009},
doi = {10.1016/J.COMGEO.2015.10.009},
timestamp = {Wed, 25 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaeKO19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeOS19,
author = {Sang Won Bae and
Yoshio Okamoto and
Chan{-}Su Shin},
title = {Area bounds of rectilinear polygons realized by angle sequences},
journal = {Comput. Geom.},
volume = {83},
pages = {9--29},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.05.004},
doi = {10.1016/J.COMGEO.2019.05.004},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaeOS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeS19,
author = {Sang Won Bae and
Michiel H. M. Smid},
title = {Closest-pair queries in fat rectangles},
journal = {Comput. Geom.},
volume = {83},
pages = {1--8},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.05.003},
doi = {10.1016/J.COMGEO.2019.05.003},
timestamp = {Fri, 15 Nov 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaeS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeSV19,
author = {Sang Won Bae and
Chan{-}Su Shin and
Antoine Vigneron},
title = {Tight bounds for beacon-based coverage in simple rectilinear polygons},
journal = {Comput. Geom.},
volume = {80},
pages = {40--52},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.02.002},
doi = {10.1016/J.COMGEO.2019.02.002},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaeSV19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshF19,
author = {Davood Bakhshesh and
Mohammad Farshi},
title = {(Weakly) Self-approaching geometric graphs and spanners},
journal = {Comput. Geom.},
volume = {78},
pages = {20--36},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.002},
doi = {10.1016/J.COMGEO.2018.10.002},
timestamp = {Tue, 04 Dec 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshF19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyapadhyayMM19,
author = {Sayan Bandyapadhyay and
Anil Maheshwari and
Saeed Mehrabi and
Subhash Suri},
title = {Approximating dominating set on intersection graphs of rectangles
and L-frames},
journal = {Comput. Geom.},
volume = {82},
pages = {32--44},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.04.004},
doi = {10.1016/J.COMGEO.2019.04.004},
timestamp = {Fri, 31 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BandyapadhyayMM19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergM19,
author = {Mark de Berg and
Aleksandar Markovic},
title = {Dynamic conflict-free colorings in the plane},
journal = {Comput. Geom.},
volume = {78},
pages = {61--73},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.005},
doi = {10.1016/J.COMGEO.2018.10.005},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergM19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS19,
author = {Ahmad Biniaz and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Flip distance to some plane configurations},
journal = {Comput. Geom.},
volume = {81},
pages = {12--21},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.008},
doi = {10.1016/J.COMGEO.2019.01.008},
timestamp = {Tue, 14 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrazilVZRT19,
author = {Marcus Brazil and
Marcus Volz and
Martin Zachariasen and
Charl J. Ras and
Doreen A. Thomas},
title = {New pruning rules for the Steiner tree problem and 2-connected Steiner
network problem},
journal = {Comput. Geom.},
volume = {78},
pages = {37--49},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.003},
doi = {10.1016/J.COMGEO.2018.10.003},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BrazilVZRT19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBMS19,
author = {Kevin Buchin and
Maike Buchin and
Wouter Meulemans and
Bettina Speckmann},
title = {Locally correct Fr{\'{e}}chet matchings},
journal = {Comput. Geom.},
volume = {76},
pages = {1--18},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.09.002},
doi = {10.1016/J.COMGEO.2018.09.002},
timestamp = {Fri, 27 Mar 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinBMS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiCO19,
author = {Paz Carmi and
Lilach Chaitman{-}Yerushalmi and
Bat{-}Chen Ozeri},
title = {Minimizing the sum of distances to a server in a constraint network},
journal = {Comput. Geom.},
volume = {80},
pages = {1--12},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.003},
doi = {10.1016/J.COMGEO.2019.01.003},
timestamp = {Tue, 14 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiCO19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChaplickLWZ19,
author = {Steven Chaplick and
Fabian Lipp and
Alexander Wolff and
Johannes Zink},
title = {Compact drawings of 1-planar graphs with right-angle crossings and
few bends},
journal = {Comput. Geom.},
volume = {84},
pages = {50--68},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.006},
doi = {10.1016/J.COMGEO.2019.07.006},
timestamp = {Wed, 14 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChaplickLWZ19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChoudharyG19,
author = {Aruni Choudhary and
Arijit Ghosh},
title = {Delaunay simplices in diagonally distorted lattices},
journal = {Comput. Geom.},
volume = {81},
pages = {33--44},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.010},
doi = {10.1016/J.COMGEO.2019.01.010},
timestamp = {Fri, 31 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChoudharyG19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuFMPS19,
author = {Ovidiu Daescu and
Stephan Friedrichs and
Hemant Malik and
Valentin Polishchuk and
Christiane Schmidt},
title = {Altitude terrain guarding and guarding uni-monotone polygons},
journal = {Comput. Geom.},
volume = {84},
pages = {22--35},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.004},
doi = {10.1016/J.COMGEO.2019.07.004},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DaescuFMPS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyPRS19,
author = {Tamal K. Dey and
Pan Peng and
Alfred Rossi and
Anastasios Sidiropoulos},
title = {Spectral concentration and greedy \emph{k}-clustering},
journal = {Comput. Geom.},
volume = {76},
pages = {19--32},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.09.001},
doi = {10.1016/J.COMGEO.2018.09.001},
timestamp = {Fri, 13 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DeyPRS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu19,
author = {Adrian Dumitrescu},
title = {A product inequality for extreme distances},
journal = {Comput. Geom.},
volume = {85},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.101577},
doi = {10.1016/J.COMGEO.2019.101577},
timestamp = {Mon, 09 Dec 2019 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherM19,
author = {Stephane Durocher and
Debajyoti Mondal},
title = {Drawing plane triangulations with few segments},
journal = {Comput. Geom.},
volume = {77},
pages = {27--39},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.02.003},
doi = {10.1016/J.COMGEO.2018.02.003},
timestamp = {Tue, 04 Dec 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherM19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoxPS19,
author = {Jacob Fox and
J{\'{a}}nos Pach and
Andrew Suk},
title = {Approximating the rectilinear crossing number},
journal = {Comput. Geom.},
volume = {81},
pages = {45--53},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.04.003},
doi = {10.1016/J.COMGEO.2019.04.003},
timestamp = {Tue, 14 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FoxPS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeZ19,
author = {Meng He and
Norbert Zeh},
title = {Editorial: Special issue on the 26th Canadian Conference on Computational
Geometry {(CCCG)}},
journal = {Comput. Geom.},
volume = {77},
pages = {1--2},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.08.001},
doi = {10.1016/J.COMGEO.2018.08.001},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HeZ19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HlinenyPR19,
author = {Petr Hlinen{\'{y}} and
Filip Pokr{\'{y}}vka and
Bodhayan Roy},
title = {{FO} model checking on geometric graphs},
journal = {Comput. Geom.},
volume = {78},
pages = {1--19},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.001},
doi = {10.1016/J.COMGEO.2018.10.001},
timestamp = {Wed, 25 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HlinenyPR19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HuemerPS19,
author = {Clemens Huemer and
Alexander Pilz and
Rodrigo I. Silveira},
title = {A new lower bound on the maximum number of plane graphs using production
matrices},
journal = {Comput. Geom.},
volume = {84},
pages = {36--49},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.005},
doi = {10.1016/J.COMGEO.2019.07.005},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HuemerPS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaplanRS19,
author = {Haim Kaplan and
Sasanka Roy and
Micha Sharir},
title = {Finding axis-parallel rectangles of fixed perimeter or area containing
the largest number of points},
journal = {Comput. Geom.},
volume = {81},
pages = {1--11},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.007},
doi = {10.1016/J.COMGEO.2019.01.007},
timestamp = {Tue, 14 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KaplanRS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KawamuraMOP19,
author = {Akitoshi Kawamura and
Sonoko Moriyama and
Yota Otachi and
J{\'{a}}nos Pach},
title = {A lower bound on opaque sets},
journal = {Comput. Geom.},
volume = {80},
pages = {13--22},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.002},
doi = {10.1016/J.COMGEO.2019.01.002},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KawamuraMOP19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleistKLSSS19,
author = {Linda Kleist and
Boris Klemz and
Anna Lubiw and
Lena Schlipf and
Frank Staals and
Darren Strash},
title = {Convexity-increasing morphs of planar graphs},
journal = {Comput. Geom.},
volume = {84},
pages = {69--88},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.007},
doi = {10.1016/J.COMGEO.2019.07.007},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KleistKLSSS19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanM19,
author = {Matias Korman and
Wolfgang Mulzer},
title = {Special Issue on the 34th European Workshop on Computational Geometry,
Guest Editors' Foreword},
journal = {Comput. Geom.},
volume = {84},
pages = {1--2},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.07.001},
doi = {10.1016/J.COMGEO.2019.07.001},
timestamp = {Tue, 10 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KormanM19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartinY19,
author = {Pedro Mart{\'{\i}}n and
Diego Y{\'{a}}{\~{n}}ez},
title = {Geometric clustering in normed planes},
journal = {Comput. Geom.},
volume = {78},
pages = {50--60},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.004},
doi = {10.1016/J.COMGEO.2018.10.004},
timestamp = {Thu, 23 Sep 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/MartinY19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhA19,
author = {Eunjin Oh and
Hee{-}Kap Ahn},
title = {Assigning weights to minimize the covering radius in the plane},
journal = {Comput. Geom.},
volume = {81},
pages = {22--32},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2018.10.007},
doi = {10.1016/J.COMGEO.2018.10.007},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/OhA19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhA19a,
author = {Eunjin Oh and
Hee{-}Kap Ahn},
title = {Finding pairwise intersections of rectangles in a query rectangle},
journal = {Comput. Geom.},
volume = {85},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.101576},
doi = {10.1016/J.COMGEO.2019.101576},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/OhA19a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhBA19,
author = {Eunjin Oh and
Sang Won Bae and
Hee{-}Kap Ahn},
title = {Computing a geodesic two-center of points in a simple polygon},
journal = {Comput. Geom.},
volume = {82},
pages = {45--59},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.05.001},
doi = {10.1016/J.COMGEO.2019.05.001},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/OhBA19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmatiAKW19,
author = {Zahed Rahmati and
Mohammad Ali Abam and
Valerie King and
Sue Whitesides},
title = {Kinetic \emph{k}-Semi-Yao graph and its applications},
journal = {Comput. Geom.},
volume = {77},
pages = {10--26},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2015.11.001},
doi = {10.1016/J.COMGEO.2015.11.001},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/RahmatiAKW19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SattariI19,
author = {Sattar Sattari and
Mohammad Izadi},
title = {An improved upper bound on dilation of regular polygons},
journal = {Comput. Geom.},
volume = {80},
pages = {53--68},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.01.009},
doi = {10.1016/J.COMGEO.2019.01.009},
timestamp = {Fri, 31 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SattariI19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ19,
author = {Jie Xue and
Yuan Li and
Ravi Janardan},
title = {On the expected diameter, width, and complexity of a stochastic convex
hull},
journal = {Comput. Geom.},
volume = {82},
pages = {16--31},
year = {2019},
url = {https://doi.org/10.1016/j.comgeo.2019.04.002},
doi = {10.1016/J.COMGEO.2019.04.002},
timestamp = {Fri, 27 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/XueLJ19.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbelDDISU18,
author = {Zachary Abel and
Erik D. Demaine and
Martin L. Demaine and
Hiro Ito and
Jack Snoeyink and
Ryuhei Uehara},
title = {Bumpy pyramid folding},
journal = {Comput. Geom.},
volume = {75},
pages = {22--31},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.007},
doi = {10.1016/J.COMGEO.2018.06.007},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbelDDISU18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBHPRV18,
author = {Oswin Aichholzer and
Martin Balko and
Thomas Hackl and
Alexander Pilz and
Pedro Ramos and
Pavel Valtr and
Birgit Vogtenhuber},
title = {Holes in 2-convex point sets},
journal = {Comput. Geom.},
volume = {74},
pages = {38--49},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.002},
doi = {10.1016/J.COMGEO.2018.06.002},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBHPRV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBHPV18,
author = {Oswin Aichholzer and
Luis Barba and
Thomas Hackl and
Alexander Pilz and
Birgit Vogtenhuber},
title = {Linear transformation distance for bichromatic matchings},
journal = {Comput. Geom.},
volume = {68},
pages = {77--88},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.003},
doi = {10.1016/J.COMGEO.2017.05.003},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBHPV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMFHUV18,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
David Flores{-}Pe{\~{n}}aloza and
Thomas Hackl and
Jorge Urrutia and
Birgit Vogtenhuber},
title = {Modem illumination of monotone polygons},
journal = {Comput. Geom.},
volume = {68},
pages = {101--118},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.010},
doi = {10.1016/J.COMGEO.2017.05.010},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMFHUV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkitayaDDHHKL18,
author = {Hugo A. Akitaya and
Erik D. Demaine and
Martin L. Demaine and
Adam Hesterberg and
Ferran Hurtado and
Jason S. Ku and
Jayson Lynch},
title = {Pachinko},
journal = {Comput. Geom.},
volume = {68},
pages = {226--242},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.011},
doi = {10.1016/J.COMGEO.2017.06.011},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AkitayaDDHHKL18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Alegria-Galicia18,
author = {Carlos Alegr{\'{\i}}a{-}Galicia and
David Orden and
Carlos Seara and
Jorge Urrutia},
title = {On the {\unicode{119978}}\({}_{\mbox{{\(\beta\)}}}\) of a planar point
set},
journal = {Comput. Geom.},
volume = {68},
pages = {277--291},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.003},
doi = {10.1016/J.COMGEO.2017.06.003},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Alegria-Galicia18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArleoBGEGLMMWW18,
author = {Alessio Arleo and
Carla Binucci and
Emilio Di Giacomo and
William S. Evans and
Luca Grilli and
Giuseppe Liotta and
Henk Meijer and
Fabrizio Montecchiani and
Sue Whitesides and
Stephen K. Wismath},
title = {Visibility representations of boxes in 2.5 dimensions},
journal = {Comput. Geom.},
volume = {72},
pages = {19--33},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.02.007},
doi = {10.1016/J.COMGEO.2018.02.007},
timestamp = {Mon, 15 Jun 2020 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ArleoBGEGLMMWW18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsinowskiR18,
author = {Andrei Asinowski and
G{\"{u}}nter Rote},
title = {Point sets with many non-crossing perfect matchings},
journal = {Comput. Geom.},
volume = {68},
pages = {7--33},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.006},
doi = {10.1016/J.COMGEO.2017.05.006},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AsinowskiR18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BakhsheshBBCDFF18,
author = {Davood Bakhshesh and
Luis Barba and
Prosenjit Bose and
Jean{-}Lou De Carufel and
Mirela Damian and
Rolf Fagerberg and
Mohammad Farshi and
Andr{\'{e}} van Renssen and
Perouz Taslakian and
Sander Verdonschot},
title = {Continuous Yao graphs},
journal = {Comput. Geom.},
volume = {67},
pages = {42--52},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.002},
doi = {10.1016/J.COMGEO.2017.10.002},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BakhsheshBBCDFF18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaramFHHM18,
author = {Alon Baram and
Efi Fogel and
Dan Halperin and
Michael Hemmer and
Sebastian Morr},
title = {Exact Minkowski sums of polygons with holes},
journal = {Comput. Geom.},
volume = {73},
pages = {46--56},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.005},
doi = {10.1016/J.COMGEO.2018.06.005},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaramFHHM18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyFMMOP18,
author = {Imre B{\'{a}}r{\'{a}}ny and
Ferenc Fodor and
{\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and
Luis Montejano and
Deborah Oliveros and
Attila P{\'{o}}r},
title = {Acknowledgement of priority - {A} fractional Helly theorem for boxes},
journal = {Comput. Geom.},
volume = {67},
pages = {1},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2016.09.001},
doi = {10.1016/J.COMGEO.2016.09.001},
timestamp = {Fri, 29 Jul 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS18,
author = {Ahmad Biniaz and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Strong matching of points with geometric shapes},
journal = {Comput. Geom.},
volume = {68},
pages = {186--205},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.009},
doi = {10.1016/J.COMGEO.2017.06.009},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerKLL18,
author = {Cecilia Bohler and
Rolf Klein and
Andrzej Lingas and
Chih{-}Hung Liu},
title = {Forest-like abstract Voronoi diagrams in linear time},
journal = {Comput. Geom.},
volume = {68},
pages = {134--145},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.013},
doi = {10.1016/J.COMGEO.2017.06.013},
timestamp = {Tue, 14 Sep 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BohlerKLL18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCR18,
author = {Prosenjit Bose and
Jean{-}Lou De Carufel and
Andr{\'{e}} van Renssen},
title = {Constrained generalized Delaunay graphs are plane spanners},
journal = {Comput. Geom.},
volume = {74},
pages = {50--65},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.006},
doi = {10.1016/J.COMGEO.2018.06.006},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCR18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseLPV18,
author = {Prosenjit Bose and
Anna Lubiw and
Vinayak Pathak and
Sander Verdonschot},
title = {Flipping edge-labelled triangulations},
journal = {Comput. Geom.},
volume = {68},
pages = {309--326},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.005},
doi = {10.1016/J.COMGEO.2017.06.005},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseLPV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseR18,
author = {Prosenjit Bose and
Pedro Ramos},
title = {Editorial: Special issue in memory of Dr. Ferran Hurtado},
journal = {Comput. Geom.},
volume = {68},
pages = {1},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.001},
doi = {10.1016/J.COMGEO.2017.10.001},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseR18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg18,
author = {Franz J. Brandenburg},
title = {T-shape visibility representations of 1-planar graphs},
journal = {Comput. Geom.},
volume = {69},
pages = {16--30},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.007},
doi = {10.1016/J.COMGEO.2017.10.007},
timestamp = {Wed, 20 Dec 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brenner18,
author = {Ulrich Brenner},
title = {\emph{{\(\gamma\)}}-Soft packings of rectangles},
journal = {Comput. Geom.},
volume = {70-71},
pages = {49--64},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.005},
doi = {10.1016/J.COMGEO.2018.01.005},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Brenner18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrodnikC18,
author = {Andrej Brodnik and
Sergio Cabello},
title = {Editorial: EuroCG2015},
journal = {Comput. Geom.},
volume = {73},
pages = {1},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.010},
doi = {10.1016/J.COMGEO.2018.06.010},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BrodnikC18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinOS18,
author = {Kevin Buchin and
Tim Ophelders and
Bettina Speckmann},
title = {Computing the similarity between moving curves},
journal = {Comput. Geom.},
volume = {73},
pages = {2--14},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.01.002},
doi = {10.1016/J.COMGEO.2017.01.002},
timestamp = {Sun, 02 Jun 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinOS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloM18,
author = {Sergio Cabello and
Lazar Milinkovic},
title = {Two optimization problems for unit disks},
journal = {Comput. Geom.},
volume = {70-71},
pages = {1--12},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.12.001},
doi = {10.1016/J.COMGEO.2017.12.001},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloM18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CannonFILS18,
author = {Sarah Cannon and
Thomas G. Fai and
Justin Iwerks and
Undine Leopold and
Christiane Schmidt},
title = {Combinatorics and complexity of guarding polygons with edge and point
2-transmitters},
journal = {Comput. Geom.},
volume = {68},
pages = {89--100},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.004},
doi = {10.1016/J.COMGEO.2017.06.004},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CannonFILS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalHKTW18,
author = {Jean Cardinal and
Michael Hoffmann and
Vincent Kusters and
Csaba D. T{\'{o}}th and
Manuel Wettstein},
title = {Arc diagrams, flip distances, and Hamiltonian triangulations},
journal = {Comput. Geom.},
volume = {68},
pages = {206--225},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.001},
doi = {10.1016/J.COMGEO.2017.06.001},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalHKTW18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersFHMMVSW18,
author = {Erin W. Chambers and
S{\'{a}}ndor P. Fekete and
Hella{-}Franziska Hoffmann and
Dimitri Marinakis and
Joseph S. B. Mitchell and
Srinivasan Venkatesh and
Ulrike Stege and
Sue Whitesides},
title = {Connecting a set of circles with minimum sum of radii},
journal = {Comput. Geom.},
volume = {68},
pages = {62--76},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.002},
doi = {10.1016/J.COMGEO.2017.06.002},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChambersFHMMVSW18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ClaverolOGST18,
author = {Merc{\`{e}} Claverol and
Alfredo Garc{\'{\i}}a Olaverri and
Delia Garijo and
Carlos Seara and
Javier Tejel},
title = {On Hamiltonian alternating cycles and paths},
journal = {Comput. Geom.},
volume = {68},
pages = {146--166},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.009},
doi = {10.1016/J.COMGEO.2017.05.009},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ClaverolOGST18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Damian18,
author = {Mirela Damian},
title = {Cone-based spanners of constant degree},
journal = {Comput. Geom.},
volume = {68},
pages = {48--61},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.004},
doi = {10.1016/J.COMGEO.2017.05.004},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Damian18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevroyeM18,
author = {Luc Devroye and
Pat Morin},
title = {A note on interference in random networks},
journal = {Comput. Geom.},
volume = {67},
pages = {2--10},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.006},
doi = {10.1016/J.COMGEO.2017.10.006},
timestamp = {Wed, 25 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DevroyeM18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ18,
author = {Adrian Dumitrescu and
Minghui Jiang},
title = {Minimum rectilinear Steiner tree of n points in the unit square},
journal = {Comput. Geom.},
volume = {68},
pages = {253--261},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.007},
doi = {10.1016/J.COMGEO.2017.06.007},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EdelsbrunnerH18,
author = {Herbert Edelsbrunner and
Mabel Iglesias Ham},
title = {Multiple covers with balls {I:} Inclusion-exclusion},
journal = {Comput. Geom.},
volume = {68},
pages = {119--133},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.014},
doi = {10.1016/J.COMGEO.2017.06.014},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerH18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EderHP18,
author = {G{\"{u}}nther Eder and
Martin Held and
Peter Palfrader},
title = {Parallelized ear clipping for the triangulation and constrained Delaunay
triangulation of polygons},
journal = {Comput. Geom.},
volume = {73},
pages = {15--23},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.004},
doi = {10.1016/J.COMGEO.2018.01.004},
timestamp = {Mon, 03 Feb 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EderHP18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansFKKMNV18,
author = {William S. Evans and
Stefan Felsner and
Michael Kaufmann and
Stephen G. Kobourov and
Debajyoti Mondal and
Rahnuma Islam Nishat and
Kevin Verbeek},
title = {Table cartogram},
journal = {Comput. Geom.},
volume = {68},
pages = {174--185},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.010},
doi = {10.1016/J.COMGEO.2017.06.010},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EvansFKKMNV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GyorgyiHK18,
author = {P{\'{e}}ter Gy{\"{o}}rgyi and
B{\'{a}}lint Hujter and
S{\'{a}}ndor Kisfaludi{-}Bak},
title = {On the number of touching pairs in a set of planar curves},
journal = {Comput. Geom.},
volume = {67},
pages = {29--37},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.004},
doi = {10.1016/J.COMGEO.2017.10.004},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GyorgyiHK18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannKSVW18,
author = {Frank Hoffmann and
Klaus Kriegel and
Subhash Suri and
Kevin Verbeek and
Max Willert},
title = {Tight bounds for conflict-free chromatic guarding of orthogonal art
galleries},
journal = {Comput. Geom.},
volume = {73},
pages = {24--34},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.003},
doi = {10.1016/J.COMGEO.2018.01.003},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HoffmannKSVW18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoKKLSSSST18,
author = {Ferran Hurtado and
Matias Korman and
Marc J. van Kreveld and
Maarten L{\"{o}}ffler and
Vera Sacrist{\'{a}}n and
Akiyoshi Shioura and
Rodrigo I. Silveira and
Bettina Speckmann and
Takeshi Tokuyama},
title = {Colored spanning graphs for set visualization},
journal = {Comput. Geom.},
volume = {68},
pages = {262--276},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.006},
doi = {10.1016/J.COMGEO.2017.06.006},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HurtadoKKLSSSST18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KanoK18,
author = {Mikio Kano and
Jan Kyncl},
title = {The hamburger theorem},
journal = {Comput. Geom.},
volume = {68},
pages = {167--173},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.012},
doi = {10.1016/J.COMGEO.2017.06.012},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KanoK18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KellerS18,
author = {Chaya Keller and
Yael Stein},
title = {Reconstruction of the path graph},
journal = {Comput. Geom.},
volume = {72},
pages = {1--10},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.02.002},
doi = {10.1016/J.COMGEO.2018.02.002},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KellerS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KellerS18a,
author = {Chaya Keller and
Shakhar Smorodinsky},
title = {On piercing numbers of families satisfying the (\emph{p}, \emph{q})\({}_{\mbox{\emph{r}}}\)
property},
journal = {Comput. Geom.},
volume = {72},
pages = {11--18},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.02.001},
doi = {10.1016/J.COMGEO.2018.02.001},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KellerS18a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Klein18,
author = {Rolf Klein},
title = {Reversibility properties of the fire-fighting problem in graphs},
journal = {Comput. Geom.},
volume = {67},
pages = {38--41},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.003},
doi = {10.1016/J.COMGEO.2017.10.003},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Klein18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerSS18,
author = {Christian Knauer and
Luise Sommer and
Fabian Stehn},
title = {Elastic geometric shape matching for translations under the Manhattan
norm},
journal = {Comput. Geom.},
volume = {73},
pages = {57--69},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.002},
doi = {10.1016/J.COMGEO.2018.01.002},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KnauerSS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanLMPSV18,
author = {Matias Korman and
Stefan Langerman and
Wolfgang Mulzer and
Alexander Pilz and
Maria Saumell and
Birgit Vogtenhuber},
title = {The dual diameter of triangulations},
journal = {Comput. Geom.},
volume = {68},
pages = {243--252},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.008},
doi = {10.1016/J.COMGEO.2017.06.008},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KormanLMPSV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanLSS18,
author = {Matias Korman and
Maarten L{\"{o}}ffler and
Rodrigo I. Silveira and
Darren Strash},
title = {On the complexity of barrier resilience for fat regions and bounded
ply},
journal = {Comput. Geom.},
volume = {72},
pages = {34--51},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.02.006},
doi = {10.1016/J.COMGEO.2018.02.006},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KormanLSS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KormanMRRSS18,
author = {Matias Korman and
Wolfgang Mulzer and
Andr{\'{e}} van Renssen and
Marcel Roeloffzen and
Paul Seiferth and
Yannik Stein},
title = {Time-space trade-offs for triangulations and Voronoi diagrams},
journal = {Comput. Geom.},
volume = {73},
pages = {35--45},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.01.001},
doi = {10.1016/J.COMGEO.2017.01.001},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KormanMRRSS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KouhestaniRS18,
author = {Bahram Kouhestani and
David Rappaport and
Kai Salomaa},
title = {Routing in a polygonal terrain with the shortest beacon watchtower},
journal = {Comput. Geom.},
volume = {68},
pages = {34--47},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.005},
doi = {10.1016/J.COMGEO.2017.05.005},
timestamp = {Mon, 27 Nov 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KouhestaniRS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LeeY18,
author = {Seunghun Lee and
Kang Min Yoo},
title = {On a conjecture of Karasev},
journal = {Comput. Geom.},
volume = {75},
pages = {1--10},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.003},
doi = {10.1016/J.COMGEO.2018.06.003},
timestamp = {Sun, 22 Oct 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LeeY18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSS18,
author = {Anil Maheshwari and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Christian Scheffer},
title = {Approximating the integral Fr{\'{e}}chet distance},
journal = {Comput. Geom.},
volume = {70-71},
pages = {13--30},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.001},
doi = {10.1016/J.COMGEO.2018.01.001},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MonroyOHJPSSTU18,
author = {Ruy Fabila Monroy and
Alfredo Garc{\'{\i}}a Olaverri and
Ferran Hurtado and
Rafel Jaume and
Pablo P{\'{e}}rez{-}Lantero and
Maria Saumell and
Rodrigo I. Silveira and
Javier Tejel and
Jorge Urrutia},
title = {Colored ray configurations},
journal = {Comput. Geom.},
volume = {68},
pages = {292--308},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.008},
doi = {10.1016/J.COMGEO.2017.05.008},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MonroyOHJPSSTU18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OhCA18,
author = {Eunjin Oh and
Jean{-}Lou De Carufel and
Hee{-}Kap Ahn},
title = {The geodesic 2-center problem in a simple polygon},
journal = {Comput. Geom.},
volume = {74},
pages = {21--37},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.02.008},
doi = {10.1016/J.COMGEO.2018.02.008},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/OhCA18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachSTT18,
author = {J{\'{a}}nos Pach and
L{\'{a}}szl{\'{o}} A. Sz{\'{e}}kely and
Csaba D. T{\'{o}}th and
G{\'{e}}za T{\'{o}}th},
title = {Note on k-planar crossing numbers},
journal = {Comput. Geom.},
volume = {68},
pages = {2--6},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.06.015},
doi = {10.1016/J.COMGEO.2017.06.015},
timestamp = {Mon, 20 May 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/PachSTT18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RamaswamiS18,
author = {Suneeta Ramaswami and
Marcelo Siqueira},
title = {A fast algorithm for computing irreducible triangulations of closed
surfaces in {\(\mathbb{E}\)}\({}^{\mbox{d}}\)},
journal = {Comput. Geom.},
volume = {68},
pages = {327--357},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.05.007},
doi = {10.1016/J.COMGEO.2017.05.007},
timestamp = {Tue, 21 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RamaswamiS18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sack18,
author = {J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {Editor's note},
journal = {Comput. Geom.},
volume = {69},
pages = {1},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.11.002},
doi = {10.1016/J.COMGEO.2017.11.002},
timestamp = {Wed, 20 Dec 2017 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Sack18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SharirSVZ18,
author = {Micha Sharir and
Shakhar Smorodinsky and
Claudiu Valculescu and
Frank de Zeeuw},
title = {Distinct distances between points and lines},
journal = {Comput. Geom.},
volume = {69},
pages = {2--15},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.008},
doi = {10.1016/J.COMGEO.2017.10.008},
timestamp = {Sat, 19 Oct 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SharirSVZ18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SpeckmannV18,
author = {Bettina Speckmann and
Kevin Verbeek},
title = {Homotopic {\unicode{119966}}-oriented routing with few links and thick
edges},
journal = {Comput. Geom.},
volume = {67},
pages = {11--28},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.10.005},
doi = {10.1016/J.COMGEO.2017.10.005},
timestamp = {Sun, 02 Jun 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SpeckmannV18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SultanaHRMH18,
author = {Shaheena Sultana and
Md. Iqbal Hossain and
Md. Saidur Rahman and
Nazmun Nessa Moon and
Tahsina Hashem},
title = {On triangle cover contact graphs},
journal = {Comput. Geom.},
volume = {69},
pages = {31--38},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2017.11.001},
doi = {10.1016/J.COMGEO.2017.11.001},
timestamp = {Tue, 12 Mar 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SultanaHRMH18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wang18,
author = {Haitao Wang},
title = {An improved algorithm for diameter-optimally augmenting paths in a
metric space},
journal = {Comput. Geom.},
volume = {75},
pages = {11--21},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.004},
doi = {10.1016/J.COMGEO.2018.06.004},
timestamp = {Sun, 18 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Wang18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XueLJ18,
author = {Jie Xue and
Yuan Li and
Ravi Janardan},
title = {On the separability of stochastic geometric objects, with applications},
journal = {Comput. Geom.},
volume = {74},
pages = {1--20},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.06.001},
doi = {10.1016/J.COMGEO.2018.06.001},
timestamp = {Fri, 27 Nov 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/XueLJ18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZangenehO18,
author = {Reza Zangeneh and
Carl Ollivier{-}Gooch},
title = {Thread-parallel mesh improvement using face and edge swapping and
vertex insertion},
journal = {Comput. Geom.},
volume = {70-71},
pages = {31--48},
year = {2018},
url = {https://doi.org/10.1016/j.comgeo.2018.01.006},
doi = {10.1016/J.COMGEO.2018.01.006},
timestamp = {Mon, 29 Oct 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZangenehO18.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaM17,
author = {Jin Akiyama and
Kiyoko Matsunaga},
title = {Reversibility and foldability of Conway tiles},
journal = {Comput. Geom.},
volume = {64},
pages = {30--45},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.03.003},
doi = {10.1016/J.COMGEO.2017.03.003},
timestamp = {Wed, 17 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaM17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlamKM17,
author = {Md. Jawaherul Alam and
Stephen G. Kobourov and
Debajyoti Mondal},
title = {Orthogonal layout with optimal face complexity},
journal = {Comput. Geom.},
volume = {63},
pages = {40--52},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.02.005},
doi = {10.1016/J.COMGEO.2017.02.005},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AlamKM17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AnshuGSV17,
author = {Anurag Anshu and
Rahul Gangopadhyay and
Saswata Shannigrahi and
Satyanarayana Vusirikala},
title = {On the rectilinear crossing number of complete uniform hypergraphs},
journal = {Comput. Geom.},
volume = {61},
pages = {38--47},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.11.001},
doi = {10.1016/J.COMGEO.2016.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AnshuGSV17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikBDM17,
author = {Aritra Banik and
Bhaswar B. Bhattacharya and
Sandip Das and
Satyaki Mukherjee},
title = {The discrete Voronoi game in R\({}^{\mbox{2}}\)},
journal = {Comput. Geom.},
volume = {63},
pages = {53--62},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.02.003},
doi = {10.1016/J.COMGEO.2017.02.003},
timestamp = {Sat, 14 Oct 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BanikBDM17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarbaDMH17,
author = {Luis Barba and
Frank Duque and
Ruy Fabila Monroy and
Carlos Hidalgo{-}Toscano},
title = {Drawing the Horton set in an integer grid of minimum size},
journal = {Comput. Geom.},
volume = {63},
pages = {10--19},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.02.002},
doi = {10.1016/J.COMGEO.2017.02.002},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BarbaDMH17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BennettY17,
author = {Huck Bennett and
Chee Yap},
title = {Amortized analysis of smooth quadtrees in all dimensions},
journal = {Comput. Geom.},
volume = {63},
pages = {20--39},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.02.001},
doi = {10.1016/J.COMGEO.2017.02.001},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BennettY17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazLMS17,
author = {Ahmad Biniaz and
Paul Liu and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Approximation algorithms for the unit disk cover problem in 2D and
3D},
journal = {Comput. Geom.},
volume = {60},
pages = {8--18},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.04.002},
doi = {10.1016/J.COMGEO.2016.04.002},
timestamp = {Tue, 19 Dec 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazLMS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMNS17,
author = {Ahmad Biniaz and
Anil Maheshwari and
Subhas C. Nandy and
Michiel H. M. Smid},
title = {An optimal algorithm for plane matchings in multipartite geometric
graphs},
journal = {Comput. Geom.},
volume = {63},
pages = {1--9},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.02.004},
doi = {10.1016/J.COMGEO.2017.02.004},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMNS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatDGO17,
author = {Jean{-}Daniel Boissonnat and
Ramsay Dyer and
Arijit Ghosh and
Steve Y. Oudot},
title = {Only distances are required to reconstruct submanifolds},
journal = {Comput. Geom.},
volume = {66},
pages = {32--67},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.08.001},
doi = {10.1016/J.COMGEO.2017.08.001},
timestamp = {Tue, 26 Sep 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatDGO17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseV17,
author = {Prosenjit Bose and
Sander Verdonschot},
title = {Flips in edge-labelled pseudo-triangulations},
journal = {Comput. Geom.},
volume = {60},
pages = {45--54},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.08.001},
doi = {10.1016/J.COMGEO.2016.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseV17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanR17,
author = {Timothy M. Chan and
Zahed Rahmati},
title = {Approximating the minimum closest pair distance and nearest neighbor
distances of linearly moving points},
journal = {Comput. Geom.},
volume = {60},
pages = {2--7},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.04.001},
doi = {10.1016/J.COMGEO.2016.04.001},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChanR17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanS17,
author = {Timothy M. Chan and
Dimitrios Skrepetos},
title = {Dynamic data structures for approximate Hausdorff distance in the
word {RAM}},
journal = {Comput. Geom.},
volume = {60},
pages = {37--44},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.08.002},
doi = {10.1016/J.COMGEO.2016.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChangY17,
author = {Yi{-}Jun Chang and
Hsu{-}Chun Yen},
title = {On orthogonally convex drawings of plane graphs},
journal = {Comput. Geom.},
volume = {62},
pages = {34--51},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.01.003},
doi = {10.1016/J.COMGEO.2017.01.003},
timestamp = {Mon, 16 Sep 2019 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChangY17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianN17,
author = {Mirela Damian and
Naresh Nelavalli},
title = {Improved bounds on the stretch factor of Y\({}_{\mbox{4}}\)},
journal = {Comput. Geom.},
volume = {62},
pages = {14--24},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.12.001},
doi = {10.1016/J.COMGEO.2016.12.001},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DamianN17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DuqueMHP17,
author = {Frank Duque and
Ruy Fabila Monroy and
Carlos Hidalgo{-}Toscano and
Pablo P{\'{e}}rez{-}Lantero},
title = {Drawing the almost convex set in an integer grid of minimum size},
journal = {Comput. Geom.},
volume = {65},
pages = {1--11},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.04.002},
doi = {10.1016/J.COMGEO.2017.04.002},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DuqueMHP17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherFFMM17,
author = {Stephane Durocher and
Omrit Filtser and
Robert Fraser and
Ali D. Mehrabi and
Saeed Mehrabi},
title = {Guarding orthogonal art galleries with sliding cameras},
journal = {Comput. Geom.},
volume = {65},
pages = {12--26},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.04.001},
doi = {10.1016/J.COMGEO.2017.04.001},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherFFMM17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Fulek17,
author = {Radoslav Fulek},
title = {C-planarity of embedded cyclic c-graphs},
journal = {Comput. Geom.},
volume = {66},
pages = {1--13},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.06.016},
doi = {10.1016/J.COMGEO.2017.06.016},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Fulek17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FulekMNSSS17,
author = {Radoslav Fulek and
Hossein Nassajian Mojarrad and
M{\'{a}}rton Nasz{\'{o}}di and
J{\'{o}}zsef Solymosi and
Sebastian U. Stich and
May Szedl{\'{a}}k},
title = {On the existence of ordinary triangles},
journal = {Comput. Geom.},
volume = {66},
pages = {28--31},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.07.002},
doi = {10.1016/J.COMGEO.2017.07.002},
timestamp = {Fri, 30 Nov 2018 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FulekMNSSS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HatamiZ17,
author = {Behnam Hatami and
Hamid Zarrabi{-}Zadeh},
title = {A streaming algorithm for 2-center with outliers in high dimensions},
journal = {Comput. Geom.},
volume = {60},
pages = {26--36},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.07.002},
doi = {10.1016/J.COMGEO.2016.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HatamiZ17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeldK17,
author = {Stephan Held and
Nicolas K{\"{a}}mmerling},
title = {Two-level rectilinear Steiner trees},
journal = {Comput. Geom.},
volume = {61},
pages = {48--59},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.11.002},
doi = {10.1016/J.COMGEO.2016.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HeldK17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HolmsenKV17,
author = {Andreas F. Holmsen and
Jan Kyncl and
Claudiu Valculescu},
title = {Near equipartitions of colored point sets},
journal = {Comput. Geom.},
volume = {65},
pages = {35--42},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.05.001},
doi = {10.1016/J.COMGEO.2017.05.001},
timestamp = {Sat, 16 Sep 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HolmsenKV17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeilMPV17,
author = {J. Mark Keil and
Joseph S. B. Mitchell and
Dinabandhu Pradhan and
Martin Vatshelle},
title = {An algorithm for the maximum weight independent set problem on outerstring
graphs},
journal = {Comput. Geom.},
volume = {60},
pages = {19--25},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.05.001},
doi = {10.1016/J.COMGEO.2016.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KeilMPV17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwSV17,
author = {Anna Lubiw and
Jack Snoeyink and
Hamideh Vosoughpour},
title = {Visibility graphs, dismantlability, and the cops and robbers game},
journal = {Comput. Geom.},
volume = {66},
pages = {14--27},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.07.001},
doi = {10.1016/J.COMGEO.2017.07.001},
timestamp = {Tue, 26 Sep 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LubiwSV17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OrickSC17,
author = {Gerald L. Orick and
Kenneth Stephenson and
Charles R. Collins},
title = {A linearized circle packing algorithm},
journal = {Comput. Geom.},
volume = {64},
pages = {13--29},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.03.002},
doi = {10.1016/J.COMGEO.2017.03.002},
timestamp = {Wed, 17 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/OrickSC17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rappaport17,
author = {David Rappaport},
title = {Guest Editor's foreword},
journal = {Comput. Geom.},
volume = {60},
pages = {1},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.08.005},
doi = {10.1016/J.COMGEO.2016.08.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Rappaport17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RathodMN17,
author = {Abhishek Rathod and
Talha Bin Masood and
Vijay Natarajan},
title = {Approximation algorithms for Max Morse Matching},
journal = {Comput. Geom.},
volume = {61},
pages = {1--23},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.10.002},
doi = {10.1016/J.COMGEO.2016.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RathodMN17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RazSS17,
author = {Orit E. Raz and
Micha Sharir and
Ilya D. Shkredov},
title = {On the number of unit-area triangles spanned by convex grids in the
plane},
journal = {Comput. Geom.},
volume = {62},
pages = {25--33},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.12.002},
doi = {10.1016/J.COMGEO.2016.12.002},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/RazSS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ruiz-Vargas17,
author = {Andres J. Ruiz{-}Vargas},
title = {Many disjoint edges in topological graphs},
journal = {Comput. Geom.},
volume = {62},
pages = {1--13},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.11.003},
doi = {10.1016/J.COMGEO.2016.11.003},
timestamp = {Sat, 20 May 2017 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Ruiz-Vargas17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SavicS17,
author = {Marko Savic and
Milos Stojakovic},
title = {Faster bottleneck non-crossing matchings of points in convex position},
journal = {Comput. Geom.},
volume = {65},
pages = {27--34},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.05.002},
doi = {10.1016/J.COMGEO.2017.05.002},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SavicS17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SheikhiMBM17,
author = {Farnaz Sheikhi and
Ali Mohades and
Mark de Berg and
Ali D. Mehrabi},
title = {Separability of imprecise points},
journal = {Comput. Geom.},
volume = {61},
pages = {24--37},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2016.10.001},
doi = {10.1016/J.COMGEO.2016.10.001},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SheikhiMBM17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XuHSU17,
author = {Dawei Xu and
Takashi Horiyama and
Toshihiro Shirakawa and
Ryuhei Uehara},
title = {Common developments of three incongruent boxes of area 30},
journal = {Comput. Geom.},
volume = {64},
pages = {1--12},
year = {2017},
url = {https://doi.org/10.1016/j.comgeo.2017.03.001},
doi = {10.1016/J.COMGEO.2017.03.001},
timestamp = {Tue, 29 Dec 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/XuHSU17.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AdamaszekS16,
author = {Michal Adamaszek and
Juraj Stacho},
title = {Complexity of simplicial homology and independence complexes of chordal
graphs},
journal = {Comput. Geom.},
volume = {57},
pages = {8--18},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.05.003},
doi = {10.1016/J.COMGEO.2016.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AdamaszekS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBERS16,
author = {Boris Aronov and
Mark de Berg and
David Eppstein and
Marcel Roeloffzen and
Bettina Speckmann},
title = {Distance-sensitive planar point location},
journal = {Comput. Geom.},
volume = {54},
pages = {17--31},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.02.001},
doi = {10.1016/J.COMGEO.2016.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovBERS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae16,
author = {Sang Won Bae},
title = {An almost optimal algorithm for Voronoi diagrams of non-disjoint line
segments},
journal = {Comput. Geom.},
volume = {52},
pages = {34--43},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.11.002},
doi = {10.1016/J.COMGEO.2015.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bae16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikCMS16,
author = {Aritra Banik and
Jean{-}Lou De Carufel and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Discrete Voronoi games and {\unicode{1013}}-nets, in two and three
dimensions},
journal = {Comput. Geom.},
volume = {55},
pages = {41--58},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.02.002},
doi = {10.1016/J.COMGEO.2016.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BanikCMS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregHKPT16,
author = {Sergey Bereg and
Seok{-}Hee Hong and
Naoki Katoh and
Sheung{-}Hung Poon and
Shin{-}ichi Tanigawa},
title = {On the edge crossing properties of Euclidean minimum weight Laman
graphs},
journal = {Comput. Geom.},
volume = {51},
pages = {15--24},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.002},
doi = {10.1016/J.COMGEO.2015.10.002},
timestamp = {Thu, 27 Apr 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BeregHKPT16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazBMS16,
author = {Ahmad Biniaz and
Prosenjit Bose and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Plane geodesic spanning trees, Hamiltonian cycles, and perfect matchings
in a simple polygon},
journal = {Comput. Geom.},
volume = {57},
pages = {27--39},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.05.004},
doi = {10.1016/J.COMGEO.2016.05.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazBMS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusLR16,
author = {Thomas Bl{\"{a}}sius and
Sebastian Lehmann and
Ignaz Rutter},
title = {Orthogonal graph drawing with inflexible edges},
journal = {Comput. Geom.},
volume = {55},
pages = {26--40},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.03.001},
doi = {10.1016/J.COMGEO.2016.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BlasiusLR16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerLPZ16,
author = {Cecilia Bohler and
Chih{-}Hung Liu and
Evanthia Papadopoulou and
Maksym Zavershynskyi},
title = {A randomized divide and conquer algorithm for higher-order abstract
Voronoi diagrams},
journal = {Comput. Geom.},
volume = {59},
pages = {26--38},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.08.004},
doi = {10.1016/J.COMGEO.2016.08.004},
timestamp = {Tue, 14 Sep 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BohlerLPZ16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCSS16,
author = {Prosenjit Bose and
Jean{-}Lou De Carufel and
Alina Shaikhet and
Michiel H. M. Smid},
title = {Probing convex polygons with a wedge},
journal = {Comput. Geom.},
volume = {58},
pages = {34--59},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.06.001},
doi = {10.1016/J.COMGEO.2016.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCSS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchetCOS16,
author = {Micka{\"{e}}l Buchet and
Fr{\'{e}}d{\'{e}}ric Chazal and
Steve Y. Oudot and
Donald R. Sheehy},
title = {Efficient and robust persistent homology for measures},
journal = {Comput. Geom.},
volume = {58},
pages = {70--96},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.07.001},
doi = {10.1016/J.COMGEO.2016.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchetCOS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BusGMR16,
author = {Norbert Bus and
Shashwat Garg and
Nabil H. Mustafa and
Saurabh Ray},
title = {Tighter estimates for {\unicode{1013}}-nets for disks},
journal = {Comput. Geom.},
volume = {53},
pages = {27--35},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.12.002},
doi = {10.1016/J.COMGEO.2015.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BusGMR16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloCKS16,
author = {Sergio Cabello and
Otfried Cheong and
Christian Knauer and
Lena Schlipf},
title = {Finding largest rectangles in convex polygons},
journal = {Comput. Geom.},
volume = {51},
pages = {67--74},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.08.001},
doi = {10.1016/J.COMGEO.2015.08.001},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloCKS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Capitelli16,
author = {Nicolas Ariel Capitelli},
title = {The non-pure version of the simplex and the boundary of the simplex},
journal = {Comput. Geom.},
volume = {57},
pages = {19--26},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.05.002},
doi = {10.1016/J.COMGEO.2016.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Capitelli16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChattopadhyayCD16,
author = {Amit Chattopadhyay and
Hamish A. Carr and
David J. Duke and
Zhao Geng and
Osamu Saeki},
title = {Multivariate topology simplification},
journal = {Comput. Geom.},
volume = {58},
pages = {1--24},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.05.006},
doi = {10.1016/J.COMGEO.2016.05.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChattopadhyayCD16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChavezCL16,
author = {Edgar Ch{\'{a}}vez and
Ana C. Ch{\'{a}}vez{-}C{\'{a}}liz and
Jorge L. L{\'{o}}pez{-}L{\'{o}}pez},
title = {Affine invariants of generalized polygons and matching under affine
transformations},
journal = {Comput. Geom.},
volume = {58},
pages = {60--69},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.06.003},
doi = {10.1016/J.COMGEO.2016.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChavezCL16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaiKL16,
author = {Bang{-}Sin Dai and
Mong{-}Jen Kao and
D. T. Lee},
title = {Optimal time-convex hull for a straight-line highway in L\({}_{\mbox{p}}\)-metrics},
journal = {Comput. Geom.},
volume = {53},
pages = {1--20},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.007},
doi = {10.1016/J.COMGEO.2015.10.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DaiKL16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezHPSUV16,
author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Marco A. Heredia and
Canek Pel{\'{a}}ez and
Joan Antoni Sellar{\`{e}}s and
Jorge Urrutia and
Inmaculada Ventura},
title = {Convex blocking and partial orders on the plane},
journal = {Comput. Geom.},
volume = {51},
pages = {55--66},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.08.003},
doi = {10.1016/J.COMGEO.2015.08.003},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezHPSUV16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DobrevHMMPNOS16,
author = {Stefan Dobrev and
Mohsen Eftekhari Hesari and
Fraser MacQuarie and
J{\'{a}}n Manuch and
Oscar Morales{-}Ponce and
Lata Narayanan and
Jaroslav Opatrny and
Ladislav Stacho},
title = {Connectivity with directional antennas in the symmetric communication
model},
journal = {Comput. Geom.},
volume = {55},
pages = {1--25},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.03.002},
doi = {10.1016/J.COMGEO.2016.03.002},
timestamp = {Mon, 03 May 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DobrevHMMPNOS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherGM16,
author = {Stephane Durocher and
Ellen Gethner and
Debajyoti Mondal},
title = {Thickness and colorability of geometric graphs},
journal = {Comput. Geom.},
volume = {56},
pages = {1--18},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.03.003},
doi = {10.1016/J.COMGEO.2016.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherGM16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansLMW16,
author = {William S. Evans and
Giuseppe Liotta and
Henk Meijer and
Stephen K. Wismath},
title = {Alternating paths and cycles of minimum length},
journal = {Comput. Geom.},
volume = {58},
pages = {124--135},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.07.005},
doi = {10.1016/J.COMGEO.2016.07.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EvansLMW16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvrendilekGH16,
author = {Cem Evrendilek and
Burkay Gen{\c{c}} and
Brahim Hnich},
title = {Covering points with minimum/maximum area orthogonally convex polygons},
journal = {Comput. Geom.},
volume = {54},
pages = {32--44},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.02.003},
doi = {10.1016/J.COMGEO.2016.02.003},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EvrendilekGH16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FarshiP16,
author = {Mohammad Farshi and
Abolfazl Poureidi},
title = {A lower bound for computing geometric spanners},
journal = {Comput. Geom.},
volume = {53},
pages = {21--26},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.12.004},
doi = {10.1016/J.COMGEO.2015.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FarshiP16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FisikopoulosP16,
author = {Vissarion Fisikopoulos and
Luis Mariano Pe{\~{n}}aranda},
title = {Faster geometric algorithms via dynamic determinant computation},
journal = {Comput. Geom.},
volume = {54},
pages = {1--16},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.12.001},
doi = {10.1016/J.COMGEO.2015.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FisikopoulosP16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Garcia-MarcoK16,
author = {Ignacio Garc{\'{\i}}a{-}Marco and
Kolja Knauer},
title = {Drawing graphs with vertices and edges in convex position},
journal = {Comput. Geom.},
volume = {58},
pages = {25--33},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.06.002},
doi = {10.1016/J.COMGEO.2016.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Garcia-MarcoK16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GyoriM16,
author = {Ervin Gy{\"{o}}ri and
Tam{\'{a}}s R{\'{o}}bert Mezei},
title = {Partitioning orthogonal polygons into {\(\leq\)} 8-vertex pieces,
with application to an art gallery theorem},
journal = {Comput. Geom.},
volume = {59},
pages = {13--25},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.07.003},
doi = {10.1016/J.COMGEO.2016.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GyoriM16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaCGY16,
author = {Jae{-}Soon Ha and
Otfried Cheong and
Xavier Goaoc and
Jungwoo Yang},
title = {Geometric permutations of non-overlapping unit balls revisited},
journal = {Comput. Geom.},
volume = {53},
pages = {36--50},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.12.003},
doi = {10.1016/J.COMGEO.2015.12.003},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HaCGY16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HemmerKH16,
author = {Michael Hemmer and
Michal Kleinbort and
Dan Halperin},
title = {Optimal randomized incremental construction for guaranteed logarithmic
planar point location},
journal = {Comput. Geom.},
volume = {58},
pages = {110--123},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.07.006},
doi = {10.1016/J.COMGEO.2016.07.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HemmerKH16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HenzeJ16,
author = {Matthias Henze and
Rafel Jaume},
title = {Bottleneck partial-matching Voronoi diagrams and applications},
journal = {Comput. Geom.},
volume = {51},
pages = {40--54},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.001},
doi = {10.1016/J.COMGEO.2015.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HenzeJ16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/IgamberdievS16,
author = {Alexander Igamberdiev and
Andr{\'{e}} Schulz},
title = {A duality transform for constructing small grid embeddings of 3d polytopes},
journal = {Comput. Geom.},
volume = {56},
pages = {19--36},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.03.004},
doi = {10.1016/J.COMGEO.2016.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/IgamberdievS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ItoNOOUUU16,
author = {Takehiro Ito and
Shin{-}Ichi Nakano and
Yoshio Okamoto and
Yota Otachi and
Ryuhei Uehara and
Takeaki Uno and
Yushi Uno},
title = {A polynomial-time approximation scheme for the geometric unique coverage
problem on unit squares},
journal = {Comput. Geom.},
volume = {51},
pages = {25--39},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.004},
doi = {10.1016/J.COMGEO.2015.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ItoNOOUUU16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KamousiLMW16,
author = {Pegah Kamousi and
Sylvain Lazard and
Anil Maheshwari and
Stefanie Wuhrer},
title = {Analysis of farthest point sampling for approximating geodesics in
a graph},
journal = {Comput. Geom.},
volume = {57},
pages = {1--7},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.05.005},
doi = {10.1016/J.COMGEO.2016.05.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KamousiLMW16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ParkBAA16,
author = {Dongwoo Park and
Sang Won Bae and
Helmut Alt and
Hee{-}Kap Ahn},
title = {Bundling three convex polygons to minimize area or perimeter},
journal = {Comput. Geom.},
volume = {51},
pages = {1--14},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.003},
doi = {10.1016/J.COMGEO.2015.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ParkBAA16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PupyrevNBH16,
author = {Sergey Pupyrev and
Lev Nachmanson and
Sergey Bereg and
Alexander E. Holroyd},
title = {Edge routing with ordered bundles},
journal = {Comput. Geom.},
volume = {52},
pages = {18--33},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.005},
doi = {10.1016/J.COMGEO.2015.10.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PupyrevNBH16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/TokekarI16,
author = {Pratap Tokekar and
Volkan Isler},
title = {Polygon guarding with orientation},
journal = {Comput. Geom.},
volume = {58},
pages = {97--109},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.07.004},
doi = {10.1016/J.COMGEO.2016.07.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/TokekarI16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VerbeekS16,
author = {Kevin Verbeek and
Subhash Suri},
title = {Metric embedding, hyperbolic space, and social networks},
journal = {Comput. Geom.},
volume = {59},
pages = {1--12},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2016.08.003},
doi = {10.1016/J.COMGEO.2016.08.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/VerbeekS16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YankelevskyB16,
author = {Yael Yankelevsky and
Alfred M. Bruckstein},
title = {On optimal disc covers and a new characterization of the Steiner center},
journal = {Comput. Geom.},
volume = {52},
pages = {1--8},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.006},
doi = {10.1016/J.COMGEO.2015.10.006},
timestamp = {Sat, 09 Apr 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/YankelevskyB16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhangK16,
author = {Huaming Zhang and
Xiang{-}Zhi Kong},
title = {On k-greedy routing algorithms},
journal = {Comput. Geom.},
volume = {52},
pages = {9--17},
year = {2016},
url = {https://doi.org/10.1016/j.comgeo.2015.10.008},
doi = {10.1016/J.COMGEO.2015.10.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZhangK16.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashBCMS15,
author = {A. Karim Abu{-}Affash and
Ahmad Biniaz and
Paz Carmi and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Approximating the bottleneck plane perfect matching of a point set},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {718--731},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.005},
doi = {10.1016/J.COMGEO.2015.06.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashBCMS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBBBKR15,
author = {Oswin Aichholzer and
Sang Won Bae and
Luis Barba and
Prosenjit Bose and
Matias Korman and
Andr{\'{e}} van Renssen and
Perouz Taslakian and
Sander Verdonschot},
title = {Reprint of: Theta-3 is connected},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {407--414},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.01.002},
doi = {10.1016/J.COMGEO.2015.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKR15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMGHHH15,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
Thomas Hackl and
Marco A. Heredia and
Clemens Huemer and
Jorge Urrutia and
Pavel Valtr and
Birgit Vogtenhuber},
title = {On k-gons and k-holes in point sets},
journal = {Comput. Geom.},
volume = {48},
number = {7},
pages = {528--537},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.007},
doi = {10.1016/J.COMGEO.2014.12.007},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHH15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonF15,
author = {Noga Alon and
Ohad N. Feldheim},
title = {Drawing outerplanar graphs using three edge lengths},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {260--267},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.006},
doi = {10.1016/J.COMGEO.2014.10.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlonF15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBLS15,
author = {Greg Aloupis and
Luis Barba and
Stefan Langerman and
Diane L. Souvaine},
title = {Bichromatic compatible matchings},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {622--633},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.009},
doi = {10.1016/J.COMGEO.2014.08.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisBLS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlvarezBRS15,
author = {Victor Alvarez and
Karl Bringmann and
Saurabh Ray and
Raimund Seidel},
title = {Counting triangulations and other crossing-free structures approximately},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {386--397},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.006},
doi = {10.1016/J.COMGEO.2014.12.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlvarezBRS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniBLDGMPT15,
author = {Patrizio Angelini and
Carla Binucci and
Giordano Da Lozzo and
Walter Didimo and
Luca Grilli and
Fabrizio Montecchiani and
Maurizio Patrignani and
Ioannis G. Tollis},
title = {Algorithms and bounds for drawing non-planar graphs with crossing-free
subgraphs},
journal = {Comput. Geom.},
volume = {50},
pages = {34--48},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.07.002},
doi = {10.1016/J.COMGEO.2015.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AngeliniBLDGMPT15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniLBFPR15,
author = {Patrizio Angelini and
Giordano Da Lozzo and
Giuseppe Di Battista and
Fabrizio Frati and
Maurizio Patrignani and
Vincenzo Roselli},
title = {Relaxing the constraints of clustered planarity},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {42--75},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.001},
doi = {10.1016/J.COMGEO.2014.08.001},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AngeliniLBFPR15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinAMM15,
author = {Esther M. Arkin and
Antonio Fern{\'{a}}ndez Anta and
Joseph S. B. Mitchell and
Miguel A. Mosteiro},
title = {Probabilistic bounds on the length of a longest edge in Delaunay graphs
of random points in d-dimensions},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {134--146},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.008},
doi = {10.1016/J.COMGEO.2014.08.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinAMM15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinDHKMPPSS15,
author = {Esther M. Arkin and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Ferran Hurtado and
Piyush Kumar and
Joseph S. B. Mitchell and
Bel{\'{e}}n Palop and
Pablo P{\'{e}}rez{-}Lantero and
Maria Saumell and
Rodrigo I. Silveira},
title = {Bichromatic 2-center of pairs of points},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {94--107},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.004},
doi = {10.1016/J.COMGEO.2014.08.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinDHKMPPSS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AttaliBDGL15,
author = {Dominique Attali and
Ulrich Bauer and
Olivier Devillers and
Marc Glisse and
Andr{\'{e}} Lieutier},
title = {Homological reconstruction and simplification in R\({}^{\mbox{3}}\)},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {606--621},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.010},
doi = {10.1016/J.COMGEO.2014.08.010},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AttaliBDGL15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeKOW15,
author = {Sang Won Bae and
Matias Korman and
Yoshio Okamoto and
Haitao Wang},
title = {Computing the {L1} geodesic diameter and center of a simple polygon
in linear time},
journal = {Comput. Geom.},
volume = {48},
number = {6},
pages = {495--505},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.02.005},
doi = {10.1016/J.COMGEO.2015.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaeKOW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyFMMOP15,
author = {Imre B{\'{a}}r{\'{a}}ny and
Ferenc Fodor and
{\'{A}}lvaro Mart{\'{\i}}nez{-}P{\'{e}}rez and
Luis Montejano and
Deborah Oliveros and
Attila P{\'{o}}r},
title = {A fractional Helly theorem for boxes},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {221--224},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.007},
doi = {10.1016/J.COMGEO.2014.09.007},
timestamp = {Fri, 29 Jul 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyFMMOP15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDMPRSUV15,
author = {Sergey Bereg and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Ruy Fabila Monroy and
Pablo P{\'{e}}rez{-}Lantero and
Adriana Ram{\'{\i}}rez{-}Vigueras and
Toshinori Sakai and
Jorge Urrutia and
Inmaculada Ventura},
title = {On balanced 4-holes in bichromatic point sets},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {169--179},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.004},
doi = {10.1016/J.COMGEO.2014.09.004},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BeregDMPRSUV15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhatiaWNPB15,
author = {Harsh Bhatia and
Bei Wang and
Gregory Norgard and
Valerio Pascucci and
Peer{-}Timo Bremer},
title = {Local, smooth, and consistent Jacobi set simplification},
journal = {Comput. Geom.},
volume = {48},
number = {4},
pages = {311--332},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.009},
doi = {10.1016/J.COMGEO.2014.10.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BhatiaWNPB15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHHKP15,
author = {Therese Biedl and
Martin Held and
Stefan Huber and
Dominik Kaaser and
Peter Palfrader},
title = {Weighted straight skeletons in the plane},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {120--133},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.006},
doi = {10.1016/J.COMGEO.2014.08.006},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHHKP15a,
author = {Therese Biedl and
Martin Held and
Stefan Huber and
Dominik Kaaser and
Peter Palfrader},
title = {Reprint of: Weighted straight skeletons in the plane},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {429--442},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.01.004},
doi = {10.1016/J.COMGEO.2015.01.004},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlHHKP15a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS15,
author = {Ahmad Biniaz and
Anil Maheshwari and
Michiel H. M. Smid},
title = {On full Steiner trees in unit disk graphs},
journal = {Comput. Geom.},
volume = {48},
number = {6},
pages = {453--458},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.02.004},
doi = {10.1016/J.COMGEO.2015.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS15a,
author = {Ahmad Biniaz and
Anil Maheshwari and
Michiel H. M. Smid},
title = {Higher-order triangular-distance Delaunay graphs: Graph-theoretical
properties},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {646--660},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.07.003},
doi = {10.1016/J.COMGEO.2015.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS15a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BlasiusR15,
author = {Thomas Bl{\"{a}}sius and
Ignaz Rutter},
title = {Disconnectivity and relative positions in simultaneous embeddings},
journal = {Comput. Geom.},
volume = {48},
number = {6},
pages = {459--478},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.02.002},
doi = {10.1016/J.COMGEO.2015.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BlasiusR15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BohlerCKLPZ15,
author = {Cecilia Bohler and
Panagiotis Cheilaris and
Rolf Klein and
Chih{-}Hung Liu and
Evanthia Papadopoulou and
Maksym Zavershynskyi},
title = {On the complexity of higher order abstract Voronoi diagrams},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {539--551},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.008},
doi = {10.1016/J.COMGEO.2015.04.008},
timestamp = {Tue, 14 Sep 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BohlerCKLPZ15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BonichonGHP15,
author = {Nicolas Bonichon and
Cyril Gavoille and
Nicolas Hanusse and
Ljubomir Perkovic},
title = {Tight stretch factors for L\({}_{\mbox{1}}\)- and L\({}_{\mbox{{\(\infty\)}}}\)-Delaunay
triangulations},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {237--250},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.005},
doi = {10.1016/J.COMGEO.2014.10.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BonichonGHP15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BorradaileE15,
author = {Glencora Borradaile and
David Eppstein},
title = {Near-linear-time deterministic plane Steiner spanners for well-spaced
point sets},
journal = {Comput. Geom.},
volume = {49},
pages = {8--16},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.005},
doi = {10.1016/J.COMGEO.2015.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BorradaileE15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMRV15,
author = {Prosenjit Bose and
Pat Morin and
Andr{\'{e}} van Renssen and
Sander Verdonschot},
title = {The {\texttheta}\({}_{\mbox{5}}\)-graph is a spanner},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {108--119},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.005},
doi = {10.1016/J.COMGEO.2014.08.005},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseMRV15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BozokiLR15,
author = {S{\'{a}}ndor Boz{\'{o}}ki and
Tsung{-}Lin Lee and
Lajos R{\'{o}}nyai},
title = {Seven mutually touching infinite cylinders},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {87--93},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.007},
doi = {10.1016/J.COMGEO.2014.08.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BozokiLR15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassVX15,
author = {Peter Brass and
Ivo Vigan and
Ning Xu},
title = {Shortest path planning for a tethered robot},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {732--742},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.004},
doi = {10.1016/J.COMGEO.2015.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BrassVX15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloJ15,
author = {Sergio Cabello and
Miha Jejcic},
title = {Shortest paths in intersection graphs of unit disks},
journal = {Comput. Geom.},
volume = {48},
number = {4},
pages = {360--367},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.003},
doi = {10.1016/J.COMGEO.2014.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloJ15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaoET15,
author = {Thanh{-}Tung Cao and
Herbert Edelsbrunner and
Tiow Seng Tan},
title = {Triangulations from topologically correct digital Voronoi diagrams},
journal = {Comput. Geom.},
volume = {48},
number = {7},
pages = {507--519},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.001},
doi = {10.1016/J.COMGEO.2015.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CaoET15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiFK15,
author = {Paz Carmi and
Eran Friedman and
Matthew J. Katz},
title = {Spiderman graph: Visibility in urban regions},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {251--259},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.004},
doi = {10.1016/J.COMGEO.2014.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiFK15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanH15,
author = {Timothy M. Chan and
Nan Hu},
title = {Geometric red-blue set cover for unit squares and related problems},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {380--385},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.005},
doi = {10.1016/J.COMGEO.2014.12.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanH15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanK15,
author = {Timothy M. Chan and
Rolf Klein},
title = {Guest Editor's foreword},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {552--553},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.003},
doi = {10.1016/J.COMGEO.2014.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanK15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenM15,
author = {Dan Chen and
Pat Morin},
title = {Reprint of: Approximating majority depth},
journal = {Comput. Geom.},
volume = {49},
pages = {2--7},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2013.11.005},
doi = {10.1016/J.COMGEO.2013.11.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenM15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW15,
author = {Danny Z. Chen and
Haitao Wang},
title = {Visibility and ray shooting queries in polygonal domains},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {31--41},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.003},
doi = {10.1016/J.COMGEO.2014.08.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW15a,
author = {Danny Ziyi Chen and
Haitao Wang},
title = {Weak visibility queries of line segments in simple polygons},
journal = {Comput. Geom.},
volume = {48},
number = {6},
pages = {443--452},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.02.001},
doi = {10.1016/J.COMGEO.2015.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenW15a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CookDSW15,
author = {Atlas F. Cook IV and
Anne Driemel and
Jessica Sherette and
Carola Wenk},
title = {Computing the Fr{\'{e}}chet distance between folded polygons},
journal = {Comput. Geom.},
volume = {50},
pages = {1--16},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.08.002},
doi = {10.1016/J.COMGEO.2015.08.002},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CookDSW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CrepaldiRS15,
author = {Bruno E. Crepaldi and
Pedro J. de Rezende and
Cid C. de Souza},
title = {Solving the natural wireless localization problem to optimality efficiently},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {370--379},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.004},
doi = {10.1016/J.COMGEO.2014.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CrepaldiRS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyFW15,
author = {Tamal K. Dey and
Fengtao Fan and
Yusu Wang},
title = {Graph induced complex on point data},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {575--588},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.003},
doi = {10.1016/J.COMGEO.2015.04.003},
timestamp = {Mon, 02 Jan 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DeyFW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezKPPSS15,
author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Matias Korman and
Pablo P{\'{e}}rez{-}Lantero and
Alexander Pilz and
Carlos Seara and
Rodrigo I. Silveira},
title = {New results on stabbing segments with a polygon},
journal = {Comput. Geom.},
volume = {48},
number = {1},
pages = {14--29},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.06.002},
doi = {10.1016/J.COMGEO.2014.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezKPPSS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ15,
author = {Adrian Dumitrescu and
Minghui Jiang},
title = {On the approximability of covering points by lines and related problems},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {703--717},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.006},
doi = {10.1016/J.COMGEO.2015.06.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriedlerM15,
author = {Sorelle A. Friedler and
David M. Mount},
title = {A sensor-based framework for kinetic data compression},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {147--168},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.002},
doi = {10.1016/J.COMGEO.2014.09.002},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FriedlerM15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FunkeMMW15,
author = {Stefan Funke and
Theocharis Malamatos and
Domagoj Matijevic and
Nicola Wolpert},
title = {Conic nearest neighbor queries and approximate Voronoi diagrams},
journal = {Comput. Geom.},
volume = {48},
number = {2},
pages = {76--86},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.08.002},
doi = {10.1016/J.COMGEO.2014.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FunkeMMW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonS15,
author = {Joachim Gudmundsson and
Michiel H. M. Smid},
title = {Fast algorithms for approximate Fr{\'{e}}chet matching queries
in geometric trees},
journal = {Comput. Geom.},
volume = {48},
number = {6},
pages = {479--494},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.02.003},
doi = {10.1016/J.COMGEO.2015.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hosono15,
author = {Kiyoshi Hosono},
title = {On the minimum number of mutually disjoint holes in planar point sets},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {661--672},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.07.001},
doi = {10.1016/J.COMGEO.2015.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Hosono15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimA15,
author = {Sang{-}Sub Kim and
Hee{-}Kap Ahn},
title = {An improved data stream algorithm for clustering},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {635--645},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.003},
doi = {10.1016/J.COMGEO.2015.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimA15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinS15,
author = {Kyle Klein and
Subhash Suri},
title = {Capture bounds for visibility-based pursuit evasion},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {205--220},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.002},
doi = {10.1016/J.COMGEO.2014.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KleinS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KynclPRT15,
author = {Jan Kyncl and
J{\'{a}}nos Pach and
Rados Radoicic and
G{\'{e}}za T{\'{o}}th},
title = {Saturated simple and k-simple topological graphs},
journal = {Comput. Geom.},
volume = {48},
number = {4},
pages = {295--310},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.008},
doi = {10.1016/J.COMGEO.2014.10.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KynclPRT15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lopez-Ortiz15,
author = {Alejandro L{\'{o}}pez{-}Ortiz},
title = {Guest editorial: Special issue on the 25th Canadian Conference on
Computational Geometry {(CCCG)}},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {369},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.001},
doi = {10.1016/J.COMGEO.2014.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Lopez-Ortiz15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LubiwP15,
author = {Anna Lubiw and
Vinayak Pathak},
title = {Flip distance between two triangulations of a point set is NP-complete},
journal = {Comput. Geom.},
volume = {49},
pages = {17--23},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.11.001},
doi = {10.1016/J.COMGEO.2014.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/LubiwP15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoricP15,
author = {Filip Moric and
J{\'{a}}nos Pach},
title = {Remarks on Schur's conjecture},
journal = {Comput. Geom.},
volume = {48},
number = {7},
pages = {520--527},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.007},
doi = {10.1016/J.COMGEO.2014.10.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MoricP15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanahiS15,
author = {Fatemeh Panahi and
A. Frank van der Stappen},
title = {Reprint of: Bounding the locus of the center of mass for a part with
shape variation},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {398--406},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.01.001},
doi = {10.1016/J.COMGEO.2015.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PanahiS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmatiAKWZ15,
author = {Zahed Rahmati and
Mohammad Ali Abam and
Valerie King and
Sue Whitesides and
Alireza Zarei},
title = {A simple, faster method for kinetic proximity problems},
journal = {Comput. Geom.},
volume = {48},
number = {4},
pages = {342--359},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.002},
doi = {10.1016/J.COMGEO.2014.12.002},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/RahmatiAKWZ15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ras15,
author = {Charl J. Ras},
title = {Survivable minimum bottleneck networks},
journal = {Comput. Geom.},
volume = {50},
pages = {17--23},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.002},
doi = {10.1016/J.COMGEO.2015.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ras15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Raz15,
author = {Orit E. Raz},
title = {On the zone of the boundary of a convex body},
journal = {Comput. Geom.},
volume = {48},
number = {4},
pages = {333--341},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.12.001},
doi = {10.1016/J.COMGEO.2014.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Raz15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RusuF15,
author = {Adrian Rusu and
Andrew J. Fabian},
title = {A straight-line order-preserving binary tree drawing algorithm with
linear area and arbitrary aspect ratio},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {268--294},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.001},
doi = {10.1016/J.COMGEO.2014.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RusuF15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SavicS15,
author = {Marko Savic and
Milos Stojakovic},
title = {Linear time algorithm for optimal feed-link placement},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {189--204},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.006},
doi = {10.1016/J.COMGEO.2014.09.006},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SavicS15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchmidtV15,
author = {Jens M. Schmidt and
Pavel Valtr},
title = {Cubic plane graphs on a given point set},
journal = {Comput. Geom.},
volume = {48},
number = {1},
pages = {1--13},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.06.001},
doi = {10.1016/J.COMGEO.2014.06.001},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchmidtV15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SharmaBVRT15,
author = {Gokarna Sharma and
Costas Busch and
Ramachandran Vaidyanathan and
Suresh Rai and
Jerry L. Trahan},
title = {Efficient transformations for Klee's measure problem in the streaming
model},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {688--702},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.007},
doi = {10.1016/J.COMGEO.2015.06.007},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SharmaBVRT15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SheikhiMBD15,
author = {Farnaz Sheikhi and
Ali Mohades and
Mark de Berg and
Mansoor Davoodi},
title = {Separating bichromatic point sets by L-shapes},
journal = {Comput. Geom.},
volume = {48},
number = {9},
pages = {673--687},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.008},
doi = {10.1016/J.COMGEO.2015.06.008},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/SheikhiMBD15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ShewchukB15,
author = {Jonathan Richard Shewchuk and
Brielin C. Brown},
title = {Fast segment insertion and incremental construction of constrained
Delaunay triangulations},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {554--574},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.006},
doi = {10.1016/J.COMGEO.2015.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ShewchukB15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SukW15,
author = {Andrew Suk and
Bartosz Walczak},
title = {New bounds on the maximum number of edges in k-quasi-planar graphs},
journal = {Comput. Geom.},
volume = {50},
pages = {24--33},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.06.001},
doi = {10.1016/J.COMGEO.2015.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SukW15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sukilovic15,
author = {Tijana Sukilovic},
title = {Curvature based shape detection},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {180--188},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.09.005},
doi = {10.1016/J.COMGEO.2014.09.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Sukilovic15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Traub15,
author = {Cynthia M. Traub},
title = {Steiner reducing sets of minimum weight triangulations: Structure
and topology},
journal = {Comput. Geom.},
volume = {49},
pages = {24--36},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.004},
doi = {10.1016/J.COMGEO.2015.04.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Traub15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta15,
author = {Giovanni Viglietta},
title = {Reprint of: Face-guarding polyhedra},
journal = {Comput. Geom.},
volume = {48},
number = {5},
pages = {415--428},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.01.003},
doi = {10.1016/J.COMGEO.2015.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Viglietta15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WangCY15,
author = {Cong Wang and
Yi{-}Jen Chiang and
Chee{-}Keng Yap},
title = {On soft predicates in subdivision motion planning},
journal = {Comput. Geom.},
volume = {48},
number = {8},
pages = {589--605},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2015.04.002},
doi = {10.1016/J.COMGEO.2015.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WangCY15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zivaljevic15,
author = {Rade T. Zivaljevic},
title = {Illumination complexes, {\(\Delta\)}-zonotopes, and the polyhedral
curtain theorem},
journal = {Comput. Geom.},
volume = {48},
number = {3},
pages = {225--236},
year = {2015},
url = {https://doi.org/10.1016/j.comgeo.2014.10.003},
doi = {10.1016/J.COMGEO.2014.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Zivaljevic15.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/0006X14,
author = {Lei Xu and
Jinhui Xu},
title = {Approximating minimum bending energy path in a simple corridor},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {349--366},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.09.001},
doi = {10.1016/J.COMGEO.2013.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/0006X14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamDDEG14,
author = {Mohammad Ali Abam and
Shervin Daneshpajouh and
Lasse Deleuran and
Shayan Ehsani and
Mohammad Ghodsi},
title = {Computing homotopic line simplification},
journal = {Comput. Geom.},
volume = {47},
number = {7},
pages = {728--739},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.02.002},
doi = {10.1016/J.COMGEO.2014.02.002},
timestamp = {Sat, 16 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AbamDDEG14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashCKT14,
author = {A. Karim Abu{-}Affash and
Paz Carmi and
Matthew J. Katz and
Yohai Trabelsi},
title = {Bottleneck non-crossing matching in the plane},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {447--457},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.10.005},
doi = {10.1016/J.COMGEO.2013.10.005},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashCKT14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanFPS14,
author = {Eyal Ackerman and
Jacob Fox and
J{\'{a}}nos Pach and
Andrew Suk},
title = {On grids in topological graphs},
journal = {Comput. Geom.},
volume = {47},
number = {7},
pages = {710--723},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.02.003},
doi = {10.1016/J.COMGEO.2014.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AckermanFPS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCKY14,
author = {Hee{-}Kap Ahn and
Siu{-}Wing Cheng and
Hyuk Jun Kweon and
Juyoung Yon},
title = {Overlap of convex polytopes under rigid motion},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {15--24},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.001},
doi = {10.1016/J.COMGEO.2013.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnCKY14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAHHPRUVV14,
author = {Oswin Aichholzer and
Franz Aurenhammer and
Thomas Hackl and
Ferran Hurtado and
Alexander Pilz and
Pedro Ramos and
Jorge Urrutia and
Pavel Valtr and
Birgit Vogtenhuber},
title = {On k-convex point sets},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {809--832},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.004},
doi = {10.1016/J.COMGEO.2014.04.004},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAHHPRUVV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBBBKRTV14,
author = {Oswin Aichholzer and
Sang Won Bae and
Luis Barba and
Prosenjit Bose and
Matias Korman and
Andr{\'{e}} van Renssen and
Perouz Taslakian and
Sander Verdonschot},
title = {Theta-3 is connected},
journal = {Comput. Geom.},
volume = {47},
number = {9},
pages = {910--917},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.05.001},
doi = {10.1016/J.COMGEO.2014.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBBBKRTV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMGHHHUV14,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
Thomas Hackl and
Marco A. Heredia and
Clemens Huemer and
Jorge Urrutia and
Birgit Vogtenhuber},
title = {4-Holes in point sets},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {644--650},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.004},
doi = {10.1016/J.COMGEO.2013.12.004},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMGHHHUV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHHPV14,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
Thomas Hackl and
Clemens Huemer and
Alexander Pilz and
Birgit Vogtenhuber},
title = {Lower bounds for the number of small convex k-holes},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {605--613},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.002},
doi = {10.1016/J.COMGEO.2013.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHHPV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMP14,
author = {Oswin Aichholzer and
Tillmann Miltzow and
Alexander Pilz},
title = {Reprint of: Extreme point and halving edge search in abstract order
types},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {518--526},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.002},
doi = {10.1016/J.COMGEO.2013.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMP14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisB14,
author = {Greg Aloupis and
David Bremner},
title = {Editorial},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {111},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.004},
doi = {10.1016/J.COMGEO.2013.08.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisB14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBDGLS14,
author = {Greg Aloupis and
Prosenjit Bose and
Vida Dujmovic and
Chris Gray and
Stefan Langerman and
Bettina Speckmann},
title = {Triangulating and guarding realistic polygons},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {296--306},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.03.005},
doi = {10.1016/J.COMGEO.2013.03.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisBDGLS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCHLO14,
author = {Greg Aloupis and
Jean Cardinal and
S{\'{e}}bastien Collette and
Ferran Hurtado and
Stefan Langerman and
Joseph O'Rourke},
title = {Draining a polygon - or - rolling a ball out of a polygon},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {316--328},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2009.08.002},
doi = {10.1016/J.COMGEO.2009.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCHLO14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AngeliniBCFKS14,
author = {Patrizio Angelini and
Till Bruckdorfer and
Marco Chiesa and
Fabrizio Frati and
Michael Kaufmann and
Claudio Squarcella},
title = {On the area requirements of Euclidean minimum spanning trees},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {200--213},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.011},
doi = {10.1016/J.COMGEO.2012.10.011},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AngeliniBCFKS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinDKMPSY14,
author = {Esther M. Arkin and
Claudia Dieckmann and
Christian Knauer and
Joseph S. B. Mitchell and
Valentin Polishchuk and
Lena Schlipf and
Shang Yang},
title = {Convex transversals},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {224--239},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.009},
doi = {10.1016/J.COMGEO.2012.10.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinDKMPSY14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBBKMRS14,
author = {Tetsuo Asano and
Kevin Buchin and
Maike Buchin and
Matias Korman and
Wolfgang Mulzer and
G{\"{u}}nter Rote and
Andr{\'{e}} Schulz},
title = {Reprint of: Memory-constrained algorithms for simple polygons},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {469--479},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.004},
doi = {10.1016/J.COMGEO.2013.11.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AshokAG14,
author = {Pradeesha Ashok and
Umair Azmi and
Sathish Govindarajan},
title = {Small strong epsilon nets},
journal = {Comput. Geom.},
volume = {47},
number = {9},
pages = {899--909},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.05.002},
doi = {10.1016/J.COMGEO.2014.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AshokAG14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bae14,
author = {Sang Won Bae},
title = {Tight bound and improved algorithm for farthest-color Voronoi diagrams
of line segments},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {779--788},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.005},
doi = {10.1016/J.COMGEO.2014.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bae14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Balko14,
author = {Martin Balko},
title = {Reprint of: Grid representations and the chromatic number},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {480--492},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.006},
doi = {10.1016/J.COMGEO.2013.11.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Balko14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BanikBD14,
author = {Aritra Banik and
Bhaswar B. Bhattacharya and
Sandip Das},
title = {Minimum enclosing circle of a set of fixed points and a mobile point},
journal = {Comput. Geom.},
volume = {47},
number = {9},
pages = {891--898},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.006},
doi = {10.1016/J.COMGEO.2014.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BanikBD14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyR14,
author = {Imre B{\'{a}}r{\'{a}}ny and
Edgardo Rold{\'{a}}n{-}Pensado},
title = {Longest convex lattice chains},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {367--376},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.09.002},
doi = {10.1016/J.COMGEO.2013.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyR14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarbaKLS14,
author = {Luis Barba and
Matias Korman and
Stefan Langerman and
Rodrigo I. Silveira},
title = {Computing a visibility polygon using few variables},
journal = {Comput. Geom.},
volume = {47},
number = {9},
pages = {918--926},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.001},
doi = {10.1016/J.COMGEO.2014.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BarbaKLS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetG14,
author = {Gill Barequet and
Alex Goryachev},
title = {Offset polygon and annulus placement problems},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {407--434},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.10.003},
doi = {10.1016/J.COMGEO.2013.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BarequetG14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergSW14,
author = {Mark de Berg and
Bettina Speckmann and
Vincent van der Weele},
title = {Treemaps with bounded aspect ratio},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {683--693},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.008},
doi = {10.1016/J.COMGEO.2013.12.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergSW14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaS14,
author = {Binay K. Bhattacharya and
Qiaosheng Shi},
title = {Improved algorithms to network p-center location problems},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {307--315},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2009.07.003},
doi = {10.1016/J.COMGEO.2009.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlV14,
author = {Therese Biedl and
Lesvia Elena Ruiz Vel{\'{a}}zquez},
title = {Orthogonal cartograms with at most 12 corners per face},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {282--294},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.005},
doi = {10.1016/J.COMGEO.2013.08.005},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiniazMS14,
author = {Ahmad Biniaz and
Anil Maheshwari and
Michiel H. M. Smid},
title = {An optimal algorithm for the Euclidean bottleneck full Steiner tree
problem},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {377--380},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.10.001},
doi = {10.1016/J.COMGEO.2013.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiniazMS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BokowskiP14,
author = {J{\"{u}}rgen Bokowski and
Vincent Pilaud},
title = {Enumerating topological (n\({}_{\mbox{k}}\))-configurations},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {175--186},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.002},
doi = {10.1016/J.COMGEO.2012.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BokowskiP14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseC14,
author = {Prosenjit Bose and
Jean{-}Lou De Carufel},
title = {Minimum-area enclosing triangle with a fixed angle},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {90--109},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.07.002},
doi = {10.1016/J.COMGEO.2013.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseC14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseJRSV14,
author = {Prosenjit Bose and
Dana Jansens and
Andr{\'{e}} van Renssen and
Maria Saumell and
Sander Verdonschot},
title = {Making triangulations 4-connected using flips},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {187--197},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.012},
doi = {10.1016/J.COMGEO.2012.10.012},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseJRSV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BotanaA14,
author = {Francisco Botana and
Miguel A. Ab{\'{a}}nades},
title = {Automatic deduction in (dynamic) geometry: Loci computation},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {75--89},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.07.001},
doi = {10.1016/J.COMGEO.2013.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BotanaA14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bourrieres14,
author = {Jean{-}Paul Bourri{\`{e}}res},
title = {The Minkowski sum of simplices in 3-dimensional space: An analytical
description},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {856--867},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.002},
doi = {10.1016/J.COMGEO.2014.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bourrieres14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Brandenburg14,
author = {Franz{-}Josef Brandenburg},
title = {Upward planar drawings on the standing and the rolling cylinders},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {25--41},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.003},
doi = {10.1016/J.COMGEO.2013.08.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Brandenburg14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CalinescuK14,
author = {Gruia C{\u{a}}linescu and
Howard J. Karloff},
title = {Sequential dependency computation via geometric data structures},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {141--148},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.009},
doi = {10.1016/J.COMGEO.2013.08.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CalinescuK14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMOS14,
author = {Jean{-}Lou De Carufel and
Carsten Grimm and
Anil Maheshwari and
Megan Owen and
Michiel H. M. Smid},
title = {A note on the unsolvability of the weighted region shortest path problem},
journal = {Comput. Geom.},
volume = {47},
number = {7},
pages = {724--727},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.02.004},
doi = {10.1016/J.COMGEO.2014.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMOS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarufelGMSS14,
author = {Jean{-}Lou De Carufel and
Amin Gheibi and
Anil Maheshwari and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Christian Scheffer},
title = {Similarity of polygonal curves in the presence of outliers},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {625--641},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.01.002},
doi = {10.1016/J.COMGEO.2014.01.002},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CarufelGMSS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanG14,
author = {Timothy M. Chan and
Elyot Grant},
title = {Exact algorithms and APX-hardness results for geometric packing and
covering problems},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {112--124},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.04.001},
doi = {10.1016/J.COMGEO.2012.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanG14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanP14,
author = {Timothy M. Chan and
Vinayak Pathak},
title = {Streaming and dynamic algorithms for minimum enclosing balls in high
dimensions},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {240--247},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.05.007},
doi = {10.1016/J.COMGEO.2013.05.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanP14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DehlingerD14,
author = {Christophe Dehlinger and
Jean{-}Fran{\c{c}}ois Dufourd},
title = {Formal specification and proofs for the topology and classification
of combinatorial surfaces},
journal = {Comput. Geom.},
volume = {47},
number = {9},
pages = {869--890},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.007},
doi = {10.1016/J.COMGEO.2014.04.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DehlingerD14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DehneI14,
author = {Frank Dehne and
John Iacono},
title = {Foreword},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {199},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.05.006},
doi = {10.1016/J.COMGEO.2013.05.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DehneI14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DellingGNPR14,
author = {Daniel Delling and
Andreas Gemsa and
Martin N{\"{o}}llenburg and
Thomas Pajor and
Ignaz Rutter},
title = {On d-regular schematization of embedded paths},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {381--406},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.10.002},
doi = {10.1016/J.COMGEO.2013.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DellingGNPR14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDILNO14,
author = {Erik D. Demaine and
Martin L. Demaine and
Jin{-}ichi Itoh and
Anna Lubiw and
Chie Nara and
Joseph O'Rourke},
title = {Reprint of: Refold rigidity of convex polyhedra},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {507--517},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.001},
doi = {10.1016/J.COMGEO.2013.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineDILNO14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DidimoL14,
author = {Walter Didimo and
Giuseppe Liotta},
title = {Special Issue on the 28th European Workshop on Computational Geometry,
Guest Editors' Foreword},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {459},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.03.003},
doi = {10.1016/J.COMGEO.2013.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DidimoL14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuMZ14,
author = {Adrian Dumitrescu and
Joseph S. B. Mitchell and
Pawel Zylinski},
title = {Watchman routes for lines and line segments},
journal = {Comput. Geom.},
volume = {47},
number = {4},
pages = {527--538},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.008},
doi = {10.1016/J.COMGEO.2013.11.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuMZ14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FarzanGN14,
author = {Arash Farzan and
Travis Gagie and
Gonzalo Navarro},
title = {Entropy-bounded representation of point grids},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {1--14},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.002},
doi = {10.1016/J.COMGEO.2013.08.002},
timestamp = {Wed, 28 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FarzanGN14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FelsnerKV14,
author = {Stefan Felsner and
Michael Kaufmann and
Pavel Valtr},
title = {Bend-optimal orthogonal graph drawing in the general position model},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {460--468},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.03.002},
doi = {10.1016/J.COMGEO.2013.03.002},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FelsnerKV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FoteinosCC14,
author = {Panagiotis A. Foteinos and
Andrey N. Chernikov and
Nikos Chrisochoides},
title = {Guaranteed quality tetrahedral Delaunay meshing for medical images},
journal = {Comput. Geom.},
volume = {47},
number = {4},
pages = {539--562},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.009},
doi = {10.1016/J.COMGEO.2013.11.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FoteinosCC14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GeissKPR14,
author = {Darius Gei{\ss} and
Rolf Klein and
Rainer Penninger and
G{\"{u}}nter Rote},
title = {Reprint of: Optimally solving a transportation problem using Voronoi
diagrams},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {499--506},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.003},
doi = {10.1016/J.COMGEO.2013.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GeissKPR14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GhodsiMBSZ14,
author = {Mohammad Ghodsi and
Anil Maheshwari and
Mostafa Nouri Baygi and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Hamid Zarrabi{-}Zadeh},
title = {{\(\alpha\)}-Visibility},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {435--446},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.10.004},
doi = {10.1016/J.COMGEO.2013.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GhodsiMBSZ14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GilbersK14,
author = {Alexander Gilbers and
Rolf Klein},
title = {A new upper bound for the VC-dimension of visibility regions},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {61--74},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.012},
doi = {10.1016/J.COMGEO.2013.08.012},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GilbersK14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuptaJKS14,
author = {Prosenjit Gupta and
Ravi Janardan and
Yokesh Kumar and
Michiel H. M. Smid},
title = {Data structures for range-aggregate extent queries},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {329--347},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2009.08.001},
doi = {10.1016/J.COMGEO.2009.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GuptaJKS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HarrenJPS14,
author = {Rolf Harren and
Klaus Jansen and
Lars Pr{\"{a}}del and
Rob van Stee},
title = {A {(5/3} + {\(\epsilon\)})-approximation for strip packing},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {248--267},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.008},
doi = {10.1016/J.COMGEO.2013.08.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HarrenJPS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HeM14,
author = {Meng He and
J. Ian Munro},
title = {Space efficient data structures for dynamic orthogonal range counting},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {268--281},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.007},
doi = {10.1016/J.COMGEO.2013.08.007},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HeM14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannW14,
author = {Michael Hoffmann and
Emo Welzl},
title = {Editorial},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {643},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.003},
doi = {10.1016/J.COMGEO.2013.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HoffmannW14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Jiang0G14,
author = {Xiaoye Jiang and
Jian Sun and
Leonidas J. Guibas},
title = {A Fourier-theoretic approach for inferring symmetries},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {164--174},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.001},
doi = {10.1016/J.COMGEO.2012.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Jiang0G14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KamousiCS14,
author = {Pegah Kamousi and
Timothy M. Chan and
Subhash Suri},
title = {Closest pair and the post office problem for stochastic points},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {214--223},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.10.010},
doi = {10.1016/J.COMGEO.2012.10.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KamousiCS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeszeghP14,
author = {Bal{\'{a}}zs Keszegh and
D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi},
title = {Octants are cover-decomposable into many coverings},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {585--588},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.001},
doi = {10.1016/J.COMGEO.2013.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KeszeghP14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerMW14,
author = {Kolja B. Knauer and
Piotr Micek and
Bartosz Walczak},
title = {Outerplanar graph drawings with few slopes},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {614--624},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.01.003},
doi = {10.1016/J.COMGEO.2014.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KnauerMW14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Mchedlidze14,
author = {Tamara Mchedlidze},
title = {Reprint of: Upward planar embedding of an n-vertex oriented path on
O(n\({}^{\mbox{2}}\)) points},
journal = {Comput. Geom.},
volume = {47},
number = {3},
pages = {493--498},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.11.007},
doi = {10.1016/J.COMGEO.2013.11.007},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Mchedlidze14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MitchellPS14,
author = {Joseph S. B. Mitchell and
Valentin Polishchuk and
Mikko Sysikaski},
title = {Minimum-link paths revisited},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {651--667},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.005},
doi = {10.1016/J.COMGEO.2013.12.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MitchellPS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Morin14,
author = {Pat Morin},
title = {Guest Editor's Introduction},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {295},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.03.006},
doi = {10.1016/J.COMGEO.2013.03.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Morin14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaTW14,
author = {Nabil H. Mustafa and
Hans Raj Tiwary and
Daniel Werner},
title = {A proof of the Oja depth conjecture in the plane},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {668--674},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.006},
doi = {10.1016/J.COMGEO.2013.12.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MustafaTW14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NivaschPT14,
author = {Gabriel Nivasch and
J{\'{a}}nos Pach and
G{\'{a}}bor Tardos},
title = {The visible perimeter of an arrangement of disks},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {42--51},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.006},
doi = {10.1016/J.COMGEO.2013.08.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/NivaschPT14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ORourkeV14,
author = {Joseph O'Rourke and
Costin V{\^{\i}}lcu},
title = {Development of curves on polyhedra via conical existence},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {149--163},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.010},
doi = {10.1016/J.COMGEO.2013.08.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ORourkeV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/OlaverriHHT14,
author = {Alfredo Garc{\'{\i}}a Olaverri and
Clemens Huemer and
Ferran Hurtado and
Javier Tejel},
title = {Compatible spanning trees},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {563--584},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.009},
doi = {10.1016/J.COMGEO.2013.12.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/OlaverriHHT14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanahiS14,
author = {Fatemeh Panahi and
A. Frank van der Stappen},
title = {Bounding the locus of the center of mass for a part with shape variation},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {847--855},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.008},
doi = {10.1016/J.COMGEO.2014.04.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PanahiS14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Pilz14,
author = {Alexander Pilz},
title = {Flip distance between triangulations of a planar point set is APX-hard},
journal = {Comput. Geom.},
volume = {47},
number = {5},
pages = {589--604},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.01.001},
doi = {10.1016/J.COMGEO.2014.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Pilz14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchefferV14,
author = {Christian Scheffer and
Jan Vahrenhold},
title = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\)},
journal = {Comput. Geom.},
volume = {47},
number = {2},
pages = {125--140},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2012.05.001},
doi = {10.1016/J.COMGEO.2012.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchefferV14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchefferV14a,
author = {Christian Scheffer and
Jan Vahrenhold},
title = {Approximating geodesic distances on 2-manifolds in R\({}^{\mbox{3}}\):
The weighted case},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {789--808},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.003},
doi = {10.1016/J.COMGEO.2014.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchefferV14a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ShawiGL14,
author = {Radwa El Shawi and
Joachim Gudmundsson and
Christos Levcopoulos},
title = {Quickest path queries on transportation network},
journal = {Comput. Geom.},
volume = {47},
number = {7},
pages = {695--709},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.01.004},
doi = {10.1016/J.COMGEO.2014.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ShawiGL14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Shewchuk14,
author = {Jonathan Richard Shewchuk},
title = {Reprint of: Delaunay refinement algorithms for triangular mesh generation},
journal = {Comput. Geom.},
volume = {47},
number = {7},
pages = {741--778},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.02.005},
doi = {10.1016/J.COMGEO.2014.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Shewchuk14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sugihara14,
author = {Kokichi Sugihara},
title = {Design of solids for antigravity motion illusion},
journal = {Comput. Geom.},
volume = {47},
number = {6},
pages = {675--682},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.12.007},
doi = {10.1016/J.COMGEO.2013.12.007},
timestamp = {Tue, 04 Feb 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Sugihara14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Viglietta14,
author = {Giovanni Viglietta},
title = {Face-guarding polyhedra},
journal = {Comput. Geom.},
volume = {47},
number = {8},
pages = {833--846},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2014.04.009},
doi = {10.1016/J.COMGEO.2014.04.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Viglietta14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WalzerAU14,
author = {Stefan Walzer and
Maria Axenovich and
Torsten Ueckerdt},
title = {Packing polyominoes clumsily},
journal = {Comput. Geom.},
volume = {47},
number = {1},
pages = {52--60},
year = {2014},
url = {https://doi.org/10.1016/j.comgeo.2013.08.011},
doi = {10.1016/J.COMGEO.2013.08.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WalzerAU14.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamCFS13,
author = {Mohammad Ali Abam and
Paz Carmi and
Mohammad Farshi and
Michiel H. M. Smid},
title = {On the power of the semi-separated pair decomposition},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {631--639},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.02.003},
doi = {10.1016/J.COMGEO.2013.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbamCFS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AcarCHT13,
author = {Umut A. Acar and
Andrew Cotter and
Beno{\^{\i}}t Hudson and
Duru T{\"{u}}rkoglu},
title = {Dynamic well-spaced point sets},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {756--773},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.007},
doi = {10.1016/J.COMGEO.2012.11.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AcarCHT13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanGP13,
author = {Eyal Ackerman and
Tsachik Gelander and
Rom Pinchasi},
title = {Ice-creams and wedge graphs},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {213--218},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.07.003},
doi = {10.1016/J.COMGEO.2012.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AckermanGP13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanPSS13,
author = {Eyal Ackerman and
Rom Pinchasi and
Ludmila Scharf and
Marc Scherfenberg},
title = {On inducing polygons and related problems},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {861--878},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.06.003},
doi = {10.1016/J.COMGEO.2011.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AckermanPSS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Adamatzky13,
author = {Andrew Adamatzky},
title = {On growing connected {\(\beta\)}-skeletons},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {805--816},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.009},
doi = {10.1016/J.COMGEO.2012.11.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Adamatzky13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalAG0Y13,
author = {Pankaj K. Agarwal and
Lars Arge and
Sathish Govindarajan and
Jun Yang and
Ke Yi},
title = {Efficient external memory structures for range-aggregate queries},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {358--370},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.003},
doi = {10.1016/J.COMGEO.2012.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AgarwalAG0Y13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalAS13,
author = {Pankaj K. Agarwal and
Rinat Ben Avraham and
Micha Sharir},
title = {The 2-center problem in three dimensions},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {734--746},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.005},
doi = {10.1016/J.COMGEO.2012.11.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AgarwalAS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhipasaogluT13,
author = {Selin Damla Ahipasaoglu and
Michael J. Todd},
title = {A modified Frank-Wolfe algorithm for computing minimum-area enclosing
ellipsoidal cylinders: Theory and algorithms},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {494--519},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.11.004},
doi = {10.1016/J.COMGEO.2011.11.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhipasaogluT13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBKLSV13,
author = {Hee{-}Kap Ahn and
Sang Won Bae and
Christian Knauer and
Mira Lee and
Chan{-}Su Shin and
Antoine Vigneron},
title = {Realistic roofs over a rectilinear polygon},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1042--1055},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.06.002},
doi = {10.1016/J.COMGEO.2013.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBKLSV13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCR13,
author = {Hee{-}Kap Ahn and
Siu{-}Wing Cheng and
Iris Reinbacher},
title = {Maximum overlap of convex polytopes under translation},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {552--565},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.11.003},
doi = {10.1016/J.COMGEO.2011.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnCR13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnKKSSV13,
author = {Hee{-}Kap Ahn and
Sang{-}Sub Kim and
Christian Knauer and
Lena Schlipf and
Chan{-}Su Shin and
Antoine Vigneron},
title = {Covering and piercing disks with two centers},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {253--262},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.002},
doi = {10.1016/J.COMGEO.2012.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnKKSSV13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHHHPSSV13,
author = {Oswin Aichholzer and
Thomas Hackl and
Michael Hoffmann and
Clemens Huemer and
Attila P{\'{o}}r and
Francisco Santos and
Bettina Speckmann and
Birgit Vogtenhuber},
title = {Maximizing maximal angles for plane straight-line graphs},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {17--28},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.03.002},
doi = {10.1016/J.COMGEO.2012.03.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHHHPSSV13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMHKPRV13,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
Thomas Hackl and
Marc J. van Kreveld and
Alexander Pilz and
Pedro Ramos and
Birgit Vogtenhuber},
title = {Blocking Delaunay triangulations},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {154--159},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.005},
doi = {10.1016/J.COMGEO.2012.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMHKPRV13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMP13,
author = {Oswin Aichholzer and
Tillmann Miltzow and
Alexander Pilz},
title = {Extreme point and halving edge search in abstract order types},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {970--978},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.001},
doi = {10.1016/J.COMGEO.2013.05.001},
timestamp = {Tue, 04 Feb 2020 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMP13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisBDDFIW13,
author = {Greg Aloupis and
Nadia M. Benbernou and
Mirela Damian and
Erik D. Demaine and
Robin Y. Flatland and
John Iacono and
Stefanie Wuhrer},
title = {Efficient reconfiguration of lattice-based modular robots},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {917--928},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.03.004},
doi = {10.1016/J.COMGEO.2013.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisBDDFIW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCDDDMHHLSST13,
author = {Greg Aloupis and
Jean Cardinal and
S{\'{e}}bastien Collette and
Erik D. Demaine and
Martin L. Demaine and
Muriel Dulieu and
Ruy Fabila Monroy and
Vi Hart and
Ferran Hurtado and
Stefan Langerman and
Maria Saumell and
Carlos Seara and
Perouz Taslakian},
title = {Non-crossing matchings of points with geometric objects},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {78--92},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.005},
doi = {10.1016/J.COMGEO.2012.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCDDDMHHLSST13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisDFKORW13,
author = {Greg Aloupis and
Mirela Damian and
Robin Y. Flatland and
Matias Korman and
{\"{O}}zg{\"{u}}r {\"{O}}zkan and
David Rappaport and
Stefanie Wuhrer},
title = {Establishing strong connectivity using optimal radius half-disk antennas},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {328--339},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.008},
doi = {10.1016/J.COMGEO.2012.09.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisDFKORW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArnaudonN13,
author = {Marc Arnaudon and
Frank Nielsen},
title = {On approximating the Riemannian 1-center},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {93--104},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.007},
doi = {10.1016/J.COMGEO.2012.04.007},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ArnaudonN13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovD13,
author = {Boris Aronov and
Muriel Dulieu},
title = {How to cover a point set with a V-shape of minimum width},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {298--309},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.006},
doi = {10.1016/J.COMGEO.2012.09.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovD13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDH13,
author = {Boris Aronov and
Muriel Dulieu and
Ferran Hurtado},
title = {Witness Gabriel graphs},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {894--908},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.06.004},
doi = {10.1016/J.COMGEO.2011.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovDH13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBBKMRS13,
author = {Tetsuo Asano and
Kevin Buchin and
Maike Buchin and
Matias Korman and
Wolfgang Mulzer and
G{\"{u}}nter Rote and
Andr{\'{e}} Schulz},
title = {Memory-constrained algorithms for simple polygons},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {959--969},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.04.005},
doi = {10.1016/J.COMGEO.2013.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AsanoBBKMRS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AschnerKM13,
author = {Rom Aschner and
Matthew J. Katz and
Gila Morgenstern},
title = {Symmetric connectivity with directional antennas},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1017--1026},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.06.003},
doi = {10.1016/J.COMGEO.2013.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AschnerKM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AttaliLS13,
author = {Dominique Attali and
Andr{\'{e}} Lieutier and
David Salinas},
title = {Vietoris-Rips complexes also provide topologically correct reconstructions
of sampled shapes},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {448--465},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.009},
doi = {10.1016/J.COMGEO.2012.02.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AttaliLS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AugustineDMNRS13,
author = {John Augustine and
Sandip Das and
Anil Maheshwari and
Subhas C. Nandy and
Sasanka Roy and
Swami Sarvattomananda},
title = {Localized geometric query problems},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {340--357},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.009},
doi = {10.1016/J.COMGEO.2012.09.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AugustineDMNRS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AvisMM13,
author = {David Avis and
Hiroyuki Miyata and
Sonoko Moriyama},
title = {Families of polytopal digraphs that do not satisfy the shelling property},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {382--393},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.005},
doi = {10.1016/J.COMGEO.2012.10.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AvisMM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Balko13,
author = {Martin Balko},
title = {Grid representations and the chromatic number},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {990--1002},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.003},
doi = {10.1016/J.COMGEO.2013.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Balko13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaloghGS13,
author = {J{\'{o}}zsef Balogh and
Hern{\'{a}}n Gonz{\'{a}}lez{-}Aguilar and
Gelasio Salazar},
title = {Large convex holes in random point sets},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {725--733},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.004},
doi = {10.1016/J.COMGEO.2012.11.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaloghGS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bar-YehudaR13,
author = {Reuven Bar{-}Yehuda and
Dror Rawitz},
title = {A note on multicovering with disks},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {394--399},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.006},
doi = {10.1016/J.COMGEO.2012.10.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bar-YehudaR13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyS13,
author = {Imre B{\'{a}}r{\'{a}}ny and
William L. Steiger},
title = {On the variance of random polygons},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {173--180},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.003},
doi = {10.1016/J.COMGEO.2012.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetBCDDILSSTW13,
author = {Gill Barequet and
Nadia M. Benbernou and
David Charlton and
Erik D. Demaine and
Martin L. Demaine and
Mashhood Ishaque and
Anna Lubiw and
Andr{\'{e}} Schulz and
Diane L. Souvaine and
Godfried T. Toussaint and
Andrew Winslow},
title = {Bounded-degree polyhedronization of point sets},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {148--153},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.008},
doi = {10.1016/J.COMGEO.2012.02.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BarequetBCDDILSSTW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaygiG13,
author = {Mostafa Nouri Baygi and
Mohammad Ghodsi},
title = {Space/query-time tradeoff for computing the visibility polygon},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {371--381},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.004},
doi = {10.1016/J.COMGEO.2012.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaygiG13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ben-NerSS13,
author = {Moria Ben{-}Ner and
Andr{\'{e}} Schulz and
Adam Sheffer},
title = {On numbers of pseudo-triangulations},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {688--699},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.002},
doi = {10.1016/J.COMGEO.2012.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ben-NerSS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDLPSU13,
author = {Sergey Bereg and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Dolores Lara and
Pablo P{\'{e}}rez{-}Lantero and
Carlos Seara and
Jorge Urrutia},
title = {On the coarseness of bicolored point sets},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {65--77},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.003},
doi = {10.1016/J.COMGEO.2012.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeregDLPSU13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergCG13,
author = {Mark de Berg and
Atlas F. Cook IV and
Joachim Gudmundsson},
title = {Fast Fr{\'{e}}chet queries},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {747--755},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.006},
doi = {10.1016/J.COMGEO.2012.11.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergCG13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlV13,
author = {Therese Biedl and
Lesvia Elena Ruiz Vel{\'{a}}zquez},
title = {Drawing planar 3-trees with given face areas},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {276--285},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.004},
doi = {10.1016/J.COMGEO.2012.09.004},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlV13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BokowskiS13,
author = {J{\"{u}}rgen Bokowski and
Lars Schewe},
title = {On the finite set of missing geometric configurations (\emph{n}\({}_{\mbox{4}}\))},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {532--540},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.11.001},
doi = {10.1016/J.COMGEO.2011.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BokowskiS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCCKL13,
author = {Prosenjit Bose and
Paz Carmi and
Lilach Chaitman{-}Yerushalmi and
S{\'{e}}bastien Collette and
Matthew J. Katz and
Stefan Langerman},
title = {Stable Roommates Spanner},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {120--130},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.07.001},
doi = {10.1016/J.COMGEO.2012.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCCCKL13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCHKLSS13,
author = {Prosenjit Bose and
S{\'{e}}bastien Collette and
Ferran Hurtado and
Matias Korman and
Stefan Langerman and
Vera Sacrist{\'{a}}n and
Maria Saumell},
title = {Some properties of k-Delaunay and k-Gabriel graphs},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {131--139},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.006},
doi = {10.1016/J.COMGEO.2012.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCHKLSS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseDDHM13,
author = {Prosenjit Bose and
Karim Dou{\"{\i}}eb and
Vida Dujmovic and
John Howat and
Pat Morin},
title = {Fast local searches and updates in bounded universes},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {181--189},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.002},
doi = {10.1016/J.COMGEO.2012.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseDDHM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseS13,
author = {Prosenjit Bose and
Michiel H. M. Smid},
title = {On plane geometric spanners: {A} survey and open problems},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {818--830},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.04.002},
doi = {10.1016/J.COMGEO.2013.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrandtsDHK13,
author = {Jan Brandts and
Sander Dijkhuis and
Vincent de Haan and
Michal Kr{\'{\i}}zek},
title = {There are only two nonobtuse binary triangulations of the unit n-cube},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {286--297},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.005},
doi = {10.1016/J.COMGEO.2012.09.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BrandtsDHK13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BremnerDIM13,
author = {David Bremner and
Antoine Deza and
Hiroshi Imai and
Sonoko Moriyama},
title = {Editorial},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {493},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.009},
doi = {10.1016/J.COMGEO.2012.01.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BremnerDIM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloDP13,
author = {Sergio Cabello and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Pablo P{\'{e}}rez{-}Lantero},
title = {Covering a bichromatic point set with two disjoint monochromatic disks},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {203--212},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.06.002},
doi = {10.1016/J.COMGEO.2012.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloDP13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CanoTU13,
author = {Javier Cano and
Csaba D. T{\'{o}}th and
Jorge Urrutia},
title = {A tight bound for point guards in piecewise convex art galleries},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {945--958},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.04.004},
doi = {10.1016/J.COMGEO.2013.04.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CanoTU13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalK13,
author = {Jean Cardinal and
Matias Korman},
title = {Coloring planar homothets and three-dimensional hypergraphs},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1027--1035},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.06.004},
doi = {10.1016/J.COMGEO.2013.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalK13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenDILM13,
author = {Dan Chen and
Olivier Devillers and
John Iacono and
Stefan Langerman and
Pat Morin},
title = {Oja centers and centers of gravity},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {140--147},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.004},
doi = {10.1016/J.COMGEO.2012.04.004},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChenDILM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenK13,
author = {Chao Chen and
Michael Kerber},
title = {An output-sensitive algorithm for persistent homology},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {435--447},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.010},
doi = {10.1016/J.COMGEO.2012.02.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenK13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenM13,
author = {Dan Chen and
Pat Morin},
title = {Approximating majority depth},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1059--1064},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.06.005},
doi = {10.1016/J.COMGEO.2013.06.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenMW13,
author = {Dan Chen and
Pat Morin and
Uli Wagner},
title = {Absolute approximation of Tukey depth: Theory and experiments},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {566--573},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.03.001},
doi = {10.1016/J.COMGEO.2012.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenMW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengL13,
author = {Siu{-}Wing Cheng and
Chi{-}Kit Lam},
title = {Shape matching under rigid motion},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {591--603},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.01.002},
doi = {10.1016/J.COMGEO.2013.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChengL13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChepoiF13,
author = {Victor Chepoi and
Stefan Felsner},
title = {Approximating hitting sets of axis-parallel rectangles intersecting
a monotone curve},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1036--1041},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.008},
doi = {10.1016/J.COMGEO.2013.05.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChepoiF13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChepoiM13,
author = {Victor Chepoi and
Daniela Maftuleac},
title = {Shortest path problem in rectangular complexes of global nonpositive
curvature},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {51--64},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.04.002},
doi = {10.1016/J.COMGEO.2012.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChepoiM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ColletteL13,
author = {S{\'{e}}bastien Collette and
Stefan Langerman},
title = {Editorial},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {817},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.04.001},
doi = {10.1016/J.COMGEO.2013.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ColletteL13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeMNS13,
author = {Minati De and
Anil Maheshwari and
Subhas C. Nandy and
Michiel H. M. Smid},
title = {An in-place min-max priority search tree},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {310--327},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.007},
doi = {10.1016/J.COMGEO.2012.09.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DeMNS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDILNO13,
author = {Erik D. Demaine and
Martin L. Demaine and
Jin{-}ichi Itoh and
Anna Lubiw and
Chie Nara and
Joseph O'Rourke},
title = {Refold rigidity of convex polyhedra},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {979--989},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.002},
doi = {10.1016/J.COMGEO.2013.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineDILNO13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DoradoPT13,
author = {Rub{\'{e}}n Dorado and
B. Pivec and
Eloisa Torres{-}Jim{\'{e}}nez},
title = {Advancing front circle packing to approximate conformal strips},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {105--118},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.05.002},
doi = {10.1016/J.COMGEO.2012.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DoradoPT13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicELLLRW13,
author = {Vida Dujmovic and
William S. Evans and
Sylvain Lazard and
William J. Lenhart and
Giuseppe Liotta and
David Rappaport and
Stephen K. Wismath},
title = {On point-sets that support planar graphs},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {29--50},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.03.003},
doi = {10.1016/J.COMGEO.2012.03.003},
timestamp = {Tue, 20 Sep 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DujmovicELLLRW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuJ13,
author = {Adrian Dumitrescu and
Minghui Jiang},
title = {On reconfiguration of disks in the plane and related problems},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {191--202},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.06.001},
doi = {10.1016/J.COMGEO.2012.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuJ13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherM13,
author = {Stephane Durocher and
Jason Morrison},
title = {Foreword},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {119},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.07.002},
doi = {10.1016/J.COMGEO.2012.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EvansGKLMS13,
author = {William S. Evans and
Emden R. Gansner and
Michael Kaufmann and
Giuseppe Liotta and
Henk Meijer and
Andreas Spillner},
title = {Approximate proximity drawings},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {604--614},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.01.001},
doi = {10.1016/J.COMGEO.2013.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EvansGKLMS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EzraM13,
author = {Esther Ezra and
Wolfgang Mulzer},
title = {Convex hull of points lying on lines in time after preprocessing},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {417--434},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.03.004},
doi = {10.1016/J.COMGEO.2012.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EzraM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GeissKPR13,
author = {Darius Gei{\ss} and
Rolf Klein and
Rainer Penninger and
G{\"{u}}nter Rote},
title = {Optimally solving a transportation problem using Voronoi diagrams},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {1009--1016},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.005},
doi = {10.1016/J.COMGEO.2013.05.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GeissKPR13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GerbnerT13,
author = {D{\'{a}}niel Gerbner and
G{\'{e}}za T{\'{o}}th},
title = {Separating families of convex sets},
journal = {Comput. Geom.},
volume = {46},
number = {9},
pages = {1056--1058},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.06.001},
doi = {10.1016/J.COMGEO.2013.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GerbnerT13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoDLM13,
author = {Emilio Di Giacomo and
Walter Didimo and
Giuseppe Liotta and
Fabrizio Montecchiani},
title = {Area requirement of graph drawings with few crossings per edge},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {909--916},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.03.001},
doi = {10.1016/J.COMGEO.2013.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiacomoDLM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoFFGK13,
author = {Emilio Di Giacomo and
Fabrizio Frati and
Radoslav Fulek and
Luca Grilli and
Marcus Krug},
title = {Orthogeodesic point-set embedding of trees},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {929--944},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.04.003},
doi = {10.1016/J.COMGEO.2013.04.003},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GiacomoFFGK13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiannopoulosKRW13,
author = {Panos Giannopoulos and
Christian Knauer and
G{\"{u}}nter Rote and
Daniel Werner},
title = {Fixed-parameter tractability and lower bounds for stabbing problems},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {839--860},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.06.005},
doi = {10.1016/J.COMGEO.2011.06.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiannopoulosKRW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GuibasMM13,
author = {Leonidas J. Guibas and
Nikola Milosavljevic and
Arik Motskin},
title = {Connected dominating sets on dynamic geometric graphs},
journal = {Comput. Geom.},
volume = {46},
number = {2},
pages = {160--172},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.004},
doi = {10.1016/J.COMGEO.2012.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GuibasMM13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HerrmannJP13,
author = {Sven Herrmann and
Michael Joswig and
Marc E. Pfetsch},
title = {Computing the bounded subcomplex of an unbounded polyhedron},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {541--551},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.11.002},
doi = {10.1016/J.COMGEO.2011.11.002},
timestamp = {Mon, 28 Aug 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HerrmannJP13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hershberger13,
author = {John Hershberger},
title = {Stable snap rounding},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {403--416},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.011},
doi = {10.1016/J.COMGEO.2012.02.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Hershberger13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoK13,
author = {Ferran Hurtado and
Marc J. van Kreveld},
title = {Guest Editors' foreword},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {401},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.007},
doi = {10.1016/J.COMGEO.2012.10.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HurtadoK13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JelinekKR13,
author = {V{\'{\i}}t Jel{\'{\i}}nek and
Jan Kratochv{\'{\i}}l and
Ignaz Rutter},
title = {A Kuratowski-type theorem for planarity of partially embedded graphs},
journal = {Comput. Geom.},
volume = {46},
number = {4},
pages = {466--492},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.07.005},
doi = {10.1016/J.COMGEO.2012.07.005},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/JelinekKR13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaravelasST13,
author = {Menelaos I. Karavelas and
Raimund Seidel and
Eleni Tzanaki},
title = {Convex hulls of spheres and convex hulls of disjoint convex polytopes},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {615--630},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.02.001},
doi = {10.1016/J.COMGEO.2013.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KaravelasST13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaufmannMS13,
author = {Michael Kaufmann and
Tamara Mchedlidze and
Antonios Symvonis},
title = {On upward point set embeddability},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {774--804},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.008},
doi = {10.1016/J.COMGEO.2012.11.008},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KaufmannMS13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimC13,
author = {Hyo{-}Sil Kim and
Otfried Cheong},
title = {The cost of bounded curvature},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {648--672},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.10.008},
doi = {10.1016/J.COMGEO.2012.10.008},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KimC13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/King13,
author = {James King},
title = {Fast vertex guarding for polygons with and without holes},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {219--231},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.07.004},
doi = {10.1016/J.COMGEO.2012.07.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/King13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KulkarniZ13,
author = {Omkar Kulkarni and
Huaming Zhang},
title = {An optimal greedy routing algorithm for triangulated polygons},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {640--647},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.02.002},
doi = {10.1016/J.COMGEO.2013.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KulkarniZ13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LaarhovenA13,
author = {Jon W. Van Laarhoven and
Kurt M. Anstreicher},
title = {Geometric conditions for Euclidean Steiner trees in {\(\mathfrak{R}\)}\({}^{\mbox{\emph{d}}}\)},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {520--531},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.11.007},
doi = {10.1016/J.COMGEO.2011.11.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/LaarhovenA13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LoeraDKMPW13,
author = {Jes{\'{u}}s A. De Loera and
Brandon E. Dutra and
Matthias K{\"{o}}ppe and
S. Moreinis and
G. Pinto and
J. Wu},
title = {Software for exact integration of polynomials over polyhedra},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {232--252},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.001},
doi = {10.1016/J.COMGEO.2012.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/LoeraDKMPW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaierP13,
author = {Georg Maier and
Georg Pisinger},
title = {Approximation of a closed polygon with a minimum number of circular
arcs and line segments},
journal = {Comput. Geom.},
volume = {46},
number = {3},
pages = {263--275},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.09.003},
doi = {10.1016/J.COMGEO.2012.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MaierP13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Mchedlidze13,
author = {Tamara Mchedlidze},
title = {Upward planar embedding of an n-vertex oriented path on O(n\({}^{\mbox{2}}\))
points},
journal = {Comput. Geom.},
volume = {46},
number = {8},
pages = {1003--1008},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2013.05.004},
doi = {10.1016/J.COMGEO.2013.05.004},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Mchedlidze13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RazenW13,
author = {Andreas Razen and
Emo Welzl},
title = {On the number of crossing-free partitions},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {879--893},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2011.07.001},
doi = {10.1016/J.COMGEO.2011.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RazenW13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rivera-CampoU13,
author = {Eduardo Rivera{-}Campo and
Virginia Urrutia{-}Galicia},
title = {A sufficient condition for the existence of plane spanning trees on
geometric graphs},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {1--6},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.006},
doi = {10.1016/J.COMGEO.2012.02.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Rivera-CampoU13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchulzT13,
author = {Andr{\'{e}} Schulz and
Csaba D. T{\'{o}}th},
title = {The union of colorful simplices spanned by a colored point set},
journal = {Comput. Geom.},
volume = {46},
number = {5},
pages = {574--590},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.006},
doi = {10.1016/J.COMGEO.2012.01.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchulzT13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Sunic13,
author = {Zoran Sunic},
title = {Normal art galleries: Wall in - all in},
journal = {Comput. Geom.},
volume = {46},
number = {1},
pages = {7--16},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.02.007},
doi = {10.1016/J.COMGEO.2012.02.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Sunic13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VanderZeeHGZR13,
author = {Evan VanderZee and
Anil N. Hirani and
Damrong Guoy and
Vadim Zharnitsky and
Edgar A. Ramos},
title = {Geometric and combinatorial properties of well-centered triangulations
in three and higher dimensions},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {700--724},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.003},
doi = {10.1016/J.COMGEO.2012.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/VanderZeeHGZR13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WuDBB13,
author = {Xiaodong Wu and
Xin Dou and
John E. Bayouth and
John M. Buatti},
title = {An almost linear time algorithm for field splitting in radiation therapy},
journal = {Comput. Geom.},
volume = {46},
number = {6},
pages = {673--687},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.11.001},
doi = {10.1016/J.COMGEO.2012.11.001},
timestamp = {Mon, 01 Mar 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WuDBB13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen13,
author = {Christian Wulff{-}Nilsen},
title = {Constant time distance queries in planar unweighted graphs with subquadratic
preprocessing time},
journal = {Comput. Geom.},
volume = {46},
number = {7},
pages = {831--838},
year = {2013},
url = {https://doi.org/10.1016/j.comgeo.2012.01.016},
doi = {10.1016/J.COMGEO.2012.01.016},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen13.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamH12,
author = {Mohammad Ali Abam and
Sariel Har{-}Peled},
title = {New constructions of SSPDs and their applications},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {200--214},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.003},
doi = {10.1016/J.COMGEO.2011.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbamH12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Abu-AffashACK12,
author = {A. Karim Abu{-}Affash and
Rom Aschner and
Paz Carmi and
Matthew J. Katz},
title = {The {MST} of symmetric disk graphs is light},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {54--61},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.08.002},
doi = {10.1016/J.COMGEO.2011.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Abu-AffashACK12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCMV12,
author = {Hee{-}Kap Ahn and
Otfried Cheong and
Jir{\'{\i}} Matousek and
Antoine Vigneron},
title = {Reachability by paths of bounded curvature in a convex polygon},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {21--32},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.07.003},
doi = {10.1016/J.COMGEO.2011.07.003},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnCMV12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerADHRU12,
author = {Oswin Aichholzer and
Franz Aurenhammer and
Erik D. Demaine and
Ferran Hurtado and
Pedro Ramos and
Jorge Urrutia},
title = {On k-convex polygons},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {73--87},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.09.001},
doi = {10.1016/J.COMGEO.2011.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerADHRU12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerRSV12,
author = {Oswin Aichholzer and
G{\"{u}}nter Rote and
Andr{\'{e}} Schulz and
Birgit Vogtenhuber},
title = {Pointed drawings of planar graphs},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {482--494},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.08.001},
doi = {10.1016/J.COMGEO.2010.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerRSV12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoMS12,
author = {Javier Alonso and
Horst Martini and
Margarita Spirova},
title = {Minimal enclosing discs, circumcircles, and circumcenters in normed
planes (Part {I)}},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {258--274},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.007},
doi = {10.1016/J.COMGEO.2012.01.007},
timestamp = {Thu, 28 Mar 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlonsoMS12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoMS12a,
author = {Javier Alonso and
Horst Martini and
Margarita Spirova},
title = {Minimal enclosing discs, circumcircles, and circumcenters in normed
planes (Part {II)}},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {350--369},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.02.003},
doi = {10.1016/J.COMGEO.2012.02.003},
timestamp = {Thu, 28 Mar 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlonsoMS12a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArikushiFKMT12,
author = {Karin Arikushi and
Radoslav Fulek and
Bal{\'{a}}zs Keszegh and
Filip Moric and
Csaba D. T{\'{o}}th},
title = {Graphs that admit right angle crossing drawings},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {169--177},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.11.008},
doi = {10.1016/J.COMGEO.2011.11.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArikushiFKMT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeO12,
author = {Sang Won Bae and
Yoshio Okamoto},
title = {Querying two boundary points for shortest paths in a polygonal domain},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {284--293},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.012},
doi = {10.1016/J.COMGEO.2012.01.012},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaeO12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaranyMT12,
author = {Imre B{\'{a}}r{\'{a}}ny and
Hiroshi Maehara and
Norihide Tokushige},
title = {Tetrahedra passing through a triangular hole, and tetrahedra fixed
by a planar frame},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {14--20},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.07.004},
doi = {10.1016/J.COMGEO.2011.07.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaranyMT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeckersB12,
author = {Benoit Beckers and
Pierre Beckers},
title = {A general rule for disk and hemisphere partition into equal-area cells},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {275--283},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.011},
doi = {10.1016/J.COMGEO.2012.01.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeckersB12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregCDPSV12,
author = {Sergey Bereg and
Sergio Cabello and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Pablo P{\'{e}}rez{-}Lantero and
Carlos Seara and
Inmaculada Ventura},
title = {The class cover problem with boxes},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {294--304},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.014},
doi = {10.1016/J.COMGEO.2012.01.014},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeregCDPSV12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG12,
author = {Mark de Berg and
Dirk H. P. Gerrits},
title = {Approximation algorithms for free-label maximization},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {153--168},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.10.004},
doi = {10.1016/J.COMGEO.2011.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergG12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BitnerD12,
author = {Steven Bitner and
Ovidiu Daescu},
title = {Minimum-sum dipolar spanning tree in R\({}^{\mbox{3}}\)},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {476--481},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.09.011},
doi = {10.1016/J.COMGEO.2010.09.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BitnerD12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseC12,
author = {Prosenjit Bose and
Paz Carmi},
title = {Editorial},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {475},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.010},
doi = {10.1016/J.COMGEO.2012.01.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseC12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bringmann12,
author = {Karl Bringmann},
title = {An improved algorithm for Klee's measure problem on fat boxes},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {225--233},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.001},
doi = {10.1016/J.COMGEO.2011.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bringmann12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrunDM12,
author = {Christophe Brun and
Jean{-}Fran{\c{c}}ois Dufourd and
Nicolas Magaud},
title = {Designing and proving correct a convex hull algorithm with hypermaps
in Coq},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {436--457},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.06.006},
doi = {10.1016/J.COMGEO.2010.06.006},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BrunDM12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloVL12,
author = {Sergio Cabello and
{\'{E}}ric Colin de Verdi{\`{e}}re and
Francis Lazarus},
title = {Algorithms for the edge-width of an embedded graph},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {215--224},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.002},
doi = {10.1016/J.COMGEO.2011.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloVL12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CazalsC12,
author = {Fr{\'{e}}d{\'{e}}ric Cazals and
David Cohen{-}Steiner},
title = {Reconstructing 3D compact sets},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {1--13},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.07.005},
doi = {10.1016/J.COMGEO.2011.07.005},
timestamp = {Mon, 05 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CazalsC12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenDDM12,
author = {Dan Chen and
Luc Devroye and
Vida Dujmovic and
Pat Morin},
title = {Memoryless routing in convex subdivisions: Random walks are optimal},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {178--185},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.005},
doi = {10.1016/J.COMGEO.2011.12.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenDDM12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenHT12,
author = {Wei{-}Mei Chen and
Hsien{-}Kuei Hwang and
Tsung{-}Hsi Tsai},
title = {Maxima-finding algorithms for multidimensional samples: {A} two-phase
approach},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {33--53},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.08.001},
doi = {10.1016/J.COMGEO.2011.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenHT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenW12,
author = {Danny Z. Chen and
Haitao Wang},
title = {An improved algorithm for reconstructing a simple polygon from its
visibility angles},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {254--257},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.005},
doi = {10.1016/J.COMGEO.2012.01.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenW12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChiangHR12,
author = {Ching{-}Shoei Chiang and
Christoph M. Hoffmann and
Paul Rosen},
title = {A generalized Malfatti problem},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {425--435},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.06.005},
doi = {10.1016/J.COMGEO.2010.06.005},
timestamp = {Tue, 15 Jun 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChiangHR12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Davis12,
author = {Ernest Davis},
title = {Preserving geometric properties in reconstructing regions from internal
and nearby points},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {234--253},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.001},
doi = {10.1016/J.COMGEO.2012.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Davis12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DulaL12,
author = {Jos{\'{e}} H. Dul{\'{a}} and
Francisco J. L{\'{o}}pez},
title = {Competing output-sensitive frame algorithms},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {186--197},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.006},
doi = {10.1016/J.COMGEO.2011.12.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DulaL12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Dumitrescu12,
author = {Adrian Dumitrescu},
title = {Going around in circles},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {370--381},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.02.004},
doi = {10.1016/J.COMGEO.2012.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Dumitrescu12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuT12,
author = {Adrian Dumitrescu and
Csaba D. T{\'{o}}th},
title = {Watchman tours for polygons with holes},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {326--333},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.02.001},
doi = {10.1016/J.COMGEO.2012.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Frati12,
author = {Fabrizio Frati},
title = {Straight-line drawings of outerplanar graphs in O(dn log n) area},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {524--533},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.03.007},
doi = {10.1016/J.COMGEO.2010.03.007},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Frati12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GajentaanO12,
author = {Anka Gajentaan and
Mark H. Overmars},
title = {On a class of O(n\({}^{\mbox{2}}\)) problems in computational geometry},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {140--152},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.11.006},
doi = {10.1016/J.COMGEO.2011.11.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GajentaanO12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GaoJM12,
author = {Xiao{-}Shan Gao and
Robert Joan{-}Arinyo and
Dominique Michelucci},
title = {Special issue on geometric constraints and reasoning},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {383--384},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.008},
doi = {10.1016/J.COMGEO.2012.01.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GaoJM12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiesenMP12,
author = {Joachim Giesen and
Balint Miklos and
Mark Pauly},
title = {The medial axis of the union of inner Voronoi balls in the plane},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {515--523},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.03.006},
doi = {10.1016/J.COMGEO.2010.03.006},
timestamp = {Mon, 05 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiesenMP12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrayKLS12,
author = {Chris Gray and
Frank Kammer and
Maarten L{\"{o}}ffler and
Rodrigo I. Silveira},
title = {Removing local extrema from imprecise terrains},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {334--349},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.02.002},
doi = {10.1016/J.COMGEO.2012.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GrayKLS12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HallerJSSW12,
author = {Kirk Haller and
Audrey Lee{-}St. John and
Meera Sitharam and
Ileana Streinu and
Neil White},
title = {Body-and-cad geometric constraint systems},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {385--405},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.06.003},
doi = {10.1016/J.COMGEO.2010.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HallerJSSW12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HararyT12,
author = {Gur Harary and
Ayellet Tal},
title = {3D Euler spirals for 3D curve completion},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {115--126},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.10.001},
doi = {10.1016/J.COMGEO.2011.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HararyT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HechtKT12,
author = {Fr{\'{e}}d{\'{e}}ric Hecht and
Rapha{\"{e}}l Kuate and
Timothy Tautges},
title = {Local transformations of hexahedral meshes of lower valence},
journal = {Comput. Geom.},
volume = {45},
number = {1-2},
pages = {62--71},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.07.002},
doi = {10.1016/J.COMGEO.2011.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HechtKT12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzLM12,
author = {Matthew J. Katz and
Nissan Lev{-}Tov and
Gila Morgenstern},
title = {Conflict-Free Coloring of points on a line with respect to a set of
intervals},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {508--514},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.013},
doi = {10.1016/J.COMGEO.2012.01.013},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KatzLM12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Keszegh12,
author = {Bal{\'{a}}zs Keszegh},
title = {Coloring half-planes and bottomless rectangles},
journal = {Comput. Geom.},
volume = {45},
number = {9},
pages = {495--507},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.09.004},
doi = {10.1016/J.COMGEO.2011.09.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Keszegh12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KimMPYZ12,
author = {Joondong Kim and
Joseph S. B. Mitchell and
Valentin Polishchuk and
Shang Yang and
Jingyu Zou},
title = {Routing multi-class traffic flows in the plane},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {99--114},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.09.003},
doi = {10.1016/J.COMGEO.2011.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KimMPYZ12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kirkpatrick12,
author = {David G. Kirkpatrick},
title = {Guest editor's foreword},
journal = {Comput. Geom.},
volume = {45},
number = {5-6},
pages = {199},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.12.004},
doi = {10.1016/J.COMGEO.2011.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Kirkpatrick12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MagaudNS12,
author = {Nicolas Magaud and
Julien Narboux and
Pascal Schreck},
title = {A case study in formalizing projective geometry in Coq: Desargues
theorem},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {406--424},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.06.004},
doi = {10.1016/J.COMGEO.2010.06.004},
timestamp = {Mon, 26 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/MagaudNS12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornS12,
author = {Kurt Mehlhorn and
J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {CGTA-Awards 2011},
journal = {Comput. Geom.},
volume = {45},
number = {4},
pages = {139},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.11.005},
doi = {10.1016/J.COMGEO.2011.11.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MehlhornS12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MukhopadhyayG12,
author = {Asish Mukhopadhyay and
Eugene Greene},
title = {The ordinary line problem revisited},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {127--130},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.10.003},
doi = {10.1016/J.COMGEO.2011.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MukhopadhyayG12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NishatMR12,
author = {Rahnuma Islam Nishat and
Debajyoti Mondal and
Md. Saidur Rahman},
title = {Point-set embeddings of plane 3-trees},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {88--98},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.09.002},
doi = {10.1016/J.COMGEO.2011.09.002},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/NishatMR12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachST12,
author = {J{\'{a}}nos Pach and
Andrew Suk and
Miroslav Treml},
title = {Tangencies between families of disjoint regions in the plane},
journal = {Comput. Geom.},
volume = {45},
number = {3},
pages = {131--138},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2011.10.002},
doi = {10.1016/J.COMGEO.2011.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PachST12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YanXD12,
author = {Chenyu Yan and
Yang Xiang and
Feodor F. Dragan},
title = {Compact and low delay routing labeling scheme for Unit Disk Graphs},
journal = {Comput. Geom.},
volume = {45},
number = {7},
pages = {305--325},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2012.01.015},
doi = {10.1016/J.COMGEO.2012.01.015},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/YanXD12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zhang12,
author = {Gui{-}Fang Zhang},
title = {Classification of direct kinematics to planar generalized Stewart
platforms},
journal = {Comput. Geom.},
volume = {45},
number = {8},
pages = {458--473},
year = {2012},
url = {https://doi.org/10.1016/j.comgeo.2010.06.007},
doi = {10.1016/J.COMGEO.2010.06.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Zhang12.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbregoMFFHSS11,
author = {Bernardo M. {\'{A}}brego and
Ruy Fabila Monroy and
Silvia Fern{\'{a}}ndez{-}Merchant and
David Flores{-}Pe{\~{n}}aloza and
Ferran Hurtado and
Vera Sacrist{\'{a}}n and
Maria Saumell},
title = {On crossing numbers of geometric proximity graphs},
journal = {Comput. Geom.},
volume = {44},
number = {4},
pages = {216--233},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.11.003},
doi = {10.1016/J.COMGEO.2010.11.003},
timestamp = {Mon, 26 Jun 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AbregoMFFHSS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBDDKKRS11,
author = {Hee{-}Kap Ahn and
Sang Won Bae and
Erik D. Demaine and
Martin L. Demaine and
Sang{-}Sub Kim and
Matias Korman and
Iris Reinbacher and
Wanbin Son},
title = {Covering points by disjoint boxes with outliers},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {178--190},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.10.002},
doi = {10.1016/J.COMGEO.2010.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBDDKKRS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoR11,
author = {Laurent Alonso and
Edward M. Reingold},
title = {Improved bounds for cops-and-robber pursuit},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {365--369},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.03.001},
doi = {10.1016/J.COMGEO.2011.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlonsoR11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinBMP11,
author = {Esther M. Arkin and
Michael A. Bender and
Joseph S. B. Mitchell and
Valentin Polishchuk},
title = {The snowblower problem},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {370--384},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.03.003},
doi = {10.1016/J.COMGEO.2011.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinBMP11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovDH11,
author = {Boris Aronov and
Muriel Dulieu and
Ferran Hurtado},
title = {Witness (Delaunay) graphs},
journal = {Comput. Geom.},
volume = {44},
number = {6-7},
pages = {329--344},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.01.001},
doi = {10.1016/J.COMGEO.2011.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovDH11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bar-YehudaHR11,
author = {Reuven Bar{-}Yehuda and
Danny Hermelin and
Dror Rawitz},
title = {Minimum vertex cover in rectangle graphs},
journal = {Comput. Geom.},
volume = {44},
number = {6-7},
pages = {356--364},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.03.002},
doi = {10.1016/J.COMGEO.2011.03.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bar-YehudaHR11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlG11,
author = {Therese Biedl and
Burkay Gen{\c{c}}},
title = {Reconstructing orthogonal polyhedra from putative vertex sets},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {409--417},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.04.002},
doi = {10.1016/J.COMGEO.2011.04.002},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlG11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlHL11,
author = {Therese Biedl and
Masud Hasan and
Alejandro L{\'{o}}pez{-}Ortiz},
title = {Efficient view point selection for silhouettes of convex polyhedra},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {399--408},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.04.001},
doi = {10.1016/J.COMGEO.2011.04.001},
timestamp = {Thu, 11 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlHL11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCSX11,
author = {Prosenjit Bose and
Paz Carmi and
Mathieu Couture and
Michiel H. M. Smid and
Daming Xu},
title = {On a family of strong geometric spanners that admit local routing
strategies},
journal = {Comput. Geom.},
volume = {44},
number = {6-7},
pages = {319--328},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.01.002},
doi = {10.1016/J.COMGEO.2011.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCCSX11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCD11,
author = {Prosenjit Bose and
Otfried Cheong and
Vida Dujmovic},
title = {A note on the perimeter of fat objects},
journal = {Comput. Geom.},
volume = {44},
number = {1},
pages = {1--8},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.06.002},
doi = {10.1016/J.COMGEO.2010.06.002},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCD11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseDLSV11,
author = {Prosenjit Bose and
Luc Devroye and
Maarten L{\"{o}}ffler and
Jack Snoeyink and
Vishal Verma},
title = {Almost all Delaunay triangulations have stretch factor greater than
pi/2},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {121--127},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.009},
doi = {10.1016/J.COMGEO.2010.09.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseDLSV11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMSW11,
author = {Prosenjit Bose and
Anil Maheshwari and
Chang Shu and
Stefanie Wuhrer},
title = {A survey of geodesic paths on 3D surfaces},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {486--498},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.006},
doi = {10.1016/J.COMGEO.2011.05.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseMSW11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BriseG11,
author = {Yves Brise and
Bernd G{\"{a}}rtner},
title = {Clarkson's algorithm for violator spaces},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {70--81},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.003},
doi = {10.1016/J.COMGEO.2010.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BriseG11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBKL11,
author = {Kevin Buchin and
Maike Buchin and
Marc J. van Kreveld and
Jun Luo},
title = {Finding long and similar parts of trajectories},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {465--476},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.004},
doi = {10.1016/J.COMGEO.2011.05.004},
timestamp = {Tue, 16 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinBKL11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKLR11,
author = {Paz Carmi and
Matthew J. Katz and
Zvi Lotker and
Adi Ros{\'{e}}n},
title = {Connectivity guarantees for wireless networks with directional antennas},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {477--485},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.003},
doi = {10.1016/J.COMGEO.2011.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiKLR11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CheongEGGHLLN11,
author = {Otfried Cheong and
Hazel Everett and
Marc Glisse and
Joachim Gudmundsson and
Samuel Hornus and
Sylvain Lazard and
Mira Lee and
Hyeon{-}Suk Na},
title = {Farthest-polygon Voronoi diagrams},
journal = {Comput. Geom.},
volume = {44},
number = {4},
pages = {234--247},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.11.004},
doi = {10.1016/J.COMGEO.2010.11.004},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CheongEGGHLLN11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ClaverolGGMS11,
author = {Merc{\`{e}} Claverol and
Delia Garijo and
Clara I. Grima and
Alberto M{\'{a}}rquez and
Carlos Seara},
title = {Stabbers of line segments in the plane},
journal = {Comput. Geom.},
volume = {44},
number = {5},
pages = {303--318},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.12.004},
doi = {10.1016/J.COMGEO.2010.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ClaverolGGMS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CookW11,
author = {Atlas F. Cook and
Carola Wenk},
title = {Link distance and shortest path problems in the plane},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {442--455},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.04.004},
doi = {10.1016/J.COMGEO.2011.04.004},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CookW11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CordascoCF11,
author = {Gennaro Cordasco and
Rosario De Chiara and
Andrew Fish},
title = {Efficient on-line algorithms for Euler diagram region computation},
journal = {Comput. Geom.},
volume = {44},
number = {1},
pages = {52--68},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.07.003},
doi = {10.1016/J.COMGEO.2010.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CordascoCF11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CuiKX11,
author = {Shiliang Cui and
Iyad A. Kanj and
Ge Xia},
title = {On the stretch factor of Delaunay triangulations of points in convex
position},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {104--109},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.007},
doi = {10.1016/J.COMGEO.2010.09.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CuiKX11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineFRSSZ11,
author = {Erik D. Demaine and
S{\'{a}}ndor P. Fekete and
G{\"{u}}nter Rote and
Nils Schweer and
Daria Schymura and
Mariano Zelke},
title = {Integer point sets minimizing average pairwise L\({}_{\mbox{1}}\)
distance: What is the optimal shape of a town?},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {82--94},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.004},
doi = {10.1016/J.COMGEO.2010.09.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineFRSSZ11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Devillers11,
author = {Olivier Devillers},
title = {Vertex removal in two-dimensional Delaunay triangulation: Speed-up
by low degrees optimization},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {169--177},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.10.001},
doi = {10.1016/J.COMGEO.2010.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Devillers11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevillersT11,
author = {Olivier Devillers and
Monique Teillaud},
title = {Perturbations for Delaunay and weighted Delaunay 3D triangulations},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {160--168},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.010},
doi = {10.1016/J.COMGEO.2010.09.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DevillersT11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Diaz-BanezLMSV11,
author = {Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Mario Alberto L{\'{o}}pez and
Merc{\`{e}} Mora and
Carlos Seara and
Inmaculada Ventura},
title = {Fitting a two-joint orthogonal chain to a point set},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {135--147},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.07.005},
doi = {10.1016/J.COMGEO.2010.07.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Diaz-BanezLMSV11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DisserMW11,
author = {Yann Disser and
Mat{\'{u}}s Mihal{\'{a}}k and
Peter Widmayer},
title = {A polygon is determined by its angles},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {418--426},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.04.003},
doi = {10.1016/J.COMGEO.2011.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DisserMW11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Duncan11,
author = {Christian A. Duncan},
title = {On graph thickness, geometric thickness, and separator theorems},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {95--99},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.005},
doi = {10.1016/J.COMGEO.2010.09.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Duncan11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherJLN11,
author = {Stephane Durocher and
Krishnam Raju Jampani and
Anna Lubiw and
Lata Narayanan},
title = {Modelling gateway placement in wireless networks: Geometric k-centres
of unit disc graphs},
journal = {Comput. Geom.},
volume = {44},
number = {5},
pages = {286--302},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.12.003},
doi = {10.1016/J.COMGEO.2010.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherJLN11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ElbassioniT11,
author = {Khaled M. Elbassioni and
Hans Raj Tiwary},
title = {On a cone covering problem},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {129--134},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.07.004},
doi = {10.1016/J.COMGEO.2010.07.004},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ElbassioniT11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Evans11,
author = {William Evans},
title = {Guest Editor's foreword},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {69},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.002},
doi = {10.1016/J.COMGEO.2010.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Evans11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FowlerJKS11,
author = {J. Joseph Fowler and
Michael J{\"{u}}nger and
Stephen G. Kobourov and
Michael Schulz},
title = {Characterizations of restricted pairs of planar graphs allowing simultaneous
embedding with fixed edges},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {385--398},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.02.002},
doi = {10.1016/J.COMGEO.2011.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FowlerJKS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FratiK11,
author = {Fabrizio Frati and
Michael Kaufmann},
title = {Polynomial area bounds for {MST} embeddings of trees},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {529--543},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.005},
doi = {10.1016/J.COMGEO.2011.05.005},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FratiK11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FulekP11,
author = {Radoslav Fulek and
J{\'{a}}nos Pach},
title = {A computational approach to Conway's thrackle conjecture},
journal = {Comput. Geom.},
volume = {44},
number = {6-7},
pages = {345--355},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.02.001},
doi = {10.1016/J.COMGEO.2011.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FulekP11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GencEH11,
author = {Burkay Gen{\c{c}} and
Cem Evrendilek and
Brahim Hnich},
title = {Covering points with orthogonally convex polygons},
journal = {Comput. Geom.},
volume = {44},
number = {5},
pages = {249--264},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.12.001},
doi = {10.1016/J.COMGEO.2010.12.001},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GencEH11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Hougardy11,
author = {Stefan Hougardy},
title = {On packing squares into a rectangle},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {456--463},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.001},
doi = {10.1016/J.COMGEO.2011.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Hougardy11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Jiang11,
author = {Minghui Jiang},
title = {An inequality on the edge lengths of triangular meshes},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {100--103},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.006},
doi = {10.1016/J.COMGEO.2010.09.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Jiang11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaplanRS11,
author = {Haim Kaplan and
Natan Rubin and
Micha Sharir},
title = {A kinetic triangulation scheme for moving points in the plane},
journal = {Comput. Geom.},
volume = {44},
number = {4},
pages = {191--205},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.11.001},
doi = {10.1016/J.COMGEO.2010.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KaplanRS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Karavelas11,
author = {Menelaos I. Karavelas},
title = {Guarding curvilinear art galleries with edge or mobile guards via
2-dominance of triangulation graphs},
journal = {Comput. Geom.},
volume = {44},
number = {1},
pages = {20--51},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.07.002},
doi = {10.1016/J.COMGEO.2010.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Karavelas11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KashyapKS11,
author = {Abhishek Kashyap and
Samir Khuller and
Mark A. Shayman},
title = {Relay placement for fault tolerance in wireless networks in higher
dimensions},
journal = {Comput. Geom.},
volume = {44},
number = {4},
pages = {206--215},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.11.002},
doi = {10.1016/J.COMGEO.2010.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KashyapKS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Kreveld11,
author = {Marc J. van Kreveld},
title = {Bold graph drawings},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {499--506},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.06.002},
doi = {10.1016/J.COMGEO.2011.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Kreveld11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSSZ11,
author = {Anil Maheshwari and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Kaveh Shahbaz and
Hamid Zarrabi{-}Zadeh},
title = {Fr{\'{e}}chet distance with speed limits},
journal = {Comput. Geom.},
volume = {44},
number = {2},
pages = {110--120},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.008},
doi = {10.1016/J.COMGEO.2010.09.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSSZ11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartinW11,
author = {Shawn Martin and
Jean{-}Paul Watson},
title = {Non-manifold surface reconstruction from high-dimensional point cloud
data},
journal = {Comput. Geom.},
volume = {44},
number = {8},
pages = {427--441},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.05.002},
doi = {10.1016/J.COMGEO.2011.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MartinW11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornOS11,
author = {Kurt Mehlhorn and
Ralf Osbild and
Michael Sagraloff},
title = {A general approach to the analysis of controlled perturbation algorithms},
journal = {Comput. Geom.},
volume = {44},
number = {9},
pages = {507--528},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2011.06.001},
doi = {10.1016/J.COMGEO.2011.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MehlhornOS11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Packer11,
author = {Eli Packer},
title = {Controlled Perturbation of sets of line segments in {\(\mathbb{R}\)}\({}^{\mbox{2}}\)
with smart processing order},
journal = {Comput. Geom.},
volume = {44},
number = {5},
pages = {265--285},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.12.002},
doi = {10.1016/J.COMGEO.2010.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Packer11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SadasivamZ11,
author = {Sadish Sadasivam and
Huaming Zhang},
title = {Closed rectangle-of-influence drawings for irreducible triangulations},
journal = {Comput. Geom.},
volume = {44},
number = {1},
pages = {9--19},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.07.001},
doi = {10.1016/J.COMGEO.2010.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SadasivamZ11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/YuHW11,
author = {Chih{-}Chiang Yu and
Wing{-}Kai Hon and
Biing{-}Feng Wang},
title = {Improved data structures for the orthogonal range successor problem},
journal = {Comput. Geom.},
volume = {44},
number = {3},
pages = {148--159},
year = {2011},
url = {https://doi.org/10.1016/j.comgeo.2010.09.001},
doi = {10.1016/J.COMGEO.2010.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/YuHW11.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamBG10,
author = {Mohammad Ali Abam and
Mark de Berg and
Joachim Gudmundsson},
title = {A simple and efficient kinetic spanner},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {251--256},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.01.008},
doi = {10.1016/J.COMGEO.2009.01.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbamBG10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AfshaniHZ10,
author = {Peyman Afshani and
Chris H. Hamilton and
Norbert Zeh},
title = {A general approach for cache-oblivious range reporting and approximate
range counting},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {700--712},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.003},
doi = {10.1016/J.COMGEO.2010.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AfshaniHZ10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBKNS10,
author = {Hee{-}Kap Ahn and
Peter Brass and
Christian Knauer and
Hyeon{-}Suk Na and
Chan{-}Su Shin},
title = {Covering a simple polygon by monotone directions},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {514--523},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.11.002},
doi = {10.1016/J.COMGEO.2009.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBKNS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAAHJPR10,
author = {Oswin Aichholzer and
Wolfgang Aigner and
Franz Aurenhammer and
Thomas Hackl and
Bert J{\"{u}}ttler and
Elisabeth Pilgerstorfer and
Margot Rabl},
title = {Divide-and-conquer for Voronoi diagrams revisited},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {688--699},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.004},
doi = {10.1016/J.COMGEO.2010.04.004},
timestamp = {Mon, 03 Jan 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAAHJPR10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlonsoR10,
author = {Laurent Alonso and
Edward M. Reingold},
title = {Bounds for cops and robber pursuit},
journal = {Comput. Geom.},
volume = {43},
number = {9},
pages = {749--766},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.02.002},
doi = {10.1016/J.COMGEO.2010.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlonsoR10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCCHLOP10,
author = {Greg Aloupis and
Jean Cardinal and
S{\'{e}}bastien Collette and
Ferran Hurtado and
Stefan Langerman and
Joseph O'Rourke and
Bel{\'{e}}n Palop},
title = {Highway hull revisited},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {115--130},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.001},
doi = {10.1016/J.COMGEO.2009.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisCCHLOP10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AltSS10,
author = {Helmut Alt and
Ludmila Scharf and
Daria Schymura},
title = {Probabilistic matching of planar regions},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {99--114},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.04.006},
doi = {10.1016/J.COMGEO.2009.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AltSS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlvarezS10,
author = {Victor Alvarez and
Raimund Seidel},
title = {Approximating the minimum weight spanning tree of a set of points
in the Hausdorff metric},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {94--98},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.04.005},
doi = {10.1016/J.COMGEO.2009.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlvarezS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinMP10,
author = {Esther M. Arkin and
Joseph S. B. Mitchell and
Valentin Polishchuk},
title = {Maximum thick paths in static and dynamic environments},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {279--294},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.02.007},
doi = {10.1016/J.COMGEO.2009.02.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinMP10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BagnaraHZ10,
author = {Roberto Bagnara and
Patricia M. Hill and
Enea Zaffanella},
title = {Exact join detection for convex polyhedra and other numerical abstractions},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {453--473},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.09.002},
doi = {10.1016/J.COMGEO.2009.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BagnaraHZ10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BasitMRR10,
author = {Abdul Basit and
Nabil H. Mustafa and
Saurabh Ray and
Sarfraz Raza},
title = {Centerpoints and Tverberg's technique},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {593--600},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.03.002},
doi = {10.1016/J.COMGEO.2010.03.002},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BasitMRR10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BatistaMPS10,
author = {Vicente H. F. Batista and
David L. Millman and
Sylvain Pion and
Johannes Singler},
title = {Parallel geometric algorithms for multi-core computers},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {663--677},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.008},
doi = {10.1016/J.COMGEO.2010.04.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BatistaMPS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeenNPW10,
author = {Ken Been and
Martin N{\"{o}}llenburg and
Sheung{-}Hung Poon and
Alexander Wolff},
title = {Optimizing active ranges for consistent dynamic map labeling},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {312--328},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.03.006},
doi = {10.1016/J.COMGEO.2009.03.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeenNPW10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ben-DanPZ10,
author = {Itay Ben{-}Dan and
Rom Pinchasi and
Ran Ziv},
title = {On a problem about quadrant-depth},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {587--592},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.02.001},
doi = {10.1016/J.COMGEO.2010.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ben-DanPZ10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BerberichKS10,
author = {Eric Berberich and
Michael Kerber and
Michael Sagraloff},
title = {An efficient algorithm for the stratification and triangulation of
an algebraic surface},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {257--278},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.01.009},
doi = {10.1016/J.COMGEO.2009.01.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BerberichKS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergCHLT10,
author = {Mark de Berg and
Otfried Cheong and
Herman J. Haverkort and
Jung Gun Lim and
Laura Toma},
title = {The complexity of flow on fat terrains and its i/o-efficient computation},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {331--356},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2008.12.008},
doi = {10.1016/J.COMGEO.2008.12.008},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BergCHLT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG10,
author = {Mark de Berg and
Chris Gray},
title = {Decompositions and boundary coverings of non-convex fat polyhedra},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {73--83},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.04.003},
doi = {10.1016/J.COMGEO.2009.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergG10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergG10a,
author = {Mark de Berg and
Chris Gray},
title = {Computing the visibility map of fat objects},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {410--418},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2008.12.010},
doi = {10.1016/J.COMGEO.2008.12.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergG10a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHTT10,
author = {Mark de Berg and
Herman J. Haverkort and
Shripad Thite and
Laura Toma},
title = {Star-quadtrees and guard-quadtrees: I/O-efficient indexes for fat
triangulations and low-density planar subdivisions},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {493--513},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.11.001},
doi = {10.1016/J.COMGEO.2009.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergHTT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciGDEFKL10,
author = {Carla Binucci and
Emilio Di Giacomo and
Walter Didimo and
Alejandro Estrella{-}Balderrama and
Fabrizio Frati and
Stephen G. Kobourov and
Giuseppe Liotta},
title = {Upward straight-line embeddings of directed graphs into point sets},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {219--232},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.07.002},
doi = {10.1016/J.COMGEO.2009.07.002},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BinucciGDEFKL10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BorradaileLS10,
author = {Glencora Borradaile and
James R. Lee and
Anastasios Sidiropoulos},
title = {Randomly removing g handles at once},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {655--662},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.007},
doi = {10.1016/J.COMGEO.2010.04.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BorradaileLS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BringmannF10,
author = {Karl Bringmann and
Tobias Friedrich},
title = {Approximating the volume of unions and intersections of high-dimensional
geometric objects},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {601--610},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.03.004},
doi = {10.1016/J.COMGEO.2010.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BringmannF10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarrSP10,
author = {Hamish A. Carr and
Jack Snoeyink and
Michiel van de Panne},
title = {Flexible isosurfaces: Simplifying and displaying scalar topology using
the contour tree},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {42--58},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2006.05.009},
doi = {10.1016/J.COMGEO.2006.05.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarrSP10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaryRSV10,
author = {Matthew Cary and
Atri Rudra and
Ashish Sabharwal and
Erik Vee},
title = {Floodlight illumination of infinite wedges},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {23--34},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2007.01.004},
doi = {10.1016/J.COMGEO.2007.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CaryRSV10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ceyhan10,
author = {Elvan Ceyhan},
title = {Extension of one-dimensional proximity regions to higher dimensions},
journal = {Comput. Geom.},
volume = {43},
number = {9},
pages = {721--748},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.05.002},
doi = {10.1016/J.COMGEO.2010.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ceyhan10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersVELLT10,
author = {Erin W. Chambers and
{\'{E}}ric Colin de Verdi{\`{e}}re and
Jeff Erickson and
Sylvain Lazard and
Francis Lazarus and
Shripad Thite},
title = {Homotopic Fr{\'{e}}chet distance between curves or, walking your
dog in the woods in polynomial time},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {295--311},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.02.008},
doi = {10.1016/J.COMGEO.2009.02.008},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChambersVELLT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan10,
author = {Timothy M. Chan},
title = {A (slightly) faster algorithm for Klee's measure problem},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {243--250},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.01.007},
doi = {10.1016/J.COMGEO.2009.01.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Chan10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChanC10,
author = {Timothy M. Chan and
Eric Y. Chen},
title = {Optimal in-place and cache-oblivious algorithms for 3-d convex hulls
and 2-d segment intersection},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {636--646},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.005},
doi = {10.1016/J.COMGEO.2010.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChanC10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenF10,
author = {Chao Chen and
Daniel Freedman},
title = {Measuring and computing natural generators for homology groups},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {169--181},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.004},
doi = {10.1016/J.COMGEO.2009.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenF10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChernovSR10,
author = {Nikolai I. Chernov and
Yu. G. Stoyan and
Tatiana E. Romanova},
title = {Mathematical model and efficient algorithms for object packing problem},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {535--553},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.12.003},
doi = {10.1016/J.COMGEO.2009.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChernovSR10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DasDN10,
author = {Gautam K. Das and
Sandip Das and
Subhas C. Nandy},
title = {Homogeneous 2-hop broadcast in 2D},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {182--190},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.005},
doi = {10.1016/J.COMGEO.2009.06.005},
timestamp = {Wed, 31 Mar 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DasDN10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FeketeS10,
author = {S{\'{a}}ndor P. Fekete and
Christiane Schmidt},
title = {Polygon exploration with time-discrete vision},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {148--168},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.003},
doi = {10.1016/J.COMGEO.2009.06.003},
timestamp = {Wed, 07 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FeketeS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FonsecaM10,
author = {Guilherme Dias da Fonseca and
David M. Mount},
title = {Approximate range searching: The absolute model},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {434--444},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2008.09.009},
doi = {10.1016/J.COMGEO.2008.09.009},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FonsecaM10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FriedlerM10,
author = {Sorelle A. Friedler and
David M. Mount},
title = {Approximation algorithm for the kinetic robust K-center problem},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {572--586},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.01.001},
doi = {10.1016/J.COMGEO.2010.01.001},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/FriedlerM10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrilliHLMW10,
author = {Luca Grilli and
Seok{-}Hee Hong and
Giuseppe Liotta and
Henk Meijer and
Stephen K. Wismath},
title = {Matched drawability of graph pairs and of graph triples},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {611--634},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.03.005},
doi = {10.1016/J.COMGEO.2010.03.005},
timestamp = {Thu, 27 Apr 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GrilliHLMW10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HasheminezhadHMT10,
author = {Mahdieh Hasheminezhad and
S. Mehdi Hashemi and
Brendan D. McKay and
Maryam Tahmasbi},
title = {Rectangular-radial drawings of cubic plane graphs},
journal = {Comput. Geom.},
volume = {43},
number = {9},
pages = {767--780},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.06.001},
doi = {10.1016/J.COMGEO.2010.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HasheminezhadHMT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HaverkortW10,
author = {Herman J. Haverkort and
Freek van Walderveen},
title = {Locality and bounding-box quality of two-dimensional space-filling
curves},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {131--147},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.002},
doi = {10.1016/J.COMGEO.2009.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HaverkortW10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannST10,
author = {Michael Hoffmann and
Bettina Speckmann and
Csaba D. T{\'{o}}th},
title = {Pointed binary encompassing trees: Simple and optimal},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {35--41},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2006.12.005},
doi = {10.1016/J.COMGEO.2006.12.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HoffmannST10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HongN10,
author = {Seok{-}Hee Hong and
Hiroshi Nagamochi},
title = {An algorithm for constructing star-shaped drawings of plane graphs},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {191--206},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.008},
doi = {10.1016/J.COMGEO.2009.06.008},
timestamp = {Thu, 27 Apr 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/HongN10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Iacono10,
author = {John Iacono},
title = {Editorial},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {1},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.03.003},
doi = {10.1016/J.COMGEO.2009.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Iacono10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ImaiKMRT10,
author = {Keiko Imai and
Akitoshi Kawamura and
Jir{\'{\i}} Matousek and
Daniel Reem and
Takeshi Tokuyama},
title = {Distance k-sectors exist},
journal = {Comput. Geom.},
volume = {43},
number = {9},
pages = {713--720},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.05.001},
doi = {10.1016/J.COMGEO.2010.05.001},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ImaiKMRT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JimenezSF10,
author = {Juan Jos{\'{e}} Jim{\'{e}}nez{-}Delgado and
Rafael Jes{\'{u}}s Segura and
Francisco R. Feito},
title = {A robust segment/triangle intersection algorithm for interference
tests. Efficiency study},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {474--492},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.10.001},
doi = {10.1016/J.COMGEO.2009.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/JimenezSF10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldLS10,
author = {Marc J. van Kreveld and
Maarten L{\"{o}}ffler and
Rodrigo I. Silveira},
title = {Optimization for first order Delaunay triangulations},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {377--394},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.01.010},
doi = {10.1016/J.COMGEO.2009.01.010},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KreveldLS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lazard10,
author = {Sylvain Lazard},
title = {Editorial},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {67},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.006},
doi = {10.1016/J.COMGEO.2009.06.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Lazard10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LofflerK10,
author = {Maarten L{\"{o}}ffler and
Marc J. van Kreveld},
title = {Largest bounding box, smallest diameter, and related problems on imprecise
points},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {419--433},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.03.007},
doi = {10.1016/J.COMGEO.2009.03.007},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/LofflerK10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/LofflerS10,
author = {Maarten L{\"{o}}ffler and
Jack Snoeyink},
title = {Delaunay triangulation of imprecise points in linear time after preprocessing},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {234--242},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2008.12.007},
doi = {10.1016/J.COMGEO.2008.12.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/LofflerS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MatijevicO10,
author = {Domagoj Matijevic and
Ralf Osbild},
title = {Finding the Theta-guarded region},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {207--218},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.07.001},
doi = {10.1016/J.COMGEO.2009.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MatijevicO10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornS10,
author = {Kurt Mehlhorn and
J{\"{o}}rg{-}R{\"{u}}diger Sack},
title = {Editorial},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {555},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.03.001},
doi = {10.1016/J.COMGEO.2010.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MehlhornS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MillerS10,
author = {Gary L. Miller and
Donald R. Sheehy},
title = {Approximate centerpoints with proofs},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {647--654},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.006},
doi = {10.1016/J.COMGEO.2010.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MillerS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Muller-HannemannT10,
author = {Matthias M{\"{u}}ller{-}Hannemann and
Siamak Tazari},
title = {A near linear time approximation scheme for Steiner tree among obstacles
in the plane},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {395--409},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.01.011},
doi = {10.1016/J.COMGEO.2009.01.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Muller-HannemannT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR10,
author = {Nabil H. Mustafa and
Saurabh Ray},
title = {Reprint of: Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon))
in any dimension},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {565--571},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2007.02.007},
doi = {10.1016/J.COMGEO.2007.02.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MustafaR10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PaninaS10,
author = {Gaiane Panina and
Ileana Streinu},
title = {Flattening single-vertex origami: The non-expansive case},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {678--687},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.002},
doi = {10.1016/J.COMGEO.2010.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PaninaS10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RemySW10,
author = {Jan Remy and
Reto Sp{\"{o}}hel and
Andreas Wei{\ss}l},
title = {On Euclidean vehicle routing with allocation},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {357--376},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2008.12.009},
doi = {10.1016/J.COMGEO.2008.12.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RemySW10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Seidel10,
author = {Raimund Seidel},
title = {Reprint of: {A} simple and fast incremental randomized algorithm for
computing trapezoidal decompositions and for triangulating polygons},
journal = {Comput. Geom.},
volume = {43},
number = {6-7},
pages = {556--564},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.03.003},
doi = {10.1016/J.COMGEO.2010.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Seidel10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SteffensT10,
author = {Reinhard Steffens and
Thorsten Theobald},
title = {Mixed volume techniques for embeddings of Laman graphs},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {84--93},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.04.004},
doi = {10.1016/J.COMGEO.2009.04.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SteffensT10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Teillaud10,
author = {Monique Teillaud},
title = {Foreword},
journal = {Comput. Geom.},
volume = {43},
number = {3},
pages = {233},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.04.001},
doi = {10.1016/J.COMGEO.2009.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Teillaud10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Toussaint10,
author = {Godfried T. Toussaint},
title = {Computational geometric aspects of rhythm, melody, and voice-leading},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {2--22},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2007.01.003},
doi = {10.1016/J.COMGEO.2007.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Toussaint10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/VanderZeeHZG10,
author = {Evan VanderZee and
Anil N. Hirani and
Vadim Zharnitsky and
Damrong Guoy},
title = {A dihedral acute triangulation of the cube},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {445--452},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.09.001},
doi = {10.1016/J.COMGEO.2009.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/VanderZeeHZG10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WenkZ10,
author = {Carola Wenk and
Afra Zomorodian},
title = {Guest Editors' foreword},
journal = {Comput. Geom.},
volume = {43},
number = {8},
pages = {635},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2010.04.001},
doi = {10.1016/J.COMGEO.2010.04.001},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WenkZ10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen10,
author = {Christian Wulff{-}Nilsen},
title = {Computing the dilation of edge-augmented graphs in metric spaces},
journal = {Comput. Geom.},
volume = {43},
number = {2},
pages = {68--72},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.03.008},
doi = {10.1016/J.COMGEO.2009.03.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/XuX10,
author = {Guang Xu and
Jinhui Xu},
title = {Efficient approximation algorithms for clustering point-sets},
journal = {Comput. Geom.},
volume = {43},
number = {1},
pages = {59--66},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2007.12.002},
doi = {10.1016/J.COMGEO.2007.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/XuX10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Zeh10,
author = {Norbert Zeh},
title = {Editorial},
journal = {Comput. Geom.},
volume = {43},
number = {4},
pages = {329--330},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.06.007},
doi = {10.1016/J.COMGEO.2009.06.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Zeh10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZhangW10,
author = {Heping Zhang and
Guangfu Wang},
title = {Embeddability of open-ended carbon nanotubes in hypercubes},
journal = {Comput. Geom.},
volume = {43},
number = {5},
pages = {524--534},
year = {2010},
url = {https://doi.org/10.1016/j.comgeo.2009.12.001},
doi = {10.1016/J.COMGEO.2009.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZhangW10.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbbottBCDDHKLNRSY09,
author = {Timothy G. Abbott and
Michael A. Burr and
Timothy M. Chan and
Erik D. Demaine and
Martin L. Demaine and
John Hugg and
Daniel Kane and
Stefan Langerman and
Jelani Nelson and
Eynat Rafalin and
Kathryn Seyboth and
Vincent Yeung},
title = {Dynamic ham-sandwich cuts in the plane},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {419--428},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.008},
doi = {10.1016/J.COMGEO.2008.09.008},
timestamp = {Thu, 04 Apr 2024 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AbbottBCDDHKLNRSY09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AckermanAK09,
author = {Eyal Ackerman and
Oswin Aichholzer and
Bal{\'{a}}zs Keszegh},
title = {Improved upper bounds on the reflexivity of point sets},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {241--249},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.05.004},
doi = {10.1016/J.COMGEO.2008.05.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AckermanAK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhmedL09,
author = {Mustaq Ahmed and
Anna Lubiw},
title = {Shortest descending paths through given faces},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {464--470},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2007.10.011},
doi = {10.1016/J.COMGEO.2007.10.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhmedL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBNS09,
author = {Hee{-}Kap Ahn and
Peter Brass and
Hyeon{-}Suk Na and
Chan{-}Su Shin},
title = {On the minimum total length of interval systems expressing all intervals,
and range-restricted queries},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {207--213},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.03.004},
doi = {10.1016/J.COMGEO.2008.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBNS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerA09,
author = {Oswin Aichholzer and
Franz Aurenhammer},
title = {Editorial},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {723},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.003},
doi = {10.1016/J.COMGEO.2009.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerA09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAHS09,
author = {Oswin Aichholzer and
Franz Aurenhammer and
Thomas Hackl and
Bettina Speckmann},
title = {On minimum weight pseudo-triangulations},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {627--631},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.002},
doi = {10.1016/J.COMGEO.2008.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAHS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerBDGHHKMRSSUW09,
author = {Oswin Aichholzer and
Sergey Bereg and
Adrian Dumitrescu and
Alfredo Garc{\'{\i}}a Olaverri and
Clemens Huemer and
Ferran Hurtado and
Mikio Kano and
Alberto M{\'{a}}rquez and
David Rappaport and
Shakhar Smorodinsky and
Diane L. Souvaine and
Jorge Urrutia and
David R. Wood},
title = {Compatible geometric matchings},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {617--626},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.005},
doi = {10.1016/J.COMGEO.2008.12.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerBDGHHKMRSSUW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerMFHHU09,
author = {Oswin Aichholzer and
Ruy Fabila Monroy and
David Flores{-}Pe{\~{n}}aloza and
Thomas Hackl and
Clemens Huemer and
Jorge Urrutia},
title = {Empty monochromatic triangles},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {934--938},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.04.002},
doi = {10.1016/J.COMGEO.2009.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerMFHHU09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisCDDFLORAW09,
author = {Greg Aloupis and
S{\'{e}}bastien Collette and
Mirela Damian and
Erik D. Demaine and
Robin Y. Flatland and
Stefan Langerman and
Joseph O'Rourke and
Suneeta Ramaswami and
Vera Sacrist{\'{a}}n Adinolfi and
Stefanie Wuhrer},
title = {Linear reconfiguration of cube-style modular robots},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {652--663},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.11.003},
doi = {10.1016/J.COMGEO.2008.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisCDDFLORAW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ArkinFIMMRPRX09,
author = {Esther M. Arkin and
S{\'{a}}ndor P. Fekete and
Kamrul Islam and
Henk Meijer and
Joseph S. B. Mitchell and
Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and
Valentin Polishchuk and
David Rappaport and
Henry Xiao},
title = {Not being (super)thin or solid is hard: {A} study of grid Hamiltonicity},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {582--605},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.11.004},
doi = {10.1016/J.COMGEO.2008.11.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ArkinFIMMRPRX09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovAHLRSS09,
author = {Boris Aronov and
Franz Aurenhammer and
Ferran Hurtado and
Stefan Langerman and
David Rappaport and
Carlos Seara and
Shakhar Smorodinsky},
title = {Small weak epsilon-nets},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {455--462},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.02.005},
doi = {10.1016/J.COMGEO.2008.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovAHLRSS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AsanoBCMSSW09,
author = {Tetsuo Asano and
Prosenjit Bose and
Paz Carmi and
Anil Maheshwari and
Chang Shu and
Michiel H. M. Smid and
Stefanie Wuhrer},
title = {A linear-space algorithm for distance preserving graph embedding},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {289--304},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.004},
doi = {10.1016/J.COMGEO.2008.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AsanoBCMSSW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BaeLACC09,
author = {Sang Won Bae and
Chunseok Lee and
Hee{-}Kap Ahn and
Sunghee Choi and
Kyung{-}Yong Chwa},
title = {Computing minimum-area rectilinear convex hull and L-shape},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {903--912},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.006},
doi = {10.1016/J.COMGEO.2009.02.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BaeLACC09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkocziBDS09,
author = {Robert Benkoczi and
Binay K. Bhattacharya and
Sandip Das and
Jeff Sember},
title = {Single facility collection depots location problem in the plane},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {403--418},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.004},
doi = {10.1016/J.COMGEO.2008.04.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BenkocziBDS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bereg09,
author = {Sergey Bereg},
title = {Orthogonal equipartitions},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {305--314},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.004},
doi = {10.1016/J.COMGEO.2008.09.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bereg09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregMW09,
author = {Sergey Bereg and
Nikolaus Mutsanas and
Alexander Wolff},
title = {Matching points with rectangles and squares},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {93--108},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.05.001},
doi = {10.1016/J.COMGEO.2008.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeregMW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHS09,
author = {Mark de Berg and
Herman J. Haverkort and
Micha Streppel},
title = {Efficient c-oriented range searching with DOP-trees},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {250--267},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.05.002},
doi = {10.1016/J.COMGEO.2008.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergHS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BiedlLS09,
author = {Therese C. Biedl and
Anna Lubiw and
Michael J. Spriggs},
title = {Morphing polyhedra with parallel faces: Counterexamples},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {395--402},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.006},
doi = {10.1016/J.COMGEO.2008.09.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BiedlLS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BodlaenderFGPSW09,
author = {Hans L. Bodlaender and
Corinne Feremans and
Alexander Grigoriev and
Eelko Penninkx and
Ren{\'{e}} Sitters and
Thomas Wolle},
title = {On the minimum corridor connection problem and other generalized geometric
problems},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {939--951},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.05.001},
doi = {10.1016/J.COMGEO.2009.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BodlaenderFGPSW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseCCMSZ09,
author = {Prosenjit Bose and
Paz Carmi and
Mathieu Couture and
Anil Maheshwari and
Michiel H. M. Smid and
Norbert Zeh},
title = {Geometric spanners with small chromatic number},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {134--146},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.003},
doi = {10.1016/J.COMGEO.2008.04.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseCCMSZ09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseH09,
author = {Prosenjit Bose and
Ferran Hurtado},
title = {Flips in planar graphs},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {60--80},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.001},
doi = {10.1016/J.COMGEO.2008.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseH09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseM09,
author = {Prosenjit Bose and
Asish Mukhopadhyay},
title = {Editorial {CCCG} 2005},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {363},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.001},
doi = {10.1016/J.COMGEO.2008.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseM09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMSW09,
author = {Prosenjit Bose and
Pat Morin and
Michiel H. M. Smid and
Stefanie Wuhrer},
title = {Rotationally monotone polygons},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {471--483},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2007.02.004},
doi = {10.1016/J.COMGEO.2007.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseMSW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassKNS09,
author = {Peter Brass and
Kyue D. Kim and
Hyeon{-}Suk Na and
Chan{-}Su Shin},
title = {Escaping offline searchers and isoperimetric theorems},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {119--126},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.08.001},
doi = {10.1016/J.COMGEO.2008.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BrassKNS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinRUW09,
author = {Kevin Buchin and
Andreas Razen and
Takeaki Uno and
Uli Wagner},
title = {Transforming spanning trees: {A} lower bound},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {724--730},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.03.005},
doi = {10.1016/J.COMGEO.2008.03.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinRUW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Buzer09,
author = {Lilian Buzer},
title = {Optimal simplification of polygonal chains for subpixel-accurate rendering},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {45--59},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.03.002},
doi = {10.1016/J.COMGEO.2008.03.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Buzer09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloK09,
author = {Sergio Cabello and
Christian Knauer},
title = {Algorithms for graphs of bounded treewidth via orthogonal range searching},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {815--824},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.001},
doi = {10.1016/J.COMGEO.2009.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CapposEFK09,
author = {Justin Cappos and
Alejandro Estrella{-}Balderrama and
J. Joseph Fowler and
Stephen G. Kobourov},
title = {Simultaneous graph embedding with bends and circular arcs},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {173--182},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.05.003},
doi = {10.1016/J.COMGEO.2008.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CapposEFK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCL09,
author = {Jean Cardinal and
S{\'{e}}bastien Collette and
Stefan Langerman},
title = {Empty region graphs},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {183--195},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.003},
doi = {10.1016/J.COMGEO.2008.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalCL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CastroCLT09,
author = {Pedro Machado Manh{\~{a}}es de Castro and
Fr{\'{e}}d{\'{e}}ric Cazals and
S{\'{e}}bastien Loriot and
Monique Teillaud},
title = {Design of the {CGAL} 3D Spherical Kernel and application to arrangements
of circles on a sphere},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {536--550},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.003},
doi = {10.1016/J.COMGEO.2008.10.003},
timestamp = {Mon, 05 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CastroCLT09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CazalsL09,
author = {Fr{\'{e}}d{\'{e}}ric Cazals and
S{\'{e}}bastien Loriot},
title = {Computing the arrangement of circles on a sphere, with applications
in structural biology},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {551--565},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.004},
doi = {10.1016/J.COMGEO.2008.10.004},
timestamp = {Mon, 05 Feb 2024 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CazalsL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChaudhuriK09,
author = {Siddhartha Chaudhuri and
Vladlen Koltun},
title = {Smoothed analysis of probabilistic roadmaps},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {731--747},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.005},
doi = {10.1016/J.COMGEO.2008.10.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChaudhuriK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazalCL09,
author = {Fr{\'{e}}d{\'{e}}ric Chazal and
David Cohen{-}Steiner and
Andr{\'{e}} Lieutier},
title = {Normal cone approximation and offset shape isotopy},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {566--581},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.002},
doi = {10.1016/J.COMGEO.2008.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChazalCL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChenHL09,
author = {Chieh{-}Yu Chen and
Ya{-}Fei Hung and
Hsueh{-}I Lu},
title = {Visibility representations of four-connected plane graphs with near
optimal heights},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {865--872},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.006},
doi = {10.1016/J.COMGEO.2009.01.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChenHL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengS09,
author = {Ho{-}Lun Cheng and
Xinwei Shi},
title = {Quality mesh generation for molecular skin surfaces using restricted
union of balls},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {196--206},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.001},
doi = {10.1016/J.COMGEO.2008.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChengS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineDIL09,
author = {Erik D. Demaine and
Martin L. Demaine and
John Iacono and
Stefan Langerman},
title = {Wrapping spheres with flat paper},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {748--757},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.10.006},
doi = {10.1016/J.COMGEO.2008.10.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineDIL09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemaineGMRTTWW09,
author = {Erik D. Demaine and
Francisco Gomez{-}Martin and
Henk Meijer and
David Rappaport and
Perouz Taslakian and
Godfried T. Toussaint and
Terry Winograd and
David R. Wood},
title = {The distance geometry of music},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {429--454},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.005},
doi = {10.1016/J.COMGEO.2008.04.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemaineGMRTTWW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DemouthDEGLS09,
author = {Julien Demouth and
Olivier Devillers and
Hazel Everett and
Marc Glisse and
Sylvain Lazard and
Raimund Seidel},
title = {On the complexity of umbra and penumbra},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {758--771},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.007},
doi = {10.1016/J.COMGEO.2008.04.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DemouthDEGLS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DimitrovKKR09,
author = {Darko Dimitrov and
Christian Knauer and
Klaus Kriegel and
G{\"{u}}nter Rote},
title = {Bounds on the quality of the {PCA} bounding boxes},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {772--789},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.02.007},
doi = {10.1016/J.COMGEO.2008.02.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DimitrovKKR09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DoraiswamyN09,
author = {Harish Doraiswamy and
Vijay Natarajan},
title = {Efficient algorithms for computing Reeb graphs},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {606--616},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.003},
doi = {10.1016/J.COMGEO.2008.12.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DoraiswamyN09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DurocherK09,
author = {Stephane Durocher and
David G. Kirkpatrick},
title = {The projection median of a set of points},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {364--375},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.006},
doi = {10.1016/J.COMGEO.2008.06.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DurocherK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EgebladNB09,
author = {Jens Egeblad and
Benny K. Nielsen and
Marcus Brazil},
title = {Translational packing of arbitrary polytopes},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {269--288},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.003},
doi = {10.1016/J.COMGEO.2008.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EgebladNB09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinKMS09,
author = {David Eppstein and
Marc J. van Kreveld and
Elena Mumford and
Bettina Speckmann},
title = {Edges and switches, tunnels and bridges},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {790--802},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.05.005},
doi = {10.1016/J.COMGEO.2008.05.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EppsteinKMS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Estrella-BalderramaFK09,
author = {Alejandro Estrella{-}Balderrama and
J. Joseph Fowler and
Stephen G. Kobourov},
title = {Characterization of unlabeled level planar trees},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {704--721},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.006},
doi = {10.1016/J.COMGEO.2008.12.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Estrella-BalderramaFK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EverettLLZ09,
author = {Hazel Everett and
Sylvain Lazard and
William J. Lenhart and
Linqiao Zhang},
title = {On the degree of standard geometric predicates for line transversals
in 3D},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {484--494},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2007.11.002},
doi = {10.1016/J.COMGEO.2007.11.002},
timestamp = {Tue, 20 Sep 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EverettLLZ09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Figueroa09,
author = {Ana Paulina Figueroa},
title = {A note on a theorem of Perles concerning non-crossing paths in convex
geometric graphs},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {90--91},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.07.002},
doi = {10.1016/J.COMGEO.2008.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Figueroa09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FranekM09,
author = {Vojtech Franek and
Jir{\'{\i}} Matousek},
title = {Computing D-convex hulls in the plane},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {81--89},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.03.003},
doi = {10.1016/J.COMGEO.2008.03.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FranekM09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GarciaHHTV09,
author = {Alfredo Garc{\'{\i}}a Olaverri and
Ferran Hurtado and
Clemens Huemer and
Javier Tejel and
Pavel Valtr},
title = {On triconnected and cubic plane graphs on given point sets},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {913--922},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.03.005},
doi = {10.1016/J.COMGEO.2009.03.005},
timestamp = {Tue, 27 Dec 2022 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GarciaHHTV09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiacomoDLMW09,
author = {Emilio Di Giacomo and
Walter Didimo and
Giuseppe Liotta and
Henk Meijer and
Stephen K. Wismath},
title = {Point-set embeddings of trees with given partial drawings},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {664--676},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.001},
doi = {10.1016/J.COMGEO.2009.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiacomoDLMW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonKMOW09,
author = {Joachim Gudmundsson and
Jyrki Katajainen and
Damian Merrick and
Cahya Ong and
Thomas Wolle},
title = {Compressing spatio-temporal trajectories},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {825--841},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.002},
doi = {10.1016/J.COMGEO.2009.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonKMOW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonKN09,
author = {Joachim Gudmundsson and
Marc J. van Kreveld and
Giri Narasimhan},
title = {Region-restricted clustering for geographic data mining},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {231--240},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.08.003},
doi = {10.1016/J.COMGEO.2008.08.003},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonKN09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/InkuluK09,
author = {Rajasekhar Inkulu and
Sanjiv Kapoor},
title = {Visibility queries in a polygonal region},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {852--864},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.004},
doi = {10.1016/J.COMGEO.2009.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/InkuluK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/InkuluK09a,
author = {Rajasekhar Inkulu and
Sanjiv Kapoor},
title = {Planar rectilinear shortest path computation using corridors},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {873--884},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.02.005},
doi = {10.1016/J.COMGEO.2009.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/InkuluK09a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JerseK09,
author = {Gregor Jerse and
Neza Mramor{-}Kosta},
title = {Ascending and descending regions of a discrete Morse function},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {639--651},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.11.001},
doi = {10.1016/J.COMGEO.2008.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/JerseK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/JordanS09,
author = {Tibor Jord{\'{a}}n and
Zoltan Szabadka},
title = {Operations preserving the global rigidity of graphs and frameworks
in the plane},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {511--521},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.007},
doi = {10.1016/J.COMGEO.2008.09.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/JordanS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KaravelasTT09,
author = {Menelaos I. Karavelas and
Csaba D. T{\'{o}}th and
Elias P. Tsigaridas},
title = {Guarding curvilinear art galleries with vertex or point guards},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {522--535},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.11.002},
doi = {10.1016/J.COMGEO.2008.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KaravelasTT09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinKNS09,
author = {Rolf Klein and
Christian Knauer and
Giri Narasimhan and
Michiel H. M. Smid},
title = {On the dilation spectrum of paths, cycles, and trees},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {923--933},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.03.004},
doi = {10.1016/J.COMGEO.2009.03.004},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KleinKNS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinLN09,
author = {Rolf Klein and
Elmar Langetepe and
Zahra Nilforoushan},
title = {Abstract Voronoi diagrams revisited},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {885--902},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.03.002},
doi = {10.1016/J.COMGEO.2009.03.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KleinLN09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Lucier09,
author = {Brendan Lucier},
title = {Local overlaps in special unfoldings of convex polyhedra},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {495--504},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2007.07.008},
doi = {10.1016/J.COMGEO.2007.07.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Lucier09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MartiniW09,
author = {Horst Martini and
Senlin Wu},
title = {Geometric dilation of closed curves in normed planes},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {315--321},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.001},
doi = {10.1016/J.COMGEO.2008.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MartiniW09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MehlhornSZ09,
author = {Kurt Mehlhorn and
J{\"{o}}rg{-}R{\"{u}}diger Sack and
Joseph Zaks},
title = {Note on the paper "K-vertex guarding simple polygons" [Computational
Geometry 42 {(4)} (May 2009) 352-361]},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {722},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.03.001},
doi = {10.1016/J.COMGEO.2009.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MehlhornSZ09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MeijerR09,
author = {Henk Meijer and
David Rappaport},
title = {Editorial {CCCG} 2006},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {463},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.12.004},
doi = {10.1016/J.COMGEO.2008.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MeijerR09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MeijerRR09,
author = {Henk Meijer and
Yurai N{\'{u}}{\~{n}}ez Rodr{\'{\i}}guez and
David Rappaport},
title = {Bounds for point recolouring in geometric graphs},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {690--703},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.004},
doi = {10.1016/J.COMGEO.2009.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MeijerRR09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MukkamalaS09,
author = {Padmini Mukkamala and
Mario Szegedy},
title = {Geometric representation of cubic graphs with four directions},
journal = {Comput. Geom.},
volume = {42},
number = {9},
pages = {842--851},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.005},
doi = {10.1016/J.COMGEO.2009.01.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MukkamalaS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR09,
author = {Nabil H. Mustafa and
Saurabh Ray},
title = {An optimal extension of the centerpoint theorem},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {505--510},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2007.10.004},
doi = {10.1016/J.COMGEO.2007.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MustafaR09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Nekrich09,
author = {Yakov Nekrich},
title = {Orthogonal range searching in linear and almost-linear space},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {342--351},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.001},
doi = {10.1016/J.COMGEO.2008.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Nekrich09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/NguyenBGJS09,
author = {Hoa Nguyen and
John V. Burkardt and
Max D. Gunzburger and
Lili Ju and
Yuki Saka},
title = {Constrained {CVT} meshes and a comparison of triangular mesh generators},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {1--19},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.002},
doi = {10.1016/J.COMGEO.2008.04.002},
timestamp = {Thu, 14 Oct 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/NguyenBGJS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PachT09,
author = {J{\'{a}}nos Pach and
G{\'{e}}za T{\'{o}}th},
title = {Decomposition of multiple coverings into many parts},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {127--133},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.08.002},
doi = {10.1016/J.COMGEO.2008.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PachT09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PanagiotakisAT09,
author = {Costas Panagiotakis and
Konstantin Athanassopoulos and
Georgios Tziritas},
title = {The equipartition of curves},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {677--689},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.003},
doi = {10.1016/J.COMGEO.2009.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PanagiotakisAT09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RahmanMN09,
author = {Md. Saidur Rahman and
Kazuyuki Miura and
Takao Nishizeki},
title = {Octagonal drawings of plane graphs with prescribed face areas},
journal = {Comput. Geom.},
volume = {42},
number = {3},
pages = {214--230},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.002},
doi = {10.1016/J.COMGEO.2008.09.002},
timestamp = {Tue, 21 Mar 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RahmanMN09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RamosV09,
author = {Pedro A. Ramos and
Raquel Via{\~{n}}a},
title = {Depth of segments and circles through points enclosing many points:
a note},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {338--341},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.07.001},
doi = {10.1016/J.COMGEO.2008.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RamosV09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RoyKDN09,
author = {Sasanka Roy and
Arindam Karmakar and
Sandip Das and
Subhas C. Nandy},
title = {Constrained minimum enclosing circle with center on a query line segment},
journal = {Comput. Geom.},
volume = {42},
number = {6-7},
pages = {632--638},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2009.01.002},
doi = {10.1016/J.COMGEO.2009.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RoyKDN09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rybnikov09,
author = {Konstantin A. Rybnikov},
title = {An efficient local approach to convexity testing of piecewise-linear
hypersurfaces},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {147--172},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.02.004},
doi = {10.1016/J.COMGEO.2008.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Rybnikov09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Salleh09,
author = {Ihsan Salleh},
title = {K-vertex guarding simple polygons},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {352--361},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.07.004},
doi = {10.1016/J.COMGEO.2008.07.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Salleh09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SilveiraK09,
author = {Rodrigo I. Silveira and
Marc J. van Kreveld},
title = {Towards a definition of higher order constrained Delaunay triangulations},
journal = {Comput. Geom.},
volume = {42},
number = {4},
pages = {322--337},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.09.005},
doi = {10.1016/J.COMGEO.2008.09.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SilveiraK09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SilveiraK09a,
author = {Rodrigo I. Silveira and
Marc J. van Kreveld},
title = {Optimal higher order Delaunay triangulations of polygons},
journal = {Comput. Geom.},
volume = {42},
number = {8},
pages = {803--813},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.02.006},
doi = {10.1016/J.COMGEO.2008.02.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SilveiraK09a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SouvaineT09,
author = {Diane L. Souvaine and
Csaba D. T{\'{o}}th},
title = {A vertex-face assignment for plane graphs},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {388--394},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.005},
doi = {10.1016/J.COMGEO.2008.06.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SouvaineT09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Thite09,
author = {Shripad Thite},
title = {Adaptive spacetime meshing for discontinuous Galerkin methods},
journal = {Comput. Geom.},
volume = {42},
number = {1},
pages = {20--44},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.07.003},
doi = {10.1016/J.COMGEO.2008.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Thite09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ungor09,
author = {Alper {\"{U}}ng{\"{o}}r},
title = {Off-centers: {A} new type of Steiner points for computing size-optimal
quality-guaranteed Delaunay triangulations},
journal = {Comput. Geom.},
volume = {42},
number = {2},
pages = {109--118},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.06.002},
doi = {10.1016/J.COMGEO.2008.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ungor09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WagnerDS09,
author = {David P. Wagner and
Robert L. Scot Drysdale and
Clifford Stein},
title = {An O(n\({}^{\mbox{5/2}}\)logn) algorithm for the Rectilinear Minimum
Link-Distance Problem in three dimensions},
journal = {Comput. Geom.},
volume = {42},
number = {5},
pages = {376--387},
year = {2009},
url = {https://doi.org/10.1016/j.comgeo.2008.04.006},
doi = {10.1016/J.COMGEO.2008.04.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WagnerDS09.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasBOHRRT08,
author = {Manuel Abellanas and
Prosenjit Bose and
Alfredo Garc{\'{\i}}a Olaverri and
Ferran Hurtado and
Pedro Ramos and
Eduardo Rivera{-}Campo and
Javier Tejel},
title = {On local transformations in plane geometric graphs embedded on small
grids},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {65--77},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.12.004},
doi = {10.1016/J.COMGEO.2006.12.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbellanasBOHRRT08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasOHTU08,
author = {Manuel Abellanas and
Alfredo Garc{\'{\i}}a Olaverri and
Ferran Hurtado and
Javier Tejel and
Jorge Urrutia},
title = {Augmenting the connectivity of geometric graphs},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {220--230},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.09.001},
doi = {10.1016/J.COMGEO.2007.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbellanasOHTU08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBS08,
author = {Hee{-}Kap Ahn and
Peter Brass and
Chan{-}Su Shin},
title = {Maximum overlap and minimum convex hull of two convex polyhedra under
translations},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {171--177},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.08.001},
doi = {10.1016/J.COMGEO.2007.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerAGHHHKRV08,
author = {Oswin Aichholzer and
Franz Aurenhammer and
Paola Gonzalez{-}Nava and
Thomas Hackl and
Clemens Huemer and
Ferran Hurtado and
Hannes Krasser and
Saurabh Ray and
Birgit Vogtenhuber},
title = {Matching edges and faces in polygonal partitions},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {134--141},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.002},
doi = {10.1016/J.COMGEO.2007.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerAGHHHKRV08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerHK08,
author = {Oswin Aichholzer and
Clemens Huemer and
Hannes Krasser},
title = {Triangulations without pointed spanning trees},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {79--83},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.006},
doi = {10.1016/J.COMGEO.2007.07.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerHK08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AloupisDLMOST08,
author = {Greg Aloupis and
Erik D. Demaine and
Stefan Langerman and
Pat Morin and
Joseph O'Rourke and
Ileana Streinu and
Godfried T. Toussaint},
title = {Edge-unfolding nested polyhedral bands},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {30--42},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.009},
doi = {10.1016/J.COMGEO.2007.05.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AloupisDLMOST08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCGHSV08,
author = {Boris Aronov and
Mark de Berg and
Otfried Cheong and
Joachim Gudmundsson and
Herman J. Haverkort and
Michiel H. M. Smid and
Antoine Vigneron},
title = {Sparse geometric graphs with small dilation},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {207--219},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.004},
doi = {10.1016/J.COMGEO.2007.07.004},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AronovBCGHSV08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBG08,
author = {Boris Aronov and
Mark de Berg and
Chris Gray},
title = {Ray shooting and intersection searching amidst fat convex polyhedra
in 3-space},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {68--76},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.006},
doi = {10.1016/J.COMGEO.2007.10.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovBG08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Aurenhammer08,
author = {Franz Aurenhammer},
title = {Weighted skeletons and fixed-share decomposition},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {93--101},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.08.002},
doi = {10.1016/J.COMGEO.2007.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Aurenhammer08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BadoiuC08,
author = {Mihai Badoiu and
Kenneth L. Clarkson},
title = {Optimal core-sets for balls},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {14--22},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.04.002},
doi = {10.1016/J.COMGEO.2007.04.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BadoiuC08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BarequetDS08,
author = {Gill Barequet and
Matthew T. Dickerson and
Yuval Scharf},
title = {Covering points with a polygon},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {143--162},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.001},
doi = {10.1016/J.COMGEO.2007.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BarequetDS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertGHW08,
author = {Marc Benkert and
Joachim Gudmundsson and
Herman J. Haverkort and
Alexander Wolff},
title = {Constructing minimum-interference networks},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {179--194},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.06.004},
doi = {10.1016/J.COMGEO.2007.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BenkertGHW08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertGHW08a,
author = {Marc Benkert and
Joachim Gudmundsson and
Florian H{\"{u}}bner and
Thomas Wolle},
title = {Reporting flock patterns},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {111--125},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.003},
doi = {10.1016/J.COMGEO.2007.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BenkertGHW08a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Bereg08,
author = {Sergey Bereg},
title = {Efficient algorithms for the d-dimensional rigidity matroid of sparse
graphs},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {37--44},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.11.005},
doi = {10.1016/J.COMGEO.2006.11.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Bereg08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BinucciDG08,
author = {Carla Binucci and
Walter Didimo and
Francesco Giordano},
title = {Maximum upward planar subgraphs of embedded planar digraphs},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {230--246},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2008.02.001},
doi = {10.1016/J.COMGEO.2008.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BinucciDG08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseF08,
author = {Prosenjit Bose and
Thomas Fevens},
title = {Editorial},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {1},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.06.002},
doi = {10.1016/J.COMGEO.2007.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseF08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinBW08,
author = {Kevin Buchin and
Maike Buchin and
Carola Wenk},
title = {Computing the Fr{\'{e}}chet distance between simple polygons},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {2--20},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.08.003},
doi = {10.1016/J.COMGEO.2007.08.003},
timestamp = {Sun, 12 Nov 2023 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinBW08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BuchinDGJ08,
author = {Kevin Buchin and
Tamal K. Dey and
Joachim Giesen and
Matthias John},
title = {Recursive geometry of the flow complex and topology of the flow complex
filtration},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {115--137},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.005},
doi = {10.1016/J.COMGEO.2007.05.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BuchinDGJ08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloDSSUV08,
author = {Sergio Cabello and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Carlos Seara and
Joan Antoni Sellar{\`{e}}s and
Jorge Urrutia and
Inmaculada Ventura},
title = {Covering point sets with two disjoint disks or squares},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {195--206},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.001},
doi = {10.1016/J.COMGEO.2007.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloDSSUV08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CabelloGKR08,
author = {Sergio Cabello and
Panos Giannopoulos and
Christian Knauer and
G{\"{u}}nter Rote},
title = {Matching point sets with respect to the Earth Mover's Distance},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {118--133},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.10.001},
doi = {10.1016/J.COMGEO.2006.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CabelloGKR08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CaravantesG08,
author = {Jorge Caravantes and
Laureano Gonz{\'{a}}lez{-}Vega},
title = {Improving the topology computation of an arrangement of cubics},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {206--218},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2008.03.001},
doi = {10.1016/J.COMGEO.2008.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CaravantesG08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCHLP08,
author = {Jean Cardinal and
S{\'{e}}bastien Collette and
Ferran Hurtado and
Stefan Langerman and
Bel{\'{e}}n Palop},
title = {Optimal location of transportation devices},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {219--229},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2008.01.001},
doi = {10.1016/J.COMGEO.2008.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalCHLP08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CardinalCL08,
author = {Jean Cardinal and
S{\'{e}}bastien Collette and
Stefan Langerman},
title = {Local properties of geometric graphs},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {55--64},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.011},
doi = {10.1016/J.COMGEO.2007.05.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CardinalCL08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKL08,
author = {Paz Carmi and
Matthew J. Katz and
Nissan Lev{-}Tov},
title = {Polynomial-time approximation schemes for piercing and covering with
applications in wireless networks},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {209--218},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.01.001},
doi = {10.1016/J.COMGEO.2007.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiKL08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChambersVELW08,
author = {Erin W. Chambers and
{\'{E}}ric Colin de Verdi{\`{e}}re and
Jeff Erickson and
Francis Lazarus and
Kim Whittlesey},
title = {Splitting (complicated) surfaces is hard},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {94--110},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.010},
doi = {10.1016/J.COMGEO.2007.10.010},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/ChambersVELW08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazalL08,
author = {Fr{\'{e}}d{\'{e}}ric Chazal and
Andr{\'{e}} Lieutier},
title = {Smooth manifold reconstruction from noisy and non-uniform approximation
with guarantees},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {156--170},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.001},
doi = {10.1016/J.COMGEO.2007.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChazalL08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChazelleLM08,
author = {Bernard Chazelle and
Ding Liu and
Avner Magen},
title = {Approximate range searching in higher dimension},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {24--29},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.008},
doi = {10.1016/J.COMGEO.2007.05.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChazelleLM08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ChengT08,
author = {Ho{-}Lun Cheng and
Tony Tan},
title = {Approximating polyhedral objects with deformable smooth surfaces},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {104--117},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.10.003},
doi = {10.1016/J.COMGEO.2006.10.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ChengT08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CheongHL08,
author = {Otfried Cheong and
Herman J. Haverkort and
Mira Lee},
title = {Computing a minimum-dilation spanning tree is NP-hard},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {188--205},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.12.001},
doi = {10.1016/J.COMGEO.2007.12.001},
timestamp = {Sun, 25 Jul 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/CheongHL08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianFO08,
author = {Mirela Damian and
Robin Y. Flatland and
Joseph O'Rourke},
title = {Unfolding Manhattan Towers},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {102--114},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.003},
doi = {10.1016/J.COMGEO.2007.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DamianFO08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DamianO08,
author = {Mirela Damian and
Joseph O'Rourke},
title = {On corners of objects built from parallelepiped bricks},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {43--54},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.010},
doi = {10.1016/J.COMGEO.2007.05.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DamianO08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DrysdaleRS08,
author = {Robert L. Scot Drysdale and
G{\"{u}}nter Rote and
Astrid Sturm},
title = {Approximation of an open polygonal curve with a minimum number of
circular arcs and biarcs},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {31--47},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.009},
doi = {10.1016/J.COMGEO.2007.10.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DrysdaleRS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EdelsbrunnerHMPS08,
author = {Herbert Edelsbrunner and
John Harer and
Ajith Mascarenhas and
Valerio Pascucci and
Jack Snoeyink},
title = {Time-varying Reeb graphs for continuous space-time data},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {149--166},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.11.001},
doi = {10.1016/J.COMGEO.2007.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EdelsbrunnerHMPS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EmirisP08,
author = {Ioannis Z. Emiris and
Leonidas Palios},
title = {Editorial},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {1},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2008.02.002},
doi = {10.1016/J.COMGEO.2008.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EmirisP08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EzraSE08,
author = {Esther Ezra and
Micha Sharir and
Alon Efrat},
title = {On the performance of the {ICP} algorithm},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {77--93},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.007},
doi = {10.1016/J.COMGEO.2007.10.007},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EzraSE08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GerdjikovW08,
author = {Stefan Gerdjikov and
Alexander Wolff},
title = {Decomposing a simple polygon into pseudo-triangles and convex polygons},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {21--30},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.005},
doi = {10.1016/J.COMGEO.2007.10.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GerdjikovW08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GiesenJ08,
author = {Joachim Giesen and
Matthias John},
title = {The flow complex: {A} data structure for geometric modeling},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {178--190},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.01.002},
doi = {10.1016/J.COMGEO.2007.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GiesenJ08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GoldschmidtG08,
author = {Nir Goldschmidt and
Dan Gordon},
title = {The {BOXEL} framework for 2.5D data with applications to virtual drivethroughs
and ray tracing},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {167--187},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.09.003},
doi = {10.1016/J.COMGEO.2007.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GoldschmidtG08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GopalaM08,
author = {Harish Gopala and
Pat Morin},
title = {Algorithms for bivariate zonoid depth},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {2--13},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.007},
doi = {10.1016/J.COMGEO.2007.05.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GopalaM08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GruneK08,
author = {Ansgar Gr{\"{u}}ne and
Sanaz Kamali},
title = {On the density of iterated line segment intersections},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {23--36},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.005},
doi = {10.1016/J.COMGEO.2007.07.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GruneK08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HasanL08,
author = {Masud Hasan and
Anna Lubiw},
title = {Equiprojective polyhedra},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {148--155},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.002},
doi = {10.1016/J.COMGEO.2007.05.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HasanL08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HershbergerS08,
author = {John Hershberger and
Subhash Suri},
title = {Adaptive sampling for geometric problems over data streams},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {191--208},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.10.004},
doi = {10.1016/J.COMGEO.2006.10.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HershbergerS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoKRT08,
author = {Ferran Hurtado and
Mikio Kano and
David Rappaport and
Csaba D. T{\'{o}}th},
title = {Encompassing colored planar straight line graphs},
journal = {Comput. Geom.},
volume = {39},
number = {1},
pages = {14--23},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.006},
doi = {10.1016/J.COMGEO.2007.05.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HurtadoKRT08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KatzR08,
author = {Matthew J. Katz and
Gabriel S. Roisman},
title = {On guarding the vertices of rectilinear domains},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {219--228},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.02.002},
doi = {10.1016/J.COMGEO.2007.02.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KatzR08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeszeghPPT08,
author = {Bal{\'{a}}zs Keszegh and
J{\'{a}}nos Pach and
D{\"{o}}m{\"{o}}t{\"{o}}r P{\'{a}}lv{\"{o}}lgyi and
G{\'{e}}za T{\'{o}}th},
title = {Drawing cubic graphs with at most five slopes},
journal = {Comput. Geom.},
volume = {40},
number = {2},
pages = {138--147},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.05.003},
doi = {10.1016/J.COMGEO.2007.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KeszeghPPT08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KettnerMPSY08,
author = {Lutz Kettner and
Kurt Mehlhorn and
Sylvain Pion and
Stefan Schirra and
Chee{-}Keng Yap},
title = {Classroom examples of robustness problems in geometric computations},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {61--78},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.06.003},
doi = {10.1016/J.COMGEO.2007.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KettnerMPSY08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MaheshwariSZ08,
author = {Anil Maheshwari and
Michiel H. M. Smid and
Norbert Zeh},
title = {I/O-efficient algorithms for computing planar geometric spanners},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {252--271},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.07.007},
doi = {10.1016/J.COMGEO.2007.07.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MaheshwariSZ08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Malamatos08,
author = {Theocharis Malamatos},
title = {Lower bounds for expected-case planar point location},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {91--103},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.06.001},
doi = {10.1016/J.COMGEO.2007.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Malamatos08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoetKK08,
author = {Esther Moet and
Christian Knauer and
Marc J. van Kreveld},
title = {Visibility maps of segments and triangles in 3D},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {163--177},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.11.001},
doi = {10.1016/J.COMGEO.2006.11.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MoetKK08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MoetKS08,
author = {Esther Moet and
Marc J. van Kreveld and
A. Frank van der Stappen},
title = {On realistic terrains},
journal = {Comput. Geom.},
volume = {41},
number = {1-2},
pages = {48--67},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.008},
doi = {10.1016/J.COMGEO.2007.10.008},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/MoetKS08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Morin08,
author = {Pat Morin},
title = {An optimal randomized algorithm for d-variate zonoid depth},
journal = {Comput. Geom.},
volume = {39},
number = {3},
pages = {229--235},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2006.12.002},
doi = {10.1016/J.COMGEO.2006.12.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Morin08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/MustafaR08,
author = {Nabil H. Mustafa and
Saurabh Ray},
title = {Weak epsilon-nets have basis of size O(1/epsilonlog(1/epsilon)) in
any dimension},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {84--91},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.02.006},
doi = {10.1016/J.COMGEO.2007.02.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/MustafaR08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Packer08,
author = {Eli Packer},
title = {Iterated snap rounding with bounded drift},
journal = {Comput. Geom.},
volume = {40},
number = {3},
pages = {231--251},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.09.002},
doi = {10.1016/J.COMGEO.2007.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Packer08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Tan08,
author = {Xuehou Tan},
title = {A unified and efficient solution to the room search problem},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {45--60},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.04.001},
doi = {10.1016/J.COMGEO.2007.04.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Tan08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Wulff-Nilsen08,
author = {Christian Wulff{-}Nilsen},
title = {Steiner hull algorithm for the uniform orientation metrics},
journal = {Comput. Geom.},
volume = {40},
number = {1},
pages = {1--13},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.10.002},
doi = {10.1016/J.COMGEO.2007.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Wulff-Nilsen08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZareiG08,
author = {Alireza Zarei and
Mohammad Ghodsi},
title = {Query point visibility computation in polygons with holes},
journal = {Comput. Geom.},
volume = {39},
number = {2},
pages = {78--90},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2007.02.005},
doi = {10.1016/J.COMGEO.2007.02.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZareiG08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/ZomorodianC08,
author = {Afra Zomorodian and
Gunnar E. Carlsson},
title = {Localized homology},
journal = {Comput. Geom.},
volume = {41},
number = {3},
pages = {126--148},
year = {2008},
url = {https://doi.org/10.1016/j.comgeo.2008.02.003},
doi = {10.1016/J.COMGEO.2008.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/ZomorodianC08.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbamB07,
author = {Mohammad Ali Abam and
Mark de Berg},
title = {Kinetic sorting and kinetic convex hulls},
journal = {Comput. Geom.},
volume = {37},
number = {1},
pages = {16--26},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.02.004},
doi = {10.1016/J.COMGEO.2006.02.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbamB07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnCPSV07,
author = {Hee{-}Kap Ahn and
Otfried Cheong and
Chong{-}Dae Park and
Chan{-}Su Shin and
Antoine Vigneron},
title = {Maximizing the overlap of two planar convex sets under rigid motions},
journal = {Comput. Geom.},
volume = {37},
number = {1},
pages = {3--15},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.01.005},
doi = {10.1016/J.COMGEO.2006.01.005},
timestamp = {Tue, 16 Aug 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/AhnCPSV07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerK07,
author = {Oswin Aichholzer and
Hannes Krasser},
title = {Abstract order type extension and new results on the rectilinear crossing
number},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {2--15},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2005.07.005},
doi = {10.1016/J.COMGEO.2005.07.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerK07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AichholzerR07,
author = {Oswin Aichholzer and
Klaus Reinhardt},
title = {A quadratic distance bound on sliding between crossing-free spanning
trees},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {155--161},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2004.12.010},
doi = {10.1016/J.COMGEO.2004.12.010},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AichholzerR07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AlexandronKS07,
author = {Giora Alexandron and
Haim Kaplan and
Micha Sharir},
title = {Kinetic and dynamic data structures for convex hulls and upper envelopes},
journal = {Comput. Geom.},
volume = {36},
number = {2},
pages = {144--158},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.01.002},
doi = {10.1016/J.COMGEO.2006.01.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AlexandronKS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AnderssonGL07,
author = {Mattias Andersson and
Joachim Gudmundsson and
Christos Levcopoulos},
title = {Approximate distance oracles for graphs with dense clusters},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {142--154},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2004.12.011},
doi = {10.1016/J.COMGEO.2004.12.011},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AnderssonGL07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BandyopadhyayS07,
author = {Deepak Bandyopadhyay and
Jack Snoeyink},
title = {Almost-Delaunay simplices: Robust neighbor relations for imprecise
3D points using {CGAL}},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {4--15},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.003},
doi = {10.1016/J.COMGEO.2006.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BandyopadhyayS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BekosKSW07,
author = {Michael A. Bekos and
Michael Kaufmann and
Antonios Symvonis and
Alexander Wolff},
title = {Boundary labeling: Models and efficient algorithms for rectangular
maps},
journal = {Comput. Geom.},
volume = {36},
number = {3},
pages = {215--236},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.003},
doi = {10.1016/J.COMGEO.2006.05.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BekosKSW07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregDSV07,
author = {Sergey Bereg and
Jos{\'{e}} Miguel D{\'{\i}}az{-}B{\'{a}}{\~{n}}ez and
Carlos Seara and
Inmaculada Ventura},
title = {On finding widest empty curved corridors},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {154--169},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2007.02.003},
doi = {10.1016/J.COMGEO.2007.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeregDSV07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergGOS07,
author = {Mark de Berg and
Joachim Gudmundsson and
Ren{\'{e}} van Oostrum and
Bettina Speckmann},
title = {Editorial},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {1},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.001},
doi = {10.1016/J.COMGEO.2006.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergGOS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergHO07,
author = {Mark de Berg and
Dan Halperin and
Mark H. Overmars},
title = {An intersection-sensitive algorithm for snap rounding},
journal = {Comput. Geom.},
volume = {36},
number = {3},
pages = {159--165},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.03.002},
doi = {10.1016/J.COMGEO.2006.03.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergHO07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatGO07,
author = {Jean{-}Daniel Boissonnat and
Leonidas J. Guibas and
Steve Oudot},
title = {Learning smooth shapes by probing},
journal = {Comput. Geom.},
volume = {37},
number = {1},
pages = {38--58},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.008},
doi = {10.1016/J.COMGEO.2006.05.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatGO07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseD07,
author = {Prosenjit Bose and
Luc Devroye},
title = {On the stabbing number of a random Delaunay triangulation},
journal = {Comput. Geom.},
volume = {36},
number = {2},
pages = {89--105},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.005},
doi = {10.1016/J.COMGEO.2006.05.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseD07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseMMMSV07,
author = {Prosenjit Bose and
Anil Maheshwari and
Pat Morin and
Jason Morrison and
Michiel H. M. Smid and
Jan Vahrenhold},
title = {Space-efficient geometric divide-and-conquer algorithms},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {209--227},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.03.006},
doi = {10.1016/J.COMGEO.2006.03.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseMMMSV07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BrassCDEEIKLM07,
author = {Peter Bra{\ss} and
Eowyn Cenek and
Christian A. Duncan and
Alon Efrat and
Cesim Erten and
Dan Ismailescu and
Stephen G. Kobourov and
Anna Lubiw and
Joseph S. B. Mitchell},
title = {On simultaneous planar graph embeddings},
journal = {Comput. Geom.},
volume = {36},
number = {2},
pages = {117--130},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.006},
doi = {10.1016/J.COMGEO.2006.05.006},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/BrassCDEEIKLM07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CortesM07,
author = {Carmen Cort{\'{e}}s and
Alberto M{\'{a}}rquez},
title = {Editorial},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {141},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.08.001},
doi = {10.1016/J.COMGEO.2006.08.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CortesM07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyGG07,
author = {Tamal K. Dey and
Joachim Giesen and
Samrat Goswami},
title = {Delaunay triangulations approximate anchor hulls},
journal = {Comput. Geom.},
volume = {36},
number = {2},
pages = {131--143},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.01.001},
doi = {10.1016/J.COMGEO.2006.01.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DeyGG07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicESW07,
author = {Vida Dujmovic and
David Eppstein and
Matthew Suderman and
David R. Wood},
title = {Drawings of planar graphs with few slopes and segments},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {194--212},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.09.002},
doi = {10.1016/J.COMGEO.2006.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DujmovicESW07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DujmovicSW07,
author = {Vida Dujmovic and
Matthew Suderman and
David R. Wood},
title = {Graph drawings with few slopes},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {181--193},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.08.002},
doi = {10.1016/J.COMGEO.2006.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DujmovicSW07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DumitrescuEGKR07,
author = {Adrian Dumitrescu and
Annette Ebbers{-}Baumann and
Ansgar Gr{\"{u}}ne and
Rolf Klein and
G{\"{u}}nter Rote},
title = {On the geometric dilation of closed curves, graphs, and point sets},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {16--38},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2005.07.004},
doi = {10.1016/J.COMGEO.2005.07.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DumitrescuEGKR07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Ebbers-BaumannGK07,
author = {Annette Ebbers{-}Baumann and
Ansgar Gr{\"{u}}ne and
Rolf Klein},
title = {Geometric dilation of closed planar curves: New lower bounds},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {188--208},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2004.12.009},
doi = {10.1016/J.COMGEO.2004.12.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Ebbers-BaumannGK07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EfratGHZ07,
author = {Alon Efrat and
Leonidas J. Guibas and
Olaf A. Hall{-}Holt and
Li Zhang},
title = {On incremental rendering of silhouette maps of a polyhedral scene},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {129--138},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.12.003},
doi = {10.1016/J.COMGEO.2006.12.003},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EfratGHZ07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EppsteinW07,
author = {David Eppstein and
Kevin A. Wortman},
title = {Minimum dilation stars},
journal = {Comput. Geom.},
volume = {37},
number = {1},
pages = {27--37},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.007},
doi = {10.1016/J.COMGEO.2006.05.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EppsteinW07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FragoudakisMZ07,
author = {Christodoulos Fragoudakis and
Euripides Markou and
Stathis Zachos},
title = {Maximizing the guarded boundary of an Art Gallery is APX-complete},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {170--180},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.12.001},
doi = {10.1016/J.COMGEO.2006.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FragoudakisMZ07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Freedman07,
author = {Daniel Freedman},
title = {An incremental algorithm for reconstruction of surfaces of arbitrary
codimension},
journal = {Comput. Geom.},
volume = {36},
number = {2},
pages = {106--116},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.004},
doi = {10.1016/J.COMGEO.2006.05.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Freedman07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GartnerV07,
author = {Bernd G{\"{a}}rtner and
Remco C. Veltkamp},
title = {A decade of {CGAL}},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {1--3},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2007.02.001},
doi = {10.1016/J.COMGEO.2007.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GartnerV07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Gonzalez-GutierrezG07,
author = {Arturo Gonzalez{-}Gutierrez and
Teofilo F. Gonzalez},
title = {Complexity of the minimum-length corridor problem},
journal = {Comput. Geom.},
volume = {37},
number = {2},
pages = {72--103},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.10.002},
doi = {10.1016/J.COMGEO.2006.10.002},
timestamp = {Sun, 02 Oct 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/Gonzalez-GutierrezG07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonL07,
author = {Joachim Gudmundsson and
Christos Levcopoulos},
title = {Minimum weight pseudo-triangulations},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {139--153},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2007.05.004},
doi = {10.1016/J.COMGEO.2007.05.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonL07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GudmundssonNS07,
author = {Joachim Gudmundsson and
Giri Narasimhan and
Michiel H. M. Smid},
title = {Distance-preserving approximations of polygonal paths},
journal = {Comput. Geom.},
volume = {36},
number = {3},
pages = {183--196},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.05.002},
doi = {10.1016/J.COMGEO.2006.05.002},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GudmundssonNS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HachenbergerKM07,
author = {Peter Hachenberger and
Lutz Kettner and
Kurt Mehlhorn},
title = {Boolean operations on 3D selective Nef complexes: Data structure,
algorithms, optimized implementation and experiments},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {64--99},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.009},
doi = {10.1016/J.COMGEO.2006.11.009},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HachenbergerKM07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Har-Peled07,
author = {Sariel Har{-}Peled},
title = {How to get close to the median shape},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {39--51},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.02.003},
doi = {10.1016/J.COMGEO.2006.02.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Har-Peled07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HertHKPS07,
author = {Susan Hert and
Michael Hoffmann and
Lutz Kettner and
Sylvain Pion and
Michael Seel},
title = {An adaptable and extensible geometry kernel},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {16--36},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.004},
doi = {10.1016/J.COMGEO.2006.11.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HertHKPS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HurtadoM07,
author = {Ferran Hurtado and
Joseph S. B. Mitchell},
title = {Editorial},
journal = {Comput. Geom.},
volume = {37},
number = {1},
pages = {1--2},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.07.002},
doi = {10.1016/J.COMGEO.2006.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HurtadoM07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KnauerSSW07,
author = {Christian Knauer and
{\'{E}}tienne Schramm and
Andreas Spillner and
Alexander Wolff},
title = {Configurations with few crossings in topological graphs},
journal = {Comput. Geom.},
volume = {37},
number = {2},
pages = {104--114},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.06.001},
doi = {10.1016/J.COMGEO.2006.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KnauerSSW07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KokKL07,
author = {Thierry de Kok and
Marc J. van Kreveld and
Maarten L{\"{o}}ffler},
title = {Generating realistic terrains with higher-order Delaunay triangulations},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {52--65},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2005.09.005},
doi = {10.1016/J.COMGEO.2005.09.005},
timestamp = {Fri, 09 Apr 2021 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/KokKL07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KosowskiMZ07,
author = {Adrian Kosowski and
Michal Malafiejski and
Pawel Zylinski},
title = {Cooperative mobile guards in grids},
journal = {Comput. Geom.},
volume = {37},
number = {2},
pages = {59--71},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.002},
doi = {10.1016/J.COMGEO.2006.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KosowskiMZ07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KreveldS07,
author = {Marc J. van Kreveld and
Bettina Speckmann},
title = {On rectangular cartograms},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {175--187},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.06.002},
doi = {10.1016/J.COMGEO.2006.06.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KreveldS07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KruithofV07,
author = {Nico Kruithof and
Gert Vegter},
title = {Meshing skin surfaces with certified topology},
journal = {Comput. Geom.},
volume = {36},
number = {3},
pages = {166--182},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.01.003},
doi = {10.1016/J.COMGEO.2006.01.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KruithofV07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/PourninL07,
author = {Lionel Pournin and
Thomas M. Liebling},
title = {Constrained paths in the flip-graph of regular triangulations},
journal = {Comput. Geom.},
volume = {37},
number = {2},
pages = {134--140},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.07.001},
doi = {10.1016/J.COMGEO.2006.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/PourninL07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RineauY07,
author = {Laurent Rineau and
Mariette Yvinec},
title = {A generic software design for Delaunay refinement meshing},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {100--110},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.008},
doi = {10.1016/J.COMGEO.2006.11.008},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RineauY07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Rote07,
author = {G{\"{u}}nter Rote},
title = {Computing the Fr{\'{e}}chet distance between piecewise smooth
curves},
journal = {Comput. Geom.},
volume = {37},
number = {3},
pages = {162--174},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2005.01.004},
doi = {10.1016/J.COMGEO.2005.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Rote07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RoyDN07,
author = {Sasanka Roy and
Sandip Das and
Subhas C. Nandy},
title = {Shortest monotone descent path problem in polyhedral terrain},
journal = {Comput. Geom.},
volume = {37},
number = {2},
pages = {115--133},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.06.003},
doi = {10.1016/J.COMGEO.2006.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RoyDN07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/RusselKG07,
author = {Daniel Russel and
Menelaos I. Karavelas and
Leonidas J. Guibas},
title = {A package for exact kinetic data structures and sweepline algorithms},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {111--127},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.006},
doi = {10.1016/J.COMGEO.2006.11.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/RusselKG07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/SchindelhauerVZ07,
author = {Christian Schindelhauer and
Klaus Volbert and
Martin Ziegler},
title = {Geometric spanners with applications in wireless networks},
journal = {Comput. Geom.},
volume = {36},
number = {3},
pages = {197--214},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.02.001},
doi = {10.1016/J.COMGEO.2006.02.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/SchindelhauerVZ07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Vahrenhold07,
author = {Jan Vahrenhold},
title = {Line-segment intersection made in-place},
journal = {Comput. Geom.},
volume = {38},
number = {3},
pages = {213--230},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.09.001},
doi = {10.1016/J.COMGEO.2006.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Vahrenhold07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WeinBH07,
author = {Ron Wein and
Jur P. van den Berg and
Dan Halperin},
title = {The visibility-Voronoi complex and its applications},
journal = {Comput. Geom.},
volume = {36},
number = {1},
pages = {66--87},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2005.11.007},
doi = {10.1016/J.COMGEO.2005.11.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WeinBH07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/WeinFZH07,
author = {Ron Wein and
Efi Fogel and
Baruch Zukerman and
Dan Halperin},
title = {Advanced programming techniques applied to Cgal's arrangement package},
journal = {Comput. Geom.},
volume = {38},
number = {1-2},
pages = {37--63},
year = {2007},
url = {https://doi.org/10.1016/j.comgeo.2006.11.007},
doi = {10.1016/J.COMGEO.2006.11.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/WeinFZH07.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AbellanasBHORT06,
author = {Manuel Abellanas and
Sergey Bereg and
Ferran Hurtado and
Alfredo Garc{\'{\i}}a Olaverri and
David Rappaport and
Javier Tejel},
title = {Moving coins},
journal = {Comput. Geom.},
volume = {34},
number = {1},
pages = {35--48},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.06.005},
doi = {10.1016/J.COMGEO.2005.06.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AbellanasBHORT06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AgarwalM06,
author = {Pankaj K. Agarwal and
Nabil H. Mustafa},
title = {Independent set of intersection graphs of convex objects in 2D},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {83--95},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.12.001},
doi = {10.1016/J.COMGEO.2005.12.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AgarwalM06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AhnBCNSV06,
author = {Hee{-}Kap Ahn and
Peter Bra{\ss} and
Otfried Cheong and
Hyeon{-}Suk Na and
Chan{-}Su Shin and
Antoine Vigneron},
title = {Inscribing an axially symmetric polygon and other approximation algorithms
for planar convex sets},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {152--164},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.06.001},
doi = {10.1016/J.COMGEO.2005.06.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AhnBCNSV06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaHKN06,
author = {Jin Akiyama and
Koichi Hirata and
Midori Kobayashi and
Gisaku Nakamura},
title = {Convex developments of a regular tetrahedron},
journal = {Comput. Geom.},
volume = {34},
number = {1},
pages = {2--10},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.07.003},
doi = {10.1016/J.COMGEO.2005.07.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaHKN06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AkiyamaKT06,
author = {Jin Akiyama and
Mikio Kano and
Xuehou Tan},
title = {Editorial},
journal = {Comput. Geom.},
volume = {34},
number = {1},
pages = {1},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.09.001},
doi = {10.1016/J.COMGEO.2005.09.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AkiyamaKT06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/AronovBCC06,
author = {Boris Aronov and
Herv{\'{e}} Br{\"{o}}nnimann and
Allen Y. Chang and
Yi{-}Jen Chiang},
title = {Cost prediction for ray shooting in octrees},
journal = {Comput. Geom.},
volume = {34},
number = {3},
pages = {159--181},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.09.002},
doi = {10.1016/J.COMGEO.2005.09.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/AronovBCC06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BenkertWWS06,
author = {Marc Benkert and
Alexander Wolff and
Florian Widmann and
Takeshi Shirabe},
title = {The minimum Manhattan network problem: Approximations and exact solutions},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {188--208},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.09.004},
doi = {10.1016/J.COMGEO.2005.09.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BenkertWWS06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BeregBK06,
author = {Sergey Bereg and
Prosenjit Bose and
David G. Kirkpatrick},
title = {Equitable subdivisions within polygonal regions},
journal = {Comput. Geom.},
volume = {34},
number = {1},
pages = {20--27},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.06.003},
doi = {10.1016/J.COMGEO.2005.06.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BeregBK06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BergS06,
author = {Mark de Berg and
Micha Streppel},
title = {Approximate range searching using binary space partitions},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {139--151},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.003},
doi = {10.1016/J.COMGEO.2005.08.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BergS06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BhattacharyaGS06,
author = {Binay K. Bhattacharya and
Subir Kumar Ghosh and
Thomas C. Shermer},
title = {A linear time algorithm to remove winding of a simple polygon},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {165--173},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.05.001},
doi = {10.1016/J.COMGEO.2005.05.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BhattacharyaGS06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoissonnatS06,
author = {Jean{-}Daniel Boissonnat and
Jack Snoeyink},
title = {Editorial},
journal = {Comput. Geom.},
volume = {35},
number = {1-2},
pages = {1},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.10.007},
doi = {10.1016/J.COMGEO.2005.10.007},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoissonnatS06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BoseHRW06,
author = {Prosenjit Bose and
Ferran Hurtado and
Eduardo Rivera{-}Campo and
David R. Wood},
title = {Partitions of complete geometric graphs into plane trees},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {116--125},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.006},
doi = {10.1016/J.COMGEO.2005.08.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BoseHRW06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BronnimannC06,
author = {Herv{\'{e}} Br{\"{o}}nnimann and
Timothy M. Chan},
title = {Space-efficient algorithms for computing the convex hull of a simple
polygonal line in linear time},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {75--82},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.11.005},
doi = {10.1016/J.COMGEO.2005.11.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BronnimannC06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/BronnimannG06,
author = {Herv{\'{e}} Br{\"{o}}nnimann and
Marc Glisse},
title = {Octrees with near optimal cost for ray-shooting},
journal = {Comput. Geom.},
volume = {34},
number = {3},
pages = {182--194},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.09.003},
doi = {10.1016/J.COMGEO.2005.09.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/BronnimannG06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/CarmiKM06,
author = {Paz Carmi and
Matthew J. Katz and
Joseph S. B. Mitchell},
title = {The minimum-area spanning tree problem},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {218--225},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2006.03.001},
doi = {10.1016/J.COMGEO.2006.03.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/CarmiKM06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan06,
author = {Timothy M. Chan},
title = {Faster core-set constructions and data-stream algorithms in fixed
dimensions},
journal = {Comput. Geom.},
volume = {35},
number = {1-2},
pages = {20--35},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.10.002},
doi = {10.1016/J.COMGEO.2005.10.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Chan06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Chan06a,
author = {Timothy M. Chan},
title = {Three problems about simple polygons},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {209--217},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.11.002},
doi = {10.1016/J.COMGEO.2005.11.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Chan06a.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Cheng06,
author = {Siu{-}Wing Cheng},
title = {On the sizes of Delaunay meshes},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {130--138},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.002},
doi = {10.1016/J.COMGEO.2005.08.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Cheng06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuLM06,
author = {Ovidiu Daescu and
Jun Luo and
David M. Mount},
title = {Proximity problems on line segments spanned by points},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {115--129},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.007},
doi = {10.1016/J.COMGEO.2005.08.007},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/DaescuLM06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DaescuMSW06,
author = {Ovidiu Daescu and
Ningfang Mi and
Chan{-}Su Shin and
Alexander Wolff},
title = {Farthest-point queries with geometric and combinatorial constraints},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {174--185},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.07.002},
doi = {10.1016/J.COMGEO.2005.07.002},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DaescuMSW06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DancigerDS06,
author = {Jeff Danciger and
Satyan L. Devadoss and
Don Sheehy},
title = {Compatible triangulations and point partitions by series-triangular
graphs},
journal = {Comput. Geom.},
volume = {34},
number = {3},
pages = {195--202},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.11.003},
doi = {10.1016/J.COMGEO.2005.11.003},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DancigerDS06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DevillersG06,
author = {Olivier Devillers and
Philippe Guigue},
title = {Inner and outer rounding of Boolean operations on lattice polygonal
regions},
journal = {Comput. Geom.},
volume = {33},
number = {1-2},
pages = {3--17},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2004.08.005},
doi = {10.1016/J.COMGEO.2004.08.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DevillersG06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DeyG06,
author = {Tamal K. Dey and
Samrat Goswami},
title = {Provable surface reconstruction from noisy samples},
journal = {Comput. Geom.},
volume = {35},
number = {1-2},
pages = {124--141},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.10.006},
doi = {10.1016/J.COMGEO.2005.10.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DeyG06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/DykenF06,
author = {Christopher Dyken and
Michael S. Floater},
title = {Preferred directions for resolving the non-uniqueness of Delaunay
triangulations},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {96--101},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.004},
doi = {10.1016/J.COMGEO.2005.08.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/DykenF06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EfratKL06,
author = {Alon Efrat and
Stephen G. Kobourov and
Anna Lubiw},
title = {Computing homotopic shortest paths efficiently},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {162--172},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2006.03.003},
doi = {10.1016/J.COMGEO.2006.03.003},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EfratKL06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/Eidenbenz06,
author = {Stephan J. Eidenbenz},
title = {Finding minimum hidden guard sets in polygons - tight approximability
results},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {49--57},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2006.01.004},
doi = {10.1016/J.COMGEO.2006.01.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/Eidenbenz06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EigenwilligKSW06,
author = {Arno Eigenwillig and
Lutz Kettner and
Elmar Sch{\"{o}}mer and
Nicola Wolpert},
title = {Exact, efficient, and complete arrangement computation for cubic curves},
journal = {Comput. Geom.},
volume = {35},
number = {1-2},
pages = {36--73},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.10.003},
doi = {10.1016/J.COMGEO.2005.10.003},
timestamp = {Sat, 30 Sep 2023 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/EigenwilligKSW06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/EmirisK06,
author = {Ioannis Z. Emiris and
Menelaos I. Karavelas},
title = {The predicates of the Apollonius diagram: Algorithmic analysis and
implementation},
journal = {Comput. Geom.},
volume = {33},
number = {1-2},
pages = {18--57},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2004.02.006},
doi = {10.1016/J.COMGEO.2004.02.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/EmirisK06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/FeketeKN06,
author = {S{\'{a}}ndor P. Fekete and
Rolf Klein and
Andreas N{\"{u}}chter},
title = {Online searching with an autonomous robot},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {102--115},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.08.005},
doi = {10.1016/J.COMGEO.2005.08.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/FeketeKN06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GaoGN06,
author = {Jie Gao and
Leonidas J. Guibas and
An Thai Nguyen},
title = {Deformable spanners and applications},
journal = {Comput. Geom.},
volume = {35},
number = {1-2},
pages = {2--19},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.10.001},
doi = {10.1016/J.COMGEO.2005.10.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/GaoGN06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/GrimaMO06,
author = {Clara I. Grima and
Alberto M{\'{a}}rquez and
Lidia M. Ortega},
title = {A new 2D tessellation for angle problems: The polar diagram},
journal = {Comput. Geom.},
volume = {34},
number = {2},
pages = {58--74},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.11.004},
doi = {10.1016/J.COMGEO.2005.11.004},
timestamp = {Tue, 14 Jun 2022 01:00:00 +0200},
biburl = {https://dblp.org/rec/journals/comgeo/GrimaMO06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HillarR06,
author = {Christopher J. Hillar and
Darren L. Rhea},
title = {A result about the density of iterated line intersections in the plane},
journal = {Comput. Geom.},
volume = {33},
number = {3},
pages = {106--114},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.07.001},
doi = {10.1016/J.COMGEO.2005.07.001},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HillarR06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/HoffmannO06,
author = {Michael Hoffmann and
Yoshio Okamoto},
title = {The minimum weight triangulation problem with few inner points},
journal = {Comput. Geom.},
volume = {34},
number = {3},
pages = {149--158},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.11.006},
doi = {10.1016/J.COMGEO.2005.11.006},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/HoffmannO06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KakoulisT06,
author = {Konstantinos G. Kakoulis and
Ioannis G. Tollis},
title = {Algorithms for the multiple label placement problem},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {143--161},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2006.03.005},
doi = {10.1016/J.COMGEO.2006.03.005},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KakoulisT06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KeilV06,
author = {J. Mark Keil and
Tzvetalin S. Vassilev},
title = {Algorithms for optimal area triangulations of a convex polygon},
journal = {Comput. Geom.},
volume = {35},
number = {3},
pages = {173--187},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2006.03.004},
doi = {10.1016/J.COMGEO.2006.03.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KeilV06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
@article{DBLP:journals/comgeo/KleinLL06,
author = {Rolf Klein and
Christos Levcopoulos and
Andrzej Lingas},
title = {A {PTAS} for minimum vertex dilation triangulation of a simple polygon
with a constant number of sources of dilation},
journal = {Comput. Geom.},
volume = {34},
number = {1},
pages = {28--34},
year = {2006},
url = {https://doi.org/10.1016/j.comgeo.2005.06.004},
doi = {10.1016/J.COMGEO.2005.06.004},
timestamp = {Thu, 11 Feb 2021 00:00:00 +0100},
biburl = {https://dblp.org/rec/journals/comgeo/KleinLL06.bib},
bibsource = {dblp computer science bibliography, https://dblp.org}
}
a service of 
manage site settings
To protect your privacy, all features that rely on external API calls from your browser are turned off by default. You need to opt-in for them to become active. All settings here will be stored as cookies with your web browser. For more information see our F.A.Q.
retrieved on 2024-04-18 05:54 CEST from data curated by the dblp team
all metadata released as open data under CC0 1.0 license
see also: Terms of Use | Privacy Policy | Imprint
dblp was originally created in 1993 at:
since 2018, dblp has been operated and maintained by:
the dblp computer science bibliography is funded and supported by:
